Suppose the price level and value of the U.S. dollar in year 1 are 1 and $1, respectively.



Instructions: Enter your answers rounded to 2 decimal places.



a. If the price level rises to 1.40 in year 2, what is the new value of the dollar?



$



b. If, instead, the price level falls to 0.80, what is the value of the dollar?



$

Answers

Answer 1

Answer:

a-2.40, b- 1.60

Step-by-step explanation:


Related Questions


Write a function that has the following characteristics:

-Exponential decay

-Asymptote is y = -2

-Shifted left 3 units from the parent function

Answers

9514 1404 393

Answer:

  y = 0.4^(x+3) -2

Step-by-step explanation:

I have chosen the decay function y=0.4^x as the parent function.

Shifting any function f(x) left 3 and down 2 will transform it to ...

  y = f(x+3) -2

So, the shifted parent function is ...

  y = 0.4^(x+3) -2

your family have decided to paint your room. It took 1/2 hour to paint 1/8 of your room. How long will it take to paint your whole room?

Answers

Answer:

4 hours

Step-by-step explanation:

In  6  hours,  J  paints  1  room

So, in  1  hour,  J  paints  1/6 th of the room

Using similar logic, in  1  hour,  T  paints  1/12 th of the room.

Working together in one hour, they paint  (1/6+1/12) th =1/4  of the room.

1/4  of the room is painted in  1  hour

So,  1  room is painted in  1 1/4=4  hours

Answer:

Step-by-step explanation:           1/7

Solve 8T 1398lb 14oz * 6

Answers

this is soo funny

haha thanks for the points

epic gamer question i'll mark brainliest​

Answers

Answer:

I think it is parallel

Step-by-step explanation:

10x-6x-4-1=7-12+2x+2x

Answers

Any value of

x

makes the equation true.

Always true

Interval Notation:

(−∞,∞)

Hope this helps if not I’m sorry

Can someone tell me what the evaluated answer is?

Answers

Answer:

16)  7⁻²

17) -1⁻²

Step-by-step explanation:

plug in the x=, y=, and n= into the equation.

Tim has 2/3 cup of chocolate syrup. If he uses 1/9 cup of chocolate syrup for each serving of chocolate milk, how many servings of chocolate milk can he make

Answers

Answer:

6 servings

Step-by-step explanation:

Each serving Tim uses 1/9 cup. So, after using the amount of syrup reduces and repeated subtraction is division.

[tex]\frac{2}{3}[/tex] ÷ [tex]\frac{1}{9}[/tex]

[tex]=\dfrac{2}{3}*\dfrac{9}{1}[/tex]

= 2 *3

= 6

A company makes a profit of $y (in thousand dollars) when it produces x computers,
where y is given by the formula y = a(x - 100)(x - 200) for x 20 If 120
computers are produced, the profit will be $3,200,000.
a) Find the value of a.

b) What is the maximum profit the company can make? At this profit, how many
computers should be produced?

c) If the company targets to make at least $4,800,000, what is the range of the
number of computers to be produced?


Answers

The solutions to the questions if y is represented by the formula y = a(x - 100)(x - 200) are:

a) The value of a = -2000

b) The maximum profit the company can make = $5,000,000

To make maximum profit, 150 computers must be produced

c) The company must produce between 140 and 160 computers to make at least $4,800,000

The equation representing the company's profit is:

y = a(x - 100)(x - 200)  for x > 20

If 120  computers are produced, the profit will be $3,200,000

That is, y = 3,200,000 if x = 120

a) Find the value of a

3,200,000 = a(120 - 100)(120 - 200)

3200000 = -16000a

a = -3200000/1600

a = -2000

b) Maximum profit the company can make

The equation becomes:

y = -2000(x - 100)(x - 200)

y = -2000(x² - 200x - 100x + 20000)

y = -2000(x² - 300x + 20000)

y = -2000x² + 600000x - 40000000

dy/dx = -4000x + 600000

dy/dx = 0 at maximum value

-4000x  +  600000 = 0

4000x  =  600000

x  =  600000/4000

x   =  150

To make maximum profit, 150 computers must be produced

Substitute x = 150 into y = -2000x² + 600000x - 40000000 to find the maximum profit

y  = -2000(150²) + 600000(150) - 40000000

y = 5000000

The maximum profit the company can make = $5,000,000

c) Calculate the range of the number of computers to be produced If the company targets to make at least $4,800,000

-2000x² + 600000x - 40000000 ≥ 4800000

-2000x² + 600000x - 40000000 - 4800000 ≥ 0

-2000x² + 600000x - 44800000 ≥ 0

Divide through by -2000

x² - 300x +22400 ≤ 0

(x - 140)(x - 160) ≤ 0

140 ≤ x ≤ 160

The company must produce between 140 and 160 computers to make at least $4,800,000

Learn more here: https://brainly.com/question/25471478

If a course starts September 2022,and last for three years, what year would it end. ​

Answers

Answer:

im pretty sure its 2025

Answer:

2025

Step-by-step explanation:

If the map distance is 20 cm and the scale is 4 cm = 60 km, what is the actual distance?

Answers

Answer:

300

Step-by-step explanation:

1. 60/4=15

2. 15x20=300

Find the value of y for the given value of I.
y=x/2 + 9;x = -12

Answers

9514 1404 393

Answer:

  y = 3

Step-by-step explanation:

Put the value where the variable is and do the arithmetic.

  [tex]y=\dfrac{x}{2}+9\\\\y=\dfrac{-12}{2}+9=-6+9\\\\\boxed{y=3}[/tex]

Please answer the question in the picture

Answers

(2x+8)(x-3)
2x + x = 3x
8 - 3 = 5
3x + 5 is expressed form.

Answer:

2x² + 2x - 24

Step-by-step explanation:

We can use the FOIL method to multiply the terms together and then find the values in our trinomial. First, the F in FOIL. It stands for first, and we need to multiply the first terms in the two expressions. These terms are 2x and x. Multiplying 2x by x gives us 2x², so that's our first term.

Next, the O in FOIL. It stands for outside, and we need to multiply the terms on the very left and the very right. These are 2x and -3, and multiplying 2x by -3 gives us -6x. That's our second term.

Now, the I in FOIL. It stands for inside, so we need to multiply the terms in the middle of the expressions. Those are 8 and x, and we multiply those together to get 8x. That's our third term.

Finally, the L in FOIL. This stands for last; we need to multiply the last terms of each expression. Those are 8 and -3, and we can multiply those to get -24. Now we can get all our terms added together and simplify as needed.

2x² - 6x + 8x - 24

We can simplify -6x and 8x since they are like terms.

2x² + 2x - 24

And there is our trinomial. Hopefully that's helpful! :)

72 boxes sold out of 90 boxes what percent sold

Answers

Answer:

80%

Step-by-step explanation:

Answer:

80%

Step-by-step explanation:

90 boxes = 100%

72 boxes = ?

=> (72 * 100)/ 90 = 80%

HELPPP PLZ PLZ PLZ 15 BRANULASR When x is decreased by 129 and then that number is multiplied by 129 , the result is 129. What is the value of x?

Answers

Answer:

130

Step-by-step explanation:

(x - 129) * 129 = 129

x - 129 = 129/129

x - 129 = 1

x = 129 + 1

x = 130

Answer:

x could equal 130 but I'm not sure about this one

Step-by-step explanation:

you take 130-129 which equal 1 then times 1 by 129 and it equals 129... again sorry if it's not right because I'm not entirely sure how to do this I'm pretty sure I did it correct though

If you spent 24 weeks working on a project for your job and are rewarded with 3 days of vacation write the ratio of time on vacation to time working as a fraction in lowest terms

Answers

time on vacation/time working

= 3/(24*7)

= 3/(8*3*7)

=1/(8*7)

= 1/56

A file that is 249 megabytes is being downloaded. If the download is 15.7% complete, how many megabytes have been downloaded? Round your answer to the
nearest tenth ?

Answers

Answer:

39.1 megabytes

Step-by-step explanation:

Percentages are out of a hundred, so 15.7% is 15.7 out of 100, aka 15.7/100, which is 0.157.

Now, you just need to multiple this number by 249 megabytes to get 0.157 * 249 = 39.093 which rounds to 39.1

39.1 megabytes just multiply buy 249

If you split 8 kg of strawberries among yourself and three friends, how many kilograms of strawberries will each person receive?

Answers

Answer:

2kg brainliest expected

Step-by-step explanation:

there's 4 people so divide 8 by 4.

each person shall get 2 kg

express 1 000 000 in standard form

Answers

Answer:

10^6.

Step-by-step explanation:

There are 6 digits after the 1 so it's 1 * 10^6 or just 10^6.

Which is a property of an angle?

A-has two sides that each extend forever in both directions
B-has two endpoints
C-has two center points
D-has two rays that share a common endpoint

Answers

The answer is D- has two rays that share a common endpoint

Line ℓ has equation y=5. Find the distance between ℓ and the point Q(0,1).

Answers

Answer:

Distance = 4

Step-by-step explanation:

Given the linear equation of line ℓ, y = 5 which is a horizontal line in which its slope, m = 0 (zero slope), and each of the x-coordinates along the line have the same y-coordinate of y = 5.

In order to determine the distance of the horizontal line from the given point Q, (0, 1), use the following distance formula:

[tex]d = \sqrt{(x_2 - x_1)^{2} + (y_2 - y_1)^{2}}[/tex]

Choose any x-coordinate to pair with the y-coordinate, y = 5. Let's use the y-intercept, (0, 5).

Let  (x₁, y₁) = (0, 1)  

      (x₂, y₂) = (0, 5)  

Substitute these values into the distance formula:

[tex]d = \sqrt{(x_2 - x_1)^{2} + (y_2 - y_1)^{2}}[/tex]

[tex]d = \sqrt{(0 - 0)^{2} + (5 - 1)^{2}}[/tex]  

[tex]d = \sqrt{(4)^{2}}[/tex]

[tex]d = \sqrt{16}[/tex]

d = 4  

Therefore, the distance of line ℓ from point Q is 4.

A continuous random variable X has probability density function X. Show how its
moment generating function can be used to determine the variance of this random
variable.

Answers

The moment generating function is defined by

[tex]M_X(t) = \mathbb E[e^{tX}][/tex]

Recall the power series expansion for the exponential function:

[tex]\displaystyle \sum_{n=0}^\infty \frac{x^n}{n!} = 1 + x + \frac{x^2}2 + \frac{x^3}6 + \cdots[/tex]

Then by extension, the MGF could be similarly written as

[tex]\displaystyle M_X(t) = \mathbb E \left[1 + Xt + \frac{(Xt)^2}2 + \frac{(Xt)^3}6 + \cdots\right][/tex]

There's a certain theorem (due to Fubini, in case you're interested in learning more about it) that let's us exchange the order of integration (recall the definition of expectation for continuous random variables) and summation, so that

[tex]\displaystyle M_X(t) = \mathbb E[1] + \mathbb E[Xt] + \mathbb E\left[\frac{X^2t^2}2\right] + \mathbb E\left[\frac{X^3t^3}6\right] + \cdots[/tex]

and by the linearity of expectation,

[tex]\displaystyle M_X(t) = 1 + \mathbb E[X] t + \frac12 \mathbb E\left[X^2\right] t^2 + \frac16 \mathbb E\left[X^3\right] t^3 + \cdots[/tex]

and here we see where the name MGF comes from: the coefficient of the n-th order term in the series expansion "generates" the n-th moment, which is defined as E[Xⁿ].

Now, recall the definition of variance:

[tex]\mathrm{Var}(X) = \mathbb E\left[\left(X - \mathbb E[X]\right)^2\right][/tex]

[tex]\mathrm{Var}(X) = \mathbb E\left[X^2\right] - \mathbb E[X]^2[/tex]

and this is exactly the difference between the second moment and the square of the first moment.

So if you know the MGF, then you essentially get the variance for free with little effort. By differentiating the MGF, we get

[tex]\displaystyle M_X''(t) = \mathbb E[X] + \mathbb E\left[X^2\right] t + \frac12 \mathbb E\left[X^3\right] t^2 + \cdots[/tex]

and setting t = 0 lets us recover the first moment, E[X].

Differentiating again gives

[tex]\displaystyle M_X'(t) = \mathbb E\left[X^2\right] + \mathbb E\left[X^3\right] t + \cdots[/tex]

and setting t = 0 once again recovers the second moment.

Then in terms of the MGF, we have

[tex]\boxed{\mathrm{Var}(X) = M_X''(0) - M_X'(0)^2}[/tex]

Cheryl is planning to spend $75 on a Christmas gift for her father. He needs new socks and ties. A store has socks s and ties t on sale for $4 and $11, respectively. Which equation models this situation?

Answers

Answer:

4s + 11t = 75

Step-by-step explanation:

Assuming you are asking for an equation to find how many socks and ties Cheryl could get with $75, then the equation 4s + 11t = 75 would represent that.

s is the number of socks that are bought (assuming s = 1 means that 1 pair of socks is bought).

t is the number of ties that are bought.

4s represents the total cost of the socks that are bought (if you plug in 4 for s, then the total cost of the socks is 4(4) = 16+

11t represents the total cost of the ties that are bought

Mr. Solomon, the art teacher, has 49.6 pounds of clay. If he gives every student 1.6 pounds of clay and has none left, how many students are in his class?​

Answers

Answer:

He has 31 students

Step-by-step explanation:

You know this because 49.6 ÷ 1.6 = 31

Find the difference (10j-7)-(-9j+2)

Answers

Answer:

19j-9

HOPE THIS HELPS

- Todo ❤️

Step-by-step explanation:

10+9=19j

-7-2=9

Which of the following could be the number shown on the number line?
A. V66
B. V60
C. V63
D. V65

Answers

Answer:

A

Step-by-step explanation:

v666

in which country has involved in world war

Answers

Answer:

The following countries were involved in the world war

Germany

Austria-Hungary

Bulgaria

Ottoman Empire (the Central Powers)

These countries fought against

Great Britain

France

Russia

Italy

Romania

Japan

United States (the Allied Powers).

Solve all of them please u get 30 points​

Answers

Step-by-step explanation:

from which text book please

In science class, a student is measuring the temperature of a solution in science experiment. The solution
started at -3.4 degrees. After two minutes the temperature had increased 12.4 degrees. After a few more
minutes, the temperature decreased 20.4 degrees. After one more minute the temperature increased by
3.2 degrees. What is the final temperature?

Answers

Answer:

-11.8

Step-by-step explanation:

Given:

-3.4 to 12.4        increased  (difference = 15.8)

12.4 to 20.4      decreased (difference = 8)

20.4 to 3.2        increased  (difference = 17.2)

To find:

Final temperature.

Solution:

As we noticed, this is a pattern of increase, decrease, increase... (and so on and so forth). From this alone, we have gotten the clue that the temperature is going to decrease. But here is the thing, How far will it decrease?

Use the difference of the starting result to find the ending result.

3.2 - 15

= -11.8

Therefore, the final temperature is -11.8.

four and three sevents plus six and one fith.

Answers

372/35 or 10.62857143
You could find a common denominator or use a calculator

Solve 2/v + 1/w = 1/2 for v

Answers

Answer:

v=(-4w)/(-w+2)

Other Questions
Lichens are not single organisms, but algae and fungi that function together. The algae use photosynthesis to make food for both organisms. The fungi produce digestive chemicals and absorb nutrients for both organisms.How does the biological activity of lichens cause weathering in rocks?Answer options with 4 optionsA. Lichens cause friction as they grow, which weathers the rocks.B. Lichens produce chemicals, which dissolve and weather the rocks.C. Lichens take in water, which freezes in cracks and weathers the rocks.D. Lichens absorb heat during photosynthesis, which weathers the rocks. please help me with this math problem Humans can opt against cosmetic surgery what does this mean? Finding slope from tables and Em uma avaliao que vale at 5 pontos, Joo tirou 4,2 pontos. Quanto Joo teria tirado caso a prova valesse 10 pontos? How does the line Black snake! Black snake! contribute to the structure of the poem "The Black Snake"? In at least 150 words, describe the reasons why Berryman's "Homage to Mistress Bradstreet" would have caused him to be banished from early American settlements ACCURATE ANSWER=BRAINLIST The first four terms of a sequence are shown.7, 25, 43, 61, ...Which of the following expressions can be used to find the nth term of the sequence?Question 3 options:7+18n18+7n18+7(n1)7+18(n1) What powers does the U.S. Constitution give the Congress, regarding responding to a crisis?' n = 3: 3 and 4 + 2 i are zeros:f(- 1) = 58 Could someone please help me A cars is moving at 12 m/s and has a mass of 600 kg. What is the kinetic energy for the car? (Formula:KE= 1/2 MV2) 36,300J 43,200J 72,600J 86,400J Why was the grand couvert created When a cross is made and a trait disappears in the f1 generation, only to reappear in the f2, the trait is probably. When you need to convert from one system of measurement to another, you should convert to the a) system that will have the highest number. b) system that will have the smallest number. c) system used on the medication label. d) metric system. __________ are considered bad cholesterol; high blood levels are correlated with increased risk of cardiovascular disease. 4[2(710)15]2(1) What is the author's purpose? Los asistentes, hoy, a la reunin semanal de un club social se pueden agrupar por parejas para bailar, por tros para hacer manualidades, y de 4 en 4 para jugar bingo. En ninguno de esos casos queda nadie sin grupo. Cuntas personas son si casi llegan a 25? Highest common factor of 12r and 10