If sec^2 teta (1+sin teta) (1-sin teta) = k, find k

Pls help no spamming

Answers

Answer 1
Identities to be used :-

[tex]\boxed{\sf 1-sin^2\theta=cos^2theta}[/tex]

[tex]\boxed{\sf cos^2\theta=\dfrac{1}{sec^2\theta}}[/tex]

Solution:-

Let's do

[tex]\\ \sf\longmapsto k=sec^2\theta(1+sin\theta)(1-sin\theta)[/tex]

[tex]\\ \sf\longmapsto k=sec^2\theta(1-sin^2\theta)[/tex]

[tex]\\ \sf\longmapsto k= sec^2\theta(cos^2\theta)[/tex]

[tex]\\ \sf\longmapsto k=sec^2\theta\times \dfrac{1}{sec^2\theta}[/tex]

[tex]\\ \sf\longmapsto k=1[/tex]

Answer 2

[tex]\color{lime}\boxed{\colorbox{black}{Answer : - }}[/tex]

[tex] \sec^{2} θ(1 + \sinθ)(1 - \sinθ) = k[/tex]

[tex] \sec^{2} θ \: (1 - { \sin}^{2} θ) = k[/tex]

[tex] { \sec }^{2} θ \cos^{2} θ = k[/tex]

[tex] \sec ^{2} θ. \frac{1}{ {sec}^{2}θ } = k[/tex]

[tex]1 = k[/tex]

Therefore:

[tex] \color{red}k = 1[/tex]


Related Questions

please solve this

.............​

Answers

Answer:

D

Step-by-step explanation:

Note that I will be using a, b, and y instead of their Greek counterparts.

First, we know that sin(c+d) = sin(c)cos(d) + cos(d)sin(a) and sin(c-d) = sin(c)cos(d) - cos(d)sin(a). We can apply these here to get

sin(b+y) = sin(b)cos(y) + cos(b)sin(y)

sin(b-y) = sin(b)cos(y) - cos(b)sin(y)

sin(a+y) = sin(a)cos(y) + cos(a)sin(y)

sin(a-y) = sin(a)cos(y) - cos(a)sin(y)

Plugging these into our equation, we get

(sin(b)cos(y) + cos(b)sin(y) - (sin(b)cos(y) - cos(b)sin(y)))

/

(sin(a)cos(y) + cos(a)sin(y)-(sin(a)cos(y) - cos(a)sin(y)))

=

2cos(b)sin(y) / 2cos(a)sin(y)

= cos(b)sin(y)/cos(a)sin(y)

= cos(b)/cos(a)

Next, we can see that a+b = π, so we can subtract b from both sides to get a = π -b. Plugging that in for a in our equation, we get

cos(b) / cos(π-b)

After that, we know that cos(c-d) = cos(c)cos(d) - sin(c)sin(d). Plugging that in here, we get

cos(π-b) = cos(π)cos(b) - sin(π)sin(b)

= -cos(b) + 0

= -cos(b)

Plugging that back into our equation, we get

cos(b) / -cos(b) = -1

What is the value of the expression below when y = 5? Show your work and write your answer in a complete sentence.
Y exponent 2-3y+6

Answers

Answer:

y=1

Step-by-step explanation:

5=2-3y+6

3y=2-5+6

3y= -3+6

3y= 3

3y÷3=3÷3

y=1

Answer:

16

Step-by-step explanation:

Substitute y = 5 into the expression

y² - 3y + 6

= 5² - 3(5) + 6

= 25 - 15 + 6

= 16

A can do a piece of work in 15 days. B can do the same work in 12 days and C can
finish the same piece of work in 20 days. They started the work together for 2 days
and then B and C leaves. In how many days will A finish the remaining work?​

Answers

Answer:

[tex]9\ days[/tex]

Step-by-step explanation:

[tex]We\ are\ given:\\No.\ of\ days\ A\ takes\ to\ complete\ some\ amount\ of\ work=15\ days\\No.\ of\ days\ B\ takes\ to\ complete\ the\ same\ amount\ of\ work=12\ days\\No.\ of\ days\ C\ takes\ to\ complete\ the\ same\ amount\ of\ work\ as\ A\ and\ B\ =20\ days\\[/tex]

[tex]Now,\\We\ can\ say\ that\ an\ object\ has\ to\ complete\ \frac{1}{n}th\ of\ the\\ work\ daily,\ to\ complete\ the\ work\ in\ n\ number\ of\ days.\ This\ is\ however\\ only\ true\ if\ the\ object\ covers\ equal\ amounts\ of\ work\ each\ day.[/tex]

[tex]Here,\\In\ 1\ day,\\A\ would\ cover\ \frac{1}{15}th\ of\ the\ work.\\B\ would\ cover\ \frac{1}{12}th\ of\ the\ work.\\C\ would\ cover\ \frac{1}{20}th\ of\ the\ work.[/tex]

[tex]Now,\\We\ are\ also\ given\ that:\\They\ work\ together\ for\ 2\ days\ on\ the\ same\ work.\\Hence,\\Total\ work\ done\ in\ 1\ day\ by\ A,B\ and\ C=\frac{1}{15}+\frac{1}{12}+\frac{1}{20}=\frac{4+5+3}{60}=\frac{12}{60}=\frac{1}{5}\\Hence, Total\ work\ done\ in\ 2\ days\ by\ A,B\ and\ C=2*\frac{1}{5}=\frac{2}{5}[/tex]

[tex]Hence,\\The\ portion\ of\ the\ total\ work\ left=1-\frac{2}{5}=\frac{5-2}{5}=\frac{3}{5}\\So,\\Since\ A\ has\ to\ complete\ \frac{3}{5}th\ of\ the\ work,\ lets\ compute\ the\ no.\ of\ days\ it\ takes\ to\ do\ so.\\Hence,\\No.\ of\ days\ A\ takes\ to\ complete\ the\ entire\ work=15\ days\\Hence,\\No.\ of\ days\ A\ takes\ to\ complete\ \frac{3}{5}th\ of\ the\ entire\ work=15*\frac{3}{5}=9\ days[/tex]

Answer:

9 days

Step-by-step explanation:

A does in 15days, so A in 1day does 1/15part

B does in 12days, so B in 1day does 1/12part

C does in 20days, so C in 1day does 1/20part

So. A+B+C in 1 day-- 1/15+1/12+1/20=(4+5+3)/60= 12/60=1/5 and in 2days 2/5 part..hence remaining work=1/1–2/5=(5–2) =3/5part.

Now A in 1/15 part takes 1day

So, in 3/5 part 15×3/5 = 9 days.

HELP ME PLZZ...Complete this proof...BRAINLY TO HELPFUL ANSWER

Answers

Answer:

1. Angles 2, 3 and angles 1,3 are complementary angles(Given)

2. To prove :

Since Angles 2, 3 and angles 1,3 are complementary.

When angles are complementary, then the sum of the measures of angles is 90 degrees.

So,  and  (Definition of Complementary angles)

3.  (Substitution)

4.  (Subtraction property of equality)

Step-by-step explanation:

question 3&4 help me please

Answers

Answer:

3. (1-7/9)÷2 = 2/9÷2 = 1/9

reciprocal of 1/9 is 9

4. x+2/x=3

if you solve it, you get x = 1 and x = 2, so last option, 1 and 2, is the answer

Answered by GAUTHMATH

How to solve this question pls help asap

Answers

Answer:

answered by g a u t h m a t h

Step-by-step explanation:

Find the value of x. Round to the nearest tenth.

Answers

Answer:

x=400 m is the correct answer

calculate the price with VAT of the following case.
MP=Rs.400000
profit=Rs.20000
Discount=10%
VAT=13%

Answers

Answer: $427140

Step-by-step explanation:

Firstly, we'll add MP to the profit and this will be:

= Rs 400000 + Rs 20000

= Rs 420000

Since there is a discount of 10%, this will then be:

= 420000 - (10% × 420000)

= 420000 - 42000

= $378000

With a VAT of 13%, then the final price will be:

= $378000 + (13% × $378000)

= $378000 + (0.13 × $378000)

= $378000 + $49140

= $427140

If f(x) = x2 - 4x and f(-3), then the result is:
o -3.
O 21.
0 -21.

Answers

This is pretty much saying that if x = -3, then solve for the equation, so (-3)^2 - 4(-3) = 9 - 12 = -3

Answer:

answer is 6

Step-by-step explanation:

f(x) = x2 - 4x

f(-3)= -3*2-4*-3

      =-6-(-12)

      =6

Giving brainliest! View image!

Answers

Answer:

58%

Step-by-step explanation:

10*5=50

7*3=21

21/50 chance to choose inside small rectangle

21/50*2 = 42/100 chance to choose inside small rectangle

100-42=58%

(2x2 + 1) + 3/2x2=1=4

Answers

Answer:

3(2×2+1)+3×(2×2)/3=1×3=4×3

36+3+4=3=12

36+3+4-3-12

43-15

28

The sales tax in a certain city is 2%. A man buys a camera and pays a sales tax of $3.20. What was the cause of the camera, exclusive of the sales tax?

Answers

Answer:

The base cost of the camera, exclusive of sales tax, is $160.

Step-by-step explanation:

Set up this equation and solve for x, which is the cost of the camera:

$3.20 = $0.02x [0.02 = 2%]

Solve the equation by dividing $3.20 by 0.02. The answer is $160.

Answer: $160 for the camera

Step-by-step explanation:

0.2x160=3.2

$160

What is the image of (-3,6) when reflected in the x-axis?
A. (6,-3)
B. (-3, -6)
C. (3,-6)
D. (3, 6)

Answers

The new coordinates are ( -3 , -6) , Option B is the answer.

What is meaning of Reflection ?

Reflection means to create a mirror image of an object along any axis .

The shape and size of the object remains constant while reflection.

An object of coordinate ( -3 ,6) is given

This is reflected in the x axis .

When an object is reflected along any axis , the coordinate of that axis remains the same while the coordinate of the other changes to its additive inverse .

object  ( -3 ,6) is reflected along x axis ,

( x, y) ----> ( x , -y)

The new coordinates are ( -3 , -6)

Therefore Option B is the answer.

To know more about Reflection

https://brainly.com/question/15487308

#SPJ2

Help please! Need this answered quick!

Answers

Answer:

3.6

Step-by-step explanation:

the ratio of AB to AD is 3/5 so the ratio of BC to DE is also 3/5, therefore BC=3/5 DE= (3/5)6= 3.6

Find the area of triangle ABC to the nearest tenth if AB = 11 ft, ∠BCA = 67 , and ∠CAB = 28 .

Answers

Answer:

30.7

Step-by-step explanation:

Assuming the angled are degrees and not radian.

side BC= (11÷sin67)•sin28= 5.6

angle ABC= 180-67-28=85°

A= 11•5.6•sin85÷2≈30.68

what type of variation is this relationship

Answers

Answer: C) Partial variation; $375

=========================================================

Explanation:

We don't have a direct variation because the initial cost isn't $0

The equation for this situation is y = 25x+375, where x is the number of yearbooks purchased and y is the total cost.

Notice how this line doesn't go through the origin. All direct variation graphs are straight lines through the origin.

So that's why we have partial variation instead.

The initial cost is simply the set up cost, aka the cost when x = 0. That initial cost is $375. The initial cost is located at the y intercept.

From that initial cost, we then add on multiples of $25 depending on how many yearbooks are purchased.

-----------------

In short, because the initial cost is $375, which is some nonzero value, this means we don't have direct variation. Instead, we have partial variation.

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER PLS GIVE ME A STEP BY STEP EXPLANATION!!
The students in Shawn's class got to choose whether to visit the zoo or the aquarium. 3 students went to the zoo and 15 students went to the aquarium. What is the ratio of the number of students who went to the zoo to the number of students who did not go to the zoo?
A. 1:3
B. 1:6
C. 1:5
D. 1:1

Answers

ANSWER: C (1:5)

EXPLANATION:
(s=students)
3s (zoo)
15s (aquarium)

Want To Find: Ratio of students who went to zoo to number of students who did not go to the zoo.

Students who went to the zoo= 3
Students who didn’t go to the zoo= 15

3:15 is also equal to 1:5

The ratio of the number of students who went to the zoo to the number of students who did not go to the zoo is 1: 5. Hence option C is true.

Given that;

The students in Shawn's class got to choose whether to visit the zoo or the aquarium.

Here, 3 students went to the zoo and 15 students went to the aquarium.

Hence, the ratio of the number of students who went to the zoo to the number of students who did not go to the zoo is,

Ratio = 3 : 15

Ratio = 3/15

Ratio = 1/5

Ratio = 1 : 5

Thus, option C is true.

Learn more about the ratio visit:

https://brainly.com/question/12024093

#SPJ3

Need help nsjsisjejskskkdof

Answers

Answer:

8×4=32 and 8 groups of 4 equals 32.

Help me with this question please‼️‼️

Answers

Answer: 1/2  (choice C)

Explanation:

The gradient is the same as the slope

m = slope

m = rise/run

m = (change in y)/(change in x)

m = (y2-y1)/(x2-x1)

m = (6-1)/(6 - (-4))

m = (6-1)/(6+4)

m = 5/10

m = 1/2

In decimal form, this becomes 0.5

A slope of 1/2 means we move up 1 and to the right 2 units each time to generate points along the diagonal line.

A positive slope goes uphill as we move to the right (due to the positive rise value).

Answer:

One way to find the gradient is using the expression :

[tex]m = \frac{y_{2} - y_{1}}{x_{2} - x_{1}} = \frac{y_{B} - y_{A}}{x_{B} - x_{A}}[/tex]

So [tex]m = \frac{6 - 1}{6- (-4)} =\frac{5}{10} =\frac{1}{2}[/tex]

What is the quotient of (2x3 – 29x + 13) ÷ (x + 4)?

Answers

Answer:

(19-29x) over (x-4)

Step-by-step explanation:

factor x ^ 4 - 5x ^ 2 + 4

Answers

( − 2 ) ( 3+ 2 2 − − 2 )

Hope this helps, have a great day!

if a number is added to 3, the result is 10 find the number​

Answers

Answer:

7

Step-by-step explanation:

10 minus 3 will give you the number

Answer:

7

Step-by-step explanation:

let the number added to 3 be 'x'

we know;

X+3=10

X=10-3

X=7

In the opposite figuret triangle OAB has an area of 72 cm2 and. Triangle ODC has an area of 288 Cm2 Then XandY equal​

Answers

area of OAB = 72 = (1/2) sin (AOB) * OA * OB solve the above for sin(AOB) to find sin(AOB) = 1/2 area of ODC = 288 = (1/2) sin (DOC) * OD * OD Note that sin(DOC) = sin(AOB) = 1/2, OD = 18 + y and OC = 16 + x and substitute in the above to obtain the first equation in x and y 1152 = (18 + y)(16 + x)...

HOPE SO IT HELPS YOU

twice n
Algebraic expression

Answers

Answer and Step-by-step explanation:

2n is the algebraic expression for twice n.

#teamtrees #PAW (Plant And Water)

a map of an amusement park is shown on a coordinate plane, where each square of the grid represents 1 square meter. The water ride is at (-17,12), the roller coaster is at (26,-8), and the Ferris wheel is at (2,20). Find each distance to the nearest tenth of a meter.
* what is the distance between the water ride and the roller coaster?
*What is the midpoint between the roller coaster and the ferris wheel? what is the distance from the midpoint to the ferris wheel

Answers

Answer:

Step-by-step explanation:

The graph of which functions has an axis of symmetry at x = -1/4?

Answers

Answer:

2x^2 + x - 1

If I did anything you didn't understand let me know so I can explain.  

Step-by-step explanation:

All of them are quadratics so let's use that.

The first one is 2x^2 + x - 1.  To find the axis of symmetry the strategy is usually to find the two zeroes of a quadratic and pick the number between them.  Something to  notice though is that 2x^2 + x - 1 is just 2x^2 + x sshifted down 1, so they both have the same axis of symmetry.  So I am going to ignore the constant, because then finding the zeroes is much much simpler.  I am going to do this with all opions.

So 2x^2 + x - 1 I am just going to use 2x^2 + x.  If you factor out an x you get x(2x + 1)  So now we have it in factored form and we know the zeroes are 0 and -1/2.  The number directly in between these is -1/4, so the axis of symmetry is x = -1/4.  I don't know if there is only one with that axis of symmetry so i am going to check the rest.

2x^2 - x + 1 means we are only going to look at 2x^2 - x.  factoring we get x(2x - 1) so the zeroes are 0 and 1/2, so the axis of symmetry is at 1/4.

x^2 + 2x - 1 we only use x^2 + 2x.  Factored form is x(x+2) so zeroes are 0 and -2 whichh means axis of symmetry is -1

x^2 - 2x + 1 has the same axis of symmetry as x^2 - 2x, which has zeros at 0 and 2 so the axis of symmetry is at 1.

So yep, it was just the first one.

9514 1404 393

Answer:

  (a)  f(x) = 2x^2 +x -1

Step-by-step explanation:

For ax^2 +bx +c, the axis of symmetry is x = -b/(2a). For the offered answer choices, the axes of symmetry are ...

  a) x = -1/(2·2) = -1/4 . . . . . . the function we're looking for

  b) x = -(-1)/(2·2) = 1/4

  c) x = -2/(2·1) = -1

  d) x = -(-2)/(2·1) = 1

The function with axis of symmetry x = -1/4 is f(x) = 2x^2 +x -1.

[tex]3-\sqrt{x} 1-16x^{2}[/tex]

Answers

Answer:

Step-by-step explanation:

This equation turns out to be a quartic. I'm not sure what should be done with. I can't believe you were asked to find its roots which are unbelievably complex. Here is a graph with the only 2 points that are easily found. If I am not solving what you need, please leave a note.

Express (root 19 - root 7)(root 19 + root 7) in simplest form.

Answers

Answer

root 354

Step-by-step explanation:

Answer:

12

Step-by-step explanation:

(√19 -√7)(√19 +√7)

( a +b)( a -b) = a²-b²

(√19)² -(√7)² = 19 -7 = 12

find the measure of the missing angles in the kite​

Answers

Answer:

Step-by-step explanation:

In a kite, the angles between the two non- congruent side have the same degree.

x = 114 degrees

In a quadrilateral the sum of the inner angles is 360 degrees

88 + (114 * 2) + y = 360

88 + 228 + y = 360

316 + y = 360

y = (360 - 316)

y = 44 degrees

pls help G, H, I, J pls explain​

Answers

Part G

The two angles ABD and DBC form a straight line, so the angles add to 180 degrees.

Let's solve for x.

angle ABD + angle DBC = 180

(0.5x+20) + (2x-10) = 180

2.5x+10 = 180

2.5x = 180-10

2.5x = 170

x = 170/2.5

x = 68

Then we'll use this to find angle ABD

angle ABD = 0.5*x + 20

angle ABD = 0.5*68 + 20

angle ABD = 34 + 20

angle ABD = 54

Answer:  54 degrees

============================================================

Part H

Use the value of x we found back in part G to find the measure of angle DBC

angle DBC = 2x - 10

angle DBC = 2(68) - 10

angle DBC = 136 - 10

angle DBC = 126

An alternative is to subtract the measure of angle ABD from 180

angle ABD + angle DBC = 180

angle DBC = 180 - (angle ABD)

angle DBC = 180 - 54

angle DBC = 126

Answer: 126 degrees

============================================================

Part I

This time, the two angles add to 90 degrees as shown by the square corner marker.

(angle XYW) + (angle WYZ) = 90

(1.25x - 10) + (0.75x + 20) = 90

2x + 10 = 90

2x = 90-10

2x = 80

x = 80/2

x = 40

which then leads to,

angle XYW = 1.25*x - 10

angle XYW = 1.25*40 - 10

angle XYW = 50 - 10

angle XYW = 40

Answer:  40 degrees

============================================================

Part J

We can subtract the result of part I from 90 degrees to get the answer

angle WYZ = 90 - (angle XYW)

angle WYZ = 90 - 40

angle WYZ = 50

Or we could plug the x value x = 40 into the expression for angle WYZ

angle WYZ = 0.75*x + 20

angle WYZ = 0.75*40 + 20

angle WYZ = 30 + 20

angle WYZ = 50

Answer:  50 degrees

============================================================

Summary:

The answers we found were

G.  54 degreesH.  126 degreesI.  40 degreesJ.  50 degrees

Answer:

G. m∠ABD = 54°

H. m∠DBC = 126°

I. m∠XYW = 40°

J. m∠WYZ = 50°

Step-by-step explanation:

∠ABD and ∠DBC are supplementary angles. This means their angles have a sum of 180°.

[tex]\frac{1}{2}x+20+2x-10=180\\\frac{5}{2}x+10=180\\\frac{5}{2}x=170\\x=68[/tex]

m∠ABD = 1/2(68) + 20 = 34 + 20 = 54

m∠DBC = 2(68) - 10 = 136 - 10 = 126

Same concept for ∠XYW and ∠WYZ only this time they are complementary angles. This means their angles have a sum of 90°.

[tex]1\frac{1}{4}x-10+\frac{3}{4}x+20=90\\2x+10=90\\2x=80\\x=40[/tex]

m∠XYW = 1 1/4(40) - 10 = 50 - 10 = 40

m∠WYZ = 3/4(40) + 20 = 30 + 20 = 50

Other Questions
Robert owns two dogs. Each day, one dog eats1/6 of a scoop of dog food and the other dog eats br1/6 of a scoop. Together, how much dog food dothe two dogs eat each day? Write in simplestform. help please!! i need to find the value of x what is the volume of the solid? 9. What is m JKM? A 28 C 90 B 58.5 D 117 what do you know about the fugitive slave act of 1850 Given: overline LM cong overline ON and overline LO cong overline MN Prove : LMNO is a parallelogram The invisible hand principle indicates that competitive markets can help promote the efficient use of resources Group of answer choices only if buyers and sellers really care, personally, about economic efficiency. even when each market participant cares only about their own self interest rather than about the overall efficiency of resource use. even if business firms fail to produce goods efficiently. if, and only if, businesses recognize their social obligation to keep costs low and use resources wisely. If you see your friend in in trouble particpating in an excessive amountof driking at a party. What do you do?Offer the friend a ride omer a ride home immediately.I would tell somebody at the part ty helpI would not interfere.I would call 911 give a short introduction of carl von linnaues and rh whittakers regarding classification of living beings one major point 5. Simplify: 2/5 +3/7+(-6/5)+ (-13/7) The graph shown is the solution set for which of the following inequalities? One of Hoover's relief measures for the poor was creation of the:Works Progress administrationFarm Credit ReliefReconstruction Finance CorporationEmergency banking Act Our system is a block attached to a horizontal spring on a frictionless table. The spring has a spring constant of 4.0 N/m and a rest length of 1.0 m, and the block has a mass of 0.25 kg. Compute the PE when the spring is compressed by 0.50 m. I need help on this 20 points The required minimum cooking temperature for ground beef is 155F (68C). Why must ground beef be cooked to this temperature? This temperature kills germs that may be in the meat This temperature reduces the amount of fat in the meat People don't like to see pink inside the meat This temperature activates important nutrients in the meat PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER PLS GIVE ME A STEP BY STEP EXPLANATION!!A charity is holding a benefit at an Italian restaurant. The owner of the restaurant offers to donate $200 in addition to $4 for each person that attends. Write an equation where d is the total donation and p in the number of people that attend.A. d=4p+200B. d=4+200pC. p=4+200dD. p=4d+200 What is Halo form reaction? help don't work this is easyokay tomorrow I have a assignment and is is based on which one better country side or urban (city) and I am team urban (city) so pls share your idea pls it's mean a lot to me I will mark brainist In the 1800s, mass production led to fill in the blanks with the correct form of the verbs given in the brackets ................. 1. one of the boys _________ (be) a good student 2. The policemen _______(has) solved the case