When a number is subtracted from five times of another number the result is 10. Check which of the following are solutions of the above statement?
a) (2, 0)
b) (5, 10)
c) (3, 5)

Answers

Answer 1

Answer:

(3,5)

5*3 = 15 .... 15-5 = 10

Step-by-step explanation:


Related Questions

Help me solve these 4 plssss ASAP

Answers

Step-by-step explanation:

[tex]1) \\ - 2 \leqslant x \leqslant 1 \\ 2) \\ - 3 > x \geqslant 2 \\ 3) \\ x> 0[/tex]

[tex]4) \\ x \leqslant - 3 \\ 5) \\ - 4 \leqslant x \geqslant 1[/tex]

[tex]6) \\ - 2< x \leqslant 0[/tex]

i need help with this

Answers

Answer:

[tex]y = - \frac{1}{2} x + 4[/tex]

Step-by-step explanation:

Let us consider two points through which the line passes through

[tex](x_1 , y _ 1 ) = ( 0 , 4 ) \ and \ (x_ 2 , y _ 2 ) = ( 4, 2 )[/tex]

Step 1 : Find slope of the line

[tex]Slope, m_1 = \frac{rise}{run} \\\\That \ is \ m_1 \ = \frac{y_2 - y _ 1}{x_2 - x_1}[/tex]

                  [tex]= \frac{2 - 4}{4-0} \\\\=-\frac{2}{4}\\\\= - \frac{1}{2}[/tex]

Step 2 : Find equation of the line.

[tex](y - y _ 1) = m_ 1 (x - x_1)\\\\( y - 4) = - \frac{1}{2}(x - 0)\\\\y = -\frac{1}{2}x + 4[/tex]

PLEASE PLEASE HELP ME WITH THIS GEOMETRY QUESTION!!!

Answers

Step-by-step explanation:

Objective: Circle Theorems

The arcs add up to 360 and they are in proportion so

[tex]3x + 3x + 4x + 5x = 360[/tex]

[tex]15x = 360[/tex]

[tex]x = 24[/tex]

So this means that Arc AB and BC measure is 72 each. Arc CD measure is 96 and Arc DA measures is 120.

Angle 1 measure is a inscribed angle of Arc CD.

So it measures

[tex] \frac{96}{2} = 48[/tex]

Angle 2 is a inscribed angle of Arc AB so it measures

[tex] \frac{72}{2} = 36[/tex]

Angle 3 is a inscribed angle of Arc DA.

[tex] \frac{120}{2} = 60[/tex]

Angle 4 is a inscribed angle of Arc BC so it measures

[tex] \frac{72}{2} = 36[/tex]

Angle 5 is formed by tangent line ED. Since D lies on the circumference, it also is tangent to point e so it also measures 90 degrees.

Angle 4 measures 32 so Angle 5 is it complement to Angle 4.

[tex]32 + x = 90[/tex]

[tex]x = 58[/tex]

Angle 6 is formed by two intersecting chrods

so it measures

[tex] \frac{1}{2} (120+ 72) = 96[/tex]

HELP pls help me with this problem.

Answers

Answer:

8units

Step-by-step explanation:

area of a triangle=1/2base x height

1/2×4×4

2×4

8units

The answer is 8 unit I hope it helps

4. The expression (3x –8)(2x+5)-(x+1)(2x+5) can be written as the product of 2x+5
with what other binomial?
(1) 4x-7
(3) 2x-7
(2) 2x-9
(4) 4x-9

Answers

Answer:

option 3 : (2x - 7 )

Step-by-step explanation:

ax + bx = x(a+ b)

a(x+ y) + b(x+y) = (x+y)(a+b)

[tex](3x - 8 ) ( 2x + 5) - (x + 1)(2x + 5)\\\\(2x+5)[ (3x - 8) - (x+1) ][/tex]      [ (2x + 5) is common is both terms ]

[tex](2x+ 5)(3x -8 -x + 1)\\\\(2x+ 5)(2x - 7)[/tex]

Therefore , the binomial is ( 2x - 7)

the measures of the angles of a triangle are shown in the figure. solve for x

Answers

Answer:

10

Step-by-step explanation:

First, we know that the angles of a triangle add up to 180 degrees. We can then sum up our angles as 90 (since it's a right triangle, represented by the square in the bottom left angle) +27+6x+3=180

90+27+6x+3=180

Add up left side

120+6x=180

Subtract 120 from both sides

6x=60

Divide both sides by 6

x=10

What is the equation of the line that passes through the points
(-3, 6) and (-3, 8)?

Answers

Answer:

[tex]x=-3[/tex]

Step-by-step explanation:

Hi there!

Linear equations are typically organized in slope-intercept form: [tex]y=mx+b[/tex] where m is the slope and b is the y-intercept (the value of y when x is 0).

Typically, we would start with finding the slope of the line. However, notice how the two x-coordinates in the given points are both -3. This means that this is a vertical line, with an undefined slope.

Vertical lines have their equations organized differently: [tex]x=d[/tex] where d is the x-intercept, or the value of x when y is 0.

Because the x-coordinates in all the points a vertical lines passes through are the same, the x-intercept would therefore be -3. Plug this into the equation [tex]x=d[/tex]:

[tex]x=-3[/tex]

I hope this helps!

Jada walks dogs to earn money. The points in this graph represent the total amount of money Jada earns based on the number of hours she walks dogs. Jada wants to purchase a new jacket that costs $32.

How many hours does Jada need to walk dogs to earn enough money to buy the jacket?


6 hours

7 hours

8 hours

9 hours

Answers

Answer:

8 hours

Step-by-step explanation:

In 4 hours she earns 16 dollars

Since this is proportional ( goes through zero), we can multiply by 2

8 hours = 32 dollars

Jada needs to walk the dog for, 8 hours.

4x8 = 32

120 to 150 find the percentage of increase

Answers

Answer:

25%

Step-by-step explanation:

increase by = 150 - 120

=30

increase percent = 30/120 * 100%

=3000/120

=25 %

Answer:

25%

Step-by-step explanation:

Percentage increase=(new value-original value)/(original value) x 100%

Percentage increase=(150-120)/120 x 100%

Percentage increase=30/120 x 100%

Percentage increase=1/4 x 100%

Percentage increase=25%

if x4 + 1/x4 = 4 find the value of x2+1/x2​

Answers

Answer:

Hiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiii

Answer:

Step-by-step explanation:

I think its 2

no links please, i cant find the answer for q b) ii)

Answers

Answer:

-k

Step-by-step explanation:

Cos(140)=cos(180-40)=-cos(40)=-k

Answer:

Step-by-step explanation:

Sin (90 - A)  = Cos A

Cos (90 + A) =   -Sin A

Sin 50 = Sin (90 - 40)

          = Cos 40

         = k

Cos 140 = Cos (90 + 50)

             = - Sin 50

            = (- k)

Second Number Cube
1
2.
3
4
5
6
First Number Cube
locN-
1,1 1,2 1,3 1,4 1,5 1,6
2,1 2,2 2,3 2,4 2,5 2,6
3,1 3,2 3,3 3,4 3,5 3,6
4,1 4,2 4,3 4,4 4,5 4,6
5,1 5,2 5,3 5,4 5,5 5,6
6,1 6,2 6,3 6,4 6,5 6,6
How many possible outcomes are there?
O 6
12

Answers

Answer:

36

Step-by-step explanation:

summation of all the outcome

There are 36 possible outcomes is shows in table for rolling two  six - sided number cubes.

What is mean by Multiplication?

To multiply means to add a number to itself a particular number of times. Multiplication can be viewed as a process of repeated addition.

We have to given that;

The table shows all the possible outcomes for rolling two six - sided number cubes.

Now, We know that;

For rolling one six - sided number cubes,

There is 6 possible outcomes.

Hence, For two six - sided number cubes.

Number of possible outcomes = 6 × 6

                                               = 36

Thus, There are 36 possible outcomes is shows in table for rolling two  six - sided number cubes.

Learn more about the multiplication visit:

https://brainly.com/question/10873737

#SPJ7

Please help me I really need help

Answers

hi! the first one is -2+6 i & the second one is parallelogram!

Answer:

-2 + 6i

Parallelogram

Step-by-step explanation:

( 5 - 2i ) + ( - 7 + 8i )

remove parenthesis

5 - 2i + ( -7 ) + 8i

combine like terms

5 + (-7) = -2

-2i + 8i = 6i

-2 + 6i

The arrows on the opposite sides indicate that the sides are parallel

A shape with two sets of parallel sides is known as a parallelogram

For what values of x is the expression below defined?
x +3 + x1 - x
O A. 35xs1
O B. 3 > XS-1
O C. 3 >x>1
O D. -3 sx< 1

Answers

Answer:

D. - 3 ≤ x < 1

Step-by-step explanation:

The numerator cannot be the square root of a neg. no.

So, x + 3 ≥ 0 or x ≥ -3

The denominator cannot be a neg. no. or 0.

So, 1 - x > 0

1 > x or x < 1

So, altogether - 3 ≤ x < 1

Therefore, D is the correct answer.

HOPE IT MAY HELP YOU

PLEASE MARK AS BRAINLIST

A group of people were asked if they had run a red light in the last year where 140 responded "yes," and 208 responded "no." If a person is randomly chosen, find the probability that he/she has run a red light in the last year. Give your answer as a fraction or decimal.

Answers

Answer:

35/87

Step-by-step explanation:

To find the probability, we must find (total number of favorable outcomes)/ (total number of outcomes). We thus need to find the total number of outcomes. As people have only answered "yes" or "no", the total number of outcomes is 208+140 = 348.

The total number of favorable outcomes, or what we're looking for, is 140 (140 people responded that they had run a red light). Thus, our fraction is 140/348, or 35/87

What are biofertilisiers​

Answers

Answer:

Step-by-step explanation:

biofertilizers are fertilizers consist of micro-organisms that will help plant growth. they are different from traditional fertilizers which consist of chemicals

Answer:

Any fertilizers involving living organisms, or the products obtained from living organisms can be referred to as biofertilizer, although nowadays, the term is generally used for living organisms used for fertilizer purpose.

Step-by-step explanation:

Hope this helps

Please help and thank u

Answers

Answer:

The answer to this question is C.

There is 28 kg 750 g of sugar in a sack. How many tins of 500 g sugar can be filled using the sugar in the sack?

Answers

Answer:

Step-by-step explanation:

28 kg + 750 g = 28*1000 + 750

                          28000 + 750

                       = 28750 g

Number of sack = Total quantity of sugar ÷ quantity of sugar in a sack

                           = 28750 ÷ 500

                           =  57 sacks

Answer:

57 sacks

Step-by-step explanation:

28750 ÷ 500 =

57 sacks

Glad to help! :)

Evaluate F(x) = x^2 + 1 for f(-1)

Answers

Answer:

2

Step-by-step explanation:

f(x) = x^2 + 1

f(-1) = (-1)^2 + 1

f(-1) = 2

Answer:

f(x)=x^2+1

f(-1)=(-1)^2+1

f(-1)=1+1

f(-1)=2

The tables represent the functions f(x) and g(x).

A table with 2 columns and 7 rows. The first row, x, has the entries, negative 3, negative 2, negative 1, 0, 1, 2. The second row, f(x), has the entries, negative 5, negative 3, negative 1, 1, 3, 5. A table with 2 columns and 7 rows. The first row, x, has the entries, negative 3, negative 2, negative 1, 0, 1, 2. The second row, g(x), has the entries, negative 13, negative 9, negative 5, negative 1, 3, 7.
Which input value produces the same output value for the two functions?

Answers

Answer:

rtyujn

Step-by-step explanation:

er456y7ujm

Solve -2x + 6 = -20. -7 -13 7 13

Answers

Answer:

13

Step-by-step explanation:

-2x + 6 = -20

Step 1 subtract 6 from both sides

6 - 6 cancels out

-20 - 6 = -26

We now have -2x = -26

Step 2 divide both sides by -2

-2x/-2 = x

-26/-2 = 13

We're left with x = 13

Question 7 of 27
Which of the following is an element in the sample space for first rolling a
number cube and then tossing a coin?

Answers

Answer:

TH is an element on the sample space for first rolling a die and then tossing a coin. A coin has both heads and tails.

The sample space for rolling a number cube and then tossing a coin is:

{(1, H), (1, T), (2, H), (2, T), (3, H), (3, T), (4, H), (4, T), (5, H), (5, T), (6, H), (6, T)}

The elements can be any of the elements in the sample space.

What is sample space?

It is the total number of possible outcomes from a given set.

We have,

The sample space for rolling a number cube and then tossing a coin consists of all possible outcomes from rolling the number cube and tossing the coin.

Each outcome is a pair consisting of a number from 1 to 6 (the possible outcome from rolling the number cube) and a head or tail (the possible outcome from tossing the coin).

Therefore, an element in the sample space can be represented as an ordered pair (n, h/t), where n is the number rolled on the number cube and h/t is the outcome of the coin toss (either head or tail).

So,

The sample space for rolling a number cube and then tossing a coin is:

{(1, H), (1, T), (2, H), (2, T), (3, H), (3, T), (4, H), (4, T), (5, H), (5, T), (6, H), (6, T)}

For example, (3, H), (6, T), (1, H), and (4, T) are all elements in the sample space.

Thus,

The sample space for rolling a number cube and then tossing a coin is:

{(1, H), (1, T), (2, H), (2, T), (3, H), (3, T), (4, H), (4, T), (5, H), (5, T), (6, H), (6, T)}

Learn more about sample space here:

https://brainly.com/question/24273864

#SPJ7

PLEASE HELP IF YOU KNOW GEOMETRY THIS SHOULD BE EASY

Answers

Answer:

Growth

Step-by-step explanation:

When x value increase, y value also increase, So growth.

When x = 1   ;f(1) = 2

When x = 2  ; f(2) = 2² = 4

When x = 3  ; f(3) = 2³ = 8

Answer:

Exponential Growth

Step-by-step explanation:

I found this photo that helps differentiate both growth and decay :)

I hope this helps! :)

Which statement is true regarding the graphed functions?

Answers

Answer:

f(2) = 0 and g(2) = 0

f(2) = g(2) TRUE

b) f(0) = 2 and g(0) = -2

f(0) = g(0) FALSE

c) f(2) = 0 and g(0) = -2

f(2) = g(0) FALSE

d) f(0) = 2 and g(2) = 0

f(0) = g(2) FALSE

How many sides do 2 hexagons and 2 pentagons have in all?

Answers

Answer:

22 sides total

Step-by-step explanation:

a hexagon has 6 sides, while a pentagon has 5 sides. In order to find out how many there are total, we would multiply each by two, and add them together.

[tex]2(6)+2(5)=\\12+10=22[/tex]

Find the distance between the points (11,4) and (10,5)

Answers

11-10=1
4-5=-1

Answer:
(1,-1)

Violet bought 2 yards of fabric. She will use it to make new pillow covers. How many inches of fabric did Violet get?

Answers

Answer:

24 inches

Step-by-step explanation:

2 yards to inches :

2 x 12 = 24

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

Answer:

72 inches

Step-by-step explanation:

1 yard = 3 feet

1 foot = 12 inches

1 yard = 3(12) inches or 36"

∴ 2 yards = 72 inches

The diagram shows a rectangle PQRS.
PQ = 14 cm and QR = 9 cm.
The point A lies on PS so that PA = 5 cm.
The point Blies on SR so that BR = 8 cm.

Answers

Answer:

a) The area of the triangle AQB is 43 square centimeters.

b) The length of the line segment AQ is approximately 14.866 centimeters.

Step-by-step explanation:

a) The procedure consist in subtracting the areas of triangles APQ, ASB and BRQ of the area the rectangle, that is to say:

[tex]A = (9\,cm)\cdot (14\,cm) - \frac{1}{2}\cdot (5\,cm)\cdot (14\,cm) - \frac{1}{2}\cdot (8\,cm)\cdot (9\,cm) -\frac{1}{2}\cdot (4\,cm) \cdot (6\,cm)[/tex]

[tex]A = 43\,cm^{2}[/tex]

The area of the triangle AQB is 43 square centimeters.

b) The length of the line segment AQ is determined by Pythagorean Theorem:

[tex]AQ = \sqrt{AP^{2}+PQ^{2}}[/tex] (1)

[tex]AQ = \sqrt{(5\,cm)^{2}+(14\,cm)^{2}}[/tex]

[tex]AQ \approx 14.866\,cm[/tex]

The length of the line segment AQ is approximately 14.866 centimeters.

10.
Consider the number 1750
Find the least number which must be added so as to get a perfect square?
Find the square root of the number obtained?​

Answers

Answer:

if you add 14 to 1750 you will get 1764 which equals 42²

Step-by-step explanation:

Explain in your own words why it takes more to prove quadrilaterals congruent. Include examples demonstrating how ""just angles"" or ""just sides"" is not enough.

Answers

Proving that quadrilaterals are congruent takes more because all quadrilaterals are polygons of four sides and they all have a sum angle of 360°

Meaning of Congruent quadrilaterals

A quadrilateral can be defined as a polygon shape that possesses four sides.

Congruent quadrilaterals are those quadrilaterals that are similar in sides and angles.

For example, a parallelogram needs to be proved by both the sides and the angles

In conclusion, Proving that quadrilaterals are congruent takes more because all quadrilaterals are polygons of four sides and they all have a sum angle of 360°

Learn more about Congruent quadrilaterals: https://brainly.com/question/224113

#SPJ1

Other Questions
Brainliest! Brainliest! Brainliest!What was life in the 19th Century? Does a virus have an independent lifecycle? here are some questions from different social studies assignments that i have:1) identify and explain one aspect of today's society that has its roots in societies of the past2) choose either ancient egypt, ancient greece, or ancient rome. explain how their culture, beliefs, and worldview are represented in their art. give examples. 3) how do you think worldview, culture, and beliefs are expressed in modern art (imagery, movies, books, songs, etc.)? give examples. 4) where did the British Empire expand to? and why? 5) how do you think a person's worldview might impact the type of leadership or government they want in a society?6) how does the structure of government in Canada ensure that power is distributed to all regions of the country? i would appreciate anyone's help asap, even if you can only answer one of these questions (don't need to answer all if can't) thanks in advance!! Please help please guys how are you doing The volume of a rectangular prism is given by 24x3+78x2+49x+10. The height of the prism is given by 2x+5. Find an expression for the area of the base of the prism how do i say hi in a samoan language A company is planning to purchase a machine that will cost $57,000 with a six-year life and no salvage value. The company expects to sell the machine's output of 3,000 units evenly throughout each year. A projected income statement for each year of the asset's life appears below. What is the payback period for this machine?Sales $138,000Costs: Manufacturing $68,000Depreciation on machine 9,500Selling and administrative expenses 46,000 (123,500)Income before taxes $14,500Income tax (35%) 5,075Net income $9,425 a. 6.00 years.b. 1.99 year.c. 6.05 years.d. 12.10 years.e. 3.01 years. 2. Civil rights are enforceable rights or privileges guaranteed by the US Constitution or other laws or statues.TrueFalse Was the Vietnam war winnable for America? A paragraph please someone PLSSSS HELPPP !! fast pls please Please help me. I need help the probability that a customer of a network operator has a problem about you needing technical staff's help in a month is 0.01. This operator installs internet for 500 households in a residential area a, Calculate the average number of households in this residential area having internet problems in a certain month b, Calculate the probability that in 6 consecutive months there is only one month that no customer in this area has a network problem that needs the help of technical staff Mortality is:________. Select one: a. the certainty of mass casualties. b. the possibility of dissemination. c. the potential for death. d. the availability of biologic substances. what is the area of a flower pot that have the shape of a semi circle and its diameter 2.8cm? I need help with question 6 2. EXPLIQUE o que foi o tratado de Tordesilhas Question 2Why does Bassanio need to borrow money?a. He was wreckless and wasted his own.b. His father refused to give him money.C. He was just a little short until payday. Which expression is equivalent to -6(-+2x)?O-4-12xO-4+ 2xO 4-12xO 4+ 12x Scarcity, opportunity cost, and marginal analysis Alex is training for a triathlon, a timed race that combines swimming, biking, and running. Consider the following sentence: Because his pool sessions are helping him swim more quickly, Alex plans to reduce by 1 hour per week the time he spends training on the bike and increase by 1 hour the time he spends in the swimming pool; however, his wife says that he should stop doing any biking and running and spend all 20 hours per week in the pool. Which basic principle of individual choice does Alex's plan illustrate that his wife's advice does not? a. All costs are opportunity costs. b. People usually exploit opportunities to make themselves better off. c. Resources are scarce. d. Many decisions are made on the margin. rational numbers.Example 6: Write any 3 rational numbers between 2 and 0.-200ondas-