Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.

a. True
b. Flase

Answers

Answer 1

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.


Related Questions

The chemical formula is different from the empirical formula in

Answers

Answer:be careful and relax

Explanation:

Answer:

Hahaha be careful and relax

Observe as equações e de acordo com Brönsted-Lowry, os compostos destacados são, respectivamente

Answers

answer

j'ai besoin d'aide

=]

<3

Draw a sketch showing what osmotic pressure is. Label on the sketch solute, solvent, hypertonic, hypotonic and semi permeable membrane.

Answers

Can you provide pictures please ??

Question 1
1 pts
How many mols of bromine are present in 35.7g of
Tin(IV) bromate?

Answers

Answer:

n = 0.0814 mol

Explanation:

Given mass, m = 35.7g

The molar mass of Tin(IV) bromate, M = 438.33 g/mol

We need to find the number of moles of bromine. We know that,

No. of moles = given mass/molar mass

So,

[tex]n=\dfrac{35.7}{438.33}\\\\n=0.0814\ mol[/tex]

So, there are 0.0814 moles of bromine in 35.7g of  Tin(IV) bromate.

Zn-64 = 48.63%
Zn-66 = 27.90%
Zn-67 = 4.10%
Zn-68 = 18.75%
Zn-70 = .62%
Calculate the average atomic mass/given their percent abundance

Answers

Answer:

A = 65.46 u

Explanation:

Given that,

The composition of zinc is as follows :

Zn-64 = 48.63%

Zn-66 = 27.90%

Zn-67 = 4.10%

Zn-68 = 18.75%

Zn-70 = .62%

We need to find the  average atomic mass of the given element. It can be solved as follows :

[tex]A=\dfrac{48.63\times 64+27.90\times 66+4.1\times 67+18.75\times 68+0.62\times 70}{100}\\A=65.46\ u[/tex]

So, the average atomic mass of zinc is 65.46 u.

What mass of steam initially at 120oC is needed to warm 200g of water in a glass container from 20.0 oC to 50.0 oC

Answers

Complete question:

What mass of steam initially at 120 ⁰C is needed to warm 200g of water in a 100 g glass container from 20.0 oC to 50.0 ⁰C

Answer:

the initial mass of the steam is 10.82 g

Explanation:

Given;

mass of water, m₁ = 200 g

mass of the glass, m₂ = 100 g

temperature of the steam = 120 ⁰C

initial temperature of the water, 20⁰ C

final temperature of the water, = 50⁰ C

let the mass of the steam = m

specific heat capacity of water c = 1 cal/g ⁰ C

specific heat capacity of glass c₂ = 0.2 cal/g ⁰ C

laten heat of vaporization of steam L = 540 cal/g

Apply principle of conservation energy;

Heat given off by the steam = Heat absorbed by water + heat absorbed by glass

[tex]mc\Delta T_1 + mL + mc\Delta T_2 = m_1c\Delta T_3 + m_2c_2\Delta T_3\\\\mc\Delta T_1 + mL + mc\Delta T_2 = [m_1c + m_2c_2]\Delta T_3[/tex]

m(1) (120 - 100)  +  m(540)  + m(1) (100 - 50) = [200(1)  +  100(0.2)] (50 - 20)

20m + 540m + 50m = 6600

610 m = 6600

m = 6600 / 610

m = 10.82 g

Therefore, the initial mass of the steam is 10.82 g

Assuming equal concentrations and complete dissociation, rank these aqueous solutions by their freezing points from highest to lowest. CoCl3, NH4Cl, Li2SO4

Answers

Answer:

NH4Cl > Li2SO4 > CoCl3

Explanation:

Let us recall that the freezing point depression depends on the molality of the solution and the number of particles present.

Let us also recall that freezing point depression is a colligative property. It depends on the number of particles present in solution.

Usually, the more the number of particles present, the lower the freezing point. Hence, NH4Cl which has only two particles will have the highest freezing point while CoCl3 which has four particles will have the lowest freezing point.

Draw the Lewis structure for the polyatomic formate anion. Be sure to include all resonance structures that satisfy the octet rule.

Answers

Answer:

Lewis structure of polyatomic formate anion.

Explanation:

To draw Lewis structure for any chemical species,

1)Count the total number of valence electrons present in it.

This can be obtained by adding valence electrons of each constituent atom.

2)Arrange those valence electrons in such a way that each atom should attain eight electrons around it to satisfy octet theory.

The structure of formate ion and its Lewis structure are shown below:

HCOO- is the formate ion.

It has total:

1+4+6+6+1 = 18 valence electrons.

Since, hydrogen has one, carbon has four and oxygen has six valence electrons and the charge of the anion is one.

Arrange this 18 electrons in such a way that each atom should get 8 electrons around it.

Resonance structures of formate ion:

How much carbon dioxide is released when it is fully combusted with 4Kg of ethanol with more than enough oxygen? How do you work it out?

Answers

Answer:

7.640 kg

Explanation:

Step 1: Write the balanced complete combustion equation for ethanol

C₂H₆O + 3 O₂ ⇒ 2 CO₂ + 3 H₂O

Step 2: Calculate the moles corresponding to 4 kg (4000 g) of C₂H₆O

The molar mass of C₂H₆O is 46.07 g/mol.

4000 g × 1 mol/46.07 g = 86.82 mol

Step 3: Calculate the moles of CO₂ released

86.82 mol C₂H₆O × 2 mol CO₂/1 mol C₂H₆O = 173.6 mol CO₂

Step 4: Calculate the mass corresponding to 173.6 moles of CO₂

The molar mass of CO₂ is 44.01 g/mol.

173.6 mol × 44.01 g/mol = 7640 g = 7.640 kg

During a reaction, ΔH for reactants is −750 kJ/mol and ΔH for products is 920 kJ/mol. Which statement is correct about the reaction? (5 points)

Group of answer choices

It is endothermic because the energy required to break bonds in the reactants is less than the energy released when the products are formed.

It is endothermic because the energy required to break bonds in the reactants is greater than the energy released when the products are formed.

It is exothermic because the energy required to break bonds in the reactants is less than the energy released when the products are formed.

It is exothermic because the energy required to break bonds in the reactants is greater than the energy released when the products are formed.

Answers

Answer: The statement it is endothermic because the energy required to break bonds in the reactants is less than the energy released when the products are formed, is true.

Explanation:

A chemical reaction in which heat energy  is released is called an exothermic reaction. For exothermic reactions, the value of [tex]\Delta H[/tex] is always negative.

A chemical reaction in which heat energy is absorbed is called an endothermic reaction. For endothermic reaction, the value of [tex]\Delta H[/tex] is always positive.

In endothermic reactions, energy required for breaking the bonds between reactants is less than the energy when products are formed due to which the value of [tex]\Delta H[/tex] remains positive.

Thus, we can conclude that the statement it is endothermic because the energy required to break bonds in the reactants is less than the energy released when the products are formed, is true.

It is endothermic because the energy required to break bonds in the reactants is greater than the energy released when the products are formed. The correct option is B.

The above reaction is endothermic because more energy is produced when new bonds form in the products (H = 920 kJ/mol) than is required to break bonds in the reactants (H = -750 kJ/mol).

In an endothermic process, more energy than is generated during bond creation is absorbed from the environment to dissolve existing bonds. This causes a net absorption of energy, which cools the system.

The reaction takes more energy than it releases, proving its endothermic nature, as seen by the positive difference between the energy needed to dissolve bonds and the energy released during bond formation.

Thus, the correct option is B.

For more details regarding endothermic process, visit:

https://brainly.com/question/28909381

#SPJ3

Your question seems incomplete, the probable complete question is:

During a reaction, ΔH for reactants is −750 kJ/mol and ΔH for products is 920 kJ/mol. Which statement is correct about the reaction? (5 points)

Group of answer choices

A. It is endothermic because the energy required to break bonds in the reactants is less than the energy released when the products are formed.

B. It is endothermic because the energy required to break bonds in the reactants is greater than the energy released when the products are formed.

C. It is exothermic because the energy required to break bonds in the reactants is less than the energy released when the products are formed.

D. It is exothermic because the energy required to break bonds in the reactants is greater than the energy released when the products are formed.

The first law of thermodynamics defines chemical energy. defines entropy. is a statement of conservation of energy. provides a criterion for the spontaneity of a reaction.

Answers

Answer: The first law of thermodynamics is a statement of conservation of energy.

Explanation:

According to the first law of thermodynamics, heat provided to a system is actually the sum of internal energy and work done by the system or on the system.

Mathematically, [tex]\Delta Q = \Delta U + \Delta W[/tex]

The first law of thermodynamics also means that energy can neither be created nor it can be destroyed. Hence, energy is conserved.

Thus, we can conclude that the first law of thermodynamics is a statement of conservation of energy.

Sugar is added to water and initially completely dissolves, but eventually solid sugar collects on the bottom of the container. Sugar and water are ________partially miscible . This produces a dynamic equilibrium. Ethanol (a liquid) is added to water and only a single layer is observed no matter how much ethanol is added. Ethanol and water are__________

Answers

Answer: Sugar is added to water and initially completely dissolves, but eventually solid sugar collects on the bottom of the container. Sugar and water are both partially miscible. This produces a dynamic equilibrium. Ethanol (a liquid) is added to water and only a single layer is observed no matter how much ethanol is added. Ethanol and water are miscible.

Explanation:

When a substance (solute) dissolves partially in a solvent then it is known as partially miscible in the solvent. In such cases, a small amount of solute remains at the bottom of solution.

If a solute dissolves completely in solvent like water such that only one layer is seen in the solution then it means that the solute is miscible in solvent.

Thus, we can conclude that sugar is added to water and initially completely dissolves, but eventually solid sugar collects on the bottom of the container. Sugar and water are both partially miscible. This produces a dynamic equilibrium. Ethanol (a liquid) is added to water and only a single layer is observed no matter how much ethanol is added. Ethanol and water are miscible.

The position of the equilibrium for a system where K = 6.4 × 10 9 can be described as being favoring ________________

Answers

Answer:

to the right (products side)

Explanation:

The equilibrium constant K describes the ratio between the concentration of products and reactants at equilibrium. For a general reaction:

a A + b B → c C + d D

The equilibrium constant expression is:

[tex]K = \frac{[C]^{c} [D]^{d} }{[A]^{a} [B]^{b} }[/tex]

A low value of K indicates that the concentration of products (C and D) is low in relation with the concentration of reactants (A and B).

Conversely, a high value of K indicated that the concentration of products is high compared with the concentration of reactants.

Since K = 6.4 × 10⁹ is a high value, the concentration of products is higher than the concentration of reactants at equilibrium. Thus, the position of the equilibrium is favored to the right.

17. The density of a population would influence which limiting factor?
O niche
O growth rate
O weather
O space

Answers

Answer:

The answer is growth rate

Explanation:

it will help you

formula of
Al³⁺ and SO₄²⁻

Answers

Answer:

The formula of Al³⁺ and SO₄²⁻ is aluminum sulfate.

Explanation:

The formula for aluminum sulfate is Al₂(SO₄)₃. If we say in terms of ions. The ions are Al³⁺. It is a positive ion or the cation. Other ion is SO₄²⁻. It is sulfate ion. It is anion.

Aluminum sulphate is used in water purification and as a mordant in dyeing and printing textiles.

Hence, the formula of Al³⁺ and SO₄²⁻ is aluminum sulfate.

Give the following reaction: ammonium nitrate—> dinitrogen monoxide + water.
a.) Write a complete balanced chemical equation.
b.) Calculate the number of molecules of water produced by 11.2g of ammonium nitrate

Answers

Answer:

a) NH₄NO₃ ⇒ N₂O + 2 H₂O

b) 1.69 × 10²³ molecules

Explanation:

Step 1: Write the balanced equation

NH₄NO₃ ⇒ N₂O + 2 H₂O

Step 2: Convert 11.2 g of NH₄NO₃ to moles

The molar mass of NH₄NO₃ is 80.04 g/mol.

11.2 g × 1 mol/80.04 g = 0.140 mol

Step 3: Calculate the moles of H₂O produced

0.140 mol NH₄NO₃ × 2 mol H₂O/1 mol NH₄NO₃ = 0.280 mol H₂O

Step 4: Calculate the number of molecules in 0.280 moles of water

We will use Avogadro's number.

0.280 mol × 6.02 × 10²³ molecules/1 mol = 1.69 × 10²³ molecules

Acetic acid and water react to form hydronium cation and acetate anion, like this:

HCH3CO2(aq) + H2O → H3O+(l)(aq) + CH3CO2^-(aq)

Imagine 226 mmol of CH3CO2- are added to a flask containing a mixture of HCH3CO2, H2O, H3O + and CH3CO2- at equilibrium.

Required:
What is the rate of the reverse reaction before any CH3CO2^- has t:een added to the flask?

Answers

Answer:

The rate of the reverse reaction before any addition of CH3CO2- is zero

Explanation:

When the reaction is in equilibrium:

HCH3CO2(aq) + H2O ⇄ H3O+(l)(aq) + CH3CO2^-(aq)

The reaction quotient, Q = Ka and no more products or reactants are produced because their concentrations are in the right proportion.

Now, as no reaction occurs,

The rate of the reverse reaction before any addition of CH3CO2- is zero

What happens when Sulphur dioxide (so2) gas is passed through an acidified solution of hydrogen . sulfide (H₂S) gas : ​

Answers

Answer:

When SO

2

is passed through an acidified solution of H

2

S, sulphur is precipitated out according to the reaction.

2H

2

S+SO

2

→2H

2

O+3S

Which of the following was NOT explained by Dalton's atomic theory?
ANSWER:
A. the Law of Multiple Proportions
B. the difference between elements and compounds
C.?the difference between isotopes of an element
D. the Law of Conservation of Mass

Answers

Answer:

A. the Law of Multiple Properties

Answer:

A. the law of multiple proportions

Which is the primary type of radiation from the sun that is absorbed by the ozone layer?
A. infrared radiatin
B. UV-B
C. X-rays
D. UV-C
E. UV-A

Answers

the answer to the question is B.UV-B

Calculate the volume in liters of a 1.60 mol/L sodium nitrate solution that contains of sodium nitrate . Round your answer to significant digits.

Answers

Answer:

1.5L of NaNO3 must be present

Explanation:

That contains 200g of sodium nitrate. Round to 2 significant digits

To solve this question we need to convert the mass of NaNO3 to moles using its molar mass (85g/mol). With the moles and the molar concentration we can find the volume in liters of the solution:

Moles NaNO3:

200g * (1mol / 85g) = 2.353 moles NaNO3

Volume:

2.353 moles NaNO3 * (1L / 1.60moles) =

1.5L of NaNO3 must be present

A 46.6-mgmg sample of boron reacts with oxygen to form 150 mgmg of the compound boron oxide. Part A What is the empirical formula of boron oxide

Answers

Answer:

B₂O₃

Explanation:

Step 1: Calculate the mass of oxygen in 150 mg of boron oxide

Of 150 mg of boron oxide, 46.6 mg belong to boron. The mass of oxygen is:

150 mg - 46.6 mg = 103.4 mg

Step 2: Calculate the percent by mass of each element

We will use the following expression.

%Element = mElement/mCompound × 100%

%B = 46.6 mg/150 mg × 100% = 31.1%

%O = 103.4 mg/150 mg × 100% = 68.9%

Step 3: Divide each percentage by the atomic mass of the element

B: 31.1/10.81 = 2.88

O: 68.9/16.00 = 4.31

Step 4: Divide both numbers by the smallest one (2.88)

B: 2.88/2.88 = 1

O: 4.31/2.88 ≈ 1.5

Step 5: Multiply both numbers by 2 so that they are integers

B: 1 × 2 = 2

O: 1.5 × 2 = 3

The empirical formula is B₂O₃.

g Elimination reaction simulation, Kim had tried to prepare cyclohexene from cyclohexanol using HCl as a catalyst, but he got a weird side product cyclohexyl chloride. Cyclohexyl chloride is formed possibly from the side reaction called A. SN1 substitution reaction B. E2 reaction C. E1 reaction D. SN2 substitution reaction

Answers

Answer:

SN1 substitution reaction

Explanation:

cyclohexanol is a secondary alkanol. The mechanism of acid catalysed dehydration of cyclohexanol involves the protonation of the -OH group.

This is followed by loss of water which is a good leaving group. At this stage, a proton could be abstracted to yield cyclohexene by E1 mechanism or an SN1 substitution reaction may occur to yield Cyclohexyl chloride.

The both reactions are equally likely.

A student dropped a pea size amount of K2CO3 into a solution of HCl(aq). He observed the formation of gas bubbles and collected the gas into another test tube. The student performed a splint test and observed that the splint was extingished when he placed the splint into the test tube of the gas. What can be said about the results of this students experiment?

a. The student completed the experiment correctly and there were no errors in the experiment.
b. The experiment was performed incorrectly. K2CO3 doesn't react with HCl. Therefore, the student picked up the wrong compound when conducting the experiment.
c. The student performed the splint test incorrectly. He should of observed the splint flare up when the splint was placed in the test tube.
d. The student performed the splint test incorrectly. He should of observed a popping sound when the splint was placed in the test tube.

Answers

Answer:

The student completed the experiment correctly and there were no errors in the experiment.

Explanation:

When a pea size amount of K2CO3 is dropped into a solution of HCl, the following reaction occurs;

K2CO3(s) + 2HCl(aq) ----> 2KCl(aq) + CO2(g) + H2O(l)

The gas CO2 does not support burning hence, when the student performed a splint test and observed that the splint was extinguished when he placed the splint into the test tube of the gas.

Hence, the experiment was properly conducted and the student completed the experiment correctly and there were no errors in the experiment.

A balloon contains 0.118 mol of gas and has a volume of 2.58 L . If an additional 0.116 mol of gas is added to the balloon (at the same temperature and pressure), what will its final volume be? Can you also show the work so I can understand why is it that answer. thank you

Answers

Answer:

v2=5.11L

Explanation:

given

v1=2.58L

N1=0.118mol

N2=0.234

v2=x

according to charles law V1/N1=V2/N2

2.58/0.118=V2/0.234

21.86=V2/0.234

21.86×0.234= v2

5.116L=v2

5.116L is the

answer or u can simplify it and make 5.1 L

Identify the intermolecular attractions for dimethyl ether and for ethyl alcohol. Which molecule is expected to be more soluble in water? Explain.

Answers

Answer:

See explanation

Explanation:

All molecules possess the London dispersion forces. However London dispersion forces is the only kind of intermolecular interaction that exists in nonpolar substances.

So, the only kind of intermolecular interaction that exists in dimethyl ether is London dispersion forces.

As for ethyl alcohol, the molecule is polar due to the presence of polar O-H bond. In addition to London dispersion forces, dipole-dipole interactions and specifically hydrogen bonding also occurs between the molecules.

Because ethyl alcohol is polar, it is more soluble in water than dimethyl ether.

11th grade chemistry question will mark brainliest
2.50 g of CO2 gas is confined in a rigid cylinder at a pressure
of 4.65 atm. If 0.42 g of gas is released from the cylinder,
what is the new pressure?

Answers

Answer:

3.88 atm

Explanation:

We'll begin by calculating the number of mole of CO₂ in each case. This can be obtained as follow:

For 2.50 g of CO₂:

Mass of CO₂ = 2.5 g

Molar mass of CO₂ = 12 + (2×16) = 44 g/mol

Mole of CO₂ =?

Mole = mass / molar mass

Mole of CO₂ = 2.5 / 44

Mole of CO₂ = 0.06 mole

For 0.42 g of CO₂:

Mass of CO₂ = 2.5 g

Molar mass of CO₂ = 44 g/mol

Mole of CO₂ =?

Mole = mass / molar mass

Mole of CO₂ = 0.42 / 44

Mole of CO₂ = 0.010 mole

Finally, we shall determine the new pressure. This can be obtained as follow:

Initial mole (n₁) = 0.06 mole

Initial pressure (P₁) = 4.65 atm

Final mole (n₂) = 0.06 – 0.010 = 0.05 mole

Final pressure (P₂) =?

NOTE: Temperature and volume is constant.

P₁ / n₁ = P₂ / n₂

4.65 / 0.06 = P₂ / 0.05

Cross multiply

0.06 × P₂ = 4.65 × 0.05

0.06 × P₂ = 0.2325

Divide both side by 0.06

P₂ = 0.2325 / 0.06

P₂ = 3.88 atm

Thus, the new pressure is 3.88 atm.

g A sample of chlorine gas starting at 681 mm Hg is placed under a pressure of 991 mm Hg and reduced to a volume of 513.7 mL. What was the initial volume, in mL, of the chlorine gas container if the process was performed at constant temperature?

Answers

Answer:

747.5 mL

Explanation:

Assuming ideal behaviour, we can solve this problem by using Boyle's law, which states that at constant temperature:

P₁V₁ = P₂V₂

Where in this case:

P₁ = 681 mm HgV₁ = ?P₂ = 991 mm HgV₂ = 513.7 mL

We input the data given by the problem:

681 mm Hg * V₁ = 991 mm Hg * 513.7 mL

And solve for V₁:

V₁ = 747.5 mL

How does science help us understand events in the natural world, and what is chemistry's role in understanding these interactions?

Answers

Answer:

See explanation

Explanation:

Science as a body of knowledge seeks to understand the processes that occur in nature so as to offer plausible explanations to those processes as well as redesign nature for our benefit.

Hence, science is an inquiry into nature with the aim to improve the life of the general population of the world.

Chemistry is the study of matter and the changes that matter undergoes. Chemistry lies at the very foundation of science since changes in matter is the basis for the processes that occur in nature.

Hence, chemistry plays a critical role in understanding nature as well as amending nature to improve the living condition of the world's rapidly growing population.

Draw the structure of the alkene with the molecular formula C6H10 that reacts with Br2 to give this compound.

Answers

Answer: Please, this question is not complete. I have attached the complete question.

The answer is in the attached picture below

Explanation:

The explanation is in the attached picture below

The structure of the alkene with the molecular formula [tex]C_6H_1_0[/tex] that reacts with [tex]Br_2[/tex]to give this compound is an alkene  called 1-hexene

How do we explain?

The alkene is called 1-hexene. It has a double bond between the first and second carbon atoms. When it reacts with Br2, the bromine atoms add to the double bond, resulting in the formation of 1,2-dibromohexane.

The reaction is a radical addition reaction. The first step is the formation of a radical by the homolytic cleavage of one of the bromine atoms in Br2. This radical then adds to the double bond in the alkene, forming a new radical. The second bromine atom then adds to the radical, forming 1,2-dibromohexane

Learn more about addition reaction at:

https://brainly.com/question/1433809

#SPJ6

Other Questions
4. In the game you just witnessed, Rock Paper Scissors, when students are eliminated, they must them follow their defeater around and cheer. What is the objective(s) of this game and why is it important in theater arts? Reflect on the importance of games in the classroom and what students learn from them. My cousins and I went fishing last weekend. We were catching a boatload of fish, but then a problem sprang up. The boat started taking on water, quickly! We had to jump out and swim to shore. We were dead tired after that. The boat sank quicker than the Titanic. Luckily, we werent too far from shore.What allusion does this passage include? What type of allusion is this? Write a polynomial f (x) that satisfies the given conditions. Polynomial of lowest degree with zeros of -4 (multiplicity 3), 1 (multiplicity 1), and with f(0) = 320. HELP ME !Please! Which of the following tables represents a function? 2Solve the equation log, (3t+9) - log, 21 =1 Triangle A'B'C' is formed by a reflection over x = 1 and dilation by a scale factor of 2 from the origin. Which equation shows the correct relationship between AABCand A'B'C'? plz help me out with the answer and explaination A tortoise moves forward 15 meters in one hour. It turns around and crawls 10 meters in thenext hour. Finally, in the third hour, it turns around again and crawls 8 more meters. Howmuch did the tortoise walk in total in 3 hours? The Li2+ ion is very similar to the hydrogen atom, in that it has one electron and energy levels similarto the hydrogen atom. However, the relation = (12 12) cannot be used for this ion butrather the relation = 2+ (12 12) where the constant 2+=1.96x10-17J.Use this relation to determine the third ionization energy, which is energy required to remove the lastelectron from a Li2+ ion in kJ/mol, if the ion starts off in the ground state (Li2+ Li3+ + e-). a. Consider the situation where you have three game chips, each labeled with one of the the numbers 3, 5, and 10 in a hat a. If you draw out 2 chips without replacement between each chip draw, list the entire sample space of po ssible results that can occur in the draw Use the three events are defined as follows, to answer parts b through n below: Event A: the sum of the 2 drawn numbers is even. Event B: the sum of the 2 drawn numbers is odd. Event C: the sum of the 2 drawn numbers is a prime number Now, using your answer to part a find the following probability values b. P (A)= c. P (B)=d. P (C)= e. P (A and C)-= f. P(A or B)=g. P (B andC)= h. P(A or C)- =i. P (C given B)= j. P(C given A)=k. P (not B)=l. P (not C)=Are events A and B mutually exclusive?Why or why not? Are events B and C mutually exclusive? Why or why not? 9. Suppose Betty saves $200 each month in her 401(k) account. How much less will her monthly take-home pay be than if she saved nothing? (Assume a combined 20% state and federal income tax rate.) 17. All the guests seemed to have enjoyed the party, although Ann some more attractive records. A. could choose B. was able to choose C. could have chosen D. should choose C 2:1 77 What is the point estimate for the number of cars sold per week for a sample consisting of the following weeks: 1, 3, 5, 7, 10, 13, 14, 17, 19, 21?A. 4.8B. 5.22C. 6.38D. 6.1 Match each of the words with its best antonym. Match the synthetic materials with the processes used to make them. 11.The temperature of a body of water influencesvegetation patternsglobal warmingthe formation of desertsthe temperature of the air above it Pls help me someone this is annoying me 3. oraB. Busca la definicin que corresponde a cada una de las palabras. Luego escribeuna oracin completa con cada palabra. .1. olaa. concavidad formada en la tierra2. hondab. primera letra del alfabeto; preposicin que se usa paraexpresar la idea de movimiento4. holac. palabra empleada como saludod. que tiene mucha profundidad6. ollae. ola del mar: ondulacin del cabello7. haf. forma del verbo que significa rezar8. ondag. forma del verbo haberh. vasija que se usa para cocinar10. horai. unidad de tiempo equivalente a 60 minutosj. onda en el mar o un lago5. a9. hoya Which statement is true about molarity and percent by mass? (3 points)They have the same unit.They are inversely related.They are different units of dilution.They are different units of concentration. Sheena, now 10 years old, was born to a teenage mother and a teenage father. Which statement is statistically true for Sheena?A. She is less likely to be in poor health.B. She is likely to score higher than her peers on math assessments. C. She is more likely to be unemployed as a young adult. D. She is less likely to repeat a grade in school.