Answer:
3.34 M or 3.34 mol/L
Explanation:
The formula for molarity is moles of solution ÷ liters of solution. So, we have to convert grams into moles and mL to L.
To convert grams to moles, first find the molar mass of CH₃COOH by looking at the atomic mass of each individual element.
C - 2(12.01) = 24.02
H - 4(1.01) = 4.04
O - 2(16.00) = 32.00
= 60.06
Now divide the number of grams by the molar mass.
10.0 g CH₃COOH ÷ 60.06 g = 0.167 mol CH₃COOH
To convert milliliters to liters, divide by 1000.
50.0 mL ÷ 1000 = 0.05 L
Now we can calculate the molarity.
M = moles of solution ÷ liters of solution
= 0.167 mol ÷ 0.05 L
= 3.34 M or 3.34 mol/L
The molarity is 3.34 M.
Hope that helps.
Which of these is true about electrons? posses a positive electrical charge of one (+1) have a negative electrical charge of one (-1) indicates the number of protons in each atom equals the sum of protons plus neutrons in each atom
Answer:
have a negative electrical charge of one (-1)
Explanatio
Electrons have an electrical charge of negative one. When you think electron, always think -1
BRAINLIEST!!! ❣
How do scientists use ice to study ancient climates?
A. through glacial deposits and ice cores
B. through glacial deposits and ice ages
C. through ice cores and pollen grains
D. through pollen grains and ice ages
Which greenhouse gas is produced by commercial refrigeration and air conditioning systems?
A. carbon dioxide
B. fluorinated gas
C. nitrous oxide
D. methane
Explanation:
the first question's answer is a
the second question's answer is c
Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J
Answer:
B)−6,942 J /mol
Explanation:
At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:
ΔG = ΔH - TΔS
Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.
Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):
ΔG = ΔH - TΔS
ΔG = 25450J/mol - 298K×108.7J/molK
ΔG = -6942.6J/mol
Right solution is:
B)−6,942 J /molwhy is an element considered a pure substance
Answer:
Because they cannot be separated into more then one type of substance.
Explanation:
Answer:
Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.
Question 9 of 10
How could an electron configuration be used to predict relative atomic size?
A. The more valence electrons listed, the larger the atomic radius.
B. The larger the highest energy level number, the larger the atomic
radius.
C. The more sublevels occupied, the larger the atomic radius.
D. The greater number of total electrons, the larger the atomic radius.
SUBMIT
Answer: B
Explanation: Apex
An electron configuration be used to predict relative atomic size because the larger the highest energy level number, the larger the atomic
radius.
The electron configuration of an element shows the arrangement of electrons in atoms of that element.
As more sublevels are added, repulsion between electrons occupying shells increases causing a greater shielding and consequent increase in the size of the atom.
Hence, the larger the highest energy level number, the larger the atomic
radius.
Learn more: https://brainly.com/question/238050
what is mean by stakeholder
Answer:
a stakeholder is a party that has an interest in a company and can either effect or be affected by the business. the primary stakeholder in a typical corporation are its investors , employees, customers and supplies.PLEASE PLEASE HELP!!!! What is the mass of a sample material that has a volume of 72.2cm³ and a density of 7.7g/cm³?
Answer:
The answer is
555.94g
Explanation:
To find the mass of a substance given it's density and volume we use the formula
[tex]Density \: = \frac{mass}{volume} [/tex]Making mass the subject we have
mass = Density × volume
From the question
Density = 7.7 g/cm³
Volume = 72.2 cm³
Substitute the values into the above formula
That's
mass = 7.7 g/cm³ × 72.2 cm³
We have the final answer as
mass = 555.94gHope this helps you
What is the complete ionic equation for this reaction?
2KOH(aq) + H2SO4(aq) → 2H20(1) + K2SO4(aq)
O A. 2K+ + OH + H2SO4 → OH + 2H+ + K2SO4
B. OH + 2H+ + 2H20()
C. 2KOH + H2SO4 → 2H20 + K2SO4
D. 2K+ + OH + 2H+ + SO42- → 2H20() + 2K+ + SO42-
SUBMIT
Answer:
The answer is "Option D".
Explanation:
The entire ionic equation for all the substances, which are ionic compounds but are available in an aquatic is represented in the form with ions in the full ionic equation.
In the Net ionic equation, it doesn't have the particulate matter throughout the net ionic equations throughout the equations.
In the Spectator ions, it doesn't participate in interactions mostly on reaction and the material hand. From both sides, the very same ions are present.
The evenly balanced chemical formula is,
[tex]2KOH (aq)+ H_2SO_4(aq) \longrightarrow 2H_2O(l) + K_2SO_4[/tex]
It is the separate organic compound that full ion formula will match the choice D.
please help :) How can scientists ensure that their data are reliable? A) by making a single observation B) by recording values without units C) by keeping the results private D) by repeating trials during an experiment
Answer:
D. by repeating trials during an experiment
Explanation:
chile its actually d
Explanation:
1. The Tyndall Effect is most useful for distinguishing between: *
a solute and a solvent
O a suspension and a solution
a colloid and a suspension
a colloid and a solution
Answer:
a colloid and a solution
Explanation:
When solute particles completely dissolve in a solvent, a true solution is formed. The solute particles in this case are so little that they can not be seen with naked eyes. A true solution does not scatter rays of light.
In a false solution, the solute particles are larger than the solute particles in true solutions but are not large enough to be seen with naked eyes. False solutions scatter rays of light. False solutions are also called colloids.
The major difference between a solution and a colloid is that colloids scatter light rays (Tyndall effect) while a true solution does not scatter light rays.
How many significant figures are in 0.08260 L? 4 5 6
Answer:
5
Explanation:
Count the digits after the first non zero number, any number after that (even zero) counts.
Hope that helped!!! k
Answer:
[tex]\boxed{4}[/tex]
Explanation:
[tex]\sf Leading \ zeros \ are \ not \ significant.[/tex]
[tex]\sf Trailing \ zeros \ are \ significant.[/tex]
[tex]\sf Non\ zeros \ are \ significant.[/tex]
[tex]0.08260 \sf \ has \ 4 \ significant \ figures.[/tex]
What element is depicted by the following electron configuration:
(The electron configuration is in the image)
A. None of these
B. Oxygen
C. Chlorine
D. Sulfur
Explanation:
Your required answer is sulpher.
Hope it helps...
How many moles of potassium in 73.56g of potassium chlorate (V) (KClO 3 )?
Answer:
Approximately [tex]0.6003\; \rm mol[/tex] formula units.
Explanation:
Formula Mass of KClO₃Look up the relative atomic mass data for [tex]\rm K[/tex], [tex]\rm Cl[/tex], and [tex]\rm O[/tex] on a modern periodic table:
[tex]\rm K[/tex]: [tex]39.908[/tex].[tex]\rm Cl[/tex]: [tex]35.45[/tex].[tex]\rm O[/tex]: [tex]15.999[/tex].The relative atomic mass of an element is numerically equal to the mass (in grams) of one mole of its atoms. For example, the relative atomic mass of [tex]\rm K[/tex] is [tex]39.908[/tex]. Therefore, the mass of one mole of [tex]\rm K\![/tex] atoms should be [tex]39.908\; \rm g[/tex].
Each [tex]\rm KClO_3[/tex] "formula" unit includes one [tex]\rm K[/tex] atom, one [tex]\rm Cl[/tex] atom, and three [tex]\rm O[/tex] atoms. Therefore, one mole of [tex]\rm KClO_3\![/tex] formula units would include:
one mole of [tex]\rm K[/tex] atoms, one mole of [tex]\rm Cl[/tex] atoms, and three moles of [tex]\rm O[/tex] atoms.From the relative atomic mass of these three elements:
The mass of one mole of [tex]\rm K[/tex] atoms would be [tex]39.908\; \rm g[/tex].The mass of one mole of [tex]\rm Cl[/tex] atoms would be [tex]35.45\; \rm g[/tex].The mass of three moles of [tex]\rm O[/tex] atoms would be [tex]3 \times 15.999\; \rm g = 47.997\; \rm g[/tex].Combining these three parts should give the mass of one mole of [tex]\rm KClO_3[/tex] formula units:
[tex]\begin{aligned}& M(\mathrm{KClO_3}) \\ &= 39.908 + 35.45 + 3 \times 15.999 \\ &= 122.545\; \rm g \cdot mol^{-1}\end{aligned}[/tex].
Number of moles of KClO₃ formula units in the sampleThe formula mass of [tex]\rm KClO_3[/tex] is [tex]M(\mathrm{KClO_3}) = 122.545\; \rm g \cdot mol^{-1}[/tex], meaning that the mass of one mole of [tex]\rm KClO_3\![/tex] formula units would be [tex]122.545\; \rm g\![/tex].
The mass of this [tex]\rm KClO_3\!\![/tex] sample is [tex]m(\mathrm{KClO_3}) = 73.56\; \rm g[/tex]. The number of moles of formula [tex]\rm KClO_3\![/tex] units in this sample would be:
[tex]\begin{aligned}n(\mathrm{KClO_3}) &= \frac{m(\mathrm{KClO_3})}{M(\mathrm{KClO_3})} \\ &= \frac{73.56\; \rm g}{122.545\; \rm g \cdot mol^{-1}} \approx 0.6003\; \rm mol\end{aligned}[/tex].
To know the exact number of mole of potassium (K) in 73.56 g of potassium chlorate (v), KClO₃ do the following:
Step 1:Determination of the number of mole in 73.56 g of potassium chlorate (v), KClO₃
Mass of KClO₃ = 73.56 g
Molar mass of KClO₃ = 39 + 35.5 + (16×3)
= 39 + 35.5 + 48
= 122.5 g/mol
Mole of KClO₃ =?[tex]Mole =\frac{mass}{molar mass}\\\\Mol KClO_{3} = \frac{73.56}{122.5}[/tex]
Mole of KClO₃ = 0.6 moleStep 2:Determination of the number of mole of potassium, K in 0.6 mole (i.e 73.56 g) of KClO₃
Considering the molecular formula of potassium chlorate (v), KClO₃, we can see that:
1 mole of KClO₃ contains 1 mole of K.
Therefore, 0.6 mole of KClO₃ will also contain 0.6 mole of K.
Therefore, we can conclude that 73.56 g of KClO₃ contains 0.6 mole of potassium, K.
Learn more: https://brainly.com/question/2264224
Chemical change example
Answer: burning paper
Explanation:
The paper burns in air to form smoke and ash. which makes it a chemical change.
pls balance the following chemical equation asap; Ca(OH)2 +CO2 = CaCO3+ H2O pls make it step by step
Answer:
Explanation:
Start by writing water as HOH
Ca(OH)2 +CO2 = CaCO3+ HOH
Next pay attention to the CO2 going to CO3
We need an oxygen.
Fortunately that is provided by the (OH)2
Now we have
Ca(OH)2 + CO2 ==> CaCO3 + HOH
and believe it or not, that is balanced as it is
The left side has 1 Ca. So does the right side
The Left side has 1 C. So does the right side.
The left side has 2 H. So does the right side
The left side has 2 oxygens (in Ca(OH2)) + 2 oxygens in CO2
So the equation is balanced.
Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?
Answer:
A. 35
B. 7
C. halogênios
Explanation:
Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.
..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.
O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.
A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35
B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família
C. Pertence à família dos halogênios
Which of the following statements is true? A. Isotopes of the same element have the same number of protons and neutrons. B. Isotopes have the same physical properties as the normal atom but different chemical properties. C. Isotopes have the same chemical properties as the normal atom but different physical properties. D. If an isotope of one element has the same atomic mass as another element, they will have the same properties.
Answer:
B
Explanation:
Isotopes have the same number of protons but different number of neutrons.
The true statement is,
Isotopes have the same chemical properties as the normal atom but different physical properties.So, option C is correct one.
What is isotopes?The elements have same number of proton but different number of neutrons.Example: hydrogen, deuterium, tritiumWhy isotopes of same elements have different physical properties?The isotopes have different physical properties like freezing point , mass, melting or boiling point etc because they have different mass number .
learn about isotopes,
https://brainly.com/question/11904263
#SPJ2
What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
Lab Safety Rule #3 says to always add acids or bases to the solvent and NEVER the other way around true or false?
Answer:
true
Explanation:
The standard laboratory rule is to always add acids or bases to solvent and not the other way round.
The dissolution of concentrated acids/bases in solvents (water) generates heat energy. Thus, if the solvent is added to them, a layer of hot weak acid or base will be formed and this will boil and spray around, causing an explosion.
On the other hand, if acid/base is added to solvents, they flow into the solvents and get diluted immediately without any boiling taking place. Hence, it is safe to add acid/base to solvents and not the other way round.
Increasing temperature can
When a substance's particles are packed together tightly and have a definite shape and
volume...it is said to be in what state?
solid
gas
plasma
liquid
Answer:
solid
Explanation:
Answer in the correct significant figures: 35.6 + 56.27 *
Answer:
101.87
Explanation:
that's the answer
Which substance has the highest melting point? Select one: a. sugar b. Oxygen c. Diamond
Answer:
Diamonds
Explanation:
The melting point of sugar is 186C
The melting point of oxygen is -218C
The melting point of diamonds are 4078C
Therefore diamonds have the highest melting point.
You can also think of their structures, as diamonds have a covalent network structure, meaning they are really strong and have a high melting point
Oxygen has a covalent molecular structure
Sugar has a much weaker covalent network structure
For the set of ionic compounds, CaSO4, CaCO3, Ca(OH)2, choose the correct characterization of their solubilities in water from the response list. Group of answer choices None of the three salts are soluble. All three salts are soluble. Two of the three salts are soluble. One of the three salts is soluble.
Answer:
None of the three salts are soluble.
Explanation:
According to the solubility rule, the carbonates and sulphates of group two elements are insoluble in water.
All three substances mentioned possess very low solubility in water and can be said to be slightly soluble in water. If we compare them with other ionic substances that dissolve readily in water, we can rightly say that they are insoluble in water.
Hence all three substances are insoluble in water.
how many primary carbon are in 2,3 dimethylpentane
Answer:
There are 7 carbons in 2,3 dimethylpentane
Explanation:
Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16
It requires work to _____. A. stretch a spring only B. compress a spring only C. stretch or compress a spring
Answer:
C.
Explanation:
It requires work to stretch or compress a spring.
Answer:the answer is c
Explanation: i say that because with work you can do both of those things
Describe the reaction of an acid with an alkali.?
Your question has been heard loud and clear.
The reaction of an acid with an alkali is neutralization reaction. It is a neutralization reaction because , they both neutralize each other (means it makes them chemically inactive after reacting) and produce a salt , and maybe water too.
An example: hydrochloric acid + sodium hydroxide → sodium chloride + water
Thank you
it will neutralise because if you add both of them together with a matching Ph such as 5 and 9 equally then it will neutralise and have a Ph of 7
could you please make me brainliest
explain using diagrams how potassium forms the compound potassium flouride when it reacts with flourine
Answer:
The answer to your question is given below.
Explanation:
Potassium (K) has 19 electrons with electronic configuration of 2, 8, 8, 1.
Fluorine (F) has 9 electrons with electronic configuration of 2, 7.
Fluorine needs 1 electron to complete it's octet configuration.
Hence, potassium (K), will lose 1 electron to fluorine (F) to form potassium ion (K+) with electronic configuration of 2, 8, 8. The fluorine atom (F) will receive the 1 electron from potassium to form the fluoride ion (F-) with electronic configuration of 2, 8.
**** Please see attached photo for further details.
Answer the question in attachment and can I ask from which country you are.
I am new on this app.
✌️✌️☺️☺️
Answer:
1: exothermic
2:hydrated iron (III) oxide
3:reactants
4:precipitate
5: hydrogen gas
Answer:1.exothermic
2.hydrated iron (III) oxide
3.reactants
4.precipitate
5. hydrogen gas
If the molarity of sugar is 1.1, what will the freezing point be?
Answer:
The freezing point will be -2.046°C.
Explanation:
The freezing point depression equation is [tex]\Delta T_f = k_f \cdot m \cdot i[/tex]
Where;
[tex]\Delta T_f[/tex] = The temperature depression of the freezing point
[tex]k_f[/tex]= The constant of freezing point depression which is solvent dependent = 1.86°C/m
i = The number of particles the substance decomposes into in solution = 1 for sugar (a covalent compound)
m = The molality of the solution = 1.1
Therefore, we have;
[tex]\Delta T_f = 1.86 \times 1.1 \times 1 = 2.046 ^{\circ}C[/tex]
Therefore the freezing point will be 0 - 2.046°C = -2.046°C.