Let $z$ and $w$ be complex numbers satisfying $|z| = 5, |w| = 2,$ and $z\overline{w} = 6+8i.$ Then enter in the numbers \[|z+w|^2, |zw|^2, |z-w|^2, \left| \dfrac{z}{w} \right|^2 \]below, in the order listed above. If any of these cannot be uniquely determined from the information given, enter in a question mark. Don't even know where to start.

I got 49 for the first one, 100 for the second one, 9 for the 3rd one, and 6.25 for the 4th one. But it was wrong, so I don't know how to do this question.

Answers

Answer 1

Answer:

1st entry: 41

3rd entry: 17

Step-by-step explanation:

The 1st and 3rd entry are incorrect.

We will use the following for the 1st and 3rd:

[tex]|z+w|=|z|^2+|w|^2+2R(z\overline{w})[/tex]

[tex]|z-w|=|z|^2+|w|^2-2R(z\overline{w})[/tex]

where [tex]R(z\overline{w})[/tex] means 'real part of [tex]z\overline{w}[/tex]'.

Let's do part 1 now)

25+4+2(6)

29+12

41

Let's do part 3 now)

25+4-2(6)

29-12

17


Related Questions


Dan, Harry and Regan sell cars.
Dan sells x cars.
Harry sells 5 more cars than Dan.
Regan sells twice as many cars as Dan.
Write an expression, in terms of x, for the mean number of cars Dan, Harry and Regan sell.

Answers

Answer: (4x + 5)/3

Explanation:

D = x
H = x + 5
R = 2x

Mean = (D + H + R)/3
= (x + x + 5 + 2x)/3
= (4x + 5)/2

find the value of x and y​

Answers

X=58

58-14= 44
44+58= 102
180-102= 78
78/2=39

Y=39

Answer:

x = 58

y = 39

Step-by-step explanation:

x = 58 (Vertically opposite angles)

x + 2y + (x-14) = 180 (Angles in a straight line)

=> x + 2y + x - 14 = 180

=> 2x + 2y = 180 + 14

=> 2(58) + 2y = 194

=> 116 + 2y = 194

=> 2y = 194 - 116

=> 2y = 78

=> y = 78/2

=> y = 39

Simplify 3a²b³x 4a³b

Answers

The answer will be: 12a^5b^4
The answer is 12a5b4

Here's a little something that will tease your brain. I doubt someone will answer this​

Answers

Answer:

500ml orange juice is the most cost effective

500 ml is the answer

Algebra
write down the coefficient of x in 3(x)4x
A 12
B 3
C 0


by Emmanuel okorie​

Answers

Answer:

nah its a.

Step-by-step explanation:

bakit?(#boyinthebrainly)

I need help very quickly, please!!​

Answers

Answer:

32ft

Step-by-step explanation:

Tan = opp/adj

Tan(65) = n / 15

Tan(65) x 15 = n

n = 32.16 = 32ft

Answer:

32 feet

Step-by-step explanation:

Hi there!

We are given a right triangle and the angle of elevation (one of the acute angles in the triangle) as 65°, as well as one of the legs (sides that make up the right triangle) as 15

We need to find the height of the triangle.

Let's make the height of the triangle (the side we need to find) x

Since we need to find the height of the triangle, let's use tangent. As we have the angle of elevation given, we'll use that.

Recall that tangent is [tex]\frac{opposite}{adjacent}[/tex]

in reference to the angle of elevation, the opposite side is x, and the adjacent side is 15

that means that:

tan(65)=[tex]\frac{x}{15}[/tex]

plug tan(65) into your calculator (make sure it's on degree mode!)

tan(65)≈2.14

2.14=[tex]\frac{x}{15}[/tex]

multiply both sides by 15 to clear the fraction

32.1=x

The problem asks us to round to the nearest foot, so the height of the building is 32 feet

Hope this helps! :)

Which equation shows the distributive property? (a) 6 x 3 + 6 x 8 = 6 x (3 + 8) (b) 5 + (22 + 19) = (5 + 22) + 19 (c) 20 x 10 = 10 x 20 (d) 45 + 7 = 7 + 45
help me please ​

Answers

The correct answer is A
the answer is A) 6x3+6x8=6(3+8)

Sam and Mary collect marbles. “If you give me 5 marbles I’ll have twice as many as you.” said Sam to Mary.
“But if you give me 4 marbles wwe would have the same number said Mary to Sam.
How many marbles do they have altogether?

Answers

Answer:

54 marbles

Step-by-step explanation:

The question is a word problem leading to a simultaneous equation

Let 'x' represent the initial number of marbles with Sam, and let 'y' represent the initial number of marbles with Mary,

If Mary gives Sam 5 marbles, we have;

x + 5 = 2 × (y - 5)...(1)

If Sam gives Mary 4 marbles, we get;

x - 4 = y + 4...(2)

From equation (1), we get;

x + 5 = 2 × (y - 5) = 2·y - 10

x = 2·y - 10 - 5 = 2·y - 15

x = 2·y - 15...(3)

From equation (2), we have;

x - 4 = y + 4

∴ x = y + 4 + 4 = y + 8

x = y + 8...(4)

Equating the two values of 'x' in equation (3), and equation (4), we get;

2·y - 15 = y + 8

2·y - y = 8 + 15 = 23

∴ y = 23

From equation (4), we get;

x = y + 8 = 23 + 8 = 31

x = 31

The total number of marbles they have altogether = x + y

However, x + y = 23 + 31 = 54

Therefore;

The total number of marbles they have altogether = 54 marbles.

!!!10 POINTS I KNOW IT IS NOT ENOUGH BUT PLEASE ANSWER!


AND IF YOU CAN SHOW AT LEAST A LITTLE WORK THAT WOULD BE GREAT I NEED TO SHOW WORK!!!

Answers

Answer:

B) 376 units squared

Step-by-step explanation:

Imma put a picture that has a fully explanation. Hope this helps, good luck! ;)

Btw saw your other one got deleted •_• *sigh*

Thang decided to borrow ​$90 from his local bank to help pay for a car. His loan was for 3 years at a simple interest rate of 40​%. How much interest will Thang​ pay?

Answers

Answer:

Step-by-step explanation:

P = 90

r = 40% = 40/100 = 0.4

t = 3 years

It is not clear to me what this means. Is the 40% for each year for 3 years or is the interest rate = 40% period. I know that in some of the poorer countries, this is not an unusual amount to pay for each year he holds the loan.

I will take it as 40% for each year for 3 years.

i = prt = 90 * 0.4 * 3

i = 108

Which number(s) below belong to the solution set of the equation? Check all
that apply
x + 9 = 26
A. 17
B. 234
C. 52
D. 35
E. 26
F. 3

Answers

Answer:

A

Step-by-step explanation:

x + 9 = 26

x = 17

Answer:

A.17

Step-by-step explanation:

17+9=26

Please answer quickly

Answers

Answer:

10

Step-by-step explanation:

given :

length WX ≅ (congruent means equal) length XY

therefore ,  WX = 3

WZ = WX + XZ

WZ = 3 + 7

WX = 10

Find the trigonometric ratio. Write your answer as a fraction in the simplest form

Answers

Answer:

sinB = [tex]\frac{12}{13}[/tex]

Step-by-step explanation:

sinB = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{AC}{AB}[/tex] = [tex]\frac{12}{13}[/tex]

The Trigonometric ratios is 12/13

What is Trigonometry?

The branch of mathematics concerned with specific functions of angles and their application to calculations.

We have,

H= 13, B= 5 and P=12

So,

sin B= Perpendicular/ Hypotenuse

        = 12/13

hence, sin B=  12/13

Learn more about trigonometry here:

https://brainly.com/question/14746686

#SPJ2

Consider the trapezoid shown below.
6 in.
4 in.
6 in.
6 in.
(not drawn to scale)

Answers

Answer:

36

Step-by-step explanation:

1/2bh

1/2 (6*4) =12

Considering there are three triangles we will multiply by 3

12*3=36

plz anser this nathanmalhotra (if your not them dont anserw) From midnight to 7:00 am, the temperature rose 3/10 °C each hour. If the temperature at midnight was −1°C, what was the temperature at 7:00 am?

Answers

Answer:

11/10°C

Step-by-step explanation:

7 x 3/10 = 21/10

Temperature at midnight = -1°C

Temperature at 7.00 am = 21/10°C -1°C = 11/10°C

Answer:

1.1°C

Step-by-step explanation:

Assuming we are starting at midnight, we know that at midnight it is -1°C. We want to find the temperature at 7:00 AM. Or 7 hours later than midnight. The question says that every hour the temperature rises by 3/10°C. In 7 hours, we need to multiply 3/10*7=21/10=2.1 °C. So, it rises by 2.1 °C. Next add that to the -1 from midnight. Do 2.1+-1=1.1 °C.

Hope this helps!

Lily's car has a fuel efficiency of 8 liters per 100 kilometers. What is the fuel efficiency of Lily's car in kilometers per liter? km L

Answers

Answer:

The fuel efficiency of Lily's car in kilometers per liter is 12.5 km/litre.

Step-by-step explanation:

Lily’s car would be half a liter because the difference between kilometers and liters are far from apart

660 g of 3 kg
Express as percentage
please tell how the answer is 22%..
:(

Answers

Answer:

Percent * base = Amount

660 g = 660 g

3kg = 3000g

percent(3000) = 660

percent = 660/3000

percent = .22

.22 = 22%

Step-by-step explanation:

binomial theorem to expand (x+4)^4

Answers

Answer:

Step-by-step explanation:

(x+4)^2.(x+4)^2

= x^4 +16x^3+96x^2+256x+256

A soccer ball is kicked toward the goal. The height of the ball is modeled by the function h(t) = - 16t^2 + 48t where t equals the time in seconds and the h(t) represents the height of the ball at time t seconds. What is the axis of symmetry, and what does it represent? Help please!!!

Answers

Answer:

x = 3/2

The axis of symmetry is located at the vertex,

which is the also the highest point in this problem...

the x component of the vertex can be calculated as -b/2a = -48/-32 = 24/16 = 6/4 = 3/2

x = 3/2

Step-by-step explanation:

Which expression is equivalent

Answers

Answer:

[tex]\sqrt[6]{2\\}[/tex]

Step-by-step explanation:

Rewriting

2 ^1/2 ÷ 2 ^ 1/3

We know a^ b ÷ a^c = a^ (b-c)

2 ^ (1/2 -1/3)

Getting a common denominator

2^ ( 3/6 - 2/6)

2^ 1/6

[tex]\sqrt[6]{2\\}[/tex]

Answer:

[tex]\sqrt[6]{2}[/tex]

Step-by-step explanation:

We can start by writing the expression as one power of two, and then comparing it to the options. The square root of two is the same and [tex]2^{\frac{1}{2} }[/tex] and the cube root of two is the same as [tex]2^{\frac{1}{3} }[/tex]. Therefore, we can rewrite the expression:

[tex]\frac{2^{\frac{1}{2} }}{2^{\frac{1}{3} }}[/tex]

Now, to write them as one power of two, we can use the quotient rule which states, [tex]\frac{x^m}{x^n} = x^{m-n}[/tex]:

[tex]2^{\frac{1}{2} -\frac{1}{3}}[/tex]

We just need to subtract 1/3 from 1/2 to get:

[tex]2^{\frac{1}{6} }[/tex]

This is the same as the 6th root of 2, which is the second option.

in a sale, normal prices are reduced by 10%

nathalie bought a pair of shoes in the sale for £54

what was the original price of the shoes

Answers

Question

in a sale, normal prices are reduced by 10%

nathalie bought a pair of shoes in the sale for £54

what was the original price of the shoes

Answer

[tex]x = 60[/tex]

Explanation

[tex] \sf based \: on \: the \: given \: conditions \: write : x = \frac{54}{ 1 - 01} [/tex]

[tex] \sf calculate \: the \: sum \: difference: x = \frac{54}{0.9} [/tex]

convert decimal to fraction: x= 54 / 9 / 10

[tex] \sf \: divide \: a \: fraction \: by \: multiplying \: its \: reciprosal : x = 54 \times \frac{10}{9} [/tex]

[tex] \sf \: write \: as \: a \: single \: fraction : x = \frac{54 \times 10}{9} [/tex]

[tex] \sf \: reduce \: fraction \: to \: the \: lowest \: term \: by \: cancelling \: the \: greatest \: [/tex]

[tex] \sf \: common \: factor : x = 6 \times 10[/tex]

[tex] \sf \: calculate \: the \: product \: or \: quotient : x = 60 [/tex]

[tex] \sf{ \boxed{answer : x = 60}}[/tex]

helpppp please!!!!!!

Answers

Answer:

x-8

Step-by-step explanation:

since we dont know how much gas is in the tank, lets make that X.

and since we subtract 8 gallons from how much is in the tank, we make that X-8

Answer:

Inequality:

x < 8

The Graph Would be the Hallow Dot on the 8,  then it would go the left way.

Next
Unit Pre Test
Submit Test
20
Type the correct answer in each box. Use numerals instead of words. If necessary, use / for the fraction bar(s)
The equation of a line is 2[v+ 1) = 10x* 3.
The yuntercept of the line is
and the slope of the line is

Answers

Answer:gotta go sorry

Step-by-step explanation:

Which set of numbers is arranged in increasing order? A. , , , B. , , , C. , , , D. , , ,

Answers

Answer:

its B

Step-by-step explanation:

3.14 then pi (3.14159) then 22 ÷ 7 (3.1428) then square root of 10 (3.16)

Answer:

B

Step-by-step explanation:

pi=3.141592654

square root of 10=3.16227766

3.14=3.14

22/7=3.142857143

PLEASE HELP IMAGE IS BELOW!!

Answers

Answer:

Number of small boxes shipped = 7

Number of large boxes shipped = 15

Step-by-step explanation:

Let the number of small boxes = s

And the number of large boxes = l

Weight of small box = 25 pound

Weight of the large box = 50 pounds

Total weight of the shipment = 925 pounds

Therefore, equation for the weight of shipment will be,

25s + 50l = 925

s + 2l = 37 ----- (1)

Total number of boxes shipped = 22 boxes

Therefore, equation will be,

s + l = 22 ------(2)

Subtract equation (2) from equation (1)

(s + 2l) - (s + l) = 37 -22

l = 15

From equation (2)

s + 15 = 22

s = 7

Therefore, number of small boxes shipped = 7

Number of large boxes shipped = 15

PLEASE HELP ME!! its a pretty easy question

Answers

Answer:

V= 936m³

Step-by-step explanation:

Formula:

Volume = L * W * H

Volume1= L * W * H

= 16 * 9 * 6

= 864m³

Volume2= L * W * H

= 6 * 2 * 6

= 72m³

Add both volumes to get total volume.

= 864m³ + 72m³ = 936m³

Hope this helps!

Have a nice dayy! :)

The measures, in degrees, of the three angles of a triangle are given by 2x+1, 3x - 3, and 9x. What is the
measure of the smallest angle?

Answers

Answer:

Step-by-step explanation:

27 degrees

CAN SOMEONE HELP ME OUT WITH THIS PLEASE AND THINK YOU

Answers

Answer:

[tex]10\frac{7}{18}[/tex]

Step-by-step explanation:

First revert it to improper fraction.

[tex]\frac{13}{2} +\frac{35}{9} \\\\[/tex]

Now put them to a common denominator.

[tex]\frac{187}{18}[/tex]

=> [tex]10\frac{7}{18}[/tex]

The weekly amount of money spent on maintenance and repairs by a company was observed, over a long period of time, to be approximately normally distributed with mean $400 and standard deviation $20. How much should be budgeted for weekly repairs and maintenance to provide that the probability the budgeted amount will be exceeded in a given week is only 0.1?

Answers

Answer:

$425.6 should be budgeted for weekly repairs and maintenance.

Step-by-step explanation:

Normal Probability Distribution:

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

Mean $400 and standard deviation $20.

This means that [tex]\mu = 400, \sigma = 20[/tex]

How much should be budgeted for weekly repairs and maintenance to provide that the probability the budgeted amount will be exceeded in a given week is only 0.1?

This is the 100 - 10 = 90th percentile, which is X when Z has a p-value of 0.9, so X when Z = 1.28.

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]1.28 = \frac{X - 400}{20}[/tex]

[tex]X - 400 = 20*1.28[/tex]

[tex]X = 425.6[/tex]

$425.6 should be budgeted for weekly repairs and maintenance.

no links please, i cant find the answer for q b) ii)

Answers

Answer:

-k

Step-by-step explanation:

Cos(140)=cos(180-40)=-cos(40)=-k

Answer:

Step-by-step explanation:

Sin (90 - A)  = Cos A

Cos (90 + A) =   -Sin A

Sin 50 = Sin (90 - 40)

          = Cos 40

         = k

Cos 140 = Cos (90 + 50)

             = - Sin 50

            = (- k)

Other Questions
The bacteria chromosome is She pleased everyone at the party. Analyze the pattern of the following sentence in details then explain the function of the inflectional suffix in the morphological expression Which of these four sets of side lengths will form a right triangle? set 1 set 2 set 3 set 4 Which of the following is not a reason why actual yield is less than theoretical yield?A. presence of impure reactantsB. conservation of massC. competing side reactionsD. loss of product during purification What is salary system? 2463_64help me sll Which is the graph of the system x + 3y > -3 and y < 1/2x + 1 Is the number of electrons in different shells of an atom fixed or unlimited ? Explain by giving an example. Can someone please answer this what were some inventions that contributed to the industrail Revolution of the 19th century. Design a class named Employee. The class should keep the following information in member variables:Employee nameEmployee numberHire DateWrite one or more constructors and the appropriate accessor and mutator functions for the class.Next, write a class named ProductionWorker that is derived from the Employee class. The ProductionWorker class should have member variables to hold the following information:Shift (an integer)Hourly pay rate (a double)The workday is divided into two shifts: day and night. The shift variable will hold an integer value representing the shift that the employee works. The day shift is shift 1 and the night shift is shift 2. Write one or more constructors and the appropriate accessor and mutator functions for the class. Demonstrate the classes by writing a program that uses a ProductionWorker object."Now I have written out the program, it compiles without errors. However, when I run it It asks the first question "Employees name" after input it errors and closes itself down. Can anyone find where in my code it is causing it to do this please? To be clear, I am not asking for someone to write the program, I have already done this, just need to know why it compiles but does not run all the way through. Thank You!#include #include #include using namespace std;class Employee{private: string employeeName; int employeeNumber; int hireDate;public: void setemployeeName(string employeeName); void setemployeeNumber(int); void sethireDate(int); string getemployeeName() const; int getemployeeNumber() const; int gethireDate() const; Employee();{ Help please ;-------; the graph of y=-3x+4 is? In paragraph 6 how does the author argue against bottom trawling on seamounts?A. By stating that there is coral in both deep and shallow watersB. By describing that most fish populations are already overfishedC. By suggesting the effects are unknown because unidentified species are destroyedD. By explaining that bottom trawls in the past could not reach so far undersea 1. This music has only one melodic line, with no harmony or counterpointA. Homophonic B. Monophonic C. PolyphonicD. Texture list 5 procedures done in nail preppingneed help _ On each trial of an experiment, a participant is presented with a constant soft noise, which is interrupted at some unpredictable time by a slightly louder sound. The time it takes for the participant to react to the louder sound is recorded. The following list contains the reaction times (in milliseconds) for trials of this experiment.170, 206, 218, 232, 238, 248, 254, 264, 268, 281, 281, 281, 316, 320, 320, 329, 336, 365, 399, 400, 438, 438, 452, 524, 724, 8061. measures of central tendency do not exist for this data set?a. Mean b. Median c. Mode d. None of these measures2. Suppose that the measurement 806 (the largest measurement in the data set) were replaced by 1169. Which measures of central tendency would be affected by the change? Choose all that apply. Consider the following graph:What is the limit as it is approaching -1 from the right, what is the limit? Feliciano Manufacturing Corporation has a traditional costing system in which it applies manufacturing overhead to its products using a predetermined overhead rate based on direct labor-hours (DLHs). The company has two products, I63E and E76I, about which it has provided the following data: I63E E76I Direct materials per unit $ 21.70 $ 65.10 Direct labor per unit $ 19.50 $ 58.50 Direct labor-hours per unit 0.80 2.40 Annual production (units) 90,000 30,000The company's estimated total manufacturing overhead for the year is $2,063,250 and the company's estimated total direct labor-hours for the year is 45,000.The company is considering using a form of activity-based costing to determine its unit product costs for external reports. Data for this proposed activity-based costing system appear below:Activities and Activity MeasuresEstimatedOverhead CostAssembling products (DLHs)$720,000Preparing batches (batches)263,250Product support (product variations)1,080,000Total$2,063,250Expected ActivityI63EE76ITotalDLHs24,00021,00045,000Batches1,0806751,755Product variations2,1151,4853,600The manufacturing overhead that would be applied to a unit of product E76I under the activity-based costing system is closest to:________. oxygen transport in humans involves the bonding of oxygen withA : white blood cellsb :plateletsC :HormonesD Hemoglobin molecules