In April, the number of cars sold was 546.
This was an increase of 5% on the number of cars sold in March.
Calculate the number of cars sold in March.

Answers

Answer 1

Answer:

520 cars

Step-by-step explanation:

Let the car sold in March be x, x+5%*x=546. (105/100)*x=546. x=520

Answer 2

If there was an increase of 5% on the number of cars sold in March, the number of cars sold in March was approximately 520.

To calculate the number of cars sold in March, we'll use the information that the number of cars sold in April was an increase of 5% compared to March.

Let's assume the number of cars sold in March is represented by 'x'.

According to the given information, the number of cars sold in April was 546, which is equal to 100% + 5% of the number of cars sold in March.

We can set up the equation:

x + 0.05x = 546

Combining like terms, we get:

1.05x = 546

To solve for 'x', we divide both sides of the equation by 1.05:

x = 546 / 1.05

Using a calculator, we find:

x ≈ 520.00

To learn more about increase/decrease click on,

https://brainly.com/question/32809346

#SPJ2


Related Questions

On a separate piece of graph paper, graph y=-Ixl +3 then click on the graph until the correct one appears.

Answers

Answer:

That is the graph for y = -|x| + 3

The foot of a ladder is placed 10 feet from a wall. If the top of the ladder rests 13 feet up on the wall, find the length of the ladder.

Answers

10 squared + 13 squared = your answer squared.
So do that then take the square root of whatever you get.

Find the equation of a line perpendicular to 8x - 2y = 4 and passes through the point (4, 3).

Answers

y = -2x-3

Lines that are perpendicular have slopes that are negative reciprocals of each other. Meaning, if a line has slope  , then a line perpendicular to this has slope . That means the slope of our perpendicular line is

The equation of the line that is perpendicular to 8x - 2y = 4 and passes through the point (4, 3) is y = (-1/4)x + 4.

To find the equation of a line that is perpendicular to the line 8x - 2y = 4 and passes through the point (4, 3), we can use the fact that the slopes of perpendicular lines are negative reciprocals of each other.

First, let's rewrite the given equation in slope-intercept form (y = mx + b), where m represents the slope:

8x - 2y = 4

-2y = -8x + 4

Divide both sides by -2:

y = 4x - 2

The slope of the given line is 4.

The slope of a line perpendicular to this line would be the negative reciprocal of 4, which is -1/4.

Now, we have the slope (-1/4) and a point (4, 3). We can use the point-slope form of a linear equation:

y - y₁ = m(x - x₁)

Substituting the values, we have:

y - 3 = (-1/4)(x - 4)

Expanding and simplifying, we get:

y - 3 = (-1/4)x + 1

Adding 3 to both sides, we have:

y = (-1/4)x + 4

To learn more about equation click on,

https://brainly.com/question/20712656

#SPJ2

Help pls will give brainliest

Answers

Answer:

b

Step-by-step explanation:

area of triangle = 1/2 x c x d =cd/2

area of semicircle = 1/2 x π x r^2 = 1/2 x π x (a/2)^2 = 1/2 x π x a^2/4 =πa^2/8

area of shape = area of triangle + area of semicircle

HURRY I NEED TO KNOW.... what term can you add to 5/6)x -4 to make it equivalent to 1/2x-4?

Answers

Answer:

(-1/3)x

Step-by-step explanation:

You can either solve this algebraically or solve it by testing one possible answer at a time.

First example:  To (5/6)x - 4, add (-1/3)x.  Result:  (3/6)x - 4.  This is correct.

The correct answer is the first one:  (-1/3)x.

What is the range of the given data set? OA) 30 OB) 32 OC) 37 OD) 40​

Answers

Answer:

Range = maximum number - minimum number

maximum number = 99minimum number = 62

Range = 99 - 62 = 37

Answer:

37

Step-by-step explanation:

The range is the difference between the highest number and the smallest number.

Looking at the stem and leaf plot we can identify the largest and smallest number

Largest number: 99

Smallest number: 62

If range = largest number - smallest number then range = 99 - 62 = 37

Chi needs to simplify the expression below. (1.25 -0.4)-7+4x3 Which operation should she perform first?

I need an answer quickly ​

Answers

Answer:

She should first perform the operation in the parentheses, you can reference the order of the operations based on PEMDAS.

Step-by-step explanation:

1. parentheses operations

2. multiply 4 x 3

3. add the value you get from the parentheses with -7

4. with that value add it to the product of 4 and 3

Hope that helped! :)

Answer:

Subtraction

Explanation:-

[tex]( 1.25 -0.4) \div7+ 4 \times 3[/tex]

Using BODMAS Rule:-

BracketsOrdersDivisionMultiplicationAdditionSubtraction

In bracket, the operation subtraction should be performed first .

A wholesaler purchased an electric item for Rs 2,700 and sold to retailer at
10% profit. The retailer sold it at 20% profit to a consumer. How much did the
consumer pay for it.


PLZ PLZ HELP.......​

Answers

Step-by-step explanation:

10 % of 2700 = 270

so he had 2970 rupee

20% of 2970 = 594

so customer have to pay 2970 + 594 = 3564

In right triangle ABC, AB = 3 and AC = 9. What is the measure of angle B to the nearest degree?

Answers

Answer:

90 degrees

Step-by-step explanation:

see image

make x A

y B

z C

AB=3 (given)

AC=9 (given)

measure of angel B or y, is 90

if

x= A

y= C

z= B

then the hypotenuse would be shorter than one of the legs

3<9

so B has to be the right angle (90 degrees)

What is the slope of the line that contains the points (9,-4) and (1,-5)? O A. 8 O B. - O c. 1 1 O D. 8​

Answers

Answer:

1/8

Step-by-step explanation:

-5-(-4)/1-9

Which of the following is a parent function?
O A. f(x) = e*
O B. f(x) = 2.34
O x
C. f(x) = x4 +3
O D. f(x) = 2e2x

Answers

Answer:

[tex]f(x) = e^x[/tex]

Step-by-step explanation:

Given

Options (a) to (d)

Required

Which is a parent function

A parent function is such that has a single term without coefficients

From the list of given options

[tex]f(x) = e^x[/tex] suits the above definition

Other options (b) to (d) either have coefficients, or have multiple terms

Geometry, please answer question ASAP

Answers

Answer:

Triangle ACB =~ triangle DFE, by adding 6 units to each side of both triangles their relationship will not change. They are still similar.

Step-by-step explanation:

The answer isn't great in all honesty but it's been a long time since I took geometry and I don't 100% remember the proper way of stating it. Though I am 100% sure they stay similar.

Sorry couldn't be of more help but figured something was better then nothing

Tim works as a server in a restaurant.
A
group
for $112.50. They leave Tim a tip of 20%.
Another group at Table 15 have a bill of
$142.75 and leave a 15% tip. Which table
of people at Table 22 have a bill
left Tim the greater tip

Answers

Answer:

The first group left a greater tip

Step-by-step explanation:

The first group left a tip of 20%. 20% of 112.5 is 22.5

The first group left a tip of 15%. 15% of 142.75 is 21.4125. Round to the nearest hundredth -> 21.41.

Therefore, the first group left a greater tip

I hope this helps!

pls ❤ and give brainliest pls

HELP ME PLEASE I NEED HELP

Consider the end behavior of the function g(x) = 4|x − 2| − 3.

As x approaches negative infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.


As x approaches positive infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.

Answers

Answer:

Step-by-step explanation:

This is a narrower-than-normal absolute value graph, which is a v-shaped graph. It's pointy part, the vertex, lies at (2, -3) and it opens upwards without bounds along both the positive and negative x axes. Therefore, as x approaches negative infinity, f(x) or y (same thing) approaches positive infinity. As x approaches positive infinity, f(x) approaches positive infinity.

find the ratio of Rs 20 and 900​

Answers

Answer:

1 : 45

Step-by-step explanation:

Given

Rs 20 and 900 ( divide both by 20 )

= 1 : 45

I NEED HELP ASAP!!! i dont understand

Answers

Answer:

b

Step-by-step explanation:

A parabola represents a quadratic equation. For a point called the focus and a line called the directrix, the distance from each point of the parabola to the focus is equal to its distance to the directrix. For example, if the directrix of the parabola was y=0 and the focus was (1,1), the distance between each point on the parabola to (1,1) would be equal to its distance from the line y=0.

For a parabola that has a horizontal axis of symmetry (or when y² is in the equation rather than x²), one way to write its equation is of the form

(y-k)²  =4p(x-h), where (h,k) is the vertex. Now, we can try to match up this form with the equation we have,

y² = 24x

(y-k)² = 4p(x-h)

We can start by setting both sides with y equal to each other, as well as both sides containing x

y² = (y-k)²

square root both sides

y = y-k

k=0

24x = 4p(x-h)

divide both sides by 4

6x = p(x-h)

expand

6x = p*x - p*h

Because p*h does not contain an x value, we can say

6x = p * x

p = 6

6x = p*x - p*h

6x = 6x-6*h

subtract 6x from both sidex

6*h=0

h=0

Our equation is thus

y= 4(6)(x), with our vertex being (0,0) = (h,k)

The directrix is equal to x=h-p, and with p being 6, our directrix is thus

x=0-6 = -6

x=-6

Use what you know about sine, cosine, and tangent to calculate the height of the buildings in the diagram below.

Answers

Answer:

x = 32 feet

Step-by-step explanation:

By applying tangent rule in ΔACD,

tan(40°) = [tex]\frac{\text{Opposite side}}{\text{Adjacent side}}[/tex]

             = [tex]\frac{AB+AC}{CD}[/tex]

             = [tex]\frac{x+BC}{87}[/tex]

x + BC = 73 -----(1)

By applying tangent rule in ΔBCD,

tan(25°) = [tex]\frac{BC}{CD}[/tex]

             = [tex]\frac{BC}{87}[/tex]

BC = 40.57

By substituting the value of BC in equation (1),

x + 40.57 = 73

x = 32.43

x ≈ 32 feet

What is the length of the altitude of the equilateral triangle below?

Answers

Answer:

E.  12

Step-by-step explanation:

The ratio of the lengths of the sides of a 30-60-90 triangle is

short leg : long leg : hypotenuse

1 : √3 : 2

The short leg is 4√3.

The long leg is √3 times the short leg.

a = 4√3 * √3 = 4 * √9 = 4 * 3 = 12

Answer: E.  12

x = 3

x = 5

x = 0

x = 2

Answers

Answer:

x=2 is incorrect

Step-by-step explanation:

Y(2)=(3/4)*x^2=(3/4)*4=3

If C.P. = Rs. 480, S.P. =Rs.528 find profit and profit percent​

Answers

In this question first you should find profit amount by using formula and you should use profit amount in profit percentage formula then you should calculate it

Please find the missing number for the surface area. I will mark brainiest if correct. 2.

Answers

It is 18 because it is a square so all the sides have to be the same so that would make it 18

What is the area of the following circle?

Answers

Answer:

[tex]16\pi\:\mathrm{units^2}\text{ or }50.24\:\mathrm{ units^2}[/tex]

Step-by-step explanation:

The area of a circle with radius [tex]r[/tex] is given as [tex]A=r^2\pi[/tex].

In the question, we're given [tex]r=4[/tex] and asked to solve for [tex]A[/tex].

Substituting [tex]r=4[/tex] into [tex]A=r^2\pi[/tex], we get:

[tex]A=4^2\pi,\\A=\boxed{16\pi\:\mathrm{units^2}}[/tex]

If we use [tex]\pi=3.14[/tex] as mentioned in the question, we would have:

[tex]A=16\pi=16\cdot 3.14=\boxed{50.24\:\mathrm{units^2}}[/tex]

What is a ratio that is equivalent to 12:35?

Answers

Answer:

0.3429 is a decimal and 34.29/100 or 34.29% is the percentage for 12/35.

Answer:

24 : 70

Step-by-step explanation:

12 : 35

Multiply each side by 2

12*2  : 35*2

24 : 70

(x-4)°=1
giải hộ em với ạ

Answers

Answer: 5

Step-by-step explanation:

⇒ (x - 4) = 1

⇒ x = 1 + 4

⇒ x = 5

Therefore value of x = 5

Answered by Gauthmath must click thanks and mark brainliest

Given the function f(x) = -2c + cx - x^2? and f^-1(5) = -1, find c.

Answers

Answer:

c = - 2

Step-by-step explanation:

Given inverse function

[tex]f^{-1}[/tex] (5) = - 1 , then

f(- 1) = 5 , that is

- 2c + c(- 1) - (- 1)² = 5

- 2c - c - 1 = 5

- 3c - 1 = 5 ( add 1 to both sides )

- 3c = 6 ( divide both sides by - 3 )

c = - 2

can someone help me with this?

Answers

Answer:

The answer is 660

Step-by-step explanation:

30×2200÷100= 660

Answer:

660

Step-by-step explanation:

to know 30%

2200÷10×3=660

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

Help mee quick and explain to me in an easy way as posible

Answers

Bags of limes = 4

Total limes in each bag = m

Total limes = 4m

ATQ

4m - 7(4)= 16

4m = 16+28

4m = 44

m = 44/4

m = 11

Value of m = 11

Must click thanks and mark brainliest

12. PLEASE HELP ME
Which of the following are the coordinates of the vertex of y= x2 - 10x + 2?

A. (–10, 2)

B. (2, –10)

C. (–5, 23)

D. (5, –23)

Answers

Answer:

I think b no. is the correct answer

Answer:

D. (5, –23)

Step-by-step explanation:

The vertex is in essence the turning point of the parabola y = x² − 10x + 2

the x coordinate of the turning point =  

                                                        =  

                                                        =  5

when x = 5, y = (5)² - 10(5) + 2

                     = -23

Thus coordinate or vertex is ( 5, -23)

5 right 23 down

there are x boys and y girls at the camp.how many children are at the camp altogether?
(EXPRESS YOUR ANSWER IN TERMS OF X AND Y )

Answers

there are x boys and y girls at the camp.how many children are at the camp altogether?

(EXPRESS YOUR ANSWER IN TERMS OF X AND Y )

Answer;

no.of boys = x

no.of girls = y

total no.of children in camp = no.of boys + no.of girls

= x + y..........

Answer:

total children = x+y

Explanation:

The total numper of children at the camp would be the sum of the total number of boys and the total number of girls.

Other Questions
When using a scientific calculator, what is the the correct order of buttons topress to enter the number 3.5 x 1015?O A. [EE] [1] [5] [3] [] [5]B. [1] [5] [3] [5] [EE]C. [3] [.] [5] [EE] [1] [5]O D. [1] [5] [3] [] [5] [EE]SUBMIT How have people been lately good? bad? something else? In the figure above, AD and BE intersect at point C, andthe measures of angles B, D, and E are 98, 81, and 55,respectively. What is the measure, in degrees, ofangle A ? (Disregard the degree sign when gridding youranswer.) 3. Of the events that you researched in Part II, which do you think was most important to the womens suffrage movement in the United States? Why? "Mt Everest is the glory of all Nepali". Justify the statement YOU HAVE A GARDEN HOSE AND A 0.5 LITER CONTAINER AND A 0.3 LITER CONTAINER. YOU NEED TO MEASURE OUT 0.1 LITER OF WATER. HOW DO YOU DO IT Which has had the most significant effect on the rise of globalization?A. the fall of communism B. command economiesC. computer technology D. isolationism What does the reducing agent do in a redox reaction? (A.P.E.X) For the function F defined by F(x)=x22x+4, find F(|4|).A. 8B. 4C. 12D. 28 what is sqrt 2x-3 = sqrt 3x-9 I need help please. The question is already there. Tysm. 20 points. could someone please answer this? :) thank you Here is a list of fractions 18/45 14/30 10/25 8/20 16/40 one of these fractions are not equivalent to 2/5 write down this fractions Explain the importance of leisure activities. life assurance forms part of...... insurance? A man starts repaying a loans with first insfallameny of rs.10 .If he increases the instalment by Rs 5 everything months, what amount will be paid by him in the 30the instalment. I need answering ASAP please What is the distance from point N to LM in the figure below? ''con la irrigacin adecuada prosperan los cultivos como: el trigo, la cebada, los dtiles, los olivos, las lentejas, las naranjas, las cebollas.''a que civilizacin corresponde lo anterior?romaegiptogrecia Select the best answer to describe the parabola