What is the area of polygon XYZ?

What Is The Area Of Polygon XYZ?

Answers

Answer 1

Answer:

B. 36 square units

Step-by-step explanation:

This is a triangle and to calculate the area of a triangle we multiply height with base and that divided by two

The height of this triangle is 8 units and the base is 9 units

9 × 8 ÷ 2 = 36 square units


Related Questions

If Company X has 1600 employees and 80% of those employees have attended the warehouse training course how many employees have yet to attend?

Answers

Answer:

320

Step-by-step explanation:

Total no of employees = 1600

% of employees attended the training = 80%

no. of employee who attended the training = 80/100* 1600 = 1280

No. of employees who are yet to attend the training = Total no of employees - no. of employee who attended the training =  1600-1280 = 320

Thus, 320 employees have yet to attend the training

How much money will you have in 5 years if you invest $9000 at a 5.4% annual rate of interest compounded quarterly? How much will you have if it is compounded monthly?
SHOW YOUR WORK PLEASE:)

Answers

Answer: Amount in 5 years( if compounded quarterly) = $11,768.40

Amount in 5 years( if compounded monthly = $11782.54

Step-by-step explanation:

Formula for accumulated amount in t years at annual rate of r% compounded quarterly: [tex]A=P(1+\dfrac{r}{4})^{4t}[/tex]

Formula for accumulated amount in t years at annual rate of r% compounded monthly: [tex]A=P(1+\dfrac{r}{12})^{12t}[/tex], where P= principal amount.

Given: P= $9000, r= 5.4%= 0.054, t= 5 years

Amount in 5 years if compounded quarterly =[tex]9000(1+\dfrac{0.054}{4})^{4\times5}[/tex]

[tex]=9000(1.0135)^{20}\\\\=9000(1.30760044763)\approx11768.40[/tex]

i.e. Amount in 5 years( if compounded quarterly) = $11,768.40

Amount in 5 years if compounded monthly =[tex]9000(1+\dfrac{0.054}{12})^{12\times5}[/tex]

[tex]=9000(1.0045)^{60}\\\\=9000(1.309171267)\approx11782.54[/tex]

i.e.  Amount in 5 years( if compounded monthly = $11782.54

point estimate A sample of 81 observations is taken from a normal population with a standard deviation of 5. The sample mean is 40. Determine the 95% confidence interval for the population mean

Answers

Answer:

The 95 percent Confidence Interval is for the population is (38.911 , 41.089)

Step-by-step explanation:

To solve the above question, we would be making use of the confidence interval formula:

Confidence Interval = Mean ± z score × σ/√n

In the above question,

Mean = 40

σ = Standard deviation = 5

n = number of samples = 81

Confidence Interval = 95%

The z score for a 95% confidence interval = 1.96

Therefore, the confidence interval =

= 40 ± 1.96 (5/√81)

= 40 ± 1.96(5/9)

= 40 ± 1.0888888889

Confidence Interval

a)40 + 1.0888888889

= 41.0888888889

Approximately = 41.089

b ) 40 - 1.0888888889

= 38.911111111

Approximately = 38.911

Therefore, the 95 percent Confidence Interval is for the population is (38.911 , 41.089)

Which is greater 9/20 or 60%

Answers

Answer:

60%

Step-by-step explanation:

9/20 is 45%

Answer:

60 %

Step-by-step explanation: If you divide 9/20, it equals to 0.45, makes it 45% and the number 45 in general is smaller than 60. Thus, 60% is greater than 9/20. I hope this helps.

A certain family has a husband, wife, son, and daughter. All together they are 68 years old. The husband is 3 years older than the wife, and the son is 3 years older than the daughter. Four years ago, all together the family was 54 years old. How old is the husband now?

Answers

Answer:

32

Step-by-step explanation:

Everyone added together = 68

Four years ago, they were 68 -16 = 52

But the question told 54 years.

So there was a girl who was 2 years.

Girl = 2

Boy = 2 +3 = 5

Husband = 3 +w

Wife =w

3 +w +w + 5 + 2 = 68

10 + 2w = 68

2w = 58

w = 29

Wife = 29

Husband = 29 +3 =32

Husband = 32 years

Answer:

[tex]\large \boxed{\sf \bf \ \ 32 \ \ }[/tex]

Step-by-step explanation:

Hello, please consider the following.

We know that "All together they are 68 years old." and "Four years ago, all together the family was 54 years old."

If all the family was alive four years ago, it means that four years ago the sum of their ages was 68 - 4 - 4 - 4 - 4 because they are four members, so it gives 68 - 16 =52 which is different from 54, right ?

It means that we have the daughter in between, 54- 52 = 2, so the daughter's age is 2, and then the son's age is 5.

The husband is 3 years older than the wife. Let's note W the wife's age, we can write W + 3 + W + 5 + 2 = 68

2 W + 10 = 68

2 W = 68 - 10 = 58 so W = 29

and then the husband's age is 29 + 3 = 32.

And we can verify that 32 + 29 + 5 + 2 = 68, and four years ago, 28 + 25 + 1 + 0 = 54.

Hope this helps.

Do not hesitate if you need further explanation.

Thank you

If “n” is a positive integer divisible by 3 and n is less than or equal to 44, then what is the highest possible value of n?

Answers

Answer:

Step-by-step explanation:

positive integer divisible by 3 includes

3,6,9,12,15,18,21,24,27,30,33,36,39,42,45...

less than highest possible value is 42

Question on Statistics and Confidence Intervals
A field test for a new exam was given to randomly selected seniors. The exams were graded, and the sample mean and sample standard deviation were calculated. Based on the results, the exam creator claims that on the same exam, nine times out of ten, seniors will have an average score within 5% of 75%.
Is the confidence interval at 90%, 95%, or 99%? What is the margin of error? Calculate the confidence interval and explain what it means in terms of the situation. (10 points)

Answers

The phrasing "nine times out of ten" means 9/10 = 0.90 = 90% is the confidence level. We're confident 90% of the time that the confidence interval captures the population parameter we're after (in this case mu = population mean)

The portion "have an average score within 5% of 75%" means that 75% = 0.75 is the center of the confidence interval, and it goes as low as 0.75 - 0.05 = 0.70 and as high as 0.75 + 0.05 = 0.80

This confidence interval is from 70% to 80%, meaning that nine times out of ten, we're confident that the average score is between 70% and 80%

We write the confidence interval as (0.70, 0.80). It's common to use the notation (L, U) to indicate the lower (L) and upper (U) boundaries. You might see the notation in the form L < mu < U. If so, then it would be 0.70 < mu < 0.80; either way they mean the same thing.

The margin of error is 0.05 as its the 5% radius of the interval. It tells us how far the most distant score is from the center (75%)

=========================================

In summary, we have these answers

confidence level = 90%margin of error = 5% = 0.05confidence interval = (0.70, 0.80)interpretation = We're 90% confident that the average exam score is between 0.70 and 0.80

☆ =
MODULE
The length of a rectangle is eight centimeter less than
twice the width. The area of the rectangle is 24
centimeters squared. Determine the dimensions of the
rectangle in centimeters.

Answers

Answer: The length is 4 centimeters and the width is 6 centimeters.

Step-by-step explanation:

If the length of the  rectangle is eight centimeters less than twice the width then we could represent it by the equation L= 2w - 8 .   And we know that to find the area of a rectangle we multiply the length by the width  and they've already given the area  so we will represent the width by w since it is unknown.

Now we know the length is 2w- 8 and the width is w so we would multiply them and set them equal to 24.

w(2w-8) = 24

2[tex]w^{2}[/tex] - 8w = 24     subtract 24 from both sides to set the whole equation equal zero and solve. solve using any method. I will solve by factoring.

2[tex]w^{2}[/tex] - 8w -24 = 0      divide each term by 2.

[tex]w^{2}[/tex] - 4w - 12 = 0          Five two numbers that multiply to get -12 and to -4

[tex]w^{2}[/tex] +2w - 6w - 12 = 0    Group the left hand side and factor.

w(w+2) -6( w + 2) = 0   factor out w+2

(w+2)(w-6) = 0         Set them both equal zero.

w + 2 =0      or w - 6 = 0  

    -2  -2                + 6   +6

w= -2       or   w=6  

Since we are dealing with distance -2 can't represent a distance so the wide has to 6.  

Now it says that the length is 8 less that twice the width.

So  2(6) - 8 = 12 -8 = 4  So the length in this care is 4.

Check.

6 * 4 = 24

24 = 24

Solve for 2 in the diagram below.
45°
150
42°
ea
Stuck? Watch a video or use a hint.

Answers

Step-by-step explanation:

Hi, there!!!

It's so simple..

Let me clear you, alright.

Here, On the fig line, OE is just a confusing line. If you look it in simple way,

AB and CD are interested at a point O.

so, angle AOD and angle COB are equal.{ because they are vertically opposite angle}

so, angle AOD= angle COB

or, 4x°=45°+15°

or, 4x°= 60°

or, x= 60°/4

Therefore, x= 15°.

Hope it helps....

Find the volume of the cylinder. Round your answer to the nearest tenth.

Answers

Answer:

716.75 m^3

Step-by-step explanation:

Volume of a cylinder:

=> PI x R^2 x H

H = Height

R = Radius

=> PI x 3.9^2 x 15

=> PI x 15.21 x 15

=> PI x 228.15

=> 228.15 PI

           or

=> 228.15 x 3.14159

=> 716.75 m^3

Cesium-137 has a half-life of about 30 years. A) Find the annual decay rate and round final result to 4 decimal places. B) Find the continuous decay rate and round final result to 4 decimal places. C) How long will it take for a 10 gram sample to decay to 1 gram? Round to nearest year and interpret your result with a complete sentence. D) Complete this statement: as x goes to infinity, y goes to ___.

Answers

Answer:

0.02280.0231100 years0

Step-by-step explanation:

The exponential equation for the fraction remaining after x years can be written as ...

  y = (1/2)^(x/30)

A) For x=1, the fraction remaining is ...

  y = (1/2)^(1/30) ≈ 0.97716 = 1 - 0.0228

Of the original amount, 0.0228 decays each year.

__

B) The continuous decay rate is the natural log of the growth factor, so is ...

  ln(0.97716) = -0.0231

The continuous decay rate is 0.0231 of the present amount (per year).

__

C) For y=.10 (1/10 of the original amount) we find x to be ...

  .1 = .5^(x/30)

  ln(.1) = (x/30)ln(.5) . . . . . take the natural log

  30ln(0.1)/ln(0.5) = x ≈ 100 . . . years

It will take 100 years for a 10-gram sample to decay to 1 gram.

__

D) As x goes to infinity, y goes to zero.

_____

The relationship between growth rate and growth factor is ...

  growth factor = 1 + growth rate

When the growth rate is negative, it is called a decay rate.

Find the smallest positive integer that satisfies both of the following equations: = 3 (mod4) and = 5 (mod6)

Answers

Answer:

x=3mod4

Means that when x is divided by 4 it gives an unknown integer and a remainder of 3.

x/4 = Z + 3/4

Z= (x-3)/4

Where Z is the integer

x=5 mod6

x/6 = Y + 5/6

Y = (x-5)/6

Where Y is the integer

Z-Y must be an integer on equal to zero

(x-3)/4 - (x-5)/6

3(x-3)/12 - 2(x-5)/12

(3x-9-2x+10)/12

(x+1)/12

If it is equal to 0

x=-1. But x should be positive

If it is equal to 1

x=11

Hence the smallest possible number is 11

PLEASE HELP ME ASAP On a test, the average score of 25 boys and 15 girls is 68 points. The average test score of the boys is 62 points. What is the average score of the girls? SHOW YOUR WORK

Answers

Answer:

74

Step-by-step explanation:

The average score of boys and girls is 68 and boys is 62

Think of it as an equation (62 + x)/2 = 68, where x is the average score of girls

First multiply each side by 2 making the equation 62 + x = 136

Now subtract each side by 62, which will make the average score for girls 74

(x = 74)

Point R divides PG in the ratio 1:3. If the x-coordinate of R is -1 and the x-coordinate of P is -3, what is the x-coordinate of Q

Answers

Answer:

option C . 5

Step-by-step explanation:

For two points (x1,y1) and (x2,y2) divided by a point p in ratio m:n then coordinates of that point is given by

p    :  (nx1+mx2)/(m+n),  (ny1+my2)/(m+n),  

Given

x coordinate of P (-3)

x  coordinate of Q (a) since we have to find it , let it be a

x coordinate of R(-1)\

ratio = 1:3

_______________________________________

Using the above formula to find the point of division

we can get value of x coordinate for point Q

x  coordinate of R = 3*-3 + 1*a/(1+3)

-1 = (-9 + a)/4

=> -4 = -9 +a

=>a = -4+9 = 5

Thus, x  coordinate of Q is 5

Find the value of x to the nearest tenth. A) 5 B) 9.2 C) 3.3 D) 2.9

Answers

Answer:

B) 9.2

Step-by-step explanation:

tan(57)=x/6 multiply 6 on both sides

6.tan(57)=x use calculator to find answer

9.2 rounded

Answer:9.2 is correct

Step-by-step explanation:

What number must be added to the expression below to complete the square? x2-5x

Answers

Answer:

6.25

Step-by-step explanation:

(x-a)^2=x^2-2ax+a^2

2a=5

a=2.5

2.5 ^ 2 = 6.25

For f(x) = 3х – 5 and g(x) = х2+ 2, find (f+ g)(x).
ОА. ? + 3х – 7
ОВ. 3х2 – 30
Ос. 3х3 – 3
OD. х2 + 3х - з

Answers

Answer:

x^2 +3x -3

Step-by-step explanation:

f(x) = 3х – 5

g(x) = х^2+ 2,

(f+g)(x) = 3х – 5 +х^2+ 2

Combine like terms

         = x^2 +3x -3

Jesse bought 3 T-shirts for $6 each and 4 T-shirts for $5 each. What expression can you use to describe what Jesse bought?

Answers

(3x6) + (4x5). Is your answer for this question

The end of a hose was resting on the ground, pointing up an angle. Sal measured the path of the water coming out of the hose and found that it could be modeled using the equation f(x) = –0.3x2 + 2x, where f(x) is the height of the path of the water above the ground, in feet, and x is the horizontal distance of the path of the water from the end of the hose, in feet. When the water was 4 feet from the end of the hose, what was its height above the ground? 3.2 feet 4.8 feet 5.6 feet 6.8 feet

Answers

Answer: 3.2 feet.

Step-by-step explanation:

Given: The end of a hose was resting on the ground, pointing up an angle. Sal measured the path of the water coming out of the hose and found that it could be modeled using the equation[tex]f(x) = -0.3x^2 + 2x[/tex], where [tex]f(x)[/tex] is the height of the path of the water above the ground, in feet, and [tex]x[/tex] is the horizontal distance of the path of the water from the end of the hose, in feet.

At x= 4 , we get

[tex]f(x) = -0.3(4)^2 + 2(4)=-0.3(16)+8 =-4.8+8=3.2[/tex]

Hence, when the water was 4 feet from the end of the hose,  its height above the ground is 3.2 feet.

Answer:

3.2 feet.

Step-by-step explanation:

PLEASE HELP FOR 70 POINTS!!!!!! Maria and Jackson like in adjacent neighborhoods. If they superimpose a coordinate grid on the map of their neighborhoods, Maria lives at (–9, 1) and Jackson lives at (5, –4). Each unit on the grid is equal to approximately 0.132 mile. 8. How far apart do Maria and Jackson live to the nearest thousandth? 9. If April lives equidistant to both Maria and Jackson, at what coordinate on the grid would she live? 10. How far apart would Maria and April live to the nearest thousandth?

Answers

Answer:

8)  1.962 miles

9)  (-2, -1.5)

10) 0.515 miles

Step-by-step explanation:

√(-9 - 5)² + (1 - -4)² = 14.866

14.866 x .132 = 1.962

(-9+5)/2, (1 + -4)/2

-4/2, -3/2

-2, -3/2

√(-2 - 1)² + (-3/2 - -4)² = 3.905

3.905 x .132 = 0.515 miles

what are the like terms of the expression.
3x+8x+y+x+8

Answers

Answer:

the like terms are:

3x+8x+x+y+8

12x+y+8

Answer:

The like terms are

3x, 8x, x

Step-by-step explanation:

3x+8x+y+x+8

The like terms are

3x, 8x, x

They are the terms that are in terms of the first power of x

Help us plazz this is mathematics IGCSE fast as you can​

Answers

Answer:

Step-by-step explanation:

y varies direcrtly with √(x+5) wich can be expressed mathematically as:

● y = k*√(x+5)

Let's calculate k khowing that y=4 and x=-1

● 4 = k*√(-1+5)

● 4 = k*√(4)

● 4 = k * 2

● k = 4/2

● k = 2

■■■■■■■■■■■■■■■■■■■■■■■■■■

Let's calculate y khowing that x = 11

● y = k*√(x+5)

● y = 2×√(11+5)

● y = 2× √(16)

● y = 2× 4

● y = 8

Answer:

The value of y is 8.

Step-by-step explanation:

Given that y is directly proportional to √(x+5) so the equation is y = k√(x+5) where k is constant. First, you have to find the value of k with given values :

[tex]y = k \sqrt{x + 5} [/tex]

[tex]let \: x = - 1,y = 4[/tex]

[tex]4 = k \sqrt{ - 1 + 5} [/tex]

[tex]4 = k \sqrt{4} [/tex]

[tex]4 = k(2)[/tex]

[tex]4 \div 2 = k[/tex]

[tex]k = 2[/tex]

So the equation is y = 2√(x+5). In order to find the value of y, you have to substitute x = 11 into the equation :

[tex]y = 2 \sqrt{x + 5} [/tex]

[tex]let \: x = 11[/tex]

[tex]y = 2 \sqrt{11 + 5} [/tex]

[tex]y = 2 \sqrt{16} [/tex]

[tex]y = 2(4)[/tex]

[tex]y = 8[/tex]

plz someone help me with this question

Answers

Answer:

(x+3)^2=-4(y-3)

Step-by-step explanation:

(x-h)^2 = 4p(y-k)

P is the distance between the focus and vertex

P = 1 --> used distance formula for the points of -3,2 -3,3

Vertex is -3,3 --> according to picture

(x+3)^2=-4(y-3)

P is negative since it goes downwards in the picture.

In a recent survey of drinking laws, a random sample of 1000 women showed that 65% were in favor of increasing the legal drinking age. In a random sample of 1000 men, 60% favored increasing the legal drinking age. Test the claim that the percentage of men and women favoring a higher legal drinking age is different at (alpha 0.05).

Answers

Answer:

Step-by-step explanation:

Given that:

Let sample size of women be [tex]n_1[/tex]  = 1000

Let the proportion of the women be [tex]p_1[/tex] = 0.65

Let the sample size of the men be [tex]n_2[/tex] = 1000

Let the proportion of the mem be [tex]p_2[/tex]  = 0.60

The null and the alternative hypothesis can be computed as follows:

[tex]H_0: p_1 = p_2[/tex]

[tex]H_0a: p_1 \neq p_2[/tex]

Thus from the alternative hypothesis we can realize that this is a two tailed test.

However, the pooled sample proportion p = [tex]\dfrac{p_1n_1+p_2n_2 } {n_1 +n_2}[/tex]

p =[tex]\dfrac{0.65 * 1000+0.60*1000 } {1000 +1000}[/tex]

p = [tex]\dfrac{650+600 } {2000}[/tex]

p = 0.625

The standard error of the test can be computed as follows:

[tex]SE = \sqrt{p(1-p) ( \dfrac{1} {n_1}+ \dfrac{1}{n_2} )}[/tex]

[tex]SE = \sqrt{0.625(1-0.625) ( \dfrac{1} {1000}+ \dfrac{1}{1000} )}[/tex]

[tex]SE = \sqrt{0.625(0.375) ( 0.001+0.001 )}[/tex]

[tex]SE = \sqrt{0.234375 (0.002)}[/tex]

[tex]SE = \sqrt{4.6875 * 10^{-4}}[/tex]

[tex]SE = 0.02165[/tex]

The test statistics is :

[tex]z =\dfrac{p_1-p_2}{S.E}[/tex]

[tex]z =\dfrac{0.65-0.60}{0.02165}[/tex]

[tex]z =\dfrac{0.05}{0.02165}[/tex]

[tex]z =2.31[/tex]

At level of significance of 0.05  the critical value for the z test will  be in the region between - 1.96 and 1.96

Rejection region: To reject the null hypothesis if z < -1.96 or z > 1.96

Conclusion: Since the value of z is greater than 1.96, it lies in the region region. Therefore we reject the null hypothesis and we conclude that  the percentage of men and women favoring a higher legal drinking age is different.

Can someone please help me ASAP:(

Answers

Answer:

3 =x

Step-by-step explanation:

(segment piece) x (segment piece) =   (segment piece) x (segment piece)

3x(x+1) = 4x*x

Divide each side by x

3(x+1) = 4x

Distribute

3x+3 = 4x

Subtract 3x from each side

3x-3x +3 = 4x-3x

3 =x

HELP PRECALC NEED IN PROOF FORM

Answers

Hello, please consider the following.

We know the following, right ?

[tex](\forall a, b \in \mathbb{R}) \left( sin(a+b)=sin(a)sin(b)+cos(a)cos(b) \right)[/tex]

So, here, it gives.

[tex]Asin(\omega t+\phi)=Asin(\phi){\sf \bf sin(\omega t)}+Acos(\phi){\sf \bf cos(\omega t)}\\\\=c_2{\sf \bf sin(\omega t)}+c_1{\sf \bf cos(\omega t)}\\\\\text{ *** where }c_2=Asin(\phi) \text{ and } c_1=Acos(\phi) \text{ ***}[/tex]

Do not hesitate if you need further explanation.


There are 937 entries for a talent show.
What is the value of the 3?

Answers

Answer:

the value of the 3 is 30

Step-by-step explanation:

the second digit to the left of a decimal is always tens column

Complete the square: x2+7x+?=(x+?)2

Answers

Answer:

x² + 7x + 49/4 = (x + 7/2)²

Step-by-step explanation:

x² + bx + c is a perfect square when c = (b/2)².

b = 7, c = (7/2)² = 49/4.

x² + 7x + 49/4 = (x + 7/2)²

Answer:

x² + 7x + 12.25 = (x+3.5)²

Step-by-step explanation:

(a+b)² = a²+ 2ab + b²

then:

7x = 2ab

7/2 = 3.5

then:

(x+3.5)² = x² + 2*3.5*a + 3.5²

x² + 7x + 12.25 = (x+3.5)²

1/3 of a shipment of books weights 28 pounds

Answers

Answer:

84 pounds

Step-by-step explanation:

If 1/3 of a book is equal to 28 pounds then 28*3 will give you your answer

Help please!!! Tyyyyy

Answers

Answer:

D) 60 degree

Step-by-step explanation:

Let's connect the remaining diagonal, which forms a triangle containing angle x.

As a property of regular hexagon, all diagonals are equal.

=> The formed triangle is a regular triangle and it has three equal angles, which are 60 degrees.

Other Questions
What element is being reduced in the following redox reaction? MnO4-(aq) + H2C2O4(aq) Mn2+(aq) + CO2(g) What element is being reduced in the following redox reaction? MnO4-(aq) + H2C2O4(aq) Mn2+(aq) + CO2(g) H O Mn C Which of the following is not a potential problem of using more nuclearenergy?O A. Cost to build a nuclear plant is very highOB. Spent nuclear fuel is dangerous if handled wrongO C. The cost of nuclear fuel is very lowO D. Most nuclear plants can only operate for 30 - 40 years. Hola como estan les quiero decir que los quiero mucho a todos gracias por su ayuda gracias por todo que dios los bendiga mucho a todos ustedes y que dios le este dando inteligencia y sabidura cada da ms en sus estudios y les quiero decir que los amo a todosu ustedes con el amor de cristo yo no soy catlica soy cristiana gracias por su ayuda y apesar de la distancia y aunque no los conozco los quiero los amo con el amor de cristo. Que dios los bendiga y mucho . Explain some of the basic principles of cost management, such as profits, life cycle cost, tangible and intangible costs and benefits, direct and indirect costs, and Reserves. a quarter of the sum of a number and 87 pls help me if S( 1, 2, 3, 4, 5,6 ) find the probability that a number chosen is more than 4 Which submersible vessel has been used deep-sea research Find the measure of a.A. 60B. 57C. 40D. 80 3) Find f(3) for the function below.f(x) = 2x 3x When solving the system of equations by graphing, what is the solution of 3x + 2y = 2 and 2x y=6?A (-2,2)B. (2.-2)C. (-2,-2)D. (2, 2) What is the value of a perpetuity that pays $100 every 3 months forever? The interest rate quoted on an APR basis is 6%. plz answer this asap kofi and kweku are two brothers. Kofi is older than kweku. Given that kofi's age is (5x-4) years and kweku's age is (2x+1) years.a. write down an expression, interns of x,for how much old is Kofi than kweku.b. if Kofi is tens years older than kweku, find the value of x and the ages of Kofi and kweku Ikyume is 62m away from Amadi, on a bearing of 012. Becky is 42m away from Ikyume and on bearing of 082. How far is Amadi from Becky, and on what bearing? What grade of sprain is a completely torn ligament? grade I grade II grade III grade IV Granger Inc. Comparative Balance Sheets December 31Assets 2017 2016Cash $80,800 $48,400Accounts receivable 87,800 38,000Inventory 112,500 102,850Prepaid expenses 28,400 26,000Long-term investments 138,000 109,000Plant assets 285,000 242,500Accumulated depreciation (50,000) (52,000)Total $682,500 $514,750Liabilities and Stockholders' Equity Accounts payable $102,000 $67,300Accrued expenses payable 16,500 21,000Bonds payable 110,000 146,000Common stock 220,000 175,000Retained earnings 234,000 105,450Total $682,500 $514,750Granger Inc. Income Statement Data For the Year Ended December 31, 2017Sales revenue $388,460Less: Cost of goods sold $135,460 Operating expenses, excluding depreciation 12,410 Depreciation expense 46,500 Income tax expense 27,280 Interest expense 4,730 Loss on disposal of plant assets 7,500 233,880Net income $154,580Additional information: 1. New plant assets costing $90,000 were purchased for cash during the year. 2. Old plant assets having an original cost of $51,750 and accumulated depreciation of $43,650 were sold for $1,350 cash. 3. Bonds payable matured and were paid off at face value for cash. 4. A cash dividend of $23,427 was declared and paid during the year.Required:Prepare a statement of cash flows for Granger Inc. using the direct method. How did West African slavery differ from the kind of slavery that developed in the Americas? HELP ME PLEASE ASAP! Zoe is making a quilt. The ratio of red squares to green squares is 2 to 3. She uses a total of 55 squares. How many green squares does she use? Helpppp pleaseee!!! Thank you "A mutual fund manager of a "high technology" fund feels that the market for this sector will remain flat in the next coming months and he wishes to generate some additional income against his portfolio. The best strategy is to sell:"