I need help with these

I Need Help With These

Answers

Answer 1
2. Rubidium
3. Antimony
4. Ytterbium
5. Einsteinium

Related Questions

What has an atomic number of 1

Answers

Answer:

Hydrogen

Explanation:

How much heat must be transferred to 55 g of ice to change the ice's
temperature from -13°C to -5.0°C? (The specific heat capacity of ice is 2.11
J/g.°C)


Answers

928.4 J/.C

Q= m x c x t
M= 55 g
C=2.11
T=8

A pupil has drawn the electronic structure of fluorine and the diagram is shown below. However,
mistakes have been made. State three mistakes that have been made.

Fl atomic number: 9
Fl atomic mass: 10

(ps i have two of these but can’t figure out the last)

Answers

Answer:

The number of electrons in the orbit is wrong they have to be 9 and not 10since flourine is in group 7 the number of electrons in the outer most shell has to be 7 and not 2the first shell has 8 instead of 2 electrons

I hope this helps

What is the reducing agent in the reaction Fe + AgNO3 → Fe(NO3)3 + Ag?
O A. Fe
O B. AgNO3
C. Fe(NO3)3
O D. Ag

Answers

Answer:

A

Explanation:

Fe up to Fe+3

In the given reaction, Fe is a reducing agent. Therefore, option (A) is correct.

What is a reducing agent?

A substance in a redox reaction that donates its electrons to another substance and gets oxidized to a higher valency is called a reducing agent.

A reducing agent can be explained as one of the reactants of a redox reaction that can reduce the other reactant of the chemical reaction by donating its electrons.

If the reducing agent will not provide its electrons to other substances in a chemical reaction, then the reduction cannot take place. The given chemical reaction is:

Fe  +  AgNO₃  →   Fe(NO₃)₃  +  Ag

In the above reaction, the Fe is in the zero oxidation state and changes into Fe³⁺ in  Fe(NO₃)₃ after the chemical reaction So Fe losses its electron and gets oxidized. Therefore, Fe is a reducing agent in this reaction.

Learn more about reducing agent, here:

brainly.com/question/2890416

#SPJ2

How does the position of an object relate to the energy stored in a object?

Answers

Answer:

An object can store energy as the result of its position. For example, the heavy ball of a demolition machine is storing energy when it is held at an elevated position. This stored energy of position is referred to as potential energy. Similarly, a drawn bow is able to store energy as the result of its position

Answer:

you can see the attached file is scanned the same level of detail of the heart the heart and I am a little bit of an emergency you can see it on the heart the tree is the best of luck for tomorrow be in a few days and times are available in a while back and forth to be a good idea and latitude longitude of

hii pls help me!!
even if u know how to do one, it's okk
anything helps ​

Answers

Explanation:

a) HNO2(aq) = HNO3(aq) + H2O(l) +NO(g)

b) SoCl2 (l) + H2O (l) = So2(g) + 2HCl(aq)

c) CH4 (g) + 2O2(g) = Co2 (g) + 2H2O(g)

d) 3CuO(s) + 2NH3 (g) = 3Cu(s) + 3H2O (l) + N2(g)

find the atoms of 52u of helium ​

Answers

~Solution :-

Here, we have been given the the amount of helium to be 52 amu.

Thus,

Atomic mass of Helium is 4u = 2 protons + 2Neutrons = 1 atom. No. of atoms in 52u = $ \sf{\frac{52}{4}}$ = 13 atoms.

$ \red{\leadsto}$ Hence, the number of atoms will be 13 atoms.

[tex] \\ [/tex]

How many moles are in 32g of O2?

Answers

Answer:

1 mol of O2

Explanation:

n = m/ M

n = 32/ ( 2× 15.999)

n= 1 mol of O2

Which statement includes all the steps in the change that is associated with the enthalpy of solution? solute separation and mixing reaction of reactants to form products. solute and solvent mixing and then separating solute separation, solvent separation, and then mixing

Answers

Answer: solute separation, solvent separation, and then mixing

Explanation:

The enthalpy change of solution simply means the amount of heat which can be released or absorbed when dissolving. The enthalpy of solution is usually expressed at constant temperature in kJ/mol.

The enthalpy of solution requires three main stages:

1. Solute separation: This is when the solute is broken down. In this case, all the intramolecular forces which holds the solute together is broken.

2. Solvent separation: This is when the solvent is broken down all the intramolecular forces which holds the solvent together is broken.

3. Mixing- In this case, the solute and the solvent is mixed for a solution.

QUICK CHECK
Use the periodic table to select which type of bond is present and which of the listed properties is most
likely for each substance.
Substance
Type of bond
Likely property
A А
B
A
Cuzm
Ba
lonic
DO
covalent
02
С
D
metallic

Answers

Answer:

Coppell zinc,ironic bond

Explanation:

lt will give away two zinc atoms

Answer:

I will go with Sodium chlorine NaCl

Need help fast!!
What is the pH of a solution with a 1.50 x 10-9 M hydroxide ion concentration? (4
points)
1) 0.176
2) 5.18
3) 8.82
4) 9.20

Answers

Answer:

The answer is "5.18 ".

Explanation:

It's a question of chemistry. Therefore, the following solution is provided:

We will first determine the solution's pOH. The following can possible:

The concentration of Hydroxide ion [tex][OH^{-}] = 1.5\times 10^{-9}\ M[/tex]

[tex]pOH =?\\\\pOH = -\log [OH^{-}]\\\\pOH = -\log 1.5\times 10^{-9}\\\\pOH = 8.82\\\\[/tex]

Furthermore, the pH of the solution shall be established. It was provided as follows:

[tex]pOH = 8.82\\\\pH =?\\\\pH + pOH = 14\\\\pH + 8.82 = 14\\\\[/tex]

When collecting all the like terms:

[tex]pH = 14 -8.82\\\\pH = 5.18[/tex]

Therefore, the solution of pH is 5.18.

What is the reducing agent in the reaction Fe + AgNO3 → Fe(NO3)3 + Ag?
O A. Fe
B. AgNO3
C. Fe(NO3)3
D. Ag

Answers

Answer:

A.

Iron, Fe

explanation:

Iron reduces silver nitrate to silver.

Answer:

agno3

Explanation:

just took the quiz

Which is another word for 10 meters in the metric system?

Answers

Answer:

Dekameter

Explanation:

How many moles of KOH are there in 27.5 mL of 0.250 M KOH?

Question 2 options:

4.31 × 10−3 mol KOH


6.88 × 10−3 mol KOH


7.24 × 10−3 mol KOH


8.13 × 10−3 mol KOH


9.21 × 10−3 mol KOH

Answers

Answer:

6.88 × 10^-3mol

Explanation:

Molarity = number of moles (n) ÷ volume (V)

According to this question, there in 27.5 mL of 0.250 M KOH, the number of moles of KOH can, therefore, be calculated as follows:

number of moles = molarity × volume

Volume of KOH = 27.5mL = 27.5/1000

= 0.0275L

n = 0.0275 × 0.250

n = 0.006875 mol

n = 6.88 × 10^-3mol

Please help me
will give the brainliest!​

Answers

Explanation:

a) The presence of sulfate ions in a solution can be confirmed by the reaction of barium chloride in an acidic medium.

The balanced chemical equation of the reaction is shown below:

[tex]BaCl_2(aq)+CuSO_4(aq)->CuCl_2(aq)+BaSO_4(s)[/tex]

Hence, the white precipitate is barium sulfate and its formation with the ionic equation is shown below:

[tex]Ba^2^+(aq)+SO_4^2^-(aq)->BaSO_4(aq)[/tex]

b) The presence of copper (II) ions can be confirmed by the following test:

Add potassium iodide solution to copper (II) solution.

Then a white ppt of cuprous iodide along with the liberation of iodine is observed and the entire solution attains brown color.

The chemical equation of the reaction is shown below:

[tex]2CuSO_4(aq)+4KI(aq)->Cu_2I_2(s)+I_2(s)+2K_2SO_4(aq)\\[/tex]

c)(i)Due to this reaction, the blue color of the solution becomes white.

Reddish-brown copper is deposited at the bottom of the container.

(ii)In this reaction, zinc is oxidized.

d) (i) Copper is produced at the cathode.

(ii)[tex]Cu^2^+(aq)+2e^-->Cu(s)[/tex]

(iii) The reaction that takes place at the cathode is reduction.

Reduction is gaining of electrons.

MULTIPLE CHOICE QUESTION
Substances that would be described as an Element (such as Argon gas Ar,
fluorine gas F2, pure metal like gold Au ) have an oxidation state of what
number?
mentary
2

3
-1

1

O

Answers

Answer:

the oxidation number of those elements is 2 because some of them are molecules

which particle is an atom with only 10 neutrons in its nucleus ?

Answers

Answer:

fluorine

Explanation:

Why does nuclear fusion occur in stars but not on Earth?

A.
There are no elements on Earth that can undergo fusion.
B.
Too many free neutrons are present on Earth.
C.
Fusion reactions require a lot of heat and pressure.
D.
Elements capable of undergoing fusion can’t be enriched on Earth.

Answers

Answer:

C. Fusion reactions require a lot of heat and pressure

Explanation:

A Nuclear fusion doesn't occur naturally on Earth because it requires temperatures far higher than Earth temperatures. Nuclear fusion takes place only at extremely high temperatures. That's because a great deal of energy is needed to overcome the force of repulsion between the positively charged nuclei.

William adds two values , following the rules for using significant figures in computations. He should write the sum of these two number by using

Answers

Answer:

when it comes to adding or subtracting numbers, his final answer should have the same number of decimal places as the least precise value.

For example if you add 2 numbers; 10.443 + 3.5 , 10.443 has 3 decimal places and 3.5 has only one decimal place.

Therefore 3.5 is the less precise value.

So when adding these 2 values the final answer should have only one decimal place.

after adding we get 13.943 but it can have upto one decimal place. then the second decimal place is less than 5 so the answer should be rounded off to 13.9.

the answer is the same number of decimal places as the least precise value

Explanation:

I think this is the answer I'm not sure

Answer: the same number of decimal places as the least precise value

Explanation:

There is a series of nitrogen oxides with the general formula N?O?. What is the empirical formula of one that contains 30.45% nitrogen?

Question 13 options:

N2O


NO


NO2­


N2O3


N2O5

Answers

Answer: The empirical formula of one that contains 30.45% nitrogen is [tex]NO_{2}[/tex].

Explanation:

Given: Mass of nitrogen = 30.45 g

Let us assume that the mass of given oxide is 100 grams.

As the atomic mass of nitrogen is 14.0067 g. So, moles of nitrogen will be calculated as follows.

[tex]Moles = \frac{mass}{molarmass}\\= \frac{30.45 g}{14.0067 g/mol}\\= 2.17 mol[/tex]

Also, mass of oxygen = (100 - 30.45) g = 69.55 g

Atomic mass of oxygen is 15.9994 g/mol. So, moles of oxygen will be as follows.

[tex]Moles = \frac{mass}{molarmass}\\= \frac{69.55 g}{15.9994 g/mol}\\= 4.34 mol[/tex]

The ratio of both the atoms is as follows.

[tex]\frac{4.34}{2.17} = 2[/tex]

This means that gas has 2 moles of oxygen to 1 mole of nitrogen. Hence, the formula of oxide is [tex]NO_{2}[/tex].

Thus, we can conclude that the empirical formula of one that contains 30.45% nitrogen is [tex]NO_{2}[/tex].

Asap please help 15 points

Answers

Explanation:

P_H

and

li_n

hope it helps

Li-n is the correct answer

1 mole of alkene CxH2x was fully burnt in oxygen. The products were analysed. 264g of Co2 and 108g of of H20 were produced. Use the information to balance the equation and work out the identity of CxH2x.
CxH2x+ O2--> CO2+H2O
PLEASE CAN SOMEONE EXPLAIN THIS TO ME!!!!!!!!!!!!

Answers

Answer:

C6H12

Explanation:

Step 1: Find the molar mass of carbon dioxide and water

MH2O = 2(1.008) + 16.00 = 1.802x10^1 g/mol

MCO2 = 12.01 + 2(16.00) = 4.401x10^1 g/mol

Step 2: Calculate the moles of the products

nH2O = 108g / 1.802x10^1 g/mol = 5.99 or about 6

nCO2 = 264g/ 4.401x10^1 g/mol = 5.99 or about 6

Step 3: Enter moles of carbon dioxide and water into the balanced equation

CxH2x + O2 = 6CO2 + 6H2O

Step 4: Balance

We see how there is six carbon dioxide on the right side which means there are six carbons in the equation.

This means x is equal to 6 in our equation.

If you plug the information into the equation you get:

C6H12 + O2 = 6 CO2 + 6 H2O

Now all that's left is to balance the oxygens

We see how there is 18 oxygens on the right side of the equation which means there must be 18 on the left side.

Because we have oxygen gas we divide 18 by 2 which means there are 9 O2's on the left side

Therefore, the balanced equation is C6H12 + 9O2 = 6 CO2 + 6 H2O

b) The size of a star is a balance between
2 things. Explain this statement.

Answers

Answer:

Luminosity is the amount of light that a star radiates. The size of the star and its surface temperature determine its luminosity. Apparent magnitude of a star is its perceived brightness, factoring in size and distance, while absolute magnitude is its true brightness irrespective of its distance from earth

Explanation:

plz solve the question and send the answer
I will give u branist, follow u ,rate u 5 star and also give u like ,plz help me​

Answers

Answer:

64g of [tex]\bold{CH_{3}OH}\dashrightarrow[/tex]44.8L

vapour density of [tex]CH_{3}3OH=\frac{mass}{volume}[/tex] of [tex]\bold{CH_{3}OH}[/tex]

=64/44.8=10/7=1.43 g/l

Vapour density of [tex]\bold{CH_{3}OH}[/tex]=1.43g/l

64g of [tex]\bold{CH_{3}OH => 44.8L }[/tex]

vapour density of [tex]\small{\sf{CH_{3}3OH=\frac{mass}{volume} of } \bold{CH_{3}OH}}[/tex]

=64/44.8=10/7=1.43 g/l

Vapour density of [tex]\bold{CH_{3}OH = 1.43 g/L}[/tex]

if excess nitrogen gas reacts with 600 cm³ of hydrogen gas at room conditions , calculate the maximum volume of ammonia produced from the reaction? the chemical question is N2 + 3H2 = 2NH3​

Answers

Answer:

400 cm³ of ammonia, NH₃.

Explanation:

The balanced equation for the reaction is given below:

N₂ + 3H₂ —> 2NH₃

From the balanced equation above,

3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.

Finally, we shall determine the maximum volume of ammonia, NH₃ produced from the reaction. This can be obtained as illustrated below:

From the balanced equation above,

3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.

Therefore, 600 cm³ of H₂ will react to produce = (600 × 2)/3 = 400 cm³ of NH₃.

Thus, 400 cm³ of ammonia, NH₃ were obtained from the reaction.

Draw the following structures and name them :
I. CH3CH2(OH)
II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH
III.CH3CH(CH3)CHO
IV.CH2=CH(OH)
V.CH3OCH2CH3

Answers

Answer:

hope this helps.answer is in the picture

what is the difference between double salt and complex salt​

Answers

Answer:

The main different of double salt and complex salt is that a double salt is a combination of two salt compounds whereas a complex salt is a molecular structure that is composed of one or more complex ions.

Plants in forests take up carbon dioxide from the atmosphere during photosynthesis. They transform the carbon dioxide into plant material. When plants die, their organic matter is often worked into the soil by decomposers. Some of this organic matter remains within the soil and forest floor, and some of it is taken up by other living things.

Based on this information, what role do forests play in the carbon cycle?
A.
Forests are carbon sinks because they store carbon.
B.
Forests are carbon sinks because they do not absorb carbon dioxide when plants die.
C.
Forests are carbon sources because they emit carbon.
D.
Forests are carbon sources because they can be burned to emit carbon dioxide.

Answers

Answer is A

Because Trees store carbon and make it oxygen

Answer: B. forests are carbon sinks because they store carbon

Explanation:forests take up carbon from the atmosphere through photosynthesis and from organic matter through decomposition. so, forests are carbon sinks because they store carbon

If you hit the surface of Iron with a photon of energy and find that the ejected electron has a wavelength of .75 nm, what is the wavelength of the incoming photon in nanometers?

Answers

Answer:

The wavelength of the incoming photon is 172.8 nm

Explanation:

The wavelength of the incoming photon can be calculated with the photoelectric equation:

[tex] KE = h\frac{c}{\lambda_{p}} - \phi [/tex]   (1)

Where:

KE: is the kinetic energy of the electron

h: is Planck's constant = 6.62x10⁻³⁴ J.s  

c: is the speed of light = 3.00x10⁸ m/s

[tex]\lambda_{p}[/tex]: is the wavelength of the photon =?  

Φ: is the work function of the surface (Iron) = 4.5 eV        

The kinetic energy of the electron is given by:

[tex] KE = \frac{p^{2}}{2m} = \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} [/tex]  (2)

Where:  

p: is the linear momentum = h/λ

m: is the electron's mass = 9.1x10⁻³¹ kg

[tex]\lambda_{e}[/tex]: is the wavelength of the electron = 0.75 nm = 0.75x10⁻⁹ m

Hence, the wavelength of the photon is:

[tex] \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} = h\frac{c}{\lambda_{p}} - \phi [/tex]

[tex]\lambda_{p} = \frac{hc}{\frac{h^{2}}{2m\lambda_{e}^{2}} + \phi} = \frac{6.62 \cdot 10^{-34} J.s*3.00\cdot 10^{8} m/s}{\frac{(6.62 \cdot 10^{-34} J.s)^{2}}{2*9.1 \cdot 10^{-31} kg*(0.75 \cdot 10^{-9} m)^{2}} + 4.5 eV*\frac{1.602 \cdot 10^{-19} J}{1 eV}} = 1.728 \cdot 10^{-7} m = 172.8 nm[/tex]      

Therefore, the wavelength of the incoming photon is 172.8 nm.

I hope it helps you!        

HELLO EVERYONE PLEASE I NEED HELP WITH

Please I REALLY NEED A HELP WITH THIS PLEASE HELP ME

THIS HARRY POTTER LITERARY ESSAY
OUTLINE


1. Love and Friendship is a central theme in Harry Potter and the Philosopher's Stone. Prove that this statement is true using 2(two) different characters from the novel as examples.


Introductory Statement/ Hook:



Statement of Intent: reason A and B :



thesis reason A and B:



BODY PARAGRAPH



#1 Point #1: Introduce REASON A here, but use general statement



#1: Provide quotations from the novel to support Reason A



Explanation #1:


Proof #2:


Explanation #2:



BODY PARAGRAPH


#2 Point #2: Introduce REASON B here, but use general statements


#1: Provide quotations from the novel to support ReasonB



Explanation #1:


Proof #2:


Explanation #2:



CONCLUSION


Restate/ Summarize Thesis:


Restate/ Summarize Points:

Answers

Answer:

Ron and Hermoine

Explanation:

They always fought over petty things, but at the end, they did end up together!

(Answer for your question about love and friendship being a central theme in Harry Potter and the Philosopher's stone)

*ALSO, MY ANSWER MIGHT BE WRONG* so be sure to use a pencil just in case!

Other Questions
PLEASE HELP NEED THIS ASAP I AM TIMED WILL MARK BRAINLIST TEN POINTSRead the passage from Sugar Changed the World.Sugar was the connection, the tie, between slavery and freedom. In order to create sugar, Europeans and colonists in the Americas destroyed Africans, turned them into objects. Just at that very same moment, Europeansat home and across the Atlanticdecided that they could no longer stand being objects themselves. They each needed to vote, to speak out, to challenge the rules of crowned kings and royal princes. How could that be? Why did people keep speaking of equality while profiting from slaves? In fact, the global hunger for slave-grown sugar led directly to the end of slavery. Following the strand of sugar and slavery leads directly into the tumult of the Age of Revolutions. For in North America, then England, France, Haiti, and once again North America, the Age of Sugar brought about the great, final clash between freedom and slavery.Which sentence best states the authors' claim in this passage?A. Economic demand for sugar led to political pressure to end enslavement.B. The growing demand for sugar made the lives of enslaved people even worse.C. Turning Africans into objects was important for the sugar industry to succeed.D. Monarchies became increasingly strong and popular during the Age of Sugar. His words didn't help. Kayla replayed the inelegant scene inher mind. As she had walked across the stage, she had felther heel wobble slightly, sending her swaying back andforth. Then her foot had given out completely, and theauditorium had echoed as she hit the ground. After a fewseconds, giggles from the audience had broken thesilence. Kayla had been mortified, and her face hadremained flushed as she grabbed her award and ran backto her chair."I'm dying of embarrassment," she whispered in Devon'sear. "My life is ruined."Which statement best interprets the use of hyperbole in the passage? Which phase of the cell cycle is the least common process of mitosis and what could be the reason? Read this passage from "Samuel's Memory":I will never forget that lonesome hill of stone that is herfinal bed, as it fades from my sight. I tread softly by myuncle, my hand in his. I walk with my head turned, watchingthat small hill as it fades from my sight. The soldiers makeus continue walking. My uncle talks to me, trying tocomfort me. I walk in loneliness.Which statement best describes how the author's word choice contributes tothe tone of the passage?O A. The author's use of the phrase "fades from my sight" gives thepassage an upbeat and positive tone.B. The author's use of the phrase "fades from my sight" gives thepassage a sad and isolated tone.c. The author's use of the phrase "I will never forget" gives thepassage an upbeat and positive tone.D. The author's use of the phrase "I will never forget' gives thepassage a sad and isolated tone. Which of the following is not a way to prevent drug misuse and abuse?A. Discuss all side effects with your doctor when you are taking opioidsB. Dispose of all medications properly once treatment is completeC. Keep your opioid medications in an easily visible locationD. Never take more opioids than you are prescribed MC Qu. 141 Comet Company accumulated... Comet Company accumulated the following account information for the year: Beginning raw materials inventory$6,700 Indirect materials cost 2,700 Indirect labor cost 5,700 Maintenance of factory equipment 3,500 Direct labor cost 7,700 Using the above information, total factory overhead costs would be: help me with this math question A container is filled with water and the pressure at the container bottom is P. If the container is instead filled with a liquid having specific gravity 1.05, what new bottom pressure will be measured "If we could blossom out of ourselves, giving nothing imperfect, withholding nothing!" is an example of aa.simileinstructionc. metaphord. questionb. Find the perimeter of the polygon. Two towns A and B are 220km apart. A bus left town A at 11.00 AM and travelled towards town B at 60km/hr. At the same time, a van left town B for town A and travelled at 80km/hr. The van stopped for a total of 45 minutes on the way before meeting the bus. Calculate the distance covered by the bus before meeting the van. Please show clear working and explanation to get a brainlist !!! please! can somebody help me? Each participant in a certain study was assigned a sequence of 3 different letters from the set {A, B, C, D, E, F, G, H}. If no sequence was assigned to more than one participant and if 36 of the possible sequences were not assigned, what was the number of participants in the study? (Note, for example, that the sequence A, B, C is different from the sequence C, B, A.) Company manufactures luggage sets. sells its luggage sets to department stores. expects to sell luggage sets for each in and luggage sets for each in . All sales are cash only. Prepare the sales budget for January and February. In MNP , point Q is between points M and N, and point R is between points N and P. Point H is the incenter of the triangle, HQMN, and HR NP. QN=36 and HN=39 . What is HR ? Enter your answer in the box. The difference of a number and six is the same as five times the sum of a number and two what is the number In this fictional map, which elements suggest relative location?Check all that applyA. North and South PigletB West IslandC. Howe StraitD. Whye Strait ASAP please help meeeeeeeee What causes an ionic bond?A. Two ions share electrons.B. A positive ion is attracted to a negative ion.C. A positive ion is attracted to a positive ion.D. Two atoms share electrons. A small object with mass 0.20 kg swings as a pendulum on the end of a long light rope. For small amplitude of swing, the period of the motion is 3.0 s. If the object is replaced by one with mass 0.400 kg, what is the period for small amplitude of swing? (a) 1.5 s (b) 3.05 (c) 6.0 s (d) 12.0 s (e) none of the above answers