Solve the rational equation:
2x/x-1 - 2x-5/x^2 -3x+2 = -3/x-2

Answers

Answer 1

Answer:

Step-by-step explanation:

[tex]\frac{2x}{x-1} -\frac{2x-5}{x^2-3x+2} =\frac{-3}{x-2} \\\frac{2x}{x-1} +\frac{3}{x-2} =\frac{2x-5}{x^2-3x+2} \\\frac{2x(x-2)+3(x-1)}{(x-1)(x-2)} =\frac{2x-5}{x^2-3x+2} \\\frac{2x^2-4x+3x-3}{x^2-2x-x+2} =\frac{2x-5}{x^2-3x+2} \\\frac{2x^2-x-3}{x^2-3x+2} =\frac{2x-5}{x^2-3x+2} \\x\neq 1,x\neq 2,x^2-3x+2\neq 0\\multiply~by~x^2-3x+2\\2x^2-x-3=2x-5\\2x^2-3x+2=0\\x=\frac{3\pm\sqrt{9-4*2*2} }{2*2} \\x=\frac{3 \pm\sqrt{-7} }{4} \\x=\frac{3 \pm \sqrt{7} i}{4}[/tex]

Answer 2

The solutions of the given rational equation are 13/4 and 11/4.

What is an equation?

In mathematics, an equation is a formula that expresses the equality of two expressions, by connecting them with the equals sign =.

The solution of an equation is the set of all values that, when substituted for unknowns, make an equation true.

The given equation is 2x/(x-1) - (2x-5)/(x² -3x+2) = -3/(x-2)

Here, 2x/(x-1) - (2x-5)/(x² -2x-1x+2) = -3/(x-2)

2x/(x-1) - (2x-5)/(x(x-2)-1(x-2)) = -3/(x-2)

2x/(x-1) - (2x-5)/((x-2)(x-1)) = -3/(x-2)

(2x(x-2)-(2x-5))/((x-2)(x-1)) = -3/(x-2)

(2x²-4x-2x+5)/(x-1)=-3

2x²-4x-2x+5= -3(x-1)

2x²-6x+5=-3x+3

2x²-6x+5+3x-3=0

2x²-3x+2=0

By using quadratic formula, we get

x=3±√(9-8)/4

x=3± 1/4

x= 3+1/4 and x=3-1/4

x=13/4 and x=11/4

Therefore, the solutions of the given rational equation are 13/4 and 11/4.

To learn more about an equation visit:

https://brainly.com/question/14686792.

#SPJ2


Related Questions

Please help and thank u

Answers

Answer:

The answer to this question is C.

A newborn baby weighed 133 ounces.
What is the baby's weight in pounds and
ounces? (1 pound = 16 ounces)

Answers

Answer: UHHHHH i shall halp ya

Step-by-step explanation:

if its 133 in ounces its 293.215 in pounds

Answer: 8 pounds and 5 ounces

Step-by-step explanation: Do 16 ounces divided by 2 and it will give you 8 or do 8 times 2 which will give you sixteen. I prefer you do the other way and then do 10 dividedy2to get 5 ounces. The cop is 2.

There is 28 kg 750 g of sugar in a sack. How many tins of 500 g sugar can be filled using the sugar in the sack?

Answers

Answer:

Step-by-step explanation:

28 kg + 750 g = 28*1000 + 750

                          28000 + 750

                       = 28750 g

Number of sack = Total quantity of sugar ÷ quantity of sugar in a sack

                           = 28750 ÷ 500

                           =  57 sacks

Answer:

57 sacks

Step-by-step explanation:

28750 ÷ 500 =

57 sacks

Glad to help! :)

For what values of x is the expression below defined?
x +3 + x1 - x
O A. 35xs1
O B. 3 > XS-1
O C. 3 >x>1
O D. -3 sx< 1

Answers

Answer:

D. - 3 ≤ x < 1

Step-by-step explanation:

The numerator cannot be the square root of a neg. no.

So, x + 3 ≥ 0 or x ≥ -3

The denominator cannot be a neg. no. or 0.

So, 1 - x > 0

1 > x or x < 1

So, altogether - 3 ≤ x < 1

Therefore, D is the correct answer.

HOPE IT MAY HELP YOU

PLEASE MARK AS BRAINLIST

Second Number Cube
1
2.
3
4
5
6
First Number Cube
locN-
1,1 1,2 1,3 1,4 1,5 1,6
2,1 2,2 2,3 2,4 2,5 2,6
3,1 3,2 3,3 3,4 3,5 3,6
4,1 4,2 4,3 4,4 4,5 4,6
5,1 5,2 5,3 5,4 5,5 5,6
6,1 6,2 6,3 6,4 6,5 6,6
How many possible outcomes are there?
O 6
12

Answers

Answer:

36

Step-by-step explanation:

summation of all the outcome

There are 36 possible outcomes is shows in table for rolling two  six - sided number cubes.

What is mean by Multiplication?

To multiply means to add a number to itself a particular number of times. Multiplication can be viewed as a process of repeated addition.

We have to given that;

The table shows all the possible outcomes for rolling two six - sided number cubes.

Now, We know that;

For rolling one six - sided number cubes,

There is 6 possible outcomes.

Hence, For two six - sided number cubes.

Number of possible outcomes = 6 × 6

                                               = 36

Thus, There are 36 possible outcomes is shows in table for rolling two  six - sided number cubes.

Learn more about the multiplication visit:

https://brainly.com/question/10873737

#SPJ7

Help me solve these 4 plssss ASAP

Answers

Step-by-step explanation:

[tex]1) \\ - 2 \leqslant x \leqslant 1 \\ 2) \\ - 3 > x \geqslant 2 \\ 3) \\ x> 0[/tex]

[tex]4) \\ x \leqslant - 3 \\ 5) \\ - 4 \leqslant x \geqslant 1[/tex]

[tex]6) \\ - 2< x \leqslant 0[/tex]

The tables represent the functions f(x) and g(x).

A table with 2 columns and 7 rows. The first row, x, has the entries, negative 3, negative 2, negative 1, 0, 1, 2. The second row, f(x), has the entries, negative 5, negative 3, negative 1, 1, 3, 5. A table with 2 columns and 7 rows. The first row, x, has the entries, negative 3, negative 2, negative 1, 0, 1, 2. The second row, g(x), has the entries, negative 13, negative 9, negative 5, negative 1, 3, 7.
Which input value produces the same output value for the two functions?

Answers

Answer:

rtyujn

Step-by-step explanation:

er456y7ujm

What is the equation of the line that passes through the points
(-3, 6) and (-3, 8)?

Answers

Answer:

[tex]x=-3[/tex]

Step-by-step explanation:

Hi there!

Linear equations are typically organized in slope-intercept form: [tex]y=mx+b[/tex] where m is the slope and b is the y-intercept (the value of y when x is 0).

Typically, we would start with finding the slope of the line. However, notice how the two x-coordinates in the given points are both -3. This means that this is a vertical line, with an undefined slope.

Vertical lines have their equations organized differently: [tex]x=d[/tex] where d is the x-intercept, or the value of x when y is 0.

Because the x-coordinates in all the points a vertical lines passes through are the same, the x-intercept would therefore be -3. Plug this into the equation [tex]x=d[/tex]:

[tex]x=-3[/tex]

I hope this helps!

Explain in your own words why it takes more to prove quadrilaterals congruent. Include examples demonstrating how ""just angles"" or ""just sides"" is not enough.

Answers

Proving that quadrilaterals are congruent takes more because all quadrilaterals are polygons of four sides and they all have a sum angle of 360°

Meaning of Congruent quadrilaterals

A quadrilateral can be defined as a polygon shape that possesses four sides.

Congruent quadrilaterals are those quadrilaterals that are similar in sides and angles.

For example, a parallelogram needs to be proved by both the sides and the angles

In conclusion, Proving that quadrilaterals are congruent takes more because all quadrilaterals are polygons of four sides and they all have a sum angle of 360°

Learn more about Congruent quadrilaterals: https://brainly.com/question/224113

#SPJ1

no links please, i cant find the answer for q b) ii)

Answers

Answer:

-k

Step-by-step explanation:

Cos(140)=cos(180-40)=-cos(40)=-k

Answer:

Step-by-step explanation:

Sin (90 - A)  = Cos A

Cos (90 + A) =   -Sin A

Sin 50 = Sin (90 - 40)

          = Cos 40

         = k

Cos 140 = Cos (90 + 50)

             = - Sin 50

            = (- k)

i need help with this

Answers

Answer:

[tex]y = - \frac{1}{2} x + 4[/tex]

Step-by-step explanation:

Let us consider two points through which the line passes through

[tex](x_1 , y _ 1 ) = ( 0 , 4 ) \ and \ (x_ 2 , y _ 2 ) = ( 4, 2 )[/tex]

Step 1 : Find slope of the line

[tex]Slope, m_1 = \frac{rise}{run} \\\\That \ is \ m_1 \ = \frac{y_2 - y _ 1}{x_2 - x_1}[/tex]

                  [tex]= \frac{2 - 4}{4-0} \\\\=-\frac{2}{4}\\\\= - \frac{1}{2}[/tex]

Step 2 : Find equation of the line.

[tex](y - y _ 1) = m_ 1 (x - x_1)\\\\( y - 4) = - \frac{1}{2}(x - 0)\\\\y = -\frac{1}{2}x + 4[/tex]

Evaluate F(x) = x^2 + 1 for f(-1)

Answers

Answer:

2

Step-by-step explanation:

f(x) = x^2 + 1

f(-1) = (-1)^2 + 1

f(-1) = 2

Answer:

f(x)=x^2+1

f(-1)=(-1)^2+1

f(-1)=1+1

f(-1)=2

A group of people were asked if they had run a red light in the last year where 140 responded "yes," and 208 responded "no." If a person is randomly chosen, find the probability that he/she has run a red light in the last year. Give your answer as a fraction or decimal.

Answers

Answer:

35/87

Step-by-step explanation:

To find the probability, we must find (total number of favorable outcomes)/ (total number of outcomes). We thus need to find the total number of outcomes. As people have only answered "yes" or "no", the total number of outcomes is 208+140 = 348.

The total number of favorable outcomes, or what we're looking for, is 140 (140 people responded that they had run a red light). Thus, our fraction is 140/348, or 35/87

120 to 150 find the percentage of increase

Answers

Answer:

25%

Step-by-step explanation:

increase by = 150 - 120

=30

increase percent = 30/120 * 100%

=3000/120

=25 %

Answer:

25%

Step-by-step explanation:

Percentage increase=(new value-original value)/(original value) x 100%

Percentage increase=(150-120)/120 x 100%

Percentage increase=30/120 x 100%

Percentage increase=1/4 x 100%

Percentage increase=25%

the measures of the angles of a triangle are shown in the figure. solve for x

Answers

Answer:

10

Step-by-step explanation:

First, we know that the angles of a triangle add up to 180 degrees. We can then sum up our angles as 90 (since it's a right triangle, represented by the square in the bottom left angle) +27+6x+3=180

90+27+6x+3=180

Add up left side

120+6x=180

Subtract 120 from both sides

6x=60

Divide both sides by 6

x=10

Find the distance between the points (11,4) and (10,5)

Answers

11-10=1
4-5=-1

Answer:
(1,-1)

The diagram shows a rectangle PQRS.
PQ = 14 cm and QR = 9 cm.
The point A lies on PS so that PA = 5 cm.
The point Blies on SR so that BR = 8 cm.

Answers

Answer:

a) The area of the triangle AQB is 43 square centimeters.

b) The length of the line segment AQ is approximately 14.866 centimeters.

Step-by-step explanation:

a) The procedure consist in subtracting the areas of triangles APQ, ASB and BRQ of the area the rectangle, that is to say:

[tex]A = (9\,cm)\cdot (14\,cm) - \frac{1}{2}\cdot (5\,cm)\cdot (14\,cm) - \frac{1}{2}\cdot (8\,cm)\cdot (9\,cm) -\frac{1}{2}\cdot (4\,cm) \cdot (6\,cm)[/tex]

[tex]A = 43\,cm^{2}[/tex]

The area of the triangle AQB is 43 square centimeters.

b) The length of the line segment AQ is determined by Pythagorean Theorem:

[tex]AQ = \sqrt{AP^{2}+PQ^{2}}[/tex] (1)

[tex]AQ = \sqrt{(5\,cm)^{2}+(14\,cm)^{2}}[/tex]

[tex]AQ \approx 14.866\,cm[/tex]

The length of the line segment AQ is approximately 14.866 centimeters.

HELP pls help me with this problem.

Answers

Answer:

8units

Step-by-step explanation:

area of a triangle=1/2base x height

1/2×4×4

2×4

8units

The answer is 8 unit I hope it helps

Which statement is true regarding the graphed functions?

Answers

Answer:

f(2) = 0 and g(2) = 0

f(2) = g(2) TRUE

b) f(0) = 2 and g(0) = -2

f(0) = g(0) FALSE

c) f(2) = 0 and g(0) = -2

f(2) = g(0) FALSE

d) f(0) = 2 and g(2) = 0

f(0) = g(2) FALSE

What are biofertilisiers​

Answers

Answer:

Step-by-step explanation:

biofertilizers are fertilizers consist of micro-organisms that will help plant growth. they are different from traditional fertilizers which consist of chemicals

Answer:

Any fertilizers involving living organisms, or the products obtained from living organisms can be referred to as biofertilizer, although nowadays, the term is generally used for living organisms used for fertilizer purpose.

Step-by-step explanation:

Hope this helps

10.
Consider the number 1750
Find the least number which must be added so as to get a perfect square?
Find the square root of the number obtained?​

Answers

Answer:

if you add 14 to 1750 you will get 1764 which equals 42²

Step-by-step explanation:

Please help me I really need help

Answers

hi! the first one is -2+6 i & the second one is parallelogram!

Answer:

-2 + 6i

Parallelogram

Step-by-step explanation:

( 5 - 2i ) + ( - 7 + 8i )

remove parenthesis

5 - 2i + ( -7 ) + 8i

combine like terms

5 + (-7) = -2

-2i + 8i = 6i

-2 + 6i

The arrows on the opposite sides indicate that the sides are parallel

A shape with two sets of parallel sides is known as a parallelogram

if x4 + 1/x4 = 4 find the value of x2+1/x2​

Answers

Answer:

Hiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiii

Answer:

Step-by-step explanation:

I think its 2

Jada walks dogs to earn money. The points in this graph represent the total amount of money Jada earns based on the number of hours she walks dogs. Jada wants to purchase a new jacket that costs $32.

How many hours does Jada need to walk dogs to earn enough money to buy the jacket?


6 hours

7 hours

8 hours

9 hours

Answers

Answer:

8 hours

Step-by-step explanation:

In 4 hours she earns 16 dollars

Since this is proportional ( goes through zero), we can multiply by 2

8 hours = 32 dollars

Jada needs to walk the dog for, 8 hours.

4x8 = 32

PLEASE HELP IF YOU KNOW GEOMETRY THIS SHOULD BE EASY

Answers

Answer:

Growth

Step-by-step explanation:

When x value increase, y value also increase, So growth.

When x = 1   ;f(1) = 2

When x = 2  ; f(2) = 2² = 4

When x = 3  ; f(3) = 2³ = 8

Answer:

Exponential Growth

Step-by-step explanation:

I found this photo that helps differentiate both growth and decay :)

I hope this helps! :)

Question 7 of 27
Which of the following is an element in the sample space for first rolling a
number cube and then tossing a coin?

Answers

Answer:

TH is an element on the sample space for first rolling a die and then tossing a coin. A coin has both heads and tails.

The sample space for rolling a number cube and then tossing a coin is:

{(1, H), (1, T), (2, H), (2, T), (3, H), (3, T), (4, H), (4, T), (5, H), (5, T), (6, H), (6, T)}

The elements can be any of the elements in the sample space.

What is sample space?

It is the total number of possible outcomes from a given set.

We have,

The sample space for rolling a number cube and then tossing a coin consists of all possible outcomes from rolling the number cube and tossing the coin.

Each outcome is a pair consisting of a number from 1 to 6 (the possible outcome from rolling the number cube) and a head or tail (the possible outcome from tossing the coin).

Therefore, an element in the sample space can be represented as an ordered pair (n, h/t), where n is the number rolled on the number cube and h/t is the outcome of the coin toss (either head or tail).

So,

The sample space for rolling a number cube and then tossing a coin is:

{(1, H), (1, T), (2, H), (2, T), (3, H), (3, T), (4, H), (4, T), (5, H), (5, T), (6, H), (6, T)}

For example, (3, H), (6, T), (1, H), and (4, T) are all elements in the sample space.

Thus,

The sample space for rolling a number cube and then tossing a coin is:

{(1, H), (1, T), (2, H), (2, T), (3, H), (3, T), (4, H), (4, T), (5, H), (5, T), (6, H), (6, T)}

Learn more about sample space here:

https://brainly.com/question/24273864

#SPJ7

How many sides do 2 hexagons and 2 pentagons have in all?

Answers

Answer:

22 sides total

Step-by-step explanation:

a hexagon has 6 sides, while a pentagon has 5 sides. In order to find out how many there are total, we would multiply each by two, and add them together.

[tex]2(6)+2(5)=\\12+10=22[/tex]

Violet bought 2 yards of fabric. She will use it to make new pillow covers. How many inches of fabric did Violet get?

Answers

Answer:

24 inches

Step-by-step explanation:

2 yards to inches :

2 x 12 = 24

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

Answer:

72 inches

Step-by-step explanation:

1 yard = 3 feet

1 foot = 12 inches

1 yard = 3(12) inches or 36"

∴ 2 yards = 72 inches

PLEASE PLEASE HELP ME WITH THIS GEOMETRY QUESTION!!!

Answers

Step-by-step explanation:

Objective: Circle Theorems

The arcs add up to 360 and they are in proportion so

[tex]3x + 3x + 4x + 5x = 360[/tex]

[tex]15x = 360[/tex]

[tex]x = 24[/tex]

So this means that Arc AB and BC measure is 72 each. Arc CD measure is 96 and Arc DA measures is 120.

Angle 1 measure is a inscribed angle of Arc CD.

So it measures

[tex] \frac{96}{2} = 48[/tex]

Angle 2 is a inscribed angle of Arc AB so it measures

[tex] \frac{72}{2} = 36[/tex]

Angle 3 is a inscribed angle of Arc DA.

[tex] \frac{120}{2} = 60[/tex]

Angle 4 is a inscribed angle of Arc BC so it measures

[tex] \frac{72}{2} = 36[/tex]

Angle 5 is formed by tangent line ED. Since D lies on the circumference, it also is tangent to point e so it also measures 90 degrees.

Angle 4 measures 32 so Angle 5 is it complement to Angle 4.

[tex]32 + x = 90[/tex]

[tex]x = 58[/tex]

Angle 6 is formed by two intersecting chrods

so it measures

[tex] \frac{1}{2} (120+ 72) = 96[/tex]

Solve -2x + 6 = -20. -7 -13 7 13

Answers

Answer:

13

Step-by-step explanation:

-2x + 6 = -20

Step 1 subtract 6 from both sides

6 - 6 cancels out

-20 - 6 = -26

We now have -2x = -26

Step 2 divide both sides by -2

-2x/-2 = x

-26/-2 = 13

We're left with x = 13

Other Questions
Gas occupies 30 Liters at 2.0 atm pressure and 27 Celsius. How many moles of gas are present Question 9 of 10 Based only on the given information, it is guaranteed that AB I CD. A D . Given: AABC ZDAC = ZDBC O A. True O B. False Help please if you dont mind Thankyouu! What is 15 5/7 - 6 4/5 Brian Holland, Lamont Dozier, and Eddie Holland were a producing team for Motown.A. TrueB. FalseAnswer is true!!! Which action is an example of public policy?A. Organizing a church fund-raiser B. Volunteering in a soup kitchenC. Giving a speech to local students encouraging them to stay inschoolD. Determining the required width for a sidewalk what is the different between the love expressed in " a red, red rose" by Robert Burns and the love mentioned in " when i was twenty " by A.E.Houseman? What side is the shortest in the picture?A. GFB. DGC. EFD. GEF. DE What is the resistance of a bulb of 4owconnected in a line of 220v?2 7.5 7 2/5 7.69 in order what happened if we drinking 6 litres of water in three hours without taking a trip to the bathroom The equation represents the total resistance, r, when two resistorswhose resistances are r1 and r2 are connected in parallel. Find the totalresistance when r1 is x and r2 is x + 1. Highsmith Rental Company purchased an apartment building early in 2021. There are 20 apartments in the building and each is furnished with major kitchen appliances. The company has decided to use the group depreciation method for the appliances. The following data are available:Appliance Cost Residual Value Service Life (in Years)Stoves $15,000 $3,000 6Refrigerators 10,000 1,000 5Dishwashers 8,000 500 4In 2019, three new refrigerators costing $2,700 were purchased for cash. The old refrigerators, which originally cost $1,500, were sold for $200.Requried:a. Calculate the group depreciation rate, group life, and depreciation for 2016.b. Prepare the journal entries to record the purchase of the new refrigerators and the sale of the old refrigerators. The local humane society is trying to determine how many racoons there are in a city. They catch and tag 18 raccoons. Later on, they catch 67 raccoons, and 2 of them are tagged. What is the best estimate of the raccoon population? Answer to the closest whole number. A researcher submits her study for publication in a scientific journal. If one of the peer reviewers is concerned about the external validity of the study, what is the most important aspect of the study to consider? In Antigone, what is the chorus made up of and what does it represent? A. It's made up of Creon's friends and represents his royal courtiers. B. It's made up of the Theban elders and represents the Theban citizens. C. It's made up of women and children and represents the Theban minority. D. It's made up of Oedipuss family and represents the sorrowful state of their lives. 12y^2+12y-3y^3 = 124-(y+5) What is the value ofxin the equation-3/4 = x/24 Part 1: Solve for the slope of the line inside of the scatter plot The products in a decomposition reaction _____. are compounds can be elements or compounds are elements include an element and a compound