Marcelino Co.'s March 31 inventory of raw materials is $82,000. Raw materials purchases in April are $600,000, and factory payroll cost in April is $388,000. Overhead costs incurred in April are: indirect materials, $53,000; indirect labor, $28,000; factory rent, $36,000; factory utilities, $25,000; and factory equipment depreciation, $52,000. The predetermined overhead rate is 50% of direct labor cost. Job 306 is sold for $630,000 cash in April. Costs of the three jobs worked on in April follow.

Answers

Answer 1

Answer:

Gross Profit for Job 306 is $192,000

Step-by-step explanation:

Raw Material used $682,000

Indirect Material used $53,000

Indirect Labor $28,000

Factory rent $36,000

Factory utilities $25,000

Factory equipment depreciation $52,000

Total cost $876,000

Job 306 cost allocation :  $876,000 * 50% = $438,000

Revenue of Job 306 : $630,000

Gross Profit = $192,000


Related Questions

x3 + (y +z) factorize​

Answers

I think you wrote the question wrong this question is not factorable

Find the equation of a line perpendicular to 8x - 2y = 4 and passes through the point (4, 3).

Answers

y = -2x-3

Lines that are perpendicular have slopes that are negative reciprocals of each other. Meaning, if a line has slope  , then a line perpendicular to this has slope . That means the slope of our perpendicular line is

The equation of the line that is perpendicular to 8x - 2y = 4 and passes through the point (4, 3) is y = (-1/4)x + 4.

To find the equation of a line that is perpendicular to the line 8x - 2y = 4 and passes through the point (4, 3), we can use the fact that the slopes of perpendicular lines are negative reciprocals of each other.

First, let's rewrite the given equation in slope-intercept form (y = mx + b), where m represents the slope:

8x - 2y = 4

-2y = -8x + 4

Divide both sides by -2:

y = 4x - 2

The slope of the given line is 4.

The slope of a line perpendicular to this line would be the negative reciprocal of 4, which is -1/4.

Now, we have the slope (-1/4) and a point (4, 3). We can use the point-slope form of a linear equation:

y - y₁ = m(x - x₁)

Substituting the values, we have:

y - 3 = (-1/4)(x - 4)

Expanding and simplifying, we get:

y - 3 = (-1/4)x + 1

Adding 3 to both sides, we have:

y = (-1/4)x + 4

To learn more about equation click on,

https://brainly.com/question/20712656

#SPJ2

In right triangle ABC, AB = 3 and AC = 9. What is the measure of angle B to the nearest degree?

Answers

Answer:

90 degrees

Step-by-step explanation:

see image

make x A

y B

z C

AB=3 (given)

AC=9 (given)

measure of angel B or y, is 90

if

x= A

y= C

z= B

then the hypotenuse would be shorter than one of the legs

3<9

so B has to be the right angle (90 degrees)

What is the range of the given data set? OA) 30 OB) 32 OC) 37 OD) 40​

Answers

Answer:

Range = maximum number - minimum number

maximum number = 99minimum number = 62

Range = 99 - 62 = 37

Answer:

37

Step-by-step explanation:

The range is the difference between the highest number and the smallest number.

Looking at the stem and leaf plot we can identify the largest and smallest number

Largest number: 99

Smallest number: 62

If range = largest number - smallest number then range = 99 - 62 = 37

Chi needs to simplify the expression below. (1.25 -0.4)-7+4x3 Which operation should she perform first?

I need an answer quickly ​

Answers

Answer:

She should first perform the operation in the parentheses, you can reference the order of the operations based on PEMDAS.

Step-by-step explanation:

1. parentheses operations

2. multiply 4 x 3

3. add the value you get from the parentheses with -7

4. with that value add it to the product of 4 and 3

Hope that helped! :)

Answer:

Subtraction

Explanation:-

[tex]( 1.25 -0.4) \div7+ 4 \times 3[/tex]

Using BODMAS Rule:-

BracketsOrdersDivisionMultiplicationAdditionSubtraction

In bracket, the operation subtraction should be performed first .

What is the length of the altitude of the equilateral triangle below?

Answers

Answer:

E.  12

Step-by-step explanation:

The ratio of the lengths of the sides of a 30-60-90 triangle is

short leg : long leg : hypotenuse

1 : √3 : 2

The short leg is 4√3.

The long leg is √3 times the short leg.

a = 4√3 * √3 = 4 * √9 = 4 * 3 = 12

Answer: E.  12

Find the y-intercept of the following equation. Simplify your answer.
y = -10x -3/7

Answers

Answer: (0, -3/7)

Step-by-step explanation:

The Y-intercept would be the value of y when x is at 0, which is when the Y axis is intercepted. -3/7 is the starting position of the function when the the X = 0.

A wholesaler purchased an electric item for Rs 2,700 and sold to retailer at
10% profit. The retailer sold it at 20% profit to a consumer. How much did the
consumer pay for it.


PLZ PLZ HELP.......​

Answers

Step-by-step explanation:

10 % of 2700 = 270

so he had 2970 rupee

20% of 2970 = 594

so customer have to pay 2970 + 594 = 3564

12. PLEASE HELP ME
Which of the following are the coordinates of the vertex of y= x2 - 10x + 2?

A. (–10, 2)

B. (2, –10)

C. (–5, 23)

D. (5, –23)

Answers

Answer:

I think b no. is the correct answer

Answer:

D. (5, –23)

Step-by-step explanation:

The vertex is in essence the turning point of the parabola y = x² − 10x + 2

the x coordinate of the turning point =  

                                                        =  

                                                        =  5

when x = 5, y = (5)² - 10(5) + 2

                     = -23

Thus coordinate or vertex is ( 5, -23)

5 right 23 down

Nghiệm của bất phương trình | 2x - 3| - 1 <0

Answers

Answer:

x = 1 và 2       x= 1 and 2

Step-by-step explanation:

Đầu tiên trừ đi 1 để được 2x-3 nhỏ hơn -1 sau đó bạn lập phương trình bằng 2x-3 = -1 và 2x-3 = 1 để nhận được kết quả cuối cùng là 1 và 2 do đó x = 1 và 2

First subtract 1 to get 2x-3 is less then -1 then you let the equation equal 2x-3=-1 and 2x-3=1 to get a final answer of 1 and 2 therefore x=1 and 2

In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results.

6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5

Construct a dotplot with these data and then identify the dotplot you created.

Answers

Answer:

The average, mode, and median of the results are 5, meaning that half of the time the quarter will land on heads.

Step-by-step explanation:

The required dot plot shows the result of the experiment performed by flipping a quarter 21 times.


In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results. 6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5.


What is arithmetic?

In mathematics, it deals with numbers of operations according to the statements. There are four major arithmetic operators, addition, subtraction, multiplication, and division,

What is Statistic?

Statistics is the study of mathematics that deals with relations between comprehensive data.

Here,
The dot plot has been made, for the number of outcomes and their frequencies. The dot plot gives the info about the mean mode and median.

Thus, the required a dot plot showing the result of the experiment performed by flipping a quarter 21 times.

Learn more about arithmetic here:

brainly.com/question/14753192

#SPJ2

x = 3

x = 5

x = 0

x = 2

Answers

Answer:

x=2 is incorrect

Step-by-step explanation:

Y(2)=(3/4)*x^2=(3/4)*4=3

Use what you know about sine, cosine, and tangent to calculate the height of the buildings in the diagram below.

Answers

Answer:

x = 32 feet

Step-by-step explanation:

By applying tangent rule in ΔACD,

tan(40°) = [tex]\frac{\text{Opposite side}}{\text{Adjacent side}}[/tex]

             = [tex]\frac{AB+AC}{CD}[/tex]

             = [tex]\frac{x+BC}{87}[/tex]

x + BC = 73 -----(1)

By applying tangent rule in ΔBCD,

tan(25°) = [tex]\frac{BC}{CD}[/tex]

             = [tex]\frac{BC}{87}[/tex]

BC = 40.57

By substituting the value of BC in equation (1),

x + 40.57 = 73

x = 32.43

x ≈ 32 feet

Geometry, please answer question ASAP

Answers

Answer:

Triangle ACB =~ triangle DFE, by adding 6 units to each side of both triangles their relationship will not change. They are still similar.

Step-by-step explanation:

The answer isn't great in all honesty but it's been a long time since I took geometry and I don't 100% remember the proper way of stating it. Though I am 100% sure they stay similar.

Sorry couldn't be of more help but figured something was better then nothing

If C.P. = Rs. 480, S.P. =Rs.528 find profit and profit percent​

Answers

In this question first you should find profit amount by using formula and you should use profit amount in profit percentage formula then you should calculate it

ntroduction to Functions
Assignment Active
Creating a Function from a Mapping
The mapping shows a relationship between input and
output values.
Input
Output
Which ordered pair could be removed to make this
relation a function?
O (-5,0)
0 (-1, -3)
O (4, -2)
O (6,-1)

Answers

Answer:

To be a function, each input must only have one output. In this case, input 4 has two outputs, so (4 , -2) can be removed for it to be a function.

Let me know if you have any other questions!

The ordered pair (4,2) could be removed to make the given relation a function.

What is the relation?

A relation is a function if for every input (x-value) there is exactly one output (y-value).

If there are two or more ordered pairs with the same x-value but different y-values, then the relation is not a function. In this case, one of those ordered pairs would need to be removed in order to make it a function.

As per the question, the relation was given as {(-5,0), (2, -3), (-1, -3), (4, -2), (4, -2), (6,-1)}, the ordered pair (4,-2) would need to be removed because there are two outputs (-2 and 2) for the input of 4.

Thus, removing (4,2) would result in the function.

Learn more about the relations here:

https://brainly.com/question/29207494

#SPJ7

Given the function f(x) = -2c + cx - x^2? and f^-1(5) = -1, find c.

Answers

Answer:

c = - 2

Step-by-step explanation:

Given inverse function

[tex]f^{-1}[/tex] (5) = - 1 , then

f(- 1) = 5 , that is

- 2c + c(- 1) - (- 1)² = 5

- 2c - c - 1 = 5

- 3c - 1 = 5 ( add 1 to both sides )

- 3c = 6 ( divide both sides by - 3 )

c = - 2

Find the nth term of each of the sequences.
(a) 16, 19, 22, 25, 28, ...
(b) 1,3,9,27,81,...

Answers

Answer:

a) 16, 19, 22, 25, 28, 31, 34, 37, 40

b) 1, 3, 9, 27, 81, 243, 729, 2187

Explanation:

a) Add 3 on every number.

b) Multiply every number by 3.

X+y=2 và x-y=4 tim x và y

Answers

Step-by-step explanation:

X

[tex]xx - xxyy - yy = 8[/tex]

The velocity of a particle moving along a straight line is given by v(t)=6t2+4t−5 cm/sec at time t seconds with initial position s(0)=3 cm. What is the position of the particle at t=2 seconds, in cm?

Answers

Answer:

s(2) = 17 cm

Step-by-step explanation:

We are told that the velocity function is;

v(t) = 6t² + 4t − 5 cm/sec

Integral of velocity gives distance.

Thus;

s(t) = ∫v(t) = ∫6t² + 4t − 5

s(t) = 2t³ + 2t² - 5t + c

We are told that s(0)=3 cm

Thus;

s(0) = 2(0)³ + 2(0)² - 5(0) + c = 3

Thus; c = 3

Thus;

s(t) = 2t³ + 2t² - 5t + 3

At t = 2 secs

s(2) = 2(2)³ + 2(2)² - 5(2) + 3

s(2) = 17 cm

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

Please find the missing number for the surface area. I will mark brainiest if correct. 2.

Answers

It is 18 because it is a square so all the sides have to be the same so that would make it 18

Rewrite
4/10 : 1/25 as a unit rate.

A: 10:1
B: 25:4
C: 2:125
D: 100:1

Answers

Answer:

4/10 : 1/25

4/10 / 1/25 = 4/10 x 25/1 = 100/10 = 10.

10 can also be written as 10:1, so A is correct.

Hope this helps!

Find the center and foci of the ellipse: 9x2 + 16y² + 126x + 96y + 441 = 0

Answers

Center : ( –7 , –3 )Focus 1: (–7 + √7 , –3 )Focus 2: ( –7 –√7 , –3 )

[tex] \frac{(x + 7)^{2} }{16} + \frac{(y + 3) ^{2} }{9} = 1 \\ \frac{(x - h)^{2} }{ {a}^{2} } + \frac{(y - k)^{2} }{ {b}^{2} } = 1[/tex]

a= 4 , b= 3 , k = – 3 , h = –7

The center: ( h , k ) —> ( –7 , –3 )

[tex]c = \sqrt{ {a}^{2} - {b}^{2} } = \sqrt{ {4}^{2} - {3}^{2} } \\ = \sqrt{16 - 9} = \sqrt{7} [/tex]C = √7

Focus 1: ( h + c , k ) —> ( –7 + √ 7 , –3 )

Focus 2: ( h – c , k ) —> ( –7 –√7 , –3 )

I hope I helped you^_^

looking for the equation, slope, and y-intercept of: (1,-3) and (0,-1)

Answers

Answer:

Equation: y = -2x - 1

Slope: -2

Y intercept: -1

Step-by-step explanation:

First, find the slope using rise over run, (y2 - y1) / (x2 - x1):

(y2 - y1) / (x2 - x1)

(-1 + 3) / (0 - 1)

2 / -1

= -2

So, the slope is -2. Plug this and a point into slope intercept form, y = mx + b, and solve for b:

y = mx + b

-1 = -2(0) + b

-1 = 0 + b

-1 = b

So, the y intercept is -1. Create the equation by plugging in the slope and b into y = mx + b:

y = mx + b

y = -2x - 1

The equation of the line is y = -2x - 1.

Answer: y=-2x-1. Slope is -2 and y int. is -1.

Step-by-step explanation:

First, you need to find the slope by using the slope formula y2-y1/x2-x1. Plug in the x and y coordinates, which simplifies as -1-(-3)/0-1, and furthermore to 2/-1, or -2. The y intercept can be found by the second point, (0,-1). Therefore, the y int. is -1.

On a separate piece of graph paper, graph y=-Ixl +3 then click on the graph until the correct one appears.

Answers

Answer:

That is the graph for y = -|x| + 3

What is the smallest prime number that is also a multiple of 29?

Answers

Answer:

If you like my answer than please mark me brainliest thanks. A prime number is never multiple of any number it is always multiple of itself and 1 . But your answer is 29 itself

What is a ratio that is equivalent to 12:35?

Answers

Answer:

0.3429 is a decimal and 34.29/100 or 34.29% is the percentage for 12/35.

Answer:

24 : 70

Step-by-step explanation:

12 : 35

Multiply each side by 2

12*2  : 35*2

24 : 70

(x-4)°=1
giải hộ em với ạ

Answers

Answer: 5

Step-by-step explanation:

⇒ (x - 4) = 1

⇒ x = 1 + 4

⇒ x = 5

Therefore value of x = 5

Answered by Gauthmath must click thanks and mark brainliest

The foot of a ladder is placed 10 feet from a wall. If the top of the ladder rests 13 feet up on the wall, find the length of the ladder.

Answers

10 squared + 13 squared = your answer squared.
So do that then take the square root of whatever you get.
Other Questions
FOR BRAINLIEST ANSWER ONLY THE GIVEN-NUMBERS:2. 3.4. Why is it important to know where pots will be kept ?Note :- please copy and write answers from other websites, I need your own answers... Making rough estimates of physical quantities is usefulA. So that you can see if the answer to a problem makes physical sense.B. Because we only use approximate numbers in problems.C. Because the laws we use are not exact, so using exact numbers is not crucial.D.So that you can compute answers doing simpler math. What does a claim of policy argue?O A. Whether or not a specific action should take placeO B. Whether something is morally right or wrongC. Whether one thing causes another to happenD. Whether something is an accepted fact or not plzzzz helppp only have 30 minsss left Plsss help!! In triangle ABC, AC=13, BC=84, and AB=85. Find the measure of angle C To graph the equation 2x + 5y = 10, Zeplyn draws a line through the points (5, 0) and (0, 2). What is the slope of the line represented by 2x + 5y = 10? What was the significance of the Brown v. Board of Education decision?It ended school segregation forever.It ended racist politicians' control over the South.It solidified the advances of Plessy v. Ferguson.It was the first major victory for civil rights. what did you bring with you to move to the west in the 1840spls help Mr. Johannsen is entitled to Medicare Part A and Part B. He gains the Part D low-income subsidy. How does that affect his ability to enroll or disenroll in a Part D plan? An appliance uses 120 W. If this appliance is on for 8 hours a day, how much CO2 will this produce in the month of April? When considering the mobility aspect of cloud-based enterprise systems, it's important to consider that with a cloud-based system, employee can access information from _____. An experiment consists of tossing a pair of balanced, six-sided dice. (a) Use the combinatorial theorems to determine the number of sample points in the sample space S. 36 Correct: Your answer is correct. sample points (b) Find the probability that the sum of the numbers appearing on the dice is equal to 6. (Round your answer to four decimal places.) what makes venus the hottest planet among the planets in the solar system it is the test because of theA. frozen ice and dust in its atmosphereB. presence of hydrogen and helium in the atmosphereC. dense clouds of carbon dioxide that causes the greenhouse effectD. comets meteor asteroids and other heavenly bodies in the solar system 1. He failed in the election just because he ___________ his opponent. write an example of a monomial of degrees 5 The radius of the large sphere is times longer than the radius of the small sphere.How many times the volume of the large sphere is the volume of the small sphere?Help! Help! Help! Please! Saving is a leakage in the sense that:______. a. saving is lost to the economy and ultimately leads to stagnation. b. it often accompanies a trade deficit. c. consumers spend less than their total income. d. the financial system often makes negative profits. The reversible reaction: 2SO2(g) O2(g) darrow-tn.gif 2SO3(g) has come to equilibrium in a vessel of specific volume at a given temperature. Before the reaction began, the concentrations of the reactants were 0.060 mol/L of SO2 and 0.050 mol/L of O2. After equilibrium is reached, the concentration of SO3 is 0.040 mol/L. What is the equilibrium concentration of O2 is it okay for a 14-year-old to weigh 120 pounds