Calculate the buffer ratio (base/acid) required for a buffer of pH = 5.68 that is prepared by mixing sodium hydrogen oxalate and sodium oxalate. A table of pKa values can be found here. Report your answer to 2 significant figures in scientific notation. Calculate the pH (to two decimal places) of the buffer solution after the addition of 7.77 g of sodium hydrogen carbonate (NaHOCOO) to the buffer solution above. Assume 5% approximation is valid and that the volume of solution does not change.

Answers

Answer 1

122.5 grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M.

Weak acids are defined as acids that don't completely dissociate in solution. It can be explained as any acid that is not a strong acid. The strength of a weak acid depends on how much it gets dissociates and the more it dissociates, the stronger the acid. The mass of the weak acid in a solution of a certain pH can be determined by calculating the original concentration of the acid after calculating the concentration of the hydrogen ions with the help of the pH value of the solution.

The Concentration of oxalate ion is  0.115 M.

pKa1 is 1.250.

pKa2 is 4.266.

pH is 5.193.

Molarity = (mass / molar mass) / 1 / volume in liter

The molar mass is 126.07g/mole.

Mass = Molarity × molar mass × Volume in liter

Mass=0.972 M × 126.07 g/mole × 1.00 L

        = 122.5 gram

To learn more about concentration

https://brainly.com/question/17206790

#SPJ4

The complete question is,

A buffer prepared by dissolving oxalic add dihydrate (H2C2O4⋅2H2O) and disodium oxalate (Na2C2O4) in 1.00 L of water has a pH of 5.193. How many grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M? Oxalic acid has pKa values of 1.250 (pKa1) and 4.266 (pKa2).


Related Questions

Answer the following questions with a true or a false. PLease help me this is due in 5 more minutes

1.Natural hazards cause a range of negative impacts on people including disruptions to daily life, damage to property, economic loss, and injury to people.

2.Natural hazards vary in their severity (the degree to which they have impacts) because of the range of magnitudes that are possible for any natural hazard event.

3.Many natural hazards cause damage to property such as buildings, roads, vehicles, bridges. They cause these damages due to the unbalanced forces that shaking, moving water, and wind place on objects. These forces cause objects to accelerate suddenly and then decelerate suddenly when they collide into objects that are at rest or that are moving in a different direction.

4. The most intense and impactful natural hazard events of the past can help predict the possible intensity and damages of future hazards.

5.It is possible to predict how likely it is that a natural hazard event will occur in the future by examining how often such events have occurred in the past.

6.Patterns in the locations of past events help us forecast future events.

7.In order to make forecasts based only on records of past events, scientists must assume that the conditions that created those hazards in the past will remain the same in the future.

Answers

The answer for all natural hazards statements are 1. True, 2. Ture, 3. True, 4. True, 5. True, 6. True, 7. False.

Describe Natural Hazards?

Natural hazards are natural phenomena that can potentially cause harm or damage to humans, property, or the environment. These hazards are events that are caused by natural processes, such as geological, meteorological, hydrological, or biological processes. Natural hazards can range from relatively minor events, such as a small earthquake or a local flood, to catastrophic events, such as a volcanic eruption, a major earthquake, or a tsunami.

This statement is true. Natural hazards, such as earthquakes, hurricanes, floods, and wildfires, can cause a wide range of negative impacts on people and communities, including disruptions to daily life, damage to property, economic loss, and injury to people.

This statement is true. Natural hazards vary in their severity because they can occur in a range of magnitudes, from mild to extreme. The severity of a natural hazard event depends on various factors, such as the strength and duration of the event, the location and vulnerability of the affected population, and the preparedness and response capacity of the community.

This statement is true. Many natural hazards, such as earthquakes, hurricanes, and tornadoes, cause damage to property by exerting unbalanced forces on objects. These forces can cause objects to accelerate suddenly and then decelerate suddenly when they collide into objects that are at rest or that are moving in a different direction.

This statement is true. Studying the most intense and impactful natural hazard events of the past can help scientists and communities better understand the possible intensity and damages of future hazards. This information can be used to improve preparedness, response, and recovery efforts.

This statement is true. Examining the historical record of natural hazard events can help scientists and communities predict how likely it is that a similar event will occur in the future. This information can be used to assess risk and inform decision-making.

This statement is true. Patterns in the locations, frequency, and intensity of past natural hazard events can help scientists and communities forecast future events. For example, if a certain area has experienced frequent earthquakes in the past, it is more likely to experience earthquakes in the future.

This statement is false. While records of past events can provide valuable information for predicting future hazards, scientists do not assume that the conditions that created those hazards in the past will remain the same in the future. They consider a wide range of factors, such as changes in climate, land use, and population density, that may affect the occurrence and impact of natural hazards.

To know more about hazard  visit:

https://brainly.com/question/28269548

#SPJ1

The titration of 45.0 ml of an unknown triprotic acid required 32.71 ml of 0.37 M KOH to
reach the endpoint. What is the molarity of the unknown acid?

Answers

The molarity of the unknown triprotic acid is 0.269M.

How to calculate molarity?

Molarity is the concentration of a substance in solution, expressed as the number moles of solute per litre of solution.

The molarity of the unknown acid can be calculated using the following formula:

CaVa = CbVb

Where;

Ca and Va = acid concentration and volume respectivelyCb and Vb = base concentration and volume respectively

According to this question, the titration of 45.0 ml of an unknown triprotic acid required 32.71 ml of 0.37 M KOH to reach the endpoint.

45 × Ca = 32.71 × 0.37

45Ca = 12.1027

Ca = 0.269M

Learn more about molarity at: https://brainly.com/question/8732513

#SPJ1

The appearance of a gram-negative bacteria cell after the addition of the decolorizing agent (ethyl alcohol) in the Gram stain is _____.
(a) purple
(b) red
(c) colorless
(d) green.

Answers

Gram-negative bacteria appear as pink/red under the microscope after counterstaining with safranin. In conclusion, the appearance of a gram-negative bacteria cell after the addition of the decolorizing agent (ethyl alcohol) in the Gram stain is colorless.

The appearance of a gram-negative bacteria cell after the addition of the decolorizing agent (ethyl alcohol) in the Gram stain is colorless. Gram staining is a common microbiological method that is used to differentiate bacteria into two categories: Gram-positive and Gram-negative. This differentiation is based on differences in the composition of their cell walls. Gram staining is used to identify bacteria and fungi by staining the samples with crystal violet and iodine, then decolorizing with ethanol and counterstaining with safranin. This method helps to determine the presence or absence of a thick layer of peptidoglycan in the cell wall of bacteria. In Gram-negative bacteria, the decolorizing agent, ethyl alcohol, remove the outer membrane, causing the crystal violet stain to be removed from the cell wall, therefore resulting in a colorless appearance. The alcohol also increases the permeability of the thin peptidoglycan layer, which makes the safranin stain visible in the cell wall of the bacteria.

To learn more about Gram-negative bacteria :

https://brainly.com/question/28985258

#SPJ11

Predict the principal organic product of the following reaction. Specify stereochemistry where appropriate.

Answers

The major organic product of an SN2 substitution reaction is an alkene, which may be either in retention or inversion of configuration relative to the original substrate.

The reaction you are asking about is an SN2 substitution reaction, in which a nucleophile (Nu) displaces a leaving group (LG) from a molecule with an alkyl halide substrate. The major organic product of this reaction will be an alkene, which has the same carbon chain as the alkyl halide substrate. Depending on the relative configuration of the substrate, the alkene product may be the same as the original substrate (retention) or have its configuration inverted (inversion). If stereochemistry is relevant to the question, then it should be specified in the answer.

To learn more about SN2 substitution :

https://brainly.com/question/29849583

#SPJ11

2. Assume
60.0 mL
of a
2.5M
potassium chromate solution is mixed with
40.0 mL
of a
3.2M
solution of iron (III) chloride. a) Will a reaction occur and if so, what reaction will occur? b) How much precipitate will be produced in grams? c) What is the concentration of each spectator ion in the final solution? What is the concentration of left-over ions in the solution? (Calculate the final concentration of each ion).
Previous qu

Answers

The displacement reaction will occur. The concentration of each spectator ion in the final solution is 3/2 moles of Fe2(CrO4)3 will be formed and Concentration of CrO4^2- will be  0.033 M

Step 1:

The balanced chemical equation for the reaction is given below:

K2CrO4 + FeCl3 -> Fe2(CrO4)3 + 2KCl

Hence, the reaction occurs between potassium chromate and iron (III) chloride.

Step 2:

We need to find out how much precipitate will be produced in grams.

Let's calculate the moles of reactants and then use mole ratio to find out the limiting reagent:

[tex]\[\text{Moles of potassium chromate} = \text{Molarity} \times \text{Volume} \div 1000\][Molarity of K2CrO4 = 2.5 M; Volume of K2CrO4 = 60.0 mL][/tex]

Moles of K2CrO4 = (2.5 x 60.0) / 1000 = 0.150 mol

[tex]\[\text{Moles of iron (III) chloride} = \text{Molarity} \times \text{Volume} \div 1000\][Molarity of FeCl3 = 3.2 M[/tex] = 3.2 M;

Volume of FeCl3 = 40.0 mL]Moles of FeCl3 = (3.2 x 40.0) / 1000 = 0.128 mol

As we see, K2CrO4 is the limiting reagent. So, FeCl3 is in excess.

Therefore, amount of Fe2(CrO4)3 precipitated is given by moles of K2CrO4 and mole ratio:

[tex]\[\text{Moles of Fe2(CrO4)3} = \text{Moles of K2CrO4} = 0.150 mol\][/tex]

Now, we will find the molecular weight of Fe2(CrO4)3 as 479.87 g/mol.

[tex]\[\text{Mass of Fe2(CrO4)3} = \text{Moles of Fe2(CrO4)3} \times \text{Molecular weight}\][/tex]

[tex]\[\text{Mass of Fe2(CrO4)3} = 0.150 \times 479.87 = 71.98\][/tex]

Therefore, the amount of precipitate produced is 71.98 g.c

We need to find out the concentration of each spectator ion in the final solution.

Firstly, we can write down the ionic equation for the reaction:

[tex]2 K+ + CrO4^2- + 3 Fe^3+ + 3 Cl^- - > 2 K+ + 3 Cl^- + Fe2(CrO4)3[/tex]

Now, we will check which ions remain in the final solution. We see that potassium and chloride ions are spectator ions. Hence, we don't need to calculate their concentration. The concentration of remaining ions can be calculated as follows:Fe3+ ions: In the given reaction, 3 moles of FeCl3 reacts with 2 moles of K2CrO4.

Hence, 3/2 moles of Fe2(CrO4)3 will be formed.

Therefore,

= [tex]\frac{3/2 \times 3.2 \times 40.0 \div 1000}{60.0 + 40.0}[/tex]

= 0.034 M\]CrO42- ions:

In the given reaction, 2 moles of K2CrO4 reacts with 3 moles of FeCl3.

Hence, 2/3 moles of Fe2(CrO4)3 will be formed.

Therefore,

Concentration{ of CrO4^2-}

= [tex]\frac{2/3 \times 2.5 \times 60.0 \div 1000}{60.0 + 40.0}[/tex]

= 0.033 M\]

For more such questions on displacement reaction , Visit:

https://brainly.com/question/20690229

#SPJ11

.
Using the number 22.4 L, explain how to convert from volume of Substance A to volume of Substance B at STP.

Answers

To convert the volume of Substance A to the volume of Substance B at STP, you can use the principle of molar volume, which states that one mole of any gas at standard temperature and pressure (STP) occupies a volume of 22.4 liters. Here are the steps:

Determine the number of moles of Substance A using its volume and molar volume at STP:

Number of moles of Substance A = Volume of Substance A / Molar volume at STP (22.4 L)

What is a STP ?

STP stands for "Standard Temperature and Pressure," which is a set of standard conditions used for measuring and comparing physical and chemical properties of gases.

The standard temperature is typically defined as 0 degrees Celsius (273.15 Kelvin), while the standard pressure is typically defined as 1 atmosphere (atm) or 101.325 kilopascals (kPa). At STP, one mole of any gas occupies a volume of 22.4 liters.

STP is commonly used in chemistry and physics to compare gas volumes, to determine molar masses, and to calculate other properties of gases. It is also useful for converting between different units of gas volume, pressure, and temperature.

To know more about STP visit :

https://brainly.com/question/29356493

#SPJ1

There are 7.68 × 1025 atoms of phosphorous in how many moles of diphosphorous pentoxide?

Answers

Answer:

7.68 x 1025 atoms of phosphorous correspond to 1.06 mole of diphosphorous pentoxide. This can also be written as 1.06 mol of P2O5.

identify which of the following atoms would have the lowest first ionization energy. a) ca b) c c) ge d) p e) cl

Answers

The atom with the lowest first ionization energy is C (carbon). The order from highest to lowest is: e) Cl (chlorine) > d) P (phosphorus) > c) Ge (germanium) > b) C (carbon) > a) Ca (calcium).


The atom that would have the lowest first ionization energy is Ca (Calcium). The amount of energy that is required to remove the most loosely held electron from an isolated neutral gaseous atom to form a cation is called the first ionization energy. It is a measure of the stability of an atom. The ionization energy of an element is determined by the amount of energy required to remove an electron from its ground state. The ionization energy is a physical property of an element that varies across the periodic table. The element that has the lowest ionization energy is the most reactive and will most likely form cations.

Identify which of the following atoms would have the lowest first ionization energy. The given atoms are Ca, C, Ge, P, and Cl. Out of these atoms, Ca would have the lowest first ionization energy. The electronic configuration of Ca is 2, 8, 8, 2. Calcium belongs to group 2 and period 4 of the periodic table. It has 20 protons, 20 electrons, and 2 valence electrons. Because of its 2 valence electrons, it has a low ionization energy. The electronic configuration of Ca is most stable because of the presence of the 8 valence electrons in the outermost shell.

The electronic configurations of the other given atoms are:

C: 2, 4Ge: 2, 8, 18, 4P: 2, 8, 5Cl: 2, 8, 7

All of these elements have electrons that are either in the process of filling the valence shell or have already filled it. They have higher ionization energies because of this. Therefore, Ca would have the lowest first ionization energy.

For more such questions on ionization energy , Visit:

https://brainly.com/question/20658080

#SPJ11

Part 1. A lightly inflated balloon is placed in a freezer. Explain the change to the size of the balloon based on the kinetic molecular theory.
Part 2. What would most likely happen to the balloon if it was instead kept outside in the sun for some time? Explain your answer based on the kinetic molecular theory.
In both cases, assume the balloon is tied tight enough so that air does not escape.

Answers

Part 1: When a lightly inflated balloon is placed in a freezer, the temperature of the air molecules inside the balloon decreases. According to the kinetic molecular theory, the volume of a gas is directly proportional to its temperature. As the temperature of the air molecules inside the balloon decreases, the average kinetic energy of the air molecules also decreases, causing the gas to contract. This contraction leads to a decrease in the volume of the gas inside the balloon, which causes the balloon to shrink in size.

Part 2: If the balloon is instead kept outside in the sun for some time, the temperature of the air molecules inside the balloon will increase. According to the kinetic molecular theory, an increase in temperature leads to an increase in the average kinetic energy of the gas molecules, causing them to move faster and collide more frequently. This increased collision frequency leads to an increase in pressure, which causes the balloon to expand in size. Therefore, the balloon will most likely get bigger when it is exposed to the heat of the sun.

Answer:

simple answer

Explanation:

part 1: if the balloon's temperature decreases so does the air molecules within it. The gas contracts because it's in a seal place, causing the balloon to shrink.

part 2: the balloon is exposed to heat, so the temperature is obviously going to increase as well as the air molecules. Gas molecules are moving rapidly causing the balloon to expand.

how many elements are found in the formula 3He2O4PH

Answers

There are four (4) elements in the chemical formula given above.

What is a chemical formula?

Chemical formula in chemistry is a notation indicating the number of atoms of each element present in a compound.

The chemical formula of a substance shows the types and number of elements present in such substance.

According to this question, the chemical formula of a substance is given. The elements present in the compound based on their symbols are as follows:

Helium (He)Oxygen (O)Phosphorus (P)Hydrogen (H)

Therefore, there are four elements in the substance.

Learn more about chemical formula at: https://brainly.com/question/29031056

#SPJ1

which the following optically active alcohol is treated with hbr, a racemic mixture of alkyl bromides is obtained

Answers

(S)-2-butanol will undergo an SN2 reaction with HBr to produce a racemic mixture of alkyl bromides. Here option B is the correct answer.

When optically active alcohol is treated with HBr, the reaction follows an SN1 or SN2 mechanism. In the case of SN1, a carbocation intermediate is formed, and in SN2, a backside attack by the nucleophile occurs. The stereochemistry of the product depends on the configuration of the intermediate and the direction of attack.

In the case of (S)-2-butanol, the hydroxyl group is attached to the second carbon atom, which makes it a primary alcohol. When treated with HBr, it undergoes an SN2 reaction, where the hydroxyl group is replaced by the bromine atom. The nucleophile attacks from the backside of the molecule, leading to an inversion of configuration.

This results in the formation of a racemic mixture of alkyl bromides, as both enantiomers have an equal chance of being attacked from either side. On the other hand, (R)-2-butanol, being the enantiomer of (S)-2-butanol, will also undergo the same reaction and produce the same racemic mixture of alkyl bromides.

In the case of (R)-1-phenyl ethanol and (S)-1-phenyl ethanol, they are secondary alcohols and can undergo either SN1 or SN2 reactions depending on the reaction conditions. However, the reaction mechanism will lead to the formation of a mixture of diastereomers, rather than a racemic mixture of enantiomers.

To learn more about alkyl bromides

https://brainly.com/question/29031148

#SPJ4

Complete question:

Which of the following optically active alcohols, when treated with HBr, results in a racemic mixture of alkyl bromides?

a) (R)-2-butanol

b) (S)-2-butanol

c) (R)-1-phenyl ethanol

d) (S)-1-phenyl ethanol

What is the bond angle of carbonothioyl dibromide
Also what is the molecular shape

Answers

Answer:

Carbonothioyl dibromide, also known as CBr2S, has a bond angle of approximately 109.5 degrees, which is the typical tetrahedral bond angle for molecules with sp3 hybridization.

The molecular shape of CBr2S is also tetrahedral, with the two bromine atoms and the sulfur atom arranged at the corners of a tetrahedron, and the carbon atom at the center.

one chemical formula of this element with oxygen is eo2, write the electronic configuration for the ion formed from e in this compound.

Answers

The element in question here is E, and its chemical formula with oxygen is EO2.  the electronic configuration of the ion formed from E in EO2 is 1s²2s²2p⁶.

Electronic configuration refers to the distribution of electrons among different energy levels and subshells of an atom. When E forms a compound with oxygen, it loses two electrons to form a cation with a 2+ charge. This cation is written as E2+ and has an electronic configuration of 1s²2s²2p⁶. The electronic configuration of E before it forms a compound with oxygen can be found by considering its position in the periodic table. E is in the third row and fourth column of the periodic table, which means that it has three energy levels and four valence electrons.

Therefore, its electronic configuration is 1s²2s²2p⁶3s²3p². When E forms a compound with oxygen, it loses two valence electrons from its outermost energy level, which is the third energy level in this case. This results in the formation of E2+ ions with an electronic configuration of 1s²2s²2p⁶. Thus, the electronic configuration of the ion formed from E in EO2 is 1s²2s²2p⁶.

Know more about electronic configuration here:

https://brainly.com/question/29564763

#SPJ11

which of the following alkenes is most stabilized through hyperconjugation? select answer from the options below

Answers

The alkene that is most stabilized through hyperconjugation is 2-methylpropene. The correct option is (C).

Hyperconjugation is a type of resonance that involves the overlapping of an unshared electron pair on an atom, like carbon, with an adjacent sigma bond. In this case, the unshared electron pair on the methyl group of 2-methylpropene provides stabilization to the adjacent sigma bond, making it the most stabilized alkene through hyperconjugation.

The most stabilized alkene through hyperconjugation can be determined by analyzing the degree of substitution. The greater the number of alkyl groups attached to the carbon atoms of the double bond, the greater the degree of substitution and the greater the stability due to hyperconjugation. Hence, the answer to this question would be option C (2-methylpropene.), as it has the greatest degree of substitution and is thus the most stable through hyperconjugation.

Option A (1-butene) has only one methyl group attached to one carbon of the double bond, making it less stable than option C. Option B (2-butene) has two methyl groups attached to the same carbon atom of the double bond, resulting in a similar degree of substitution to option A. Option D (2-methyl-1-pentene) has a lesser degree of substitution than option C because the methyl group is attached to only one carbon atom of the double bond, while in option C, the methyl group is attached to a tertiary carbon atom.

Hence, option C , 2-methylpropene. is the most stabilized alkene through hyperconjugation because of its greater degree of substitution.

For more such questions on Hyperconjugation , Visit:

https://brainly.com/question/28031100

#SPJ11

The complete question is:

which of the following alkenes is most stabilized through hyperconjugation? select answer from the options below

A 1-butene

B 2-butene

C 2-methylpropene

D 2-methyl-1-pentene

How many atoms of lithium are in 18.7 g?

Answers

The  atoms of lithium that  are in 18.7 g is 16 × 10²³ atoms . This is taken out by mole concept .

What is mole concept ?

The mole is a unit of measurement similar to the pair, dozen, gross, and so on. It provides a precise count of the atoms or molecules in a bulk sample of matter. A mole is the amount of substance that contains the same number of discrete entities (atoms, molecules, ions, etc.)

if 7 grams of lithium contain 6 × 10²³ atoms

then 18.7 will contain 16 × 10²³ atoms

to know more about mole concept , visit ;

brainly.com/question/31123980

#SPJ1

Four ATP molecules are made in the second step in glycolysis. However, the net production of ATP is two because Multiple Choice O two molecules of ATP are used to move glucose into the chloroplast o two molecules of ATP are needed to "activate glucose O ATP production cannot exceed NADH production O glycolysis is the final step of aerobic respiration o U glycolysis may occur without oxygen being present

Answers

The correct answer is "two molecules of ATP are needed to 'activate' glucose".

In the first step of glycolysis, glucose is converted into glucose-6-phosphate, which requires the input of ATP. This reaction is catalyzed by the enzyme hexokinase. Therefore, two molecules of ATP are used in the early steps of glycolysis to activate glucose and convert it into glucose-6-phosphate. In the later steps of glycolysis, four molecules of ATP are produced by substrate-level phosphorylation, but since two molecules of ATP were used in the beginning, the net production of ATP is only two molecules per glucose molecule.

It is also important to note that glycolysis is the first step of both aerobic and anaerobic respiration and can occur without oxygen being present. However, the subsequent steps of cellular respiration, such as the Krebs cycle and electron transport chain, require oxygen in aerobic respiration to produce more ATP.

What is an ATP?

ATP stands for Adenosine Triphosphate, which is a molecule that carries energy within cells. It is often referred to as the "energy currency" of the cell because it powers many cellular processes by releasing its stored energy when it is hydrolyzed to ADP (Adenosine Diphosphate) and inorganic phosphate.

To know more about ATP, visit:

https://brainly.com/question/174043

#SPJ1

Let's put this knowledge to the test! How many atoms are in 14 moles of cadmium? Remember that 1 mole would contain 6.02214 x 1023 atoms of cadmium.

Answers

Atoms in 14 moles of cadmium are  84.3 × 10²³ atoms .This is taken out by mole concept via Avogadro number .

What is Avogadro number ?

The Avogadro constant, also known as NA or L, is a proportionality factor that relates the number of constituent particles (typically molecules, atoms, or ions) in a sample to the amount of substance in that sample. It is a SI defining constant with the exact value of 6.02214076×10²³.  Stanislao Cannizzaro named it after the Italian scientist Amedeo Avogadro, who explained it four years after Avogadro's death at the Karlsruhe Congress in 1860.

to know more about Avogadro number , visit ;

brainly.com/question/11907018

#SPJ1

Chemistry Help Please! It's worth a lot of points
1.Write the equilibrium expression for the following reactions
a. H2SO4(aq) + H2O(L) ⇆ HSO4-(aq) + H3O+(aq)
b. 4NH3(g) + 5O2(g) ⇆ 4NO(g) + 6H2O(g)
c. NH4Cl(s) ⇆ NH3(g) + HCl(g)
d. N2O4(g) ⇆ 2NO2(g)

2. The following reaction has a K value of 0.050. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
N2(g) + 3H2(g) ⇆ 2NH3(g)

3. The following reaction has a K value of 6.8 x 103. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
2SO3(g) ⇆ 2SO2(g) + O2(g)

4. When dissolving substances in water, the degree of solubility of a substance is often represented as the solubility product constant (Ksp). The solubility product constant is the same thing as the equilibrium constant for the dissolving reaction. Two substances that dissociate in water are shown below alone with the Ksp.
NaCl(s) ⇆ Na+(aq) + Cl-(aq) Ksp = 36
BaSO4(s) ⇆ Ba2+(aq) + SO42-(aq) Ksp = 1.1 x 10-16

5. Identify and label the Brønsted-Lowry acid, its conjugate base, the Brønsted-Lowry base, and its conjugate acid in each of the following equations:
a. HNO3 + H2O ⟶ H3O+ + NO3−
b. CN− + H2O ⟶ HCN + OH−
c. H2SO4 + Cl− ⟶ HCl + HSO4−
d. HSO4− + OH− ⟶ SO42− + H2O
e. O2− + H2O ⟶2OH−

6. What is the conjugate acid of each of the following? What is the conjugate base of each of the following?
a. OH-
b. H2O
c. HCO3-
d. NH3
e. HSO4-

7. The following acids are shown with their equilibrium constants (also known as the acid dissociation constant). Rank these acids from strongest to weakest. Explain your ranking.
HCN(aq) + H2O(L) ⇆ H3O+(aq) + CN-(aq) K = 6.2 x 10-10

HC2H3O2(aq) + H2O(L) ⇆ H3O+(aq) + C2H3O-(aq) K = 1.75 x 10-5

H2CO3(aq) + H2O(L) ⇆ H3O+(aq) + HCO3-(aq) K = 4.5 x 10-7

HIO4(aq) + H2O(L) ⇆ H3O+(aq) + IO4-(aq) K = 2.3 x 10-2

8. Calculate the pH and the pOH of each of the following solutions.
a. 0.200 M HCl
b. 0.0143 M NaOH
c. 3.0 M HNO3
d. 0.0031 M Ca(OH)2

9. Wine has a pH of 3.6. What are the hydronium and hydroxide ion concentrations?

10. The hydroxide ion concentration in household ammonia is 3.2 x 10-3 M. What is the concentration of hydronium ions?

Answers

Answer:

1. Equilibrium expressions:

a. K = [HSO4-][H3O+]/[H2SO4][H2O]

b. K = [NO]^4[H2O]^6/[NH3]^4[O2]^5

c. K = [NH3][HCl]/[NH4Cl]

d. K = [NO2]^2/[N2O4]

2. Since K = 0.050, the concentrations of the reactants (N2 and H2) are larger than the concentrations of the products (NH3).

3. Since K = 6.8 x 10^3, the concentrations of the products (SO2 and O2) are larger than the concentrations of the reactant (SO3).

4. The Ksp expression for each of the reactions is:

a. Ksp = [Na+][Cl-]

b. Ksp = [Ba2+][SO42-]

5. Brønsted-Lowry acids and bases:

a. Acid: HNO3; Conjugate base: NO3-; Base: H2O; Conjugate acid: H3O+

b. Acid: HCN; Conjugate base: CN-; Base: H2O; Conjugate acid: HCN

c. Acid: H2SO4; Conjugate base: HSO4-; Base: Cl-; Conjugate acid: HCl

d. Acid: NH3; Conjugate base: NH2-; Base: H2O; Conjugate acid: NH4+

e. Acid: H2O; Conjugate base: OH-; Base: O2-; Conjugate acid: OH-

6. Conjugate acids and bases:

a. Acid: H2O; Conjugate base: OH-

b. Acid: H3O+; Conjugate base: H2O

c. Acid: H2CO3; Conjugate base: HCO3-

d. Acid: NH4+; Conjugate base: NH3

e. Acid: HSO4-; Conjugate base: SO42-

7. The strongest acid is HIO4 (highest K value), followed by HCN, HC2H3O2, and H2CO3 (lowest K value). The K values represent the degree to which the acids dissociate in solution. HIO4 is a strong acid, meaning it dissociates almost completely in solution, while H2CO3 is a weak acid, meaning it only dissociates partially.

8. pH and pOH calculations:

a. pH = -log[H3O+] = -log(0.200) = 0.699; pOH = -log[OH-] = -log(1.0 x 10^-14/0.200) = 12.301

b. pOH = -log[OH-] = -log(0.0143) = 1.844; pH = 14.000 - pOH = 12.156

c. pH = -log[H3O+] = -log(3.0) = 0.522; pOH = 13.478

d. pOH = -log[OH-] = -log(0.0062) = 2.206; pH = 14.000 - pOH = 11.794

9. Hydronium and hydroxide ion concentrations:

pH = 3.6; hydronium ion concentration = 10^-pH = 3.98 x 10^-4 M; hydro

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

For Mn3+, write an equation that shows how the cation acts as an acid. express your answer as a chemical equation including phases.

Answers

Mn3+, an ion of manganese(III), can function as an acid by giving a proton (H+) to a base. Here's an illustration: Mn3+ (aq) + 3OH- (aq) Mn(OH)3 (s)

What colour are Mn2+ and MnO4?

There is no need to add an indicator because MnO4's vivid purple colour serves as one enough. In the conical flask, there is Fe2+. The Fe2+ solution is added, and the Fe2+ lowers the MnO4- to Mn2+. As Mn2+ is a colourless solution, the purple colour disappears.

What is the ion Mn2name? +'s

The divalent metal cation manganese(2+) contains manganese as the metal. It plays the part of a cofactor. It consists of a monoatomic dication, a manganese cation, and a divalent metal cation.

To know more about cation visit:-

https://brainly.com/question/28710898

#SPJ1

structural change from a myoglobin tertiary structure to the inclusion of quaternary structure for hemoglobin

Answers

The quaternary structure of hemoglobin is responsible for the increased oxygen-carrying capacity and stability of the molecule. This structure allows hemoglobin to better transport oxygen throughout the body and is essential to life.

The structural change from myoglobin to hemoglobin includes an additional quaternary structure, which is the arrangement of two or more myoglobin subunits into a single, functional entity. This structural change allows for the cooperative binding of oxygen, meaning that the hemoglobin molecule can carry more oxygen than a single myoglobin molecule can. This is due to the increased surface area of the hemoglobin molecule, which provides more oxygen-binding sites. Additionally, the quaternary structure of hemoglobin increases the stability of the molecule, meaning it can better resist changes in pH or temperature. This is important because it allows hemoglobin to function in the wide range of temperatures and environments that are found within the human body.  

To learn more about Hemoglobin :

https://brainly.com/question/11102357

#SPJ11

Write the electronic configuration and draw the orbital diagram for the element: lead (Z=82) State if it is diamagnetic/paramagnetic. Please decide the diamagnetic/paramagnetic property based on the orbital diagram only! (It is okay to use the noble gas in square brackets here)

Answers

Answer:

See below.

Explanation:

The atomic number of lead (Pb) is 82, which means it has 82 electrons. The electronic configuration of lead is

1s² 2s² 2p⁶ 3s² 3p⁶ 3d¹⁰ 4s² 4p⁶ 4d¹⁰ 5s² 5p⁶ 4f¹⁴ 5d¹⁰ 6s² 6p²

The orbital diagram for the valence electrons of lead (Pb) is

↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓

s s p p p p d d

2 1 6 2 6 2 10 10

|||||||||

1 2 3 4 5 6 7 8

The notation ↑↓ represents a pair of electrons with opposite spins.

To determine if lead (Pb) is diamagnetic or paramagnetic, we need to look at whether there are any unpaired electrons. Based on the orbital diagram, we can see that all the electrons in the valence shell are paired, meaning that lead (Pb) is diamagnetic.

A student sets up a titration with a * 1 point buret filled with 0.5 M NaOH. In the flask below they place the phenolphthalein indicator and 6.2 mL of the unknown acid. The solution in the beaker turns pink after exactly 24.8 mL of NaOH have been added. Find the exact concentration of the unknown acid.

Answers

Nie was ich dich so gerne mal an dich sind auch nicht so gut ich habe es schon gemacht aber das ist ja nicht mehr das 47j ist aber hvd und

AsH3, HBr, KH, H2Se arrange in increasing order of acid strength

Answers

Answer:

Transcribed Image Text: Rank the following substances in order of increasing acid strength. (1 as least and 4 as most in acid strength) ✓ H₂Se ✓ HBr HI ✓ AsH3 Expert Solution

Explanation:

HOPE IT HELPS!!

A 0.036 M aqueous nitrous acid (HNO2) solution has an osmotic pressure of 0.93 atm at 25°C. Calculate the percent ionization of the acid.

Answers

The percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

How to calculate the percent ionization of the acid ?

The osmotic pressure (π) of a solution can be related to the molar concentration (M) of the solute and the temperature (T) of the solution by the following equation:

π = MRT

Where R is the gas constant.

We can use this equation to calculate the molar concentration of the nitrous acid solution:

M = π / RT

M = (0.93 atm) / (0.0821 L·atm/(mol·K) x 298 K)

M = 0.036 M

This is the molar concentration of the undissociated nitrous acid in the solution. To calculate the percent ionization of the acid, we need to know the concentration of the H+ and NO2- ions in the solution.

The balanced chemical equation for the dissociation of nitrous acid is:

HNO2(aq) ⇌ H+(aq) + NO2-(aq)

Let x be the extent of ionization of the nitrous acid. Then the concentration of H+ and NO2- ions can be expressed in terms of x as follows:

[H+] = x M

[NO2-] = x M

The concentration of the undissociated nitrous acid is (1-x)M.

The expression for the equilibrium constant (Ka) of the reaction can be written as:

Ka = [H+] [NO2-] / [HNO2]

Substituting the concentrations in terms of x, we get:

Ka = x^2M / (1-x)M

Simplifying the above equation, we get:

Ka = x^2 / (1-x)

The percent ionization of the acid is the fraction of the original HNO2 molecules that dissociate into H+ and NO2- ions. It can be calculated as follows:

% ionization = (concentration of H+ ions) / (initial concentration of HNO2) x 100

% ionization = (x M) / (M) x 100

% ionization = x x 100

Substituting the value of x from the above equation for Ka, we get:

Ka = x^2 / (1-x)

x = sqrt(Ka / (1+Ka))

We can calculate the value of Ka using the standard reference value of the acid dissociation constant (Ka) for nitrous acid at 25°C, which is 4.5 x 10^-4.

x = sqrt(4.5 x 10^-4 / (1+4.5 x 10^-4))

x = 0.021

% ionization = 0.021 x 100

% ionization = 2.1%

Therefore, the percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

Learn more about osmotic pressure here : brainly.com/question/25413362

#SPJ1

Which transition metal can form both a high and low spin complex? Zn2+, Cu2+, Mn3+, Ti2+

Answers

Answer: Manganese

Explanation:

With titanium, it only has two d electrons, so it can't form different high and low spin complexes. It doesn't matter because it will never fill the higher-energy orbitals. The total spin state turns out to be +1 (two unpaired d electrons, no matter what). Therefore, manganese will form both a high and low spin complex.

The enthalpy of vaporization for dimethyl ether is 27.5 kJ/mol. Dimethyl ether has a vapor pressure of 760 torr at 34.6 oC. Using the Clausius-Clapeyron equation, what is the vapor pressure for methanol at 4.2 oC? Give your answer in torr, to the first decimal point.

Answers

The vapor pressure of methanol at 4.2 oC is approximately 1.6 torr.

What is the vapor pressure of methanol?

The Clausius-Clapeyron equation relates the vapor pressure of a substance at two different temperatures and its enthalpy of vaporization. The equation is:

ln(P2/P1) = (-ΔHvap/R)(1/T2 - 1/T1)

where;

P1 and T1 are the vapor pressure and temperature at the first state, P2 and T2 are the vapor pressure and temperature at the second state, ΔHvap is the enthalpy of vaporization, R is the gas constant, and ln is the natural logarithm.

We are given the enthalpy of vaporization for dimethyl ether, which is 27.5 kJ/mol. We are also given the vapor pressure of dimethyl ether at 34.6 ⁰C, which is 760 torr.

We want to find the vapor pressure of methanol at 4.2 ⁰C.

Let's choose the vapor pressure of dimethyl ether at 34.6 ⁰C as the first state, and the vapor pressure of methanol at 4.2 ⁰C as the second state. We can convert the temperatures to kelvin by adding 273.15:

T1 = 34.6 + 273.15 = 307.75 K

T2 = 4.2 + 273.15 = 277.35 K

We can plug in the values into the Clausius-Clapeyron equation:

ln(P2/760) = (-27.5×10^3 J/mol)/(8.314 J/(mol·K)) × (1/277.35 K - 1/307.75 K)

Simplifying:

ln(P2/760) = -5.721

Taking the exponential of both sides:

P2/760 = e^-5.721

Multiplying both sides by 760:

P2 = 1.65 torr (to the nearest tenth)

Learn more about vapor pressure here: https://brainly.com/question/4463307

#SPJ1

Given that 4 NH3 + 5 O2 → 4 NO + 6 H2O, if 3.00 mol NH3 were made to react with excess of oxygen gas, the amount of H2O formed would be

Answers

Answer:

x mol H2O = 4.50 mol H2O

Step-by-step explanation:

From the balanced equation, we can see that for every 4 moles of NH3 that react, 6 moles of H2O are formed. Therefore, we can use a proportion to find the amount of H2O that would be formed if 3.00 mol of NH3 reacted:

4 mol NH3 : 6 mol H2O = 3.00 mol NH3 : x mol H2O

Solving for x, we get:

x mol H2O = (6 mol H2O / 4 mol NH3) * 3.00 mol NH3
x mol H2O = 4.50 mol H2O

Therefore, if 3.00 mol of NH3 were made to react with excess oxygen gas, 4.50 mol of H2O would be formed.

What is the amount of pi?

Answers

However, it is commonly approximated as 3.14159.

What is an irrational number ?

An irrational number is a number that cannot be expressed as a simple fraction or ratio of two integers. It is a non-repeating, non-terminating decimal. Examples of irrational numbers include pi (π), the square root of 2 (√2), and the golden ratio (∅).

What is a termination ?

In mathematics, a terminating decimal is a decimal number that has a finite number of digits after the decimal point, i.e., the decimal representation ends in a finite number of zeroes. For example, 0.75, 2.0, and 0.0625 are terminating decimals.

To know more about irrational visit :

https://brainly.com/question/15837135

#SPJ1

what happens when zinc chloride reacts with potassium hydroxide and what formed?​

Answers

Answer:

when the solution of potassium hydroxide and zinc chloride are mixed,the double-displacement reaction occur ,resulting in precipitation and the reaction forms potassium chloride and zinc hydroxide .

Which statement below correctly describes their relative atomic radii and first ionization energy when comparing Se and Br? The atomic radius for Se is larger than Br, and the first ionization energy for Se is greater than Br. The atomic radius for Br is larger than Se, and the first ionization energy for Bris greater than Se. The atomic radius for Se is larger than Br, and the first ionization energy for Br is greater than Se. The atomic radius for Br is larger than Se, and the first ionization energy for Se is greater than Br.

Answers

At has a higher initial ionisation energy than Br, while Br has a bigger atomic radius. Se has a bigger atomic radius than Br, and Br has a higher initial ionisation energy than Se.

How do atomic radii and ionisation energy relate to one another (i.e., what happens to ionisation energy as atomic radii grow)?

The most loosely bound electron is further from the nucleus and thus easier to remove in bigger atoms. Hence, the ionisation energy should decrease as size (atomic radius) increases.

Why does ionisation energy rise across a period while decreasing down a group?

This is because the outer electrons aren't bound as strongly because they are farther from the nucleus.

To know more about ionisation energy visit:-

brainly.com/question/27356170

#SPJ1

Other Questions
7.4y-2.9ypls lmk.... Can someone help me with this please? Which of the following would most likely be included in the positive side of the U.S. current account balance?a. U.S. foreign aid sent to as disaster relief to Haitib. interest payments to foreign investors invested in the U.S.c. money spent by U.S. tourists in Europed. money earned by U.S. firms in Europe suppose a company purchases 2,000 shares of its own $1 par value common stock for $16 per share. the company then resells 400 of these shares for $20 per share. which of the following is recorded at the time of the resale? a local university is facing some tough decisions, so they are using the decision tree, which contains individuals, websites, and organizations that specialize in handling sensitive and difficult decisions. group of answer choices true false according to documents 2 and 3, one can infer that the nazis were intentionally starving residents of the ghettos, true or false?Document 2: Life in the Warsaw GhettoLife in the Warsaw Ghetto, Emanuel Ringelblum guoted in Yad Vashem Documents onthe Holocaust, pp 228-229:Smuggling began at the very moment that the Jewish area of residence wasestablished, its inhabitants were forced to live on 180 grams of bread a day, 220 gramsof sugar a month, 1 kg. of jam and 1 kg. of honey, etc. It was caiculated that theofficially supplied rations did not cover even 10 percent of the normal reguirements. Ifone had wanted really to restrict oneself to the official rations then the entire populationof the ghetto would have had to die of hunger in a very short time.... The Germanauthorities did everything to seal off the ghetto hermeticaily and not to allow in a singlegram of food. A wall was put up around the ghetto on ali sides that did not leave asingle milimeter of open space... They fixed barbed wire and broken glass to thethe wall. X company, which uses a perpetual inventory system, sold 2000 of merchandise on account with credit terms of 2/10, n/30. The journal entry to record the initial sale gross of any discounts will include ______.a debit to accounts receivable of 2000 anda credit to sales revenue of 2000 international data on gdp and socioeconomic variablesa.Are inconclusive about the relationship between GDP an dthe economic well-being of citizensb.Suggest that poor nations actually might enjoy a higher standart of living than do rich nationsc.Leave no doubt that a nations GDP is closely associated with its citizens standart of livingd.Indicate that there are few real differences in living standarts around the world, in spite of the large differences in GDP between nations Whats the area?7 yd4 yd7 yd3 yd Question 10 (2 points)(06. 06 MC)Read the dialogue and the question. Then, choose the correct option to complete the dialoguePedro. Hola! La semana prxima tengo una case sobre biodiversidad en mi dudad. Marta: Hola! Es bueno te preparar. Necesitas ayuda?Pedro. Sicconmigo, por favorMarta St. Leeremos y visitaremos la biblioteca maana,Based on the dialogue, what will Pedro most likely as (2 points)Ajudars comeBuscars orosTomaras aguaViajares a una serie grande how are dideoxynucleotides (ddntps) different from dna nucleotides and why are ddntps needed in dna sequencing? What is the implication of the upside-down pyramid approach to industry analysis by an entrepreneur of a new venture?Multiple choice question.o The upside-down pyramid approach helps the entrepreneur avoid conducting competitor analysis.o The upside-down pyramid approach helps the entrepreneur understand competitors' strengths and weaknesses.o The upside-down pyramid approach helps the entrepreneur focus solely on secondary competitors.o The upside-down pyramid approach helps the entrepreneur create a marketing plan as a superficial document to outside financial suppliers. Consider the simple Keynesian model in the AD-AS framework. Currently the economy is located in the horizontal section of the AS curve producing Q1. If aggregate demand rises, thena.the price level will rise.b.the price level may rise.c.the price will decline.d.Real GDP will rise.e.none of the above The taiga biome has long, cold, dry winters and cool, wet summers. In three to four sentences, describe how the plants and animals would be impacted by a warm and dry summer and how they might survive. Support your answer with the abiotic factors in the biome. Which of the following studies tested the consequences of the demands of authority clashing with the demands of conscience?Select one:a. Watson's study of emotionsb. Milgram's obedience studiesc. Asch's studies of complianced. Sherif's study of norm formation a pastry chef accidentally inoculated a cream pie with six s. aureus cells. if s. aureus has a generation time of 60 minutes, how many cells would be in the cream pie after 7 hours? How does Michelangelos David stylistically fit within the context of the renaissance? Consider the following game in normal form. Player 1 chooses rows; Player 2 chooses columns.Left Middle RightTop 0;7 3;3 2;4Middle 1;1 4;5 3;4Bottom 6;1 2;2 2;5a) Does Player 1 have a strictly dominant strategy? Clearly explain.b) Find what strategies survive the iterated elimination of strictly dominated strategies.c) Find the Nash equilibrium(s) in this game. Susan jogged for 1 1/2hours on Monday and 90 minutes on Tuesday. On which day did she jog longer? What is the guidance system of a car?