What is the effect of X on Y?

Answers

Answer 1

Answer:

GMM,pooled OLC,even cross country OLC are most variables not difficult panel data analysis


Related Questions

Which of these is an example of technology?
an idea for a story
the first wheel ever built
an engineer

Answers

Answer:

the first wheel ever built

Answer:

The first wheel ever built

Step-by-step explanation

(*) Sorry for my late answer but I hope this helps others that are looking for this.

100% in the test :)

what is the value of -3^2+(4+7)(2)?​

Answers

Answer:

[tex] { - 3}^{2} + (4 + 7)(2) \\ = - 9 + 22 \\ = 13[/tex]

Help asap! Lia can rent a van for either $90 per day with unlimited mileage or $50 per day with 250 free miles and an extra 25¢ for each mile over 250. For what number of miles traveled in one day would the unlimited mileage plan save Lia money? (Show work)

Answers

Answer:

The unlimited mileage plan would save money for Lia from 410 miles onwards.

Step-by-step explanation:

Since Lia can rent a van for either $ 90 per day with unlimited mileage or $ 50 per day with 250 free miles and an extra 25 ¢ for each mile over 250, to determine for what number of miles traveled in one day would the unlimited mileage plan save Lia money, the following calculation must be performed:

90.25 - 50 = 40.25

40.25 / 0.25 = 161

161 + 250 = 411

Therefore, the unlimited mileage plan would save money for Lia from 410 miles onwards.

What is the probability of drawing 1 red marble out of a bag containing 4 red marbles, 3 green marbles, 2 blue marbles, and 1 purple marble?

Answers

Answer:

2/5

Step-by-step explanation:

There are a total of 4+3+2+1=10 marbles in the bag. Since there is an equal chance of drawing any marble from the bag, the chances of drawing a red marble is equal to the number of red marbles divided by the total number of marbles.

What we're given:

4 red marbles10 total marbles

Therefore, the probability of drawing a red marble is:

[tex]\frac{4}{10}=\boxed{\frac{2}{5}}[/tex]

Answer: Most probably

Step-by-step explanation:

Zach read a book for 10 minutes every weekend in the first month, 20 minutes in the second month, 40 minutes in the third month, and 80 minutes in the fourth month.
Victoria read a book for 35 minutes every weekend in the first month, 50 minutes in the second month, 65 minutes in the third month, and 80 minutes in the fourth month.

Which statement best describes the methods used by Zach and Victoria to increase the time they spent reading a book? (1 point)

Select one:
a. Zach's method is linear because the number of minutes increased by an equal factor every month.
b. Victoria's method is linear because the number of minutes increased by an equal number every month.
c. Both Victoria's and Zach's methods are exponential because the number of minutes increased by an equal factor every month.
d. Both Victoria's and Zach's methods are exponential because the number of minutes increased by an equal number every month.

Answers

9514 1404 393

Answer:

  b. Victoria's method is linear because the number of minutes increased by an equal number every month

Step-by-step explanation:

Zach's reading doubled each month, a characteristic of an exponential function.

Victoria's reading increased by 15 minutes each month, characteristic of a linear function.

The only reasonable description among those offered is the one shown above: choice B.

1 red marble 4 blue marbles 3 green marbles probability of drawing 2 blue marbles

Answers

Answer:

3/14

Step-by-step explanation:

Assuming you draw one after the other without replacement, you have a 1/2 chance of drawing blue the first time, and after one is taken out, you have 7 left. In order to draw 2 blues you would have to have a blue the first time, so there would be 3 blue left. Multiplying the 2 probabilities gets 1/2*3/7= 3/14. Double check that though.

U have to work out the value of a by the way

Answers

Answer:

Step-by-step explanation:

180-90=2b+b

90=3b

90/3=b

30=b

2b=2*30

   =60

180-90=a+a

90=2a

a=90/2

a=45

the answer is 45 degrees

hope it helps!!let me know if it does

Answer:

a= 15°

Step-by-step explanation:

> use the fact that the sum of angles in a triangle is 180°

> based on the picture in the small right triangle we have b° +2b° +90° =180°

b +2b +90 =180° , combine like terms

3b +90 = 180, subtract 90 from both sides of the equation

3b = 90, divide by 3 both sides of the equation

b = 30°

> angle b has a ray that continues as a line so it makes an 180° angle and we have the acute triangle so we can write that

a + a+ (180-b) =180, substitute b

2a + 180-30 =180, subtract 180 from both sides, and add 30 to both sides

2a=30, divide by 2 both sides

a= 15°

: Find absolute minimum and maximum values of (, ) = 2
2 +
4 + 4
On the close triangular region R bounded by the lines = −2, = 0, = 2

Answers

f(x , y) = x + y - xy, D is the closed triangular region with vertices (0, 0), (0 , 2) , and (4 , 0)

prove the identity sin3x=3sinx-4sin³x

Answers

Hi

we know that sin(A+B)=Sin(A)Cos(B)-Cos(A) Sin (B)

cos(2x)=1-2sin²(x)

sin(2x)=2sin(x)cos(x)

Exp:- Sin(3x)=Sin(x+2x)

Sin(x)cos(2x)+cos(x)sin(2x)

sin(x){1-2sin²(x)}+2cos²(x)sin(x)

sin(x)-2sin³(x)+2sin(x){1-sin²(x)}

sin(x)-2sin³(x)+2sin(x)-2sin³(x)

3sin(x)-4sin³(x)

Hope it helps....

Gieo 120 hạt giống của một loại cây thấy có 15 hạt nảy mầm. Với độ tin cậy 95% hãy tìm ước lượng khoảng cho tỷ lệ nảy mầm của loại hạt giống đó.
Mn giúp mình với ạ

Answers

Answer:

sorry can't understand the language



Let f(x) = 2x + 8, g(x) = x² + 2x – 8, and h(x)
Perform the indicated operation. (Simplify as far as possible.)
(g - f)(2) =

Answers

the answer is (g-f)(2)

I need help with this math problem not sure what to do?​

Answers

Answer:

B. 14

Step-by-step explanation:

It's asking for function f + function g. Then it wants you to use 2 as the x value. So you have:

(f+g)(x) = 2x^2 + 3x + x - 2

(f+g)(x) = 2x^2 + 4x -2

Then using 2 as x:

(f+g)(2) = 2(2^2) + 4* 2 -2

(f+g)(2) = 8 + 8 - 2

(f+g)(2) = 14

Hope that helps, and let me know if I did any of that wrong.

f(X) = 10x^3 find inverse

Answers

1000 is you answer
Or
10x10x10
Or
10/3

Answer: [tex]y=\sqrt[3]{\frac{x}{10} }[/tex]

Step-by-step explanation:

[tex]f(x)=10x^{3}\\y=10x^{3}[/tex]

switch the x and y:

[tex]x=10y^{3}[/tex]

Now solve for y:

[tex]x=10y^{3} \\\frac{x}{10} =y^{3} \\\sqrt[3]{\frac{x}{10} } =y\\[/tex]

Therefore, the inverse of that function is: [tex]y=\sqrt[3]{\frac{x}{10} }[/tex]

Find the range of the data.
Scores: 81, 79, 80, 88, 72, 96, 86, 73, 79, 88

Answers

Answer:

24

Step-by-step explanation:

To find the range, you must subtract the lowest value from the highest value in the data set. If you organize the set from least to greatest, 72 is the lowest, and 96 is the highest.

So, 96 - 72 = 24, which is the range.

Choose the algebraic description that maps the image ABC onto A'B'C'.

Answers

(X,Y-4) this is the answer to the question since the y value of the translated image is moved down from the preimage

8. Solve the system using elimination.
3x - 4y = 9
- 3x + 2y = 9

Answers

Answer:

3x−4y=9 −3x+2y=9

Add these equations to eliminate x: −2y=18

Then solve−2y=18

for y: −2y=18 −2y −2 = 18 −2 (Divide both sides by -2)

y=−9

Now that we've found y let's plug it back in to solve for x.

Write down an original equation: 3x−4y=9

Substitute−9for y in 3x−4y=9: 3x−(4)(−9)=9

3x+36=9(Simplify both sides of the equation)

3x+36+−36=9+−36(Add -36 to both sides)

3x=−27 3x 3 = −27 3 (Divide both sides by 3) x=−9

Answer: x=−9 and y=−9

Hope This Helps!!!

What is the sum of the 14th square number and the 3rd square number?

Answers

Answer:23

Step-by-step explanation:

The sum of the 14th square number and 3rd square number is 23

Z varies directly as Square x and inversely as y. If z = 187 when x = 64 and y = 6, find z if and 9. (Round off your answer to the nearest hundredth.)

Answers

Answer:

Z = 50

Step-by-step explanation:

Given the following data;

Z = 187

x = 64

y = 6

Translating the word problem into an algebraic expression, we have;

Z = k√x/y

First of all, we would find the constant of proportionality, k;

187 = k√64/6

187 * 6 = k√64

1122 = 8k

k = 1122/8

k = 140.25

To find z, when x and y = 9

Z = 140.25√9/9

Z = (140.25 * 3)/9

Z = 420.75/9

Z = 46.75 ≈ 50

Note: The values in the latter part of the question isn't explicitly stated, so I assumed a value of 9 for both x and y.

A cylinder with radius 3 meters and height 7 meters has its radius tripled. How many times greater is the volume of the larger cylinder than the smaller cylinder?
How many times greater is the volume of the larger cylinder than the smaller cylinder?


Please help :)

Answers

Answer:

9x

Step-by-step explanation:

Quick maths, I dont really have an explaination pls give me brainliest ;-;.

what is the perimeter of a triangle?

Answers

Answer:

P = side a + side b + side c

Step-by-step explanation:

The perimeter of any polygon is all sides added together.

Answer:

3 X sides please mark me brainlist

The graph below represents the following system of inequalities.

Answers

Answer:

(2,3)

Step-by-step explanation:

For the problem I tried dividing but my answers were not correct. How can I solve this problem then? Can someone help me out here please?

Answers

Answer:

8

Step-by-step explanation:

5 = 40

1 = x

Then we multiply by the rule of crisscrossing

5 x X = 40 x 1

5x = 40 then divide both by 5

X = 8

Precision manufacturing: A process manufactures ball bearings with diameters that are normally distributed with mean 25.0 millimeters and standard deviation 0.07 millimeter. Round the answers to at least four decimal places. (a) Find the 60th percentile of the diameters. (b) Find the 67th percentile of the diameters. (c) A hole is to be designed so that 2% of the ball bearings will fit through it. The bearings that fit through the hole will be melted down and remade. What should the diameter of the hole be

Answers

Answer:

a) The 60th percentile of the diameters is of 25.0177 millimeters.

b) The 67th percentile of the diameters is of 25.0308 millimeters.

c) The diameter of the hole should be of 24.8562 millimeters.

Step-by-step explanation:

Normal Probability Distribution

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

Normally distributed with mean 25.0 millimeters and standard deviation 0.07 millimeter.

This means that [tex]\mu = 25, \sigma = 0.07[/tex]

(a) Find the 60th percentile of the diameters.

This is X when Z has a p-value of 0.6, so X when Z = 0.253.

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]0.253 = \frac{X - 25}{0.07}[/tex]

[tex]X - 25 = 0.253*0.07[/tex]

[tex]X = 25.0177[/tex]

The 60th percentile of the diameters is of 25.0177 millimeters.

(b) Find the 67th percentile of the diameters.

This is X when Z has a p-value of 0.67, so X when Z = 0.44.

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]0.44 = \frac{X - 25}{0.07}[/tex]

[tex]X - 25 = 0.44*0.07[/tex]

[tex]X = 25.0308[/tex]

The 67th percentile of the diameters is of 25.0308 millimeters.

(c) A hole is to be designed so that 2% of the ball bearings will fit through it. The bearings that fit through the hole will be melted down and remade. What should the diameter of the hole be.

This is the 2nd percentile, which is X when Z has a p-value of 0.08, so X when Z = -2.054.

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]-2.054 = \frac{X - 25}{0.07}[/tex]

[tex]X - 25 = -2.054*0.07[/tex]

[tex]X = 24.8562[/tex]

The diameter of the hole should be of 24.8562 millimeters.

Solve the inequality 5x + 3 2 >48

Answers

Answer:

[tex]{ \tt{5x + 3 \geqslant 48}} \\ { \tt{5x \geqslant 45}} \\ { \tt{x \geqslant 9}}[/tex]

Answer:

x[tex]\geq[/tex]9

Step-by-step explanation:

5x+3[tex]\geq \\[/tex]48  /-3

5x[tex]\geq[/tex]45   //5

x[tex]\geq[/tex]9

For a data set of the pulse rates for a sample of adult​ females, the lowest pulse rate is 39 beats per​ minute, the mean of the listed pulse rates is x=76.0 beats per​ minute, and their standard deviation is s=13.8 beats per minute. a. What is the difference between the pulse rate of 39 beats per minute and the mean pulse rate of the​ females? b. How many standard deviations is that​ [the difference found in part​ (a)]? c. Convert the pulse rate of 39 beats per minutes to a z score. d. If we consider pulse rates that convert to z scores between −2 and 2 to be neither significantly low nor significantly​ high, is the pulse rate of 39 beats per minute​ significant

Answers

Answer:

a) The difference is of -37, that is, this pulse rate is 37 beats per minute below the mean.

b) 2.68 standard deviations below the mean.

c) Z = -2.68.

d) Z-score below -2, so a pulse rate of 39 beats per minute is significantly low.

Step-by-step explanation:

Normal Probability Distribution

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

a. What is the difference between the pulse rate of 39 beats per minute and the mean pulse rate of the​ females?

Difference between 39 and 76, so 39 - 76 = -37.

The difference is of -37, that is, this pulse rate is 37 beats per minute below the mean.

b. How many standard deviations is that​ [the difference found in part​ (a)]

Standard deviation of 13.8, so:

-37/13.8 = -2.68

So 2.68 standard deviations below the mean.

c. Convert the pulse rate of 39 beats per minutes to a z score.

2.68 standard deviations below the mean, so Z = -2.68.

d. If we consider pulse rates that convert to z scores between −2 and 2 to be neither significantly low nor significantly​ high, is the pulse rate of 39 beats per minute​ significant?

Z-score below -2, so a pulse rate of 39 beats per minute is significantly low.

Find the length of CE

Answers

Answer:

C. 37.8 units

Step-by-step explanation:

ED = 17/ cos(38°) = 17 / 0.7880 = 21.6 units

DF = 17× tan (38°) = 17× 0.7813 = 13.3 units

CD = 10/13.3 × 21.6 = 16.2 units

so, the length of CE = 21.6+16.2 = 37.8 units

Need help please I don’t get it

Answers

the e-function stuff can be confusing sometimes, but notices that g(x) / the blue line, is just somewhat lower, rest is the same.

how much lower? look at the y-intercepts

f(0)= "about 5"

g(0)= "about -3"

with this y-intercept only option c can work

I need help please and thank you.

Answers

Answer:

option a.

[tex] + - \frac{13}{5} [/tex]

Step-by-step explanation:

[tex]25x^2\: - \:169 = 0 [/tex]

[tex]25x^2 = 169[/tex]

[tex] {x}^{2} = \frac{169}{25} [/tex]

[tex]x = + - \sqrt{ \frac{169}{25} } [/tex]

[tex]x = + - \frac{13}{5} [/tex]

What is the depth of water in a tank with 300,000 gallons of water at 70F when the pressure gauge at the bottom of the tank reads 23 psig?​

Answers

Answer:

53.08 ft

Step-by-step explanation:

The pressure at the bottom of the tank, P = ρgh where ρ = density of water = 1000 kg/m³, g = acceleration due to gravity = 9.8 m/s² and h = depth of water in tank.

Since the pressure at the bottom of the tank, P = ρgh, making h subject of the formula, we have

h = P/ρg

Since P = 23 psig = 23 × 1 psig = 23 × 6894.76 Pa = 158579.48 Pa

Substituting the values of the other variables into h, we have

h = P/ρg

h = 158579.48 Pa/(1000 kg/m³ × 9.8 m/s²)

h = 158579.48 Pa/(9800 kg/m²s²)

h = 16.18 m

h = 16.18 × 1 m

h = 16.18 × 3.28 ft

h = 53.08 ft

7 women can bake 100 cookies in 14 days. How many would it take for 4 women to bake 240 cookies?

Answers

Answer:

it would take 30 and a half days to make 240 cookies

Other Questions
In the event of Yan Limeng, through the publicity attribute of social media, the cultural propaganda offensive from Guo Wengui and Ban Nong made immeasurable loss in the process of resisting the epidemic all over the world. Find the probability of 5 successes in 9 trials of a binomial experiment in which the probability of success in any one trial is 37%. Find the domain of the function. Write the answer in interval notation. Graphic showing the following information, Surveyor, Worked hard, Learned to think logically. British army officer, Quit in response to unfair treatment, Was courageous in battle. Commander in chief of Continental Army, Stayed with his troops, Demanded courage and discipline from his men.Which of these would be an accurate caption for this graphic? George Washington gained valuable knowledge from his terms of military service. George Washington had exceptional mapmaking and military abilities. George Washington's life experiences gave evidence that he would be an excellent president. George Washington's success as president was due to his schooling and military training. The graph shows a journey in a car. Which of the statements most likely describes the journey at the portion of the graph labeled J? The car continues its journey because the portion shows a linear function. The car is waiting at the starting point because the portion shows a constant function. The car is traveling the same distance per unit of time because the portion shows a linear function away from the starting point. The car stops a distance away from the starting point because the portion shows a constant function away from the starting point. It takes to break an carbon-chlorine single bond. Calculate the maximum wavelength of light for which an carbon-chlorine single bond could be broken b qu cosas podemos hacer para no tener enfermedades riesgosas A nation can accelerate its economic growth by a) reducing the number of immigrants allowed into the country b) adding to its capital stock c) printing more money d) imposing tariffs and quotas on imported goods The movement of the progress bar may be uneven because questions can be worth more or less (including zero) depending on your answerWhich sentence correctly compares the two numbers 5.395 and 5.385?05.395 < 5.38505.385 > 5.395o 5.395 = 5.3855.385 < 5.395hSubmitPassDon't know answer Enzymes are _______. Enzymes are _______. made of protein permanently changed by the substrate made of protein, are catalysts, and permanently changed by the substrate made of protein and are catalysts are catalysts pls help Why was the Council Oak treaty so named?A) The treaty was signed at Council Oak, Missouri.B) The treaty was signed under a tree, later called the Council Oak.C) The treaty was signed at a fort named Council Oak.D) The treaty was signed at an oak table. A man with Type B blood has children with a woman with type A blood. Their children have the following blood types, A, AB, B, and O. What are the genotypes of the parents? What would be the genotypes of the parents if the offspring could only have type AB or A blood The works of Joseph Campbell and Otto Rank show that they believed the hero myth is actually written about the struggles of __________ why is the value of g more in terai than in the mountain What is the difference between calculating the area and calculating the perimeter of a rectangle? Which of the following statements helps support the endosymbiotic theory?Choose 1 answer:AAll cells contain ribosomes that conduct protein synthesis.BCells contain genetic information in the form of DNA.If isolated from a eukaryotic cell, mitochondria can no longer survive and reproduce on theirown.If isolated from a plant cell, a chloroplast can survive and reproduce on its own. Question 26 of 30Which of the following is a type of mechanical wave?Check all that apply.A. LongitudinalB. SurfaceO C. TransverseD. Electromagnetic 8. In ABA, which is the best reason why behaviors are targeted for increase?So learners can increase overall skill repertoiresSo learners won't engage in inappropriate behaviorSo skill acquisition programs can be implementedSo individuals will learn functional skills what are life domains You are a student with a demanding schedule of classes. You also work part time and your supervisor allows you to determine your schedule. In this situation, your scarce resource is time . In this situation, you will work: multiple choice 2 enough hours to get the money to pay for school. as much as your boss demands and hope your grades do not suffer. very little so you can enjoy school. enough to earn some money but not too much to jeopardize your grades.