What is the outcome of all chemical changes when two substances are combined?​

Answers

Answer 1

Answer:

This is called a chemical reaction. gas may form.heat may be produced and the color may change


Related Questions

how many primary carbon are in 2,3 dimethylpentane​

Answers

Answer:

There are 7 carbons in 2,3 dimethylpentane

Explanation:

Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16

Is iodine a atom,a molecule,an ion or a formule unit?

Answers

Answer:

It's an atom

Explanation:

It can't be a molecule since it's only one element, the ion would've been Iodide (I-), and it's not a formula

Question 9 of 10
How could an electron configuration be used to predict relative atomic size?
A. The more valence electrons listed, the larger the atomic radius.
B. The larger the highest energy level number, the larger the atomic
radius.
C. The more sublevels occupied, the larger the atomic radius.
D. The greater number of total electrons, the larger the atomic radius.
SUBMIT

Answers

Answer: B

Explanation: Apex

An electron configuration be used to predict relative atomic size because the larger the highest energy level number, the larger the atomic

radius.

The electron configuration of an element shows the arrangement of electrons in atoms of that element.

As more sublevels are added, repulsion between electrons occupying shells increases causing a greater shielding and consequent increase in the size of the atom.

Hence, the larger the highest energy level number, the larger the atomic

radius.

Learn more: https://brainly.com/question/238050

Increasing temperature can

Answers

A- Change the phase of the matter

Which of the following statements is true? A. Isotopes of the same element have the same number of protons and neutrons. B. Isotopes have the same physical properties as the normal atom but different chemical properties. C. Isotopes have the same chemical properties as the normal atom but different physical properties. D. If an isotope of one element has the same atomic mass as another element, they will have the same properties.

Answers

Answer:

B

Explanation:

Isotopes have the same number of protons but different number of neutrons.

The true statement is,

Isotopes have the same chemical properties as the normal atom but different physical properties.

So, option C is correct one.

What is isotopes?The elements have same number of proton but different number of neutrons.Example: hydrogen, deuterium, tritium

Why isotopes of same elements have different physical properties?

The isotopes have different physical properties like freezing point , mass, melting or boiling point etc because they have different mass number .

learn about isotopes,

https://brainly.com/question/11904263

#SPJ2

BRAINLIEST!!! ❣


How do scientists use ice to study ancient climates?


A. through glacial deposits and ice cores

B. through glacial deposits and ice ages

C. through ice cores and pollen grains

D. through pollen grains and ice ages



Which greenhouse gas is produced by commercial refrigeration and air conditioning systems?


A. carbon dioxide

B. fluorinated gas

C. nitrous oxide

D. methane

Answers

Q1. A.

Q2. Nitrous oxide

Hope this helped ♥︎

Explanation:

the first question's answer is a

the second question's answer is c

An atom X has a proton number of 19 and relative atomic mass of 39.

(i) How many electrons, protons and neutrons are there in an atom of X?

(ii) How many electrons will there be in the outer energy level (shell) of an atom of X?

(iii) What is the electronic configuration of X?

Answers

Answer:

1) electron=19 Proton=19 Neutron=39-19=20

2) 1

3) in pic

Answer:

(i)electrons = 19; Protons = 19 Neutrons =39-19=20

(ii) 1

(iii) 2,8,8,1

Hope this helps.

Please mark me as Brainliest:))

What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?

Answers

Answer:

ethylpentanoate

Explanation:

Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.

The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;

CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)

The name of the compound formed is ethylpentanoate.

Which substance has the highest melting point? Select one: a. sugar b. Oxygen c. Diamond

Answers

Answer:

Diamonds

Explanation:

The melting point of sugar is 186C

The melting point of oxygen is -218C

The melting point of diamonds are 4078C

Therefore diamonds have the highest melting point.

You can also think of their structures, as diamonds have a covalent network structure, meaning they are really strong and have a high melting point

Oxygen has a covalent molecular structure

Sugar has a much weaker covalent network structure

Define physical and chemical properties, provide three examples of each, discuss their reversibility, and explain the fundamental differences between them.

Answers

Answer:

Physical properties are defined as the properties which can be observed without changing its chemical composition.

For example: color, volume, and molecular weight.

Chemical properties are defined as the properties which can be observed only after changing chemical identity of the substance.

For example: reactivity, toxicity, and flammability.

The fundamental differences between physical and chemical properties are as follows:

Chemical properties are related to chemical bonds of the substance while physical properties are not.In chemical properties, chemical identity of substance changes while physical properties do not have any change.Chemical properties predict the reaction of substance while physical properties only describe the appearance of the substance.

Answer:

Chemical properties are related to chemical bonds of the substance while physical properties are not.

In chemical properties, chemical identity of substance changes while physical properties do not have any change.

Chemical properties predict the reaction of substance while physical properties only describe the appearance of the substance.

Explanation:

A wittig reaction occurs when 4-methylbenzaldehyde and benzyltriphenylphosphonium chloride are stirred together at room temperature in the presence of sodium hydroxide base. Draw the major isomer produced by this reaction.

Answers

Answer:

See explanation

Explanation:

The wittig reaction is an organic reaction in which an aldehyde or a ketone reacts with a phosphonium ylide to give an alkene. This phoshonium ylide that participates in the reaction is usually generated insitu in the system by reaction of an alky or aryl triphenylphosphonium halide salt with a base(sodium hydroxide is mostly used).

In this particular reaction 4-methylbenzaldehyde and benzyltriphenylphosphonium chloride were reacted together in the presence of sodium hydroxide and the product with the structure shown in the answer was obtained as the major isomer produced in the reaction.

1. The Tyndall Effect is most useful for distinguishing between: *
a solute and a solvent
O a suspension and a solution
a colloid and a suspension
a colloid and a solution

Answers

Answer:

a colloid and a solution

Explanation:

When solute particles completely dissolve in a solvent, a true solution is formed. The solute particles in this case are so little that they can not be seen with naked eyes. A true solution does not scatter rays of light.

In a false solution, the solute particles are larger than the solute particles in true solutions but are not large enough to be seen with naked eyes. False solutions scatter rays of light. False solutions are also called colloids.

The major difference between a solution and a colloid is that colloids scatter light rays (Tyndall effect) while a true solution does not scatter light rays.

Which of these is true about electrons? posses a positive electrical charge of one (+1) have a negative electrical charge of one (-1) indicates the number of protons in each atom equals the sum of protons plus neutrons in each atom

Answers

Answer:

have a negative electrical charge of one (-1)

Explanatio

Electrons have an electrical charge of negative one. When you think electron, always think -1

A 0.477 mol sample of O_2 gas has a volume of 11.3 L at a certain temperature and pressure. If all this O_2 were converted to ozone (O_3) at the same temperature and pressure, what is the ozone volume (in liters)? 3 O_2(g) → 2 O_3(g)

Answers

Answer:

The volume of ozone produced is 7.53 L.

Explanation:

The reaction is:

3O₂(g)  →  2O₃(g)   (1)      

0.477 mol   V=?

11.3 L    

From the reaction (1) we have that 3 moles of O₂ produce 2 moles of O₃ so the volume of the ozone produced can be calculated as follows:

[tex] V_{O_{3}} = V_{O_{2}}*\frac{n_{O_{3}}}{n_{O_{2}}} = 11.3 L*\frac{2}{3} = 7.53 L [/tex]

Therefore, the volume of ozone produced is 7.53 L.

I hope it helps you!

The ozone volume (in liters) is 7.53 L.

The calculation is as follows:

The volume of the ozone in liters should be

[tex]= 11.3 \times 2\div 3[/tex]

= 7.53L

we have that 3 moles of O₂ produce 2 moles of O₃

Learn more: https://brainly.com/question/17961582?referrer=searchResults

3. How many meters above sea level is the base of your landform?

How many meters above sea level is the top of your platform?

Answers

Answer:

Base is 715 and top is 850.

Explanation:

715 meters above sea level is the base of my landform and 850 meters above sea level is the top of my platform. Base of landform from a sea level is a starting point of a city or region having same topography. This region has a specific height where it spreads we called it top of the platform. The starting point of my location is 715 meters above sea level spreads up to 850 meters of elevation.

PLEASE PLEASE HELP!!!! What is the mass of a sample material that has a volume of 72.2cm³ and a density of 7.7g/cm³?

Answers

Answer:

The answer is

555.94g

Explanation:

To find the mass of a substance given it's density and volume we use the formula

[tex]Density \: = \frac{mass}{volume} [/tex]

Making mass the subject we have

mass = Density × volume

From the question

Density = 7.7 g/cm³

Volume = 72.2 cm³

Substitute the values into the above formula

That's

mass = 7.7 g/cm³ × 72.2 cm³

We have the final answer as

mass = 555.94g

Hope this helps you

A botanist measures a plant growth at 3cm over a two week period. The information she gathers is called.

Answers

Answer:

The correct answer is quantitative data.

Explanation:

The value of data in the form of numbers of counts where each set of data exhibits a specific numerical value associated with it is termed as quantitative data. This information refers to any quantifiable knowledge, which can be used for statistical analysis and mathematical calculations so that decisions of real-life can be taken based on the mathematical outcomes. The quantitative data is used to find the solutions of the queries like how often, how much, or how many.  

In the given case, a botanist measured the growth of the plant for two weeks, and the outcome came in the form of numerical value. Thus, the knowledge she collected is known as quantitative data.  

What element is depicted by the following electron configuration:

(The electron configuration is in the image)




A. None of these
B. Oxygen
C. Chlorine
D. Sulfur

Answers

Explanation:

Your required answer is sulpher.

Hope it helps...

Why do.we need inactive ingredients?

Answers

Answer:

Inactive ingredients are components of a drug product that do not increase or affect the therapeutic action of the active ingredient, which is usually the active drug. Inactive ingredients are added during the manufacturing process of pharmaceutical products such as tablets, capsules, suppositories, and injections

For the set of ionic compounds, LiCl, AgCl, PbCl2, choose the correct characterization of their solubilities in water from the response list. Group of answer choices All three salts are soluble. None of the three salts are soluble. Two of the three salts are soluble. One of the three salts is soluble.

Answers

Answer:

Two of the three salts are soluble.

One of the three salts is soluble.

Explanation:

One or two of the three salts would be soluble in water depending on if the water is cold or hot.

According to the solubility rules of chloride salts, all chlorides are soluble in cold water except for those of silver (Ag), lead (Pb), and mercury (I) (Hg).

This thus means that both AgCl and [tex]PbCl_2[/tex] would be insoluble in cold water while LiCl would be soluble.

[tex]PbCl_2[/tex] is, however soluble in hot water.

Hence, in cold water, one of the three salts (LiCl) would be soluble, while in hot water, two of the three salts (LiCl and [tex]PbCl_2[/tex]) would be soluble.

How many moles of potassium in 73.56g of potassium chlorate (V) (KClO 3 )?

Answers

Answer:

Approximately [tex]0.6003\; \rm mol[/tex] formula units.

Explanation:

Formula Mass of KClO₃

Look up the relative atomic mass data for [tex]\rm K[/tex], [tex]\rm Cl[/tex], and [tex]\rm O[/tex] on a modern periodic table:

[tex]\rm K[/tex]: [tex]39.908[/tex].[tex]\rm Cl[/tex]: [tex]35.45[/tex].[tex]\rm O[/tex]: [tex]15.999[/tex].

The relative atomic mass of an element is numerically equal to the mass (in grams) of one mole of its atoms. For example, the relative atomic mass of [tex]\rm K[/tex] is [tex]39.908[/tex]. Therefore, the mass of one mole of [tex]\rm K\![/tex] atoms should be [tex]39.908\; \rm g[/tex].

Each [tex]\rm KClO_3[/tex] "formula" unit includes one [tex]\rm K[/tex] atom, one [tex]\rm Cl[/tex] atom, and three [tex]\rm O[/tex] atoms. Therefore, one mole of [tex]\rm KClO_3\![/tex] formula units would include:

one mole of [tex]\rm K[/tex] atoms, one mole of [tex]\rm Cl[/tex] atoms, and three moles of [tex]\rm O[/tex] atoms.

From the relative atomic mass of these three elements:

The mass of one mole of [tex]\rm K[/tex] atoms would be [tex]39.908\; \rm g[/tex].The mass of one mole of [tex]\rm Cl[/tex] atoms would be [tex]35.45\; \rm g[/tex].The mass of three moles of [tex]\rm O[/tex] atoms would be [tex]3 \times 15.999\; \rm g = 47.997\; \rm g[/tex].

Combining these three parts should give the mass of one mole of [tex]\rm KClO_3[/tex] formula units:

[tex]\begin{aligned}& M(\mathrm{KClO_3}) \\ &= 39.908 + 35.45 + 3 \times 15.999 \\ &= 122.545\; \rm g \cdot mol^{-1}\end{aligned}[/tex].

Number of moles of KClO₃ formula units in the sample

The formula mass of [tex]\rm KClO_3[/tex] is [tex]M(\mathrm{KClO_3}) = 122.545\; \rm g \cdot mol^{-1}[/tex], meaning that the mass of one mole of [tex]\rm KClO_3\![/tex] formula units would be [tex]122.545\; \rm g\![/tex].

The mass of this [tex]\rm KClO_3\!\![/tex] sample is [tex]m(\mathrm{KClO_3}) = 73.56\; \rm g[/tex]. The number of moles of formula [tex]\rm KClO_3\![/tex] units in this sample would be:

[tex]\begin{aligned}n(\mathrm{KClO_3}) &= \frac{m(\mathrm{KClO_3})}{M(\mathrm{KClO_3})} \\ &= \frac{73.56\; \rm g}{122.545\; \rm g \cdot mol^{-1}} \approx 0.6003\; \rm mol\end{aligned}[/tex].

73.56 g of potassium chlorate (v), KClO₃ contains 0.6 mole of potassium, K.

To know the exact number of mole of potassium (K) in 73.56 g of potassium chlorate (v), KClO₃ do the following:

Step 1:

Determination of the number of mole in 73.56 g of potassium chlorate (v), KClO₃

Mass of KClO₃ = 73.56 g

Molar mass of KClO₃ = 39 + 35.5 + (16×3)

= 39 + 35.5 + 48

= 122.5 g/mol

Mole of KClO₃ =?

[tex]Mole =\frac{mass}{molar mass}\\\\Mol KClO_{3} = \frac{73.56}{122.5}[/tex]

Mole of KClO₃ = 0.6 mole

Step 2:

Determination of the number of mole of potassium, K in 0.6 mole (i.e 73.56 g) of KClO₃

Considering the molecular formula of potassium chlorate (v), KClO₃, we can see that:

1 mole of KClO₃ contains 1 mole of K.

Therefore, 0.6 mole of KClO₃ will also contain 0.6 mole of K.

Therefore, we can conclude that 73.56 g of KClO₃ contains 0.6 mole of potassium, K.

Learn more: https://brainly.com/question/2264224

For the set of ionic compounds, CaSO4, CaCO3, Ca(OH)2, choose the correct characterization of their solubilities in water from the response list. Group of answer choices None of the three salts are soluble. All three salts are soluble. Two of the three salts are soluble. One of the three salts is soluble.

Answers

Answer:

None of the three salts are soluble.

Explanation:

According to the solubility rule, the carbonates and sulphates of group two elements are insoluble in water.

All three substances mentioned possess very low solubility in water and can be said to be slightly soluble in water. If we compare them with other ionic substances that dissolve readily in water, we can rightly say that they are insoluble in water.

Hence all three substances are insoluble in water.

Which term is defined as “anything that has mass and occupies space”? a -compound b - element c - substance d - matter

Answers

The answer is matter

Answer:

D) Matter

Explanation:

Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?

Answers

Answer:

A. 35

B. 7

C. halogênios

Explanation:

Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.

..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.

O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.

A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35

B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família

C. Pertence à família dos halogênios

Answer in the correct significant figures: 35.6 + 56.27 *

Answers

Answer:

101.87

Explanation:

that's the answer

Chemical change example

Answers

Answer: burning paper

Explanation:

The paper burns in air to form smoke and ash. which makes it a chemical change.

Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J

Answers

Answer:

B)−6,942 J /mol

Explanation:

At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:

ΔG = ΔH - TΔS

Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.

Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):

ΔG = ΔH - TΔS

ΔG = 25450J/mol - 298K×108.7J/molK

ΔG = -6942.6J/mol

Right solution is:

B)−6,942 J /mol

What is the complete ionic equation for this reaction?
2KOH(aq) + H2SO4(aq) → 2H20(1) + K2SO4(aq)
O A. 2K+ + OH + H2SO4 → OH + 2H+ + K2SO4
B. OH + 2H+ + 2H20()
C. 2KOH + H2SO4 → 2H20 + K2SO4
D. 2K+ + OH + 2H+ + SO42- → 2H20() + 2K+ + SO42-
SUBMIT

Answers

Answer:

The answer is "Option D".

Explanation:

The entire ionic equation for all the substances, which are ionic compounds but are available in an aquatic is represented in the form with ions in the full ionic equation.  

In the Net ionic equation, it doesn't have the particulate matter throughout the net ionic equations throughout the equations.  

In the Spectator ions, it doesn't participate in interactions mostly on reaction and the material hand. From both sides, the very same ions are present.  

The evenly balanced chemical formula is,

[tex]2KOH (aq)+ H_2SO_4(aq) \longrightarrow 2H_2O(l) + K_2SO_4[/tex]

It is the separate organic compound that full ion formula will match the choice D.

Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid

Answers

Answer: 1. Sodium Benzoate

Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c

Sodium benzoate is a pure preservative.

why is an element considered a pure substance​

Answers

Answer:

Because they cannot be separated into more then one type of substance.

Explanation:

Answer:

Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.

Other Questions
Ezekiel came from a priestly family, which helps explain his emphasis on sin as uncleanness and defilement and his interest in the rebuilding of the future temple.A. TrueB. False Find the value of v in the equation below(in picture) The product of a number and 3 is equal to 15 minutes twice the number, find the number. Merchandise inventory: Multiple Choice Is a current asset. Is a long-term asset. Must be sold within one month. Is classified with investments on the balance sheet. Includes supplies the company will use in future periods. Solve the equation for all values of x in simplest form: (x-9)^2 = 15 Which is not a risk factor that could lead to a cesarean section? -very narrow hips -extra large baby -triplets -regular exercise Which of the following provides a characteristic ofMgO(s) with a correct explanation?Choose 1 answer:It is hard because its ions are held together by strongelectrostatic attractions.BIt is malleable because its atoms can easily move pastone another without disrupting the bonding.It is a poor conductor of electricity because itselectrons are tightly held within covalent bonds andlone pairs.It has a high melting point because its moleculesinteract through strong intermolecular forces. Tasty Doughnuts has computed the net present value for capital expenditure at two locations. Relevant data related to the computation are as follows: Des Moines Cedar Rapids Total present value of net cash flow $712,500 $848,000 Amount to be invested (750,000) (800,000) Net present value $(37,500) $ 48,000 a. Determine the present value index for each proposal. Round your answers for the present value index to two decimal places. (9443+459.9) (9443+459.9) 8.4 10 6 Briefly explain your knowledge of sine, cosine, and tangent. If you were Brutus, what would you want to say to the people of Rome after Caesar was killed? For most cultures, initially weaning from breast milk is: ________.a. sudden and abruptb. gentle and gradualc. harsh and punitived. non existent and or absent Fiona wrote the linear equation y = y equals StartFraction 2 over 5 EndFraction x minus 5.x 5. When Henry wrote his equation, they discovered that his equation had all the same solutions as Fionas. Which equation could be Henrys? x x minus StartFraction 5 over 4 EndFraction y equals StartFraction 25 over 4 EndFraction.y = x x minus StartFraction 5 over 2 EndFraction y equals StartFraction 25 over 4 EndFraction.y = x x minus StartFraction 5 over 4 EndFraction y equals StartFraction 25 over 2 EndFraction.y = x x minus StartFraction 5 over 2 EndFraction y equals StartFraction 25 over 2 EndFraction.y = Sophie is experiencing so much guilt associated with the death of her boyfriend that it is beginning to interfere in every aspect of her life. She is probably experiencing: Group of answer choices What term matches the following definition: " ...a fundamental evolutionary process that results in both the adaptation of species to their environments and the generation of biodiversity (new species)"? Shari is taking notes in preparation for her oral presentation on the impacts of excessive homework on high school students. She finds a study that shows that having less homework would allow students to engage in other enriching activities and spend more time bonding with family and friends. How could this information fit into her presentation For which writing prompt would you use an explanatory thesis? A.) Analyze the differences between yoga and aerobics, and then explain which one is better for your body. B.)Describe the poetry of Shel Silverstein and the poems of Jack Prelutsky and then decide which poems are funnier. C.)Compare and contrast traveling by ship with traveling by airplane, discussing the pros and cons of each. D.) Compare and contrast the Great Chicago Fire (1871) and the San Francisco Earthquake of 1906 to determine which was worse. nd the measure of angle m2. Find the length of siem18.2m6115:1m105mm 5. A recent school survey found that 8 out of 10 students plan to go to college after graduating high school. Atthat rate, how many of the 2540 students at the local high school plan to go to college?318 students2032 students2000 students3175 students