Area = length x width
Area = 21 square cm
Width = x
Length = 3x + 2
21 = 3x+ 2 * x
21 = 3x ^2 + 2x
Subtract 21 from both sides:
3x^2 + 2x -21 = 0
Use the quadratic formula to solve for x:
-2 +/- sqrt(2^2-4*3(-21))/(2*3)
X = 7/3 and -3
A dimension can’t be a negative value so x needs to be 7/3
Width = x = 7/3 = 2 1/3 cm
Length = 3(7/3) + 2 = 9 cm
Check: 9 x 2 1/3 = 21
Dimensions: width 2 1/3 cm length 9 cm
Answer:
The dimensions of the rectangle are 7 by 3 centimeters.
Step-by-step explanation:
We are given that the length of a rectangle is two centimeters less than three times its width. In other words:
[tex]\displaystyle \ell = 3w-2[/tex]
Given that the area of the rectangle is 21 square centimeters, we want to determine the dimensions of the rectangle.
Recall that the area of a rectangle is given by:
[tex]A= w\ell[/tex]
Substitute:
[tex](21)=w(3w-2)[/tex]
Solve foro the width. Distribute:
[tex]3w^2-2w=21[/tex]
Isolate the equation:
[tex]3w^2-2w-21=0[/tex]
Factor. Find two numbers that multiply to 3(-21) = -63 and add to -2.
-9 and 7 suffice. Hence:
[tex]3w^2-9w+7w-21=0 \\ \\ 3w(w-3)+7(w-3) = 0 \\ \\ (3w+7)(w-3)=0[/tex]
Zero Product Property:
[tex]3w+7=0\text{ or } w-3=0[/tex]
Solve for each case. Hence:
[tex]\displaystyle w = -\frac{7}{3}\text{ or } w=3[/tex]
Since width cannot be negative, we can ignore the first solution.
Therefore, our width is three centimeters.
And since the length is two less than three times the width, the length is:
[tex]\ell = 3(3) - 2 = 7[/tex]
The dimensions of the rectangle are 7 by 3 centimeters.
look at the image below
Answer:
201.1 km²
Step-by-step explanation:
Surface area of a sphere= 4πr², where r = radius
so,
4πr²
= 4×π×4²
= 64π
= 201.1 km² (rounded to the nearest tenth)
Start with the number 2380.
Divide by 10,
The 8 will end up in the _____ place.
The 8 will end up in the "ones place".
How can we interpret the division?When 'a' is divided by 'b', then the result we get from the division is the part of 'a' that each one of 'b' items will get. Division can be interpreted as equally dividing the number that is being divided into total x parts, where x is the number of parts the given number is divided.
We need to find the 8 will end up in which place
A negative divided by a negative is positive, then;
2380/ 10 = 238
Therefore, The 8 will end up in the _ ones_ place.
Learn more about division here:
brainly.com/question/26411682
#SPJ2
90units needed 8 units per case what's the #of cases & # of additional units
Answer:
# of cases: 11
Additional units: 2
Step-by-step explanation:
If each case can hold 8 units, and we want to find the total # number of cases, we have to divide the # of units (8) for one case by the total # units (90).
As you can see, after dividing by 8, we have a total of 11 cases and a remainder of 2 units. The remainder will be the # of additional units because we cannot have another case filled with 8 units.
prove that 2^n+1>(n+2).sin(n)
Step-by-step explanation:
F(n)=|sin(n)|+|sin(n+1)|
then
F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)
and
F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)
so we must prove when n∈(0,π), have
F(n)>2sin12
when n∈(0,π−1),then
F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn
and n∈(π−1,π),then
F(n)=sinn−sin(n+1)
How prove it this two case have F(n)>2sin12? Thank you
and I know this well know inequality
|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R
The polygons in each pair are similar. Find the missing side length.
Let missing side be x
If both polygons are similar
[tex]\\ \sf\longmapsto \dfrac{3}{4}=\dfrac{18}{x}[/tex]
[tex]\\ \sf\longmapsto 3x=4(18)[/tex]
[tex]\\ \sf\longmapsto 3x=72[/tex]
[tex]\\ \sf\longmapsto x=\dfrac{72}{3}[/tex]
[tex]\\ \sf\longmapsto x=24[/tex]
please helpppp i need it by tonight its very important
Answer:
m<1=145
m<2=35
m<3=35
Step-by-step explanation:
measure one is supplementary(the angles add to 180) to measure four.
so we do 180-35=145
measure 2 is congruent to measure four because they are corresponding angles
so measure 2=35
and measure 3 is also congruent to measure 4 because the are corresponding angles
so m<3=35
Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.
The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle
The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units
The reason the above value is correct is as follows:
The given parameters in the question are;
The radius of the circle, r = 11
The length of the chord PL = 16
The measure of angle ∠PAL = 93°
Required:
The area of part of the circle enclosed by chord PL and arc PL
Solution:
The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL
The area of a segment of a circle is given by the following formula;
Area of segment = Area of the sector - Area of the triangle
Area of segment = Area of minor sector APL - Area of triangle APL
Area of minor sector APL:
Area of a sector = (θ/360)×π·r²
Where;
r = The radius of the circle
θ = The angle of the sector of the circle
Plugging in the the values of r and θ, we get;
Area of the minor sector APL = (93°/360°) × π × 11² ≈ 98.2 square units
Area of Triangle APL:
Area of a triangle = (1/2) × Base length × Height
Therefore;
The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units
Required shaded area enclosed by line PL and arc PL:
Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;
Area of the required segment PL ≈ (98.2 - 60.58) square units = 37.62 square units
The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units
Learn more about the finding the area of a segment can be found here:
https://brainly.com/question/22599425
The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.
The calculation of the area between line segment PL and circle arc PL is described below:
1) Calculation of the area of the circle arc.
2) Calculation of the area of the triangle.
3) Subtracting the area found in 2) from the area found in 1).
Step 1:
The area of a circle arc is determined by the following formula:
[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)
Where:
[tex]A_{ca}[/tex] - Area of the circle arc.
[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.
[tex]r[/tex] - Radius.
If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:
[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]
[tex]A_{ca} \approx 98.201[/tex]
Step 2:
The area of the triangle is determined by Heron's formula:
[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)
[tex]s = \frac{l + 2\cdot r}{2}[/tex]
Where:
[tex]A_{t}[/tex] - Area of the triangle.
[tex]r[/tex] - Radius.
[tex]l[/tex] - Length of the line segment PL.
If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:
[tex]s = \frac{16+2\cdot (11)}{2}[/tex]
[tex]s = 19[/tex]
[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]
[tex]A_{t} \approx 60.399[/tex]
Step 3:
And the area between the line segment PL and the circle arc PL is:
[tex]A_{s} = A_{ca}-A_{t}[/tex]
[tex]A_{s} = 98.201 - 60.399[/tex]
[tex]A_{s} = 37.802[/tex]
The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.
PLSS HELPPPP WILL GIVE BRAINLESSS A 22-foot ladder is resting against the side of a building. The bottom of the ladder is 3 feet from the building. Find the measure of the angle the ladder makes with the ground. Round your answer to the nearest tenth of a degree.
Answer:
The answer is 82.2
Step-by-step explanation
hope this helps
kabura bought a piece of cloth 3 metres long. The material shrunk by 1% after washing. What was the new length of the cloth
Answer:
2.97m
Step-by-step explanation:
1% of 3m =1/100×3=0.03
0.03m of cloth was shrunk,
So, New lenght : 3-0.03=2.97m
Factors and rewrite the expression 25x-15
Answer:
5(5x-3)
Step-by-step explanation:
The common factor in this expression is 5 so divide 5 to all the values
25/5=5
-15/5= -3
Put these values into parenthesis and leave the 5 on the left side and out of the parenthesis
5(5x-3)
Answer:
5(5x - 3)
Step-by-step explanation:
The greatest common factor here is 5. Divide each term by 5 and simplify.
25x/5 = 5x
15/5 = 3
Therefore, the answer is 5(5x - 3).
What is the simplified form of the following expression? Assume x > 0.
3
2x
16x
2x
4/24x²
2x
4/2443
16x4
124²
Answer:
fourth root of 24 x cubed/16x to the power four
After how many years, to the nearest whole year, will an investment of $100,000 compounded quarterly at 4% be worth
$213,022?
Provide your answer below:
9514 1404 393
Answer:
19 years
Step-by-step explanation:
The compound interest formula tells you the future value of principal P invested at annual rate r compounded n times per year for t years is ...
A = P(1 +r/n)^(nt)
Solving for t, we get ...
t = log(A/P)/(n·log(1 +r/n))
Using the given values, we find t to be ...
t = log(2.13022)/(4·log(1 +0.04/4)) ≈ 19.000
The investment will be worth $213,022 after 19 years.
HELP PLEASE!!!
Oak wilt is a fungal disease that infects oak trees. Scientists have discovered that a single tree in a small forest is infected with oak wilt. They determined that they can use this exponential model to predict the number of trees that will be infected after t years.
f(t)=e^0.4t
Question:
Rewrite the exponential model as a logarithmic model that calculates the # of years, g(x) for the number of infected trees to reach a value of x.
The logarithmic model is:
[tex]g(x) = \frac{\ln{x}}{0.4}[/tex]
-------------
We are given an exponential function, for the amount of infected trees f(x) after x years.To find the amount years needed for the number of infected trees to reach x, we find the inverse function, applying the natural logarithm.-------------
The original function is:
[tex]y = f(x) = e^{0.4x}[/tex]
To find the inverse function, first, we exchange y and x, so:
[tex]e^{0.4y} = x[/tex]
Now, we have to isolate y, and we start applying the natural logarithm to both sides of the equality. So
[tex]\ln{e^{0.4y}} = \ln{x}[/tex]
[tex]0.4y = \ln{x}[/tex]
[tex]y = \frac{\ln{x}}{0.4}[/tex]
Thus, the logarithmic model is:
[tex]g(x) = \frac{\ln{x}}{0.4}[/tex]
A similar question is given at https://brainly.com/question/24290183
Starting with a fresh bar of soap, you weigh the bar each day after you take a shower. Then you find the regression line for predicting weight from number of days elapsed. The slope of this line will be:__________.
Answer:
The slope will be negative
Step-by-step explanation:
The slope of the regression line tells us about the relationship or behavior of the dependent and independent variables. In the scenario above, where the weight is being compared with the number of days elapsed. What is expected of the weight and quantity of a bar soap each time it is used for a shower is that it will decrease in weight. Therefore, as the number of days increases, and hence, number of showers rise, the weight of soap will decrease. Hence, we'll obtain a negative slope, one in which the increase in a variable leads to decrease in the other.
You measure 49 turtles' weights, and find they have a mean weight of 80 ounces. Assume the population standard deviation is 6.1 ounces. Based on this, construct a 99% confidence interval for the true population mean turtle weight. Round your answers to 2 decimal places.
Answer:
The 99% confidence interval for the true population mean turtle weight is between 77.76 and 82.24 ounces.
Step-by-step explanation:
We have to find our [tex]\alpha[/tex] level, that is the subtraction of 1 by the confidence interval divided by 2. So:
[tex]\alpha = \frac{1 - 0.99}{2} = 0.005[/tex]
Now, we have to find z in the Z-table as such z has a p-value of [tex]1 - \alpha[/tex].
That is z with a p-value of [tex]1 - 0.005 = 0.995[/tex], so Z = 2.575.
Now, find the margin of error M as such
[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]
In which [tex]\sigma[/tex] is the standard deviation of the population and n is the size of the sample.
[tex]M = 2.575\frac{6.1}{\sqrt{49}} = 2.24[/tex]
The lower end of the interval is the sample mean subtracted by M. So it is 80 - 2.24 = 77.76 ounces.
The upper end of the interval is the sample mean added to M. So it is 80 + 2.24 = 82.24 ounces.
The 99% confidence interval for the true population mean turtle weight is between 77.76 and 82.24 ounces.
Round 5,821 to the nearest thousands place:
Answer:
6000 hope this helps
if the question is 5,422 then the round figure is 5000
but the question is 5,821 its above 5500 will be 6000
Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?
please help me with both questions
Answer:
(b) 829 seconds
(c) 13.8 minutes
Step-by-step explanation:
(b) 2.48×10⁸/2.99×10⁵ = 829 seconds
(c) 829/60 = 13.8 minutes
write your answer as an integer or as a decimal rounded to the nearest tenth
Answer:
FH ≈ 6.0
Step-by-step explanation:
Using the sine ratio in the right triangle
sin49° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{FH}{FG}[/tex] = [tex]\frac{FH}{8}[/tex] ( multiply both sides by 8 )
8 × sin49° = FH , then
FH ≈ 6.0 ( to the nearest tenth )
Answer:
6
Step-by-step explanation:
sin = opposite/hypotenuse
opposite = sin * hypotenuse
sin (49) = 0,75471
opposite = 0,75471 * 8 = 6,037677 = 6
Venn diagrams: unions, intersections, and complements
Attached is the photo reference
Answer:
a) 0
b) 2,3,4,5,6,7
c)3,4,6,7
Step-by-step explanation:
Which graph matches the exponential function f(x) = (3)x?
factorize : ( p- q ) cube
Answer:
[tex]( {p - q}^{3} ) \\ = {p}^{2} - 3 {p}^{2} q + 3p {q}^{2} - {q}^{3} [/tex]
A popular beach erodes 4 inches per year on average.
An eroding beach.
A. How many years will it take for the coastline to erode one foot?
Answer:
3 years
Step-by-step explanation:
4 inches per year on average
1 foot = 12 inches
12 divided by 4 equals 3
therefore it is 3 years
Give example to verify if the given statement is true or false
1) if two numbers are co-primes , at least one of them should be prime number.
Answer:
no
Step-by-step explanation:
if two numbers are co-prime that is not necessary that one of them must be a prime number
Helpp me plzzz im being timed
The number of hearing aids that needs to be produced and sold is??
Answer:
14.36 AND 9.89 ===> 14 or 10
Step-by-step explanation:
Y = Ax2 Bx C
Enter coefficients here >>> -4 97 -568
Standard Form: y = -4x²+97x-568
-24.25 -12.125 147.015625 -588.0625 20.0625
Grouped Form: No valid Grouping
Graphing Form: y = -4(x-12.13)²+20.06
Factored Form: PRIME
Solution/X-Intercepts: 14.36 AND 9.89
Discriminate =321 is positive, two real solutions
VERTEX: (12.13,20.06) Directrix: Y=20.13
five brothers of 4, 9, 11, 13 and 16 years respectively, receive an inheritance of 1,500,000, the will stipulated that that amount must be shared by the heirs so that, placed the shares in a bank, they would result in equal capitalized amounts, when each one reached 21, could raise his share. Knowing that the bank charges an interest rate of 9% per year, what is the amount of each share?
9514 1404 393
Answer:
Youngest to oldest:
160,406.86246,805.83293,230.01348,386.58451,170.72Step-by-step explanation:
At 9% interest per year, the present value of 1 at age 20 is ...
p(a) = 1.09^(a-20)
Adding the present values for the different ages, we get a total of about 2.35528984846. Dividing the inheritance by that amount gives the multiplier for each of the present value numbers. The result is the list of shares shown above. At age 20, each brother will inherit about 636,864.29.
__
Additional comment
This is the sort of question that suggests the use of a graphing calculator or spreadsheet for doing the tedious number crunching.
(We assume the bank pays 9% per year, rather than charges 9% per year.)
A factory used 99.19 kilograms of tomatoes to make 7 batches of pasta sauce. What quantity of tomatoes did the factory put in each batch?
Answer:
14.17 kilograms
Step-by-step explanation:
Find what quantity of tomatoes was in each batch by dividing the total amount of tomatoes by the number of batches:
99.19/7
= 14.17
So, the factory put 14.17 kilograms of tomatoes in each batch.
Please help explanation if possible
Answer:
18.84 feet. let me know if you have ay other questions.
Step-by-step explanation:
The way to find the formula for circumference is kinda complicated so it is best to ust memorize the formula, which is 2πr. or 2 times pi times the radius.
Your problem gives you the formula, but instead of 2 and r in it you have d, which is the diameter.
The diameter of the circle is 2 times the radius, so that's why it is replaced.
the radius is the distance from the center fo the circle to one edge, and the diameter is the distance through the circle passing through its center. so it's the center to one end plus the center to another end. or r+r which is also 2r.
So d = 2r, so in this problem d =6 feet.
So now the formula πd = 3.14*6 feet = 18.84 feet
The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False
Answer:
TRUE
Step-by-step explanation:
I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:
The given segment can form triangle. Therefore, the given statement is true.
What is triangle?A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.
All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.
Therefore, the given statement is true.
To know more about triangle, here:
https://brainly.com/question/14712269
#SPJ7