Copper reacts with sulfuric acid to yield copper(II) sulfate, water, and sulfur dioxide.

a. True
b. False

Answers

Answer 1

Answer:

B. False

Explanation:

Water does NOT react too copper. Copper does not react with water because the oxygen in water is locked into a compound with one part oxygen and two parts hydrogen. Copper oxide is a compound from the two elements copper and oxygen. Everything else listed does but since water is on this list it is false.


Related Questions

what is the machine used to check melting point called?​

Answers

Answer:

Melting-point apparatus

A technical machinist is asked to build a cubical steel tank that will hold "265" L of water. Calculate in meters the smallest possible inside length of the tank. Round your answer to the nearest .

Answers

Answer:

0.64 m

Explanation:

Given that;

1L = 0.001 cubic metre

Then;

263 L = 263 L × 0.001 cubic metre/1L

= 0.263 cubic metre

Volume of a cube = l^3

l= 3√V

l= 3√0.263 cubic metre

l= 0.64 m

Please please help help please

Answers

Acute toxin or D) 100% correct

Identify the options below that are results of adding a catalyst to a chemical system.
The reaction rates are increased.
The reaction quotient is unaffected.
The reaction quotient decreases.
The equilibrium constant is unaffected.

Answers

Answer:

The correct options are a, b and d

Explanation:

A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's  principle explains how a substance or an "action" can affect a reaction in equilibrium.

The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.

However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).

The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.

What is a catalyst?

A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.

The catalyst takes part in the reaction but did not consume in the chemical reaction.

The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.

Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.

Learn more about catalysts, here:

https://brainly.com/question/17052831

To what volume (in mL) would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN?

Answers

Answer:

To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN

Explanation:

Dilution is the reduction of the concentration of a chemical in a solution and consists simply of adding more solvent.

In a dilution the amount of solute does not vary. But as more solvent is added, the concentration of the solute decreases, as the volume (and weight) of the solution increases.

In a solution it is fulfilled:

Ci* Vi = Cf* Vf

where:

Ci: initial concentration Vi: initial volume Cf: final concentration Vf: final volume

In this case:

Ci= 1.40 MVi= 20 mLCf= 0.088 MVf= ?

Replacing:

1.40 M* 20 mL= 0.088 M* Vf

Solving:

[tex]Vf=\frac{1.40 M* 20 mL}{0.088 M}[/tex]

Vf= 318.18 mL

To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN

>
Which statement describes an electron?
EEEE
It has a positive charge and is located in the nucleus.
O It has a positive charge and is located in orbitals around the nucleus.
It has a negative charge and is located in the nucleus.
O It has a negative charge and is located in orbitals around the nucleus.

Answers

Answer:

It has a negative charge and is located in orbitals around the nucleus

Explanation:

The statement describes an electron is " It has a negative charge and is located in orbitals around the nucleus."

What is electron?

The electron would be a subatomic particle with a negatively one elementary charge electric charge.

What is nucleus?

Protons, that have a positive charge, as well as neutrons, which have no electrical charge, make up the nucleus. Quarks were subatomic particles that make up protons but also neutrons.

Electrons were present surrounding the atom's nucleus, in contrast to protons as well as neutrons, that are contained within the nucleus at its core. Negative electrons were drawn to the positive nucleus since the electric charges of opposite polarity attract one another.

To know more about electrons and nucleus.

https://brainly.com/question/23366064

#SPJ3

Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:

Answers

Answer:

Calculate the moles of N2 molecules in 3.94 grams of nitrogen.

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.

Explanation:

Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT

Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol

Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:

3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:

5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.

C3H8 is ________

A. unsaturated
B. saturated​

Answers

I believe it is saturated!

I hope this helps. Please mark me the Brainliest, it’s not necessary but I put time and effort into every answer and I would appreciate it greatly. Have a great day, stay safe and stay healthy ! :)

Would 1 pound of peanut butter occupy more or less space than 1 pound of water?

Answers

It would occupy less space

Post-Lab Questions
1. A beverage company is having trouble with the production of the dye in their drinks. The color of their drink mix is supposed to be a pale green color, but they often get different results. For each unwanted result, choose the most plausible explanation to help the company improve the formula.
(1pts)
The color of the drink is too pale after adding the dye to the drink because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The color of the dye is appearing as red, instead of green because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The drink started out the correct color but it is getting darker over time, even though nothing has been added to the drink, because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
2. Beer's Law states that A=εbc, where A is the absorbance, ε is the molar absorptivity of the solute, b is the path length, and c is the concentration. Identify the experimental evidence from the activity that you have for the dependence of absorbance on each variable.
The evidence for the dependence of absorbance on the variable ε is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable b is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable c is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
3. Describe how you could use the Beer's Law simulation to experimentally determine the best wavelength at which to perform an experiment.
Measure the absorbance for solutions of multiple different solutes and find the minimum absorbance.
Measure the absorbance for solutions with different concentrations and find the slope of the trendline.
Measure the absorbance for the same solution at different wavelengths and find the maximum absorbance.
Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.

Answers

Answer:

1. not enough dye was added to the drink.

The wrong dye was added to the drink

the water in the drink is evaporating

2. Changing the compound changes the absorbance behavior.

3. Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.

Explanation:

When the beverage company adds dye to the drink, there should be standard quantity added to the drink so that the color of the drink remains constant. When too much dye is added to the drink, the color will get dark brown or black. When the color of drink get lighter than green this means dye is not added in required quantity.

Assign oxidation state to each atom in each element ion or compound.
a. Ag
b. Ag+
c. CaF2
d. H2S
e.CO3
f. CrO4
g. Cl2
h. Fe
i. CuCl2
j. CH4

Answers

Answer:

a. [tex]Ag^0[/tex]

b. [tex]Ag^{+}[/tex]

c. [tex]Ca^{2+}F_2^-[/tex]

d. [tex]H_2^+S^{2-}[/tex]

e. [tex](C^{4+}O_3^{2-})^{-}[/tex]

f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]

g. [tex]Cl_2^0[/tex]

h. [tex]Fe^0[/tex]

i. [tex]Cu^{2+}Cl_2^-[/tex]

j. [tex]C^{4-}H_4^+[/tex]

Explanation:

Hello there!

In this case, according to the concept of charge balance, which tell us that the overall charge is zero for any compound, except ions, it turns out possible to proceed as follows:

a. [tex]Ag^0[/tex]

b. [tex]Ag^{+}[/tex]

c. [tex]Ca^{2+}F_2^-[/tex]

d. [tex]H_2^+S^{2-}[/tex]

e. [tex](C^{4+}O_3^{2-})^{-}[/tex]

f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]

g. [tex]Cl_2^0[/tex]

h. [tex]Fe^0[/tex]

i. [tex]Cu^{2+}Cl_2^-[/tex]

j. [tex]C^{4-}H_4^+[/tex]

Keep in mind lonely elements have 0 as their oxidation state.

Regards!

How do I solve this?

Answers

Explanation:

a) Since this is a double displacement reaction, we write the balanced equation as

[tex]2AgNO_3(aq) + CaCl_2(aq) \\ \rightarrow 2AgCl(s) + Ca(NO_3)_2(aq)[/tex]

b) Next we find the number of moles of AgNO3 in the solution.

[tex](0.005\:\text{L})(0.500\:M\:AgNO_3) \\ = 0.0025\:\text{mol}\:AgNO_3[/tex]

Next, use the molar ratio to find the necessary amount of CaCl2 to react with the AgNO3:

[tex]0.0025\:\text{mol}\:AgNO_3× \left(\dfrac{1\:\text{mol}\:CaCl_2}{2\:\text{mol}\:AgNO_3} \right)[/tex]

[tex]= 0.00125\:\text{mol}\:CaCl_2[/tex]

The volume of 0.500 M solution of CaCl2 necessary to react all of the given AgNO_3 is then

[tex]V = \dfrac{0.00125\:\text{mol}\:CaCl_2}{0.500\:\text{M}\:CaCl_2}[/tex]

[tex]= 0.0025\:\text{L} = 2.5\:\text{mL}\:CaCl_2[/tex]

c) The theoretical yield can then be calculated as

[tex]0.0025\:\text{mol}\:AgNO_3 × \left(\dfrac{2\:\text{mol}\:AgCl}{2\:\text{mol}\:AgNO_3} \right)[/tex]

[tex]= 0.0025\:\text{mol}\:AgCl[/tex]

Converting this amount of AgCl into grams, we get

[tex]0.0025\:\text{mol}\:AgCl × \left(\dfrac{143.32\:\text{g}\:AgCl}{1\:\text{mol}\:AgCl} \right)[/tex]

[tex]= 0.358\:\text{g}\:AgCl[/tex]

The metal tantalum becomes superconducting at temperatures below 4.483 K. Calculate the temperature at which tantalum becomes superconducting in degrees Celsius.

Answers

Answer:

The correct answer is "-268.667°C".

Explanation:

Given:

Temperature,

= 4.483 K (below)

Now,

The formula of temperature conversion will be:

⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]

By putting the values, we get

⇒            [tex]=4.483-273.15[/tex]

⇒            [tex]=-268.667^{\circ} C[/tex]

Thus the above is the correct answer.

write any two things that should be remembered while writing chemical equation​

Answers

Answer:

the product and the reactant must be balanced

if u are required to give the mechanism if the reaction it must be written

Name the compound CuI2

Answers

Answer:

Copper iodide. I think

Answer:

copper iodide(Cul2)

hope it helps

stay safe healthy and happy..

once a recrystallization is completed and filtered, what solvent would be suitable for transferring the leftover solids to filtration funnel

Answers

Answer:

To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).

Explanation:

Hope this helped

Pls pls help me me pls

Answers

Answer:

Danger

Explanation:

Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.

a. True
b. Flase

Answers

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.

#6 and #7. How many carbon atoms are in a mixture of 7.00 mol c2F2 and 0.400 mol carbon dioxide and also #7

Answers

Answer:

#6  8.67x10²⁴ atoms

#7  

1. Atom

2. Formula unit

3. Molecule

4. Ion

Explanation:

#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:

7.00 mol C₂F₂ * 2 = 14.00 mol C

As for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.

We calculate the total number of C moles:

14.00 mol + 0.400 mol = 14.4 mol C

Finally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:

14.4 mol * 6.023x10²³ atoms/mol = 8.67x10²⁴ atoms

#7

1. Radon - Atom (Ra)2. Formula unit (It is a crystalline solid, BaBr₂)3. Molecule (NH₃)4. Ion (It has a formal charge, +2)

Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these

Answers

Answer:

b. glass and charcoal

Explanation:

Step 1: Given data

Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mL

Step 2: Determine which material will float in molten lead

Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.

the force of attraction between non polar molecules are what​

Answers

Answer:

dispersion force

Explanation:

it’s dispersion force bro

Please help me ASAP in my final project I am ready to pay 20$

Answers

Answer:

$20

ASAP PROJECT

the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces​

Answers

Answer:

d. van der waals force

Explanation:

Van der Waals force :

the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.

What is the molecular formula of the structure below?

Picture is attached pls help I’ll mark as brainliest for the right answer

Answers

Answer:

C₆H₆

Explanation:

Each border of the figure represents 1 atom of carbon. We have 6 borders = 6 atoms of carbon.

Each atom of carbon form 4 bonds. All the carbons are doing a double bond and a single bond with other carbons. That means are bonded 3 times. The other bond (That is not represented in the figure. See the image) comes from hydrogens. As we have 6 carbons that are bonded each 1 with one hydrogen. There are six hydrogens and the molecular formula is:

C₆H₆

This structure is: Benzene

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Answers

Answer:

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Explanation:

According to IUPAC rules, the name of a compound is:

Prefix+root word+suffix

1) Select the longest carbon chain and it gives the root word.

2) The substituents give the prefix.

3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.

The structure of the given compounds are shown below:

For the following reaction, 11.6 grams of sulfur are allowed to react with 23.8 grams of carbon monoxide .

sulfur(s) + carbon monoxide(g) sulfur dioxide(g) + carbon(s)

What is the maximum amount of sulfur dioxide that can be formed?

What is the formula for the limiting reagent?

What amount of the excess reagent remains after the reaction is complete?

Answers

Answer:

S + 2CO = SO2 + 2C

First, look for the amount of substance of sulfur:

n(S) = m / M

n(S) = 14.8 g/32 g / mol = 0.4625 mol

n(CO) = m (CO) / M (CO)

M(CO) = 12 + 16 = 28 g/mol

n(CO) = 19.9 g/28 g/mol = 0.71 mol

S in excess, so for calculating we take CO:

n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol

m(SO2) = M(SO2)*n(SO2)

M(SO2) = 32 + 16*2 = 64 g/mol

m(SO2) = 64 g/mol * 0.355 mol = 22.74 g

Vocabulary: dipole, dipole-dipole force, dipole-induced dipole force, electronegativity, intermolecular force, ionic bond, London dispersion force, molecule, nonpolar, nonpolar covalent bond, partial charges, polar, polar covalent bond, valence electron Prior Knowledge Questions (Do these BEFORE using the Gizmo.) 1. A big bully is having a tug-of-war with a small child. There is a ball attached to the middle of the rope. Toward whom will the ball move

Answers

Answer:

Towards the big bully

Explanation:

If a big bully and a small child are involved in a thug of war, it is clear that the bully is stronger than the child and he/she will pull the rope used in the thug of war with a greater force.

By so doing, the ball attached at the centre of the rope will naturally be drawn towards the stronger bully.

An atom has 20 electrons. Find out
i. It’s atomic numbers and total number of p-electrons
ii. The value of azimuthal quantum number (l) and magnetic quantum number (m) of the 19th electron of the atom.
iii. It’s group position in the periodic table.

Answers

Answer:

it's atomic number is 5 and total number is 10

The atom has an atomic number of 20 and has a total of 12 p electrons.

The azimuthal quantum number (l) of the 19th electron is 0 and the magnetic quantum number (m) of the 19th electron is 0.

It is an element of group 2

The number of electrons in the neutral atom is equal to the number of protons and is also the atomic number of an atom.

An atom is known to be electrically neutral. This is because the number of electrons in the atom is equal to the number of protons in the neutral atom.

The number of protons in the neutral atom is called the atomic number of the atom.

For an element that has 20 electrons, its electronic configuration is;

1s2 2s2 2p6 3s2 3p6 4s2.

The 19th electron is in the 4s orbital hence both the azimuthal and magnetic quantum numbers are zero.

The element has outermost electron configuration ns2 so it mus belong to group 2 of the periodic table.

https://brainly.com/question/16979660

Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.

a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O

Answers

the answer is option c

The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

What is the Urms?

The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.

Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

Learnmore about Urms: https://brainly.com/question/365923

Excluding any secondary chemical reactions,
which would be more effective as an antifreeze; a
solution containing
Select one:
25m CH3OH
the combination of 25m CH3OH and 25m
KCI.
O 25m KCI.
O
none of these​

Answers

Answer:

Excluding any secondary chemical reactions,

which would be more effective as an antifreeze; a

solution containing

Select one:

25m CH3OH

the combination of 25m CH3OH and 25m

KCI.

25m KCI.

Explanation:

Antifreeze is the one that reduces the freezing point of a solvent further and will not allow the solvent to freeze.

Among the given options, the correct option is:

25 m CH3OH and 25m KCl.

Since, KOH is a strong electrolyte and dissociates into two ions.

So, the freezing point of solvent decreases further.

Other Questions
Self-esteem and loss of control are keyfactors of our mental well being.A-TrueB-False Plz Help..!! GERMAN LANGUAGE It has been reported that the average credit card debt for college seniors is $3262. The student senate at a large university feels that their seniors have a debt much less than this, so it conducts a study of 50 randomly selected seniors and finds that the average debt is $2995, and the population standard deviation is $1100. At = 0.05, is the student senate correct? a) State the hypotheses and identify the claim with the correct hypothesis Rima said to me stay at home until your parents arrive home tomorrow (change into indirect speech) Cholesterol is necessary for the production of many other compounds in the body but can become harmful when blood levels exceed 135 mg/dl. exceed the body's ability to use it. can only be controlled through medications. a and b. Amendment 15 (1870):The right of citizens ofthe United States to vote shall not be denied or abridged by theUnited States or by any State on account of race, color, or previous conditions of servitude...1. What is outlawed with the 13th Amendment?2. What does the 14th Amendment essential do for the African Americans?3. What night is given with the 15th Amendment?4. Why do you think these Amendments would be important following the Civil War? Situation 1: There is a Head of Human Resource (HR) in a recognized Multinational National Company (MNC). You are a marketing executive in that company. You have made a communication with the HR regarding an emergency short time leave in a Critical moment of the Companys turnover. In this case how you will communicate with him and convince him to provide you a short-term leave. The things to be aware of. 1. HR is a rudy person. 2. He isn't very familiar with you. 3. Company is now at a Critical Moment and there is a lot of turnovers. 4. HR is about the age of 45+ And also provide an alternative answer if the situation gets negative over you. Ans. Light dependent reactions are carried out both on and in between photosystems. This process is like the last stage of aerobic respiration in that both:______.a. reaction sequences carry out electron transfer phosphorylations.b. processes generate ATP.c. processes involve electron flow.d. systems are lodged along and within a membrane surface. e. all of the above. Why would a researcher use a secondary source instead of its primary source when analyzing a historical event?Answer: To learn from the conclusions of many other experts on the event. _____ is used to develop tactical plans by integrating customer-focused marketing plans for new and existing products with the operational management of the supply chain. In the diagram, WZ=StartRoot 26 EndRoot.On a coordinate plane, parallelogram W X Y Z is shown. Point W is at (negative 2, 4), point X is at (2, 4), point Y is at (1, negative 1), and point Z is at (negative 3, negative 1).What is the perimeter of parallelogram WXYZ? units units units units Say you buy halibut at $19 per pound . One portion of seared halibut requires 6 ounces of halibut . How much does the halibut for one portion cost ? Round to the nearest cent . Alice and James went to the park in the evening Clocks are melting on a tree branch, rectangular surface, and a round surface. In the background is a cliff.In the above painting by Salvador Dal, entitled Persistence of Memory, which of the following objects do not occupy positive space?a.the clocksc.the tree trunkb.the groundd.the cliff find the sin in the triangle On her first day on the job in the fast food restaurant, Kayla's supervisor spent considerable time with her, explaining procedures and making sure that she knew how to greet customers, fill orders, and operate the cash register. What stage in the leader-member exchange theory does this describe Choisissez la bonne rponse.Qu'est-ce qu'on vend chez le boucher ? On vend du pouletet du boeuf.On vend des baguettes. What are some of the primary reasons/factors why students choose to use drugs while others do not? What was the iron curtain? Why did Churchill choose that term? Round 0.485 to the nearest hundredth