What is bond energy

What Is Bond Energy

Answers

Answer 1
Bond energy is a measure of the bond strength of a chemical bond, and is the amount of energy needed to break the atoms involved in a molecular bond into free atoms.

Related Questions

bio-chemisty of protain​

Answers

Answer:

Protein biochemistry is the study of proteins. Protein biochemistry is a scientific field dedicated to the study of proteins, complex chains of amino acids which make up the building blocks of all living organisms.

Explanation:

I hope that helped

Copy and Pasted!

Answer:

Listen to what guy said on top.

Explanation:

polypeptide structures consisting of one or more long chains of amino acids residue.....

or my answer

True or false: Boron contains 2s22p1 valence electrons, so only one p orbital is needed to form molecular orbitals.

Answers

Answer:

True

Explanation:

The valence orbitals of boron are 2s2 2p1. We have to recall that all the valence orbitals whether full or empty are involved in the formation of molecular orbitals.

The number of molecular orbitals formed is equal to the number of atomic orbitals that are combined.

Since there are two valence orbitals and there is only one p orbital among the valence orbitals, it is true that only one p orbital is needed to form molecular orbitals in boron.

En la fermentación del alcohol, la levadura convierte la glucosa en etanol y dióxido de carbono:
C6H12O6(s) → 2C2H5OH(l) + 2CO2(g)
Si reaccionan 5.97 g de glucosa y se recolectan 1.44 L de CO2 gaseoso, a 293 K y 0.984 atm, ¿cuál
es el rendimiento porcentual de la reacción

Answers

Answer:

88.9%

Explanation:

Primero convertimos 5.97 g de glucosa a moles, usando su masa molar:

5.97 g ÷ 180 g/mol = 0.0332 mol

Después calculamos la cantidad máxima de moles de CO₂ que se hubieran podido producir:

0.0332 mol C₆H₁₂O₆ * [tex]\frac{2molCO_2}{1molC_6H_{12}O_6}[/tex] = 0.0664 mol CO₂

Ahora calculamos los moles de CO₂ producidos, usando los datos de recolección dados y la ecuación PV=nRT:

0.984 atm * 1.44 L = n * 0.082 atm·L·mol⁻¹·K⁻¹ * 293 Kn = 0.0590 mol

Finalmente calculamos el rendimiento porcentual:

0.0590 mol / 0.0664 mol * 100% = 88.9%

Que es la actividad física y en qué mejora

Answers

La actividad física regular puede mejorar su fuerza muscular y aumentar su resistencia. El ejercicio proporciona oxígeno y nutrientes a sus tejidos y ayuda a que su sistema cardiovascular funcione de manera más eficiente. Y cuando la salud de su corazón y pulmones mejoran, tiene más energía para hacer frente a las tareas diarias. Encantado de ayudarle

You are asked to prepare a buffer solution with a pH of 3.50. The following solutions, all 0.100 M, are available to you: HCOOH, CH3COOH, H3PO4 , NaCHOO, NaCH3COO, and NaH2PO4.  What would be the best combination to make the required buffer solution? Select one:
a. NaH2PO4 and NaCHOO  
b. H3PO4 and NaH2PO4
c. NaH2PO4 and HCOOH
d. CH3COOH and NaCH3COO e. HCOOH and NaCHOO
can someone helo me with this​

Answers

Answer:

e. HCOOH and NaCHOO

Explanation:

For a buffer solution, both an acid and its conjugate base are required.

With the information above in mind, we can discard options a) and c), as those combinations are not of an acid and its conjugate base.

Now it is a matter of comparing the pKa (found in literature tables) of the acids of the remaining three acids:

H₃PO₄ pKa = 2.12CH₃COOH pKa = 2.8HCOOH pKa = 3.74

The acid with the pKa closest to the desired pH is HCOOH, so the correct answer is e. HCOOH and NaCHOO

Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these

Answers

Answer:

b. glass and charcoal

Explanation:

Step 1: Given data

Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mL

Step 2: Determine which material will float in molten lead

Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.

Identify the options below that are results of adding a catalyst to a chemical system.
The reaction rates are increased.
The reaction quotient is unaffected.
The reaction quotient decreases.
The equilibrium constant is unaffected.

Answers

Answer:

The correct options are a, b and d

Explanation:

A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's  principle explains how a substance or an "action" can affect a reaction in equilibrium.

The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.

However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).

The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.

What is a catalyst?

A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.

The catalyst takes part in the reaction but did not consume in the chemical reaction.

The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.

Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.

Learn more about catalysts, here:

https://brainly.com/question/17052831

Liquid octane will react with gaseous oxygen to produce gaseous carbon dioxide and gaseous water . Suppose 10.3 g of octane is mixed with 23. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to significant digits.

Answers

Answer:

9.36 g

Explanation:

The equation of the reaction is;

C8H18(g) + 25/2 O2(g) ----> 8CO2(g) + 9H2O(g)

Number of moles of octane = 10.3g/ 114 g/mol = 0.09 moles

1 mole of octane yields 9 moles of water

0.09 moles of octane yields 0.09 × 9/1 = 0.81 moles of water

Number of moles of oxygen = 23g/32g/mol = 0.72 moles

12.5 moles of oxygen yields 9 moles of water

0.72 moles of oxygen yields 0.72 × 9/12.5 = 0.52 moles of water

Hence oxygen is the limiting reactant;

Maximum mass of water produced = 0.52 moles of water × 18 g/mol = 9.36 g

Indicate how the concentration of each species in the chemical equation will change to reestablish equilibrium after reactant or product is added.

2CO(g) + O2(g) ⇌ 2CO2

Answers

Answer:

Indicate how the concentration of each species in the chemical equation will change to reestablish equilibrium after reactant or product is added.

[tex]2CO(g) + O2(g) <=> 2CO2[/tex]

Explanation:

When the reactants concentration increases, then the equilibrium will shift towards products and when the concentration of products increases, then equilibrium will shift towards reactants.

So, increases in concentration of carbon monoxide (CO) shifts the equilibrium to favor the formation of carbondioxide.

Similarly increase in concentration of oxygen also favor the formation of product carbon dioxide.

Increase in concentration of CO2 favors the formation of CO and O2.

Decrease in product concentration also favors the formation of product.

Decrease in reactant concentration favors the formation of reactants only.


A scientific hypothesis is
ANSWER:
predictive.
testable.
explanatory.
all of the above.

Answers

Answer:

All of the above.

Explanation:

For a scientific hypothesis to be considered a hypothesis, it has to be testable. When conducting a lab experiment, it also allows the tester to predict what might occur during and after the experimentation. They are also explanatory. For example, theories are hypotheses that have been verified and can explain why something in nature takes place.

PLEASE HELP!!

How does temperature, agitation, and particle size affect solubility?

Answers

Answer:

At higher temperatures, particles move faster and collide more, increasing solubility rates.

Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute

The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.

Explanation:

what is the machine used to check melting point called?​

Answers

Answer:

Melting-point apparatus

The metal tantalum becomes superconducting at temperatures below 4.483 K. Calculate the temperature at which tantalum becomes superconducting in degrees Celsius.

Answers

Answer:

The correct answer is "-268.667°C".

Explanation:

Given:

Temperature,

= 4.483 K (below)

Now,

The formula of temperature conversion will be:

⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]

By putting the values, we get

⇒            [tex]=4.483-273.15[/tex]

⇒            [tex]=-268.667^{\circ} C[/tex]

Thus the above is the correct answer.

If 0.250 L of a 5.90 M HNO₃ solution is diluted to 2.00 L, what is the molarity of the new solution?

Answers

Answer:

0.74 M

Explanation:

From the question given above, the following data were obtained:

Molarity of stock solution (M₁) = 5.90 M

Volume of stock solution (V₁) = 0.250 L

Volume of diluted solution (V₂) = 2 L

Molarity of diluted solution (M₂) =?

The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:

M₁V₁ = M₂V₂

5.90 × 0.250 = M₂ × 2

1.475 = M₂ × 2

Divide both side by 2

M₂ = 1.475 / 2

M₂ = 0.74 M

Thus, the molarity of the diluted solution is 0.74 M

Write the number of sig. fig. in four numbers given in the sentence below. An (one) octopus has 8 legs. 13 octopi have 104 legs.
Give four answers.
A. Infinity, Infinity, Infinity, Infinity
B. 1, 1, 2, 3
C. Infinity, Infinity, 2, 3
D. No answer text provided.​

Answers

Answer:

1, 1, 2, 3

Explanation:

The numbers 1 and 8 both have 1 sig. fig.

The number 13 has 2 sig. figs.

The number 104 has 3 sig. figs.

For the following reaction, 11.6 grams of sulfur are allowed to react with 23.8 grams of carbon monoxide .

sulfur(s) + carbon monoxide(g) sulfur dioxide(g) + carbon(s)

What is the maximum amount of sulfur dioxide that can be formed?

What is the formula for the limiting reagent?

What amount of the excess reagent remains after the reaction is complete?

Answers

Answer:

S + 2CO = SO2 + 2C

First, look for the amount of substance of sulfur:

n(S) = m / M

n(S) = 14.8 g/32 g / mol = 0.4625 mol

n(CO) = m (CO) / M (CO)

M(CO) = 12 + 16 = 28 g/mol

n(CO) = 19.9 g/28 g/mol = 0.71 mol

S in excess, so for calculating we take CO:

n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol

m(SO2) = M(SO2)*n(SO2)

M(SO2) = 32 + 16*2 = 64 g/mol

m(SO2) = 64 g/mol * 0.355 mol = 22.74 g

4.005 X 74 X 0.007 = 2.10049

Answers

Answer:

2.07459

Explanation:

this is the correct answer.

If 12.3 g of Cu is deposited at the cathode of an electrolytic cell after 5.50 h, what was the current used?​

Answers

Answer:

1.88 A

Explanation:

Let's consider the reduction of copper in an electrolytic cell.

Cu²⁺ + 2 e⁻ ⇒ Cu

We can calculate the charge used to deposit 12.3 g of Cu using the following relations.

The molar mass of Cu is 63.55 g/mol.1 mole of Cu is deposited when 2 moles of electrons circulate.1 mole of electrons has a charge of 96486 C (Faraday's constant).

The charge used is:

[tex]12.3 g \times \frac{1 molCu}{63.55gCu} \times \frac{2molElectron}{1molCu} \times \frac{96486C}{1molElectron} = 3.73 \times 10^{4} C[/tex]

We can convert 5.50 h to seconds using the conversion factor 1 h = 3600 s.

5.50 h × 3600 s/1 h = 1.98 × 10⁴ s

The current used is:

I = q/t = 3.73 × 10⁴ C/1.98 × 10⁴ s = 1.88 A

Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.

a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O

Answers

the answer is option c

The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

What is the Urms?

The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.

Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

Learnmore about Urms: https://brainly.com/question/365923

Suppose you ran this reaction without triethylamine and simply used an excess of reactant 1. At the end of the reaction, your methylene chloride solution would contain mostly reactant 1 and the product. What would you do to remove reactant 1 from the solution

Answers

ummm is that chemistry?

Answer:

is this chem

Explanation:

write any two things that should be remembered while writing chemical equation​

Answers

Answer:

the product and the reactant must be balanced

if u are required to give the mechanism if the reaction it must be written

1.rain pours from the sky
2.leaves of the plant dried
3.fluffy clouds form in the sky
4.bathing suit dries after swim
5.water puddles disappear

A.Evaporation
B.Condensation
C.Precipitation
D.Transpiration
Yan po pag pipilian

Answers

Answer:

1.Precipitation

2.Transpiration

3.Condensation

4.Evaporation

5.Evaporation

3.Condensation

Explanation:

Rain pours from the sky occurs due to the process of precipitation, leaves of the plant dried due to the process of transpiration in which the water is evaporated from the body of plant, fluffy clouds form in the sky occurs in the process of condensation, bathing suit dries after swim is due to evaporation in which water is removed and goes into the atmosphere and water puddles disappear due to the process of evaporation. Evaporation is the removal of water from the any surface whereas transpiration is the removal of water from plant body parts.

What are the uses of Sulphuric acid?

Answers

Answer:

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:

Answers

Answer:

Calculate the moles of N2 molecules in 3.94 grams of nitrogen.

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.

Explanation:

Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT

Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol

Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:

3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:

5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.

Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.

a. True
b. Flase

Answers

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Answers

Answer:

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Explanation:

According to IUPAC rules, the name of a compound is:

Prefix+root word+suffix

1) Select the longest carbon chain and it gives the root word.

2) The substituents give the prefix.

3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.

The structure of the given compounds are shown below:

the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces​

Answers

Answer:

d. van der waals force

Explanation:

Van der Waals force :

the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.

Which equation obeys the law of conservation of
mass?

Answers

Answer:2C4H10+2C12+12O2 4CO2+CC14+H20

A quantity of 1.435 g of naphthalene , was burned in a constant-volume bomb calorimeter. Consequently, the temperature of the water rose from 20.28oC to 25.95oC If the heat capacity of the bomb plus water was , calculate the heat of combustion of naphthalene on a molar basis; that is, find the molar heat of combustion.

Answers

Answer:

molar heat of combustion = -5156 *10³ kJ/mol

Explanation:

A quantity of 1.435 g of naphthalene , was burned in a constant-volume bomb calorimeter. Consequently, the temperature of the water rose from 20.28oC to 25.95oC If the heat capacity of the bomb plus water was 10.17 kJ/°C, calculate the heat of combustion of naphthalene on a molar basis; that is, find the molar heat of combustion.

Step 1: Data given

Mass of naphthalene = 1.435 grams

Initial temperature of water = 20.28 °C

Final temperature of water = 25.95 °C

heat capacity of the bomb plus water was 10.17 kJ/°C

Molar mass naphtalene = 128.2 g/mol

Step 2:

Qcal = Ccal * ΔT

⇒with Qcal =the heat of combustion

⇒with Ccal = heat capacity of the bomb plus water = 10.17 kJ/°C

⇒with ΔT = the difference in temperature = T2 - T1 = 25.95 - 20.28 = 5.67°C

Qcal = 10.17 kJ/°C * 5.67 °C

Qcal = 57.7 kJ

Step 3: Calculate moles

Moles naphthalene = 1.435 grams / 128.2 g/mol

Moles naphthalene = 0.01119 moles

Step 4: Calculate the molar heat of combustion

molar heat of combustion = Qcal/ moles

molar heat of combustion = -57.7 kJ/ 0.01119 moles

molar heat of combustion = -5156 *10³ kJ/mol

What is the difference between conjugate acid-base pair?

a. a H atom. c. a mole water
b. a H+ ion d. a OH– ion​

Answers

Answer:

b. a H+ ion

Explanation:

The concept of conjugate acid-base pair is related to Bronsted-Lowry acid-base theory and according to this theory, acid is a proton acceptor.

In short,

conjugate base is formed when an acid donates a proton.

conjugate acid is formed when a base accepts a proton.

Other Questions
Marvelous Motor Works sells vehicles directly to businesses for use in their companies. Marvelous Motor Works has a manager for each type of vehicle it sells (cars, trucks, and delivery vehicles). The salespeople for each product report directly to his or her manager but may also consult the financing department and legal department to handle issues relating to financing and liability issues. This is an example of a(n) ______ organization. Graph the linear function described by the equation 2Select the correct text in the passage.Maya is creating a podcast for the local arts council. Which text in the script describes the purpose of Maya's podcast?(Welcome, art lovers and artists! )(Here with me today is Miguel Rodriguez, the award-winning film director and artist from San Francisco). (Today,we'll be discussing Mr. Rodriguez's new urban art project. )(This exciting new project puts the spotlight on city landscapes, celebrating their ability to transform concrete blocks into artistic masterpieces.) A gymnast falls from a height onto a trampoline. For a moment, both the gymnasts kinetic energy and gravitational potential energy are zero. How is the gymnasts mechanical energy stored for that moment? Question 12 options: rest energy chemical energy elastic energy thermal energy En argentina exista una ley pequea que sealaba uno de los requisitos para ser maestro de escuela era medir al menos 1.60 m fue hasta 1981 que una resolucin del ministerio de educacin exigi eliminarla lo cual ocurri en 1984 que opinas de la situacin anterior ? Help pls, can you solve for x? Sugar is added to water and initially completely dissolves, but eventually solid sugar collects on the bottom of the container. Sugar and water are ________partially miscible . This produces a dynamic equilibrium. Ethanol (a liquid) is added to water and only a single layer is observed no matter how much ethanol is added. Ethanol and water are__________ Select the correct answer.Which of the following would be violated if the United States were to annex Cuba following a conflict between the two countries? Why is keeping a journal about what is good and bad regarding your summer or part-time work a good idea to help you choose a career path 1. Which of the following species exhibit tetrahedral geometry? a. CCl4 b. PCI5 c. NH3 d. CO2 2. Which statement correctly describes the Valence Shell Electron Pair Repulsion (VSEPR) Theory? The valence electron pairs are__________. a. The valence electron pairs are given by the group number in the periodic table. b. The valence electron pairs are the outermost electrons of the atom that areinvolved in the bonding. c. The valence electron pairs repel one another and tend to stay as far apart aspossible. d. The valence electron pairs are the lone pairs of the atom. 3. Which of the following statements about resonance is TRUE? I. Resonance hybrids occur because a compound changes back and forth between two or more resonancestructures II. Resonance structures differ in the arrangement of electrons but not in the arrangement of atoms. III. Resonance hybrids contain delocalized electrons. IV. Resonance structures for a given compound always contribute equally to the resonance hybrid. V. Resonance structures occur when there are two or more valid Lewis structures for a given compound. VI. Resonance hybrids are a composite of resonance structures. a.I, II, V, VI b. II, III, IV, VI c. II, III, V, VI d. II, IV, V, VI 4. How many resonance forms will nitrate ion (NO3) have? a. - 1 b. 1 c. 2 d. 3 5. What is the first noble gas? a. Xenon b. Radon c. Helium d. Krypton 6. What is the principle used for filling of atomic orbitals? a. Azimithual Principle b. Hund's Principle c. Pauling's Exclusion Principle d. Aufbau Principle 7. How many electrons can "m" shell accommodate? a. 16 b. 17 c. 18 d. 19 8. What number of shells used for the accommodation of electrons in an atom? a. one b. two c. three d. four 9. What distribution does the electron configuration describe? a. protons b. neutrons c. electrons d. ions 10. How many total electrons can the "p" orbitals hold? a. 3 b. 1 c. 7 d. 6 11. Who are the founding fathers of Quantum Mechanics? a. Werner Karl Heisenberg b. Isaac Newton c. Erwin Schrodinger d. a and c 12. There are _types of quantum numbers. a. 2 b. 4 c. 5 d. 7 13. Which of the following elements can only form one bond in a Lewis structure? a. H b. O c. Al d. N 14. Which rule states that electron will go into empty orbitals of the same energy before entering into an orbital with an electron present? a. Hand's rule b. Hund's rule c. Pauli Exclusion Principle d. Aufbau Principle 15. What is the definition of diamagnetic atom? a. An atom where all of the electrons are paired b. An atom where some of the electrons are paired. c. An atom where none of the electrons are paired. d. An atom attracted to a magnetic field. Which text is the main idea of this paragraph? Although many people are afraid of spiders, spiders actually help humans in many ways. For one thing, they eat a lot of smaller insects. In fact, they eat more insects than birds do, including ones that are too small for birds to find. Some of these insects carry diseases that are harmful to humans. By eating the insects, spiders prevent the diseases from spreading to humans. Some spider venom has also been known to help humans by preventing brain damage in people who have a stroke. help fast pls i need it Please give me a 100% correct answerA ship sailed 30 kilometers in 172 hours. What was its rate in kilometers per hour? (1) 20 (2) 30 (3) 45 (4) 90 (5) Not enough information is given. A field book is a private notepad used by a surveyor to transcribe notes and is not considered a legal document True False Please can someone work this out please it would reallly help What is one theme of "To Build a Fire" by Jack London?A. A man travels by foot along a trail in the snow.B. Weather can impede a person's ability to travel.C. Relying on intelligence is better than relying on instinct.D. Depending on others is critical to survival. Below is a mature eukaryotic mRNA transcript. Translate this mRNA into a protein, also showing the tRNA anticodons involved. Make sure you start and end translation in the right place! Label the ends of the polypeptide chain as N and C terminus.mRNA: 5'GMUUACAUGCGGCUCAGUUGAGGCGAAAAAA 3' tRNA: amino acids: A magazine reports that women trust recommendations from a particular social networking site more than recommendations from any other social network platform. But does trust in this social networking site differ by gender Joshua has been working as a project manager in an information technology company for three years. Martha is a delivery team lead in the same company. When the company receives a project that has to be completed in a short span of time, Joshua decides to increase the daily work hours of the delivery team to accommodate the project. Martha, however, insists that Joshua request the client for a time extension. Not willing to reach an agreement, Joshua and Martha ignore each other's opinions and begin working on the project individually. Which of the following conflict-handling intentions does this scenario portray? Collaborating Accommodating Avoiding Compromising 3. I am now becoming an elephant, gaining every week pounds by pounds. *connotativedenotative1. What is the meaning of connotation? *Emotional meaning of a wordOfficial meaning of a wordAn emotional outburstRefers to emotional atmosphere produced by an authors use of language2. What is the meaning of denotation? *it represents something elsethe art of lasagna makingthe emotion of a wordthe official meaning of a word4. Twilight _____ the light from the sky at the end of the day when night is just beginning. *denotesconnotes5. The teachers kingdom include thirty-seven smart and intelligent pupils and a conducive classroom. *denotativeconnotative