g A two-factor study with 3 levels of factor A and 3 levels of factor B uses a separate sample of 10 participants in each treatment condition. How many participants are needed for the entire study

Answers

Answer 1

Answer:

the total number of participants required is 90

Step-by-step explanation:

Given the data in the question;

Factor A has three levels

Factor B has three levels

sample size n; ten participants

we have two Way ANOVA involving Factor A and Factor B.

Now,

{ Total # Participants Required } = { #Levels factor A } × { #Levels factor B } × { Sample size of each level }

we substitute

{ Total # Participants Required } = 3 × 3 × 10

{ Total # Participants Required } = 9 × 10

{ Total # Participants Required } = 90

Therefore, the total number of participants required is 90


Related Questions

Evaluate 3|x|+2x-1 when x = -5.

Answers

Answer:

4

Step-by-step explanation:

To start off, we are going to input our x value into our expression.

3|-5| + 2(-5) - 1

Next, we are going to find the absolute value (always positive) of -5 and multiply 2 and -5.

3(5) - 10 -1

Now, we will multiply 3 and 5.

15 - 10 -1

Finally, we are going to combine our like terms (15, -10, and -1)

4

So! Our final answer for this expression is 4!

Hope this Helps! :)

Have any questions? Ask below in the comments and I will try my best to answer.

-SGO

Where r is the radius of the cylinder and h is the height of the cylinder.
Find the surface area when r is 7 inches and h is 9 inches.




Sa of cylinder= 2(pi)rh + 2(pi)r squared

Answers

Answer:

703.7 in²

Step-by-step explanation:

SA = 2πrh+2πr²

= 2×π×7×9+2×π×7²

= 224π

= 703.7 in² (rounded to the nearest tenth)

Answer:

224π

in²

Step-by-step explanation:

Determine the critical values for the confidence interval for the population standard deviation from the given values. Round your answers to three decimal places.
n = 12 and c = 0.9.

Answers

Answer:

The answer is "[tex]\chi^2_{L} = 4.575 \ and\ \chi^2_{U}= 19.675[/tex]"

Step-by-step explanation:

[tex]n=12\\\\\ c= 0.9[/tex]

Calculating the level of significance [tex](\alpha) = 1 -c[/tex]

                                                                  [tex]=1-0.9\\\\=0.1[/tex]

Calculating the degrees of freedom:

[tex]df=n-1=12-1=11[/tex]

Calculating the critical value:

Applying the Chi-Square table, the critical values for the two-tailed test with a degree of freedom  (11) for the significance level of [tex]\alpha = 0.1[/tex]:

[tex]\chi^2_{L} = 4.575 \\\\\chi^2_{U}= 19.675[/tex]

Complete the table for the given rule.
Rule: y is 0.750.750, point, 75 greater than x
x y
0
3
9

Answers

Answer:

está inglês não dá para entende

Q12 A baker wants to order enough flour for 10 loaves of bread weighing 750g each. She has a recipe for a 500g loaf of bread which needs 480g of flour. How many kilograms of flour does the baker need? Show your working​

Answers

Answer:

7.2kg of flour

Step-by-step explanation:

Total weight of bread = 10 x 750g

                                    = 7500g = 7.5kg

500g of bread = 480g of flour

0.5kg of bread = 0.48kg of flour

7.5kg of bread = 7.2kg of flour

Which graph represents the function h(x)=x+0.5

Answers

Answer:

The correct graph of h(x) will be number 3 (c).

Step-by-step explanation:

We have the function h(x) = |x| + 0.5

On putting x=0, in the function h(x), we get,  

h(0) = |0| + 0.5

h(0)=0 + 0.5

h(0)=0.5

Thus, the point (0,0.5) lie on the graph of h(x).

The graph that represents the function h(x) is graph (c)

How to determine the graph?

The equation is given as:

h(x) = |x| + 0.5

The above equation is an absolute value function

An absolute value function is represented as:

h(x) = a|x + h| + k

Where:

Vertex = (h,k)

By comparing h(x) = a|x + h| + k and h(x) = |x| + 0.5, we have:

h = 0 and k = 0.5

So, the vertex is (0,0.5)

The graph that has a vertex of (0,0.5) is graph (c)

Hence, the graph that represents the function h(x) is graph (c)

Read more about absolute value function at:

https://brainly.com/question/3381225

help me besties pls and have a good Bestie

Answers

Answer:

6

Step-by-step explanation:

Area = length x width

Input the numbers:

Area = 78

length = 13

78 = 13 x width

width = 78 / 13

width = 6

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

Answer:

Width=6m

Step-by-step explanation:

Area=78m^2

Length=13m

width=?(let width be x)

[AREA OF RECTANGLE=length× width]

78=13×x

78=13x

×=6

Work out m and c for the line: y = 6 x

Answers

Answer:

m = 6

c = 0

General Formulas and Concepts:

Algebra I

Slope-Intercept Form: y = mx + c

m - slope c - y-intercept

Step-by-step explanation:

Step 1: Define

y = 6x

↓ Compare to Slope-Intercept Form

Slope m = 6

y-intercept c = 0

terms are there. Divide 51 into three parts in AP so that the largest exceeds the smallest by 10.​

Answers

The first three terms of the Arithmetic Progression are 12, 17 and 22.

For an ARITHMETIC PROGRESSION, AP ;

First term = a

Second term = a + d

Third term = a + 2d

Where, d = common difference ;

If third term exceeds smallest by 10 ;

Third term - first term

a + 2d - a = 10

2d = 10

d = 10/2

d = 5

Sum of the three terms :

a + (a + d) + a + 2d = 51

3a + 3d = 51

d = 5

3a + 3(5) = 51

3a + 15 = 51

3a = 51 - 15

3a = 36

a = 12

The AP would be:

First term, a = 12

Second term, a + d = 12 + 5 = 17

Third term = a + 2(d) = 12 + 10 = 22

Therefore , the first three terms of the AP are :

12, 17 and 22

Learn more about ARITHMETIC PROGRESSION :

https://brainly.com/question/12006170

Please help me with this on the picture

Answers

9514 1404 393

Answer:

  (-5, 4)

Step-by-step explanation:

The inside corner moves from (2, -2) to (-3, 2). That is 5 is subtracted from the x-coordinate, and 4 is added to the y-coordinate. (x, y) ⇒ (x -5, y +4)

The translation vector can be written horizontally as (-5, 4), or vertically as ...

  [tex]\displaystyle\binom{-5}{4}[/tex]

Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?

Answers

Ian has 48 candies. hope that helps!
Ian has 4 candies...........

12/1,000 into decimal​

Answers

0.012 is the answer!

I hope this helps you out! :D

[tex]\\ \sf\longmapsto \dfrac{12}{1000}[/tex]

1000 has 3zeros hence decimal will go 3 points left

[tex]\\ \sf\longmapsto 0.012[/tex]

More:-

[tex]\\ \sf\longmapsto \dfrac{1}{10}=0.1[/tex]

[tex]\\ \sf\longmapsto \dfrac{1}{100}=0.01[/tex]

The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False

Answers

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

What is triangle?

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

write your answer as an integer or as a decimal rounded to the nearest tenth​

Answers

Answer:

FH ≈ 6.0

Step-by-step explanation:

Using the sine ratio in the right triangle

sin49° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{FH}{FG}[/tex] = [tex]\frac{FH}{8}[/tex] ( multiply both sides by 8 )

8 × sin49° = FH , then

FH ≈ 6.0 ( to the nearest tenth )

Answer:

6

Step-by-step explanation:

sin = opposite/hypotenuse

opposite = sin * hypotenuse

sin (49) = 0,75471

opposite = 0,75471 * 8 = 6,037677 = 6

convert 35 m/s to km/hr

Answers

Hello, there I hope you are having a great day :) Your question was to convert 35 m/s to km/hr the answer would be 126 km/ hr as you would times it by 3.6 to work out your answer.

Hopefully that helps you :)

Needddd annnsssweeerrr

Answers

Answer:

90in2

Step-by-step explanation:

3x5x6=90

Answer:

C.90

Step-by-step explanation:

first multiply 3 and 5 which is 15 then times it with 6 which equals 90

Find the 97th term of the arithmetic sequence 17, 26,35,...

Answers

Hy mate!!

The answer of your question is in the attachment..!!

.

.

Hope this answer helps you..!!

.

.

Select it as the BRAINLIEST..!!

Calculate the range and the standard deviation for the set of numbers.
6,5, 1, 5, 8, 5, 3, 5, 4,7
The range is
(Simplify your answer.)

Can I please get help with this problem?

Answers

Answer:

When time is short and you just want a rough estimate of the standard deviation, turn to the range rule to quickly estimate the standard deviation value. The standard deviation is approximately equal to the range of the data divided by 4. That's it, simple.

please helpppp i need it by tonight its very important

Answers

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Solve for x.
A. 9
B. 12
C. 1
D. 7

Answers

Answer:

9

Step-by-step explanation:

use Tangent-chord formula for finding the arc knowing E

x=1/2n

4x+19=1/2n

n=8x+38

both arcs = 360

28x-2+8x+38=360

x=9

look at the image below

Answers

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

Starting with a fresh bar of soap, you weigh the bar each day after you take a shower. Then you find the regression line for predicting weight from number of days elapsed. The slope of this line will be:__________.

Answers

Answer:

The slope will be negative

Step-by-step explanation:

The slope of the regression line tells us about the relationship or behavior of the dependent and independent variables. In the scenario above, where the weight is being compared with the number of days elapsed. What is expected of the weight and quantity of a bar soap each time it is used for a shower is that it will decrease in weight. Therefore, as the number of days increases, and hence, number of showers rise, the weight of soap will decrease. Hence, we'll obtain a negative slope, one in which the increase in a variable leads to decrease in the other.

210
To rationalize the denominator of
3.11,You should multiply the expression by which fraction?
11
2- V10
2- 10
3- V11
3- V11

Answers

The answer is The second one because I took this test before and I got it right

We should multiply the expression by √11/ √11 fraction.

What is the fundamental principle of multiplication?

Multiplication is the mathematical operation that is used to determine the product of two or more numbers.

To rationalize this, we multiply both the denominator and denominator by the conjugate of the denominator.

The denominator is 2-√10 and its conjugate is; (2+√10).

(2√10)/(3√11) = (2√10)/(3√11)

                      =  ((2√10)√11/(3√11) √11

                =    (2√110)/33

This is the rationalized expression.  

Learn more about multiplications;

brainly.com/question/14059007

#SPJ7

Which phrase describes an unknown or changeable quality?
3 feet and 7 inches
4 quarts in a gallon
2 o'clock in the afternoon
The height of the building times 1/2

Answers

Answer:

it should be the height of the building time 1/2

Step-by-step explanation:

let me know if its correct or incorrect we'll I hope this help you

Banking fees have received much attention during the recent economic recession as bankslook for ways to recover from the crisis. A sample of 31 customers paid an average fee of $11.53 permonth on their checking accounts. Assume the population standard deviation is $1.50. Calculatethe margin of error for a 90% confidence interval for the mean banking fee.

Answers

Answer:

The margin of error for a 90% confidence interval for the mean banking fee is of $0.44.

Step-by-step explanation:

We have that to find our [tex]\alpha[/tex] level, that is the subtraction of 1 by the confidence interval divided by 2. So:

[tex]\alpha = \frac{1 - 0.9}{2} = 0.05[/tex]

Now, we have to find z in the Z-table as such z has a p-value of [tex]1 - \alpha[/tex].

That is z with a pvalue of [tex]1 - 0.05 = 0.95[/tex], so Z = 1.645.

Now, find the margin of error M as such

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

In which [tex]\sigma[/tex] is the standard deviation of the population and n is the size of the sample.

Sample of 31:

This means that [tex]n = 31[/tex]

Assume the population standard deviation is $1.50.

This means that [tex]\sigma = 1.5[/tex]

Calculate the margin of error for a 90% confidence interval for the mean banking fee.

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

[tex]M = 1.645\frac{1.5}{\sqrt{31}}[/tex]

[tex]M = 0.44[/tex]

The margin of error for a 90% confidence interval for the mean banking fee is of $0.44.

What is an explicit formula for the geometric sequence -64,16,-4,1,... where the first term should be f(1).

Answers

Answer:

[tex]a_{n} = -64(-\frac{1}{4})^{n-1}[/tex]

it seems like the first term is -64, so lets write the formula accordingly:

a_n = a1(r)^(n-1)

where 'n' is the number of terms

a1 is the first term of the sequence

'r' is the ratio

the ratio is [tex]-\frac{1}{4}[/tex] because -64 * [tex]-\frac{1}{4}[/tex] = 16 and so on...

the explicit formula is :

[tex]a_{n}[/tex] = [tex]-64(-\frac{1}{4} )^{n-1}[/tex]

Find the greatest rational number r such that the ratios 8/15 ÷ r and 18/35 ÷ r are whole numbers?

Answers

The answer is "[tex]\bold{\frac{2}{105}}[/tex]", and the further calculation can be defined as follows:

When the "r" is the greatest common divisor for the two fractions.

So, we will use Euclid's algorithm:  

[tex]\to \bold{(\frac{8}{15}) -(\frac{188}{35})}\\\\\to \bold{(\frac{8}{15} -\frac{188}{35})}\\\\\to \bold{(\frac{56-54}{105})}\\\\\to \bold{(\frac{2}{105})}\\\\[/tex]

this is  [tex]\bold{(\frac{8}{15}) \ \ mod \ \ (\frac{18}{35})}[/tex]

we can conclude that the GCD for [tex]\bold{\frac{54}{105}}[/tex], when divided by [tex]\bold{\frac{2}{105}}[/tex], will be the remainder is 0.  Rational numbers go from [tex]\bold{\frac{2}{105}}[/tex] with the latter being the highest.

So, the final answer is "[tex]\bold{\frac{2}{105}}[/tex]".

Learn more:

greatest rational number:brainly.com/question/16660879

Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.

Answers

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

a car drives at 45 km/h for 75 minutes how far does the car travel

Answers

Answer:

56.25km

Step-by-step explanation:

75min = 5/4 h

distance = speed * time = 45 * 5/4 = 56.25

Other Questions
TUOI 7. A stone dropped from a window reaches the ground in 1.5 seconds. Calculate the height of the window above the ground ng cng sn l g? A student dissolves 12.6g of amonium nitrate(NH4NO3) in 250.g of water in a well-insulated open cup. She then observed the temperature of the water fall from 23.0C to 18C over the course of 6.1 minutes. NH4NO3 NH4+ (aq) + NO3^-(aq)a. Is this reaction exothermic, endothermic, or neither? b. If you said the reaction was exothermic or calculate the amount of heat that was released or absorbed by the reaction in this case. c. Calculate the reaction enthalpy Hrxn per mole of NH4NO3. Rachel bought 2.5 pounds of cookies for $13.40. Her friend buys 4.5 pounds of crackers for $24.75. Which is lessexpensive per pound? By how much? (HINT: Find the unit rate for each, then find the difference) ASAPWhich of the following means 'Dehydrated'?A. Too much waterB. Too little acidC. Too much acidD. Too little water When units produced exceed units sold, net income will generally be ______ costing. Multiple choice question. the same under both absorption costing and variable higher under variable costing than under absorption higher under absorption costing than under variable Help me! thank you so much Find the slope of the line containing the points (-3, 8) and (2, 4). Martin writes down 4numbers.Their mean is 8.The range is 6.The largest value is 11.There is no mode.Write down the fournumbers. Potassiums atomic number is 19, and its atomic mass is approximately 39. How many neutrons does potassium have?19582039 what does te'amo mean in spanish Which of these supreme court cases stated the Constitution gives the federal government certain implied powers?A. Marbury v. MadisonB. McCulloch v. MarylandC. Engel v. VitaleD. Mapp v. Ohio *PLEASE HELP ME ILL GIVE BRAINLIST IF CORRECT*Noah is playing a game where he must spin two wheels, each with 9 equal slices. There are 3 red slices, 3 green slices, 2 blue slices and 1 yellow slice on each wheel. If Noah spins and lands on a yellow slice on both wheels he wins, but if he lands on any other color, he loses. This information was used to create the following area model.Is this a fair game? Why or why not?A. Yes, the game is fair because Noah has equal probabilities of winning or losing.B. Yes, the game is fair because Noah does not have equal probabilities of winning or losing.C. No, the game is not fair because Noah has equal probabilities of winning or losing.D. No, the game is not fair because Noah does not have equal probabilities of winning or losing. The value of x in the expression 2x/3 - 7 = 5 isA---8B---24C---18D---36 The average of four different positive integers is 9. What is the greatest value for one of the integers? On what basis had the federal bureaucracy been established? Write a program that takes a date as input and outputs the date's season. The input is an integer to represent the month and an integer to represent the day. Ex: If the input is: 4 11 the output is: spring In addition, check if both integers are valid (an actual month and day). Ex: If the input is: 14 65 the output is: invalid The dates for each season are: spring: March 20 - June 20 summer: June 21 - September 21 autumn: September 22 - December 20 winter: December 21 - March 19 Avanced Algebra PLS ANSWER THIS CORRECTLY Use the function f(x) to answer the questions:f(x) = 2x^2 3x 5Part A: What are the x-intercepts of the graph of f(x)? Show your work. (2 points)Part B: Is the vertex of the graph of f(x) going to be a maximum or a minimum? What are the coordinates of the vertex? Justify your answers and show your work. (3 points)Part C: What are the steps you would use to graph f(x)? Justify that you can use the answers obtained in Part A and Part B to draw the graph. (5 points) pleeaseeee help me !!! Completa el espacio en blanco con la mejor respuesta con subjuntivos (subjunctives).Tu madre dijo que t no ____acostarte tan tarde. (deber)debesdebierasdeberdebas