Area "X" show the structure of
A) a DNA molecule
B) an amino acid
C) a RNA molecule
D) a nucleotide

Area "X" Show The Structure OfA) A DNA MoleculeB) An Amino AcidC) A RNA MoleculeD) A Nucleotide

Answers

Answer 1

Answer:

D) a nucleotide

Explanation:

A single nucleotide will contain a phosphate group, sugar molecule (deoxyribose) and a nitrogenous base ( which could be adenine, thyamine, guanine or cytosine ).


Related Questions

HELP!!!! 50PTS!!!!!!

When some organic molecules, such as lipids, are added to water, vesicles can form. Which of the following best describes how scientists hypothesize true cells evolved from vesicles? (3 points)
Vesicles became enclosed by a membrane, thus becoming organelles for larger cells.
Vesicles containing amino acids fused to form nucleotides, RNA, and DNA.
Vesicles surrounded organic compounds and catalyzed reactions to form macromolecules.
Vesicles that contained self-replicating RNA grew, split, and passed their RNA to daughters.

Answers

Answer:

DNA can store genetic information and most likely appeared before RNA.

Explanation:

Answer:

Vesicles that contained self-replicating RNA grew, split, and passed their RNA to daughters.

Explanation:

RNA played role in protein synthesis and also created its own catalyst.

In the leaf cells of a plant, enzymes control the rate at which carbon dioxide is converted into glucose. Which environmental factor would MOST affect the action of the enzyme?

Answers

Answer: The environmental factor that would most affect the action of enzymes in the conversion of carbon dioxide into glucose (photosynthesis ) is the light.

PHOTOSYNTHESIS - Photosynthesis is a process by which plants and other organisms convert light energy into chemical energy, which is then released to fuel the organism's metabolic activities through cellular respiration. Carbohydrate molecules, such as sugars, store this chemical energy, which is created from carbon dioxide and water.

The first photosynthetic species most likely arose early in the evolution of life and used reducing agents such as hydrogen or hydrogen sulfide as electron sources rather than water. In the process of carbon fixation, carbon dioxide is transformed into sugars; photosynthesis uses energy from the sun to turn carbon dioxide into carbohydrate. Carbon fixation is a redox reaction that is endothermic. Photosynthesis is the oxidation of carbohydrate or other nutrients to carbon dioxide, while cellular respiration is the reduction of carbon dioxide to carbohydrate. Carbohydrates, amino acids, and fatty acids are nutrients involved in cellular respiration.

why is taking action for global warming important? please help

Answers

Answer: Global warming will cause significant harm to the health of persons and their communities by compromising food and water supplies; increasing risks of morbidity and mortality from infectious diseases and heat stress; changing social determinants of health resulting from extreme weather events, rising sea levels,

PLZZZZZ HELPPPPPPP!!!!
Neurons have long projections to transmit impulses. What is the name of these projections?
Answer:

Answers

Answer:

Axon

Explanation:

An axon is a long, slender projection of a nerve cell, or neuron, that typically conducts electrical impulses away from the neuron's cell body or soma.

Can I have brainliest, when someone else answers?

Answer:

I agree with the other person who answer

have a good day :)

Explanation:

In around 50 years, the peppered moth population changed from nearly all light wings to nearly all dark wings. Explain exactly how the moth population changed (evolved).

Answers

Answer:

The evolution of the peppered moth is an evolutionary instance of directional colour change in the moth population as a consequence of air pollution during the Industrial Revolution. ... Later, when pollution was reduced, the light-coloured form again predominated.

Muscles cannot function without ATP. Review your knowledge of ATP by answering the followini
questions.
ATP molecules store and release_____.

Answers

Answer:

energy

Explanation:

hope  it helps.

Answer:

ATP molecules store and release energy.

Energy is released when ✔phosphate bonds are broken.

edge ✅⬇️

Which of the following are sites where waste products are released from the body but not where they are produced
O skin and anus
O large intestine and small intestine
O liver and kidney
O tubules and ureters

Answers

Answer:

Its A skin and anus

(just did test)

Explanation:

The skin and the Anus are sites where waste products are released from the body but not where they are produced.

Which process of the human body eliminates the waste products?

Excretion is the biological process through which any unwanted or waste products are eliminated from the body.

Large and small intestines produce waste products that are not completely digested by the stomach. The liver and kidney are also the sites of waste products like the removal of carbon dioxide and synthesis of urine respectively.

Therefore, the skin and the Anus are sites where waste products are released from the body but not where they are produced.

To learn more about Excretion, refer to the link:

https://brainly.com/question/17097839

#SPJ2

which is a primary function of a vacuole in a cell​

Answers

Answer:

The primary function of a vacuole is that it can store water and food.

Explanation:

Answer:

A vacuole is a membrane bound cell organelle

the function of vacuoles is to maintain water balance and for storage of something

the size of vacuoles in plant cell is very big it takes more than half of the cell but in animals very small

hope it helps

dose DNA have cells


i need to know for a assingment

Answers

Answer and Explanation:

Cells are made of DNA (Deoxyribonucleic Acid).

They provide the genetic instructions for making and forming a cell.

The DNA is found inside the nucleus of the cell.

Because the cell is very small, and because organisms have many DNA molecules per cell, each DNA molecule must be tightly packaged. This packaged form of the DNA is called a chromosome

DNA do NOT have cells, but cells DO have DNA.

#teamtrees #PAW (Plant And Water)

Match the following.

1. any substance that kills germs
2. drugs that attack specific bacteria
3. substance that attacks fungi
4. chemical that destroys pathogens inside the body
antibiotics
germicide
anti-infective
antifungal agents

Answers

Explanation:

1. any substance that kills germs

ans. germicide

2. drugs that attack specific bacteria

ans. antibiotics

3. substance that attacks fungi

ans. antifungal agents

4. chemical that destroyed pathogens inside the body

ans. anti-infective

HELP ME I PROMISE ILL GIVE YOU ANYTHING

Answers

Nucleus
Function : DNA Storage
It’s is the room where blue prints are kept


Mitochondrion
Function : Energy production
It’s is the power house

Rough Endoplasmic Reticulum (RER) function :Protein production; in particular for export out of the cell
It’s Primary production line - makes the toys


Lysosome
Function : protein destruction

It’s Recycling and security

What is the strand that would pair up with ATTCAAGC?

Answers

The answer is TAAGTTCG

The principal is in desperate need of a blood transfusion but unfortunately has the rare blood type () and
needs a donor that is also O. He offers a reward to anyone who could help him. The vice principal knows
unfortunately that his blood type is heterozygous type A and that his wife is heterozygous type B. What is
the probability that one of their children will have the blood type to match the principal?

Answers

Answer:

The answer should be C

Explanation:

Why cell wall is only found in plant cells

Answers

Answer:

This is because cell walls protect the cells and allow plants to grow to great heights.

Explanation:

Cells walls are made of a cellulose are only found in plant cells.

What do you mean by anaemia?​

Answers

Answer:

Anemia is a condition in which you lack enough healthy red blood cells to carry adequate oxygen to your body's tissues.

Explanation:

It is defined as a low number of red blood cells. In a routine blood test, anemia is reported as a low hemoglobin or hematocrit.

What is the connection between work and power? Name three

Answers

Answer:

Work is the energy needed to apply a force to move an object a particular distance, where force is parallel to the displacement. Power is the rate at which that work is done.

Explanation:

Hi There!

Hope This Help?

Please Mark Me Brainly!

they both have authority

they both are very common

they both are normally taken by serious people

How can we tell that two species shared a common ancestor, and are therefore related?

Answers

Answer:

Homologous structures provide evidence for common ancestry, while analogous structures show that similar selective pressures can produce similar adaptations (beneficial features). Similarities and differences among biological molecules

Explanation:

There are multiple ways you can tell

you can look at the bone structure of an organism and see if it's homolougous

Or use a cladogram to tell what species share a common ancestor ( hope this helps)

Using the diagram below, answer the following questions:

- True or False. The arrow labeled C represents a transfer of chemical energy to mechanical energy. Explain why this is true or false.
- True or False. The arrow labeled A represents a transfer of solar energy to chemical energy. Explain why this is true or false.
- Which arrow or arrows represent a release of carbon dioxide? What process is occurring at the arrow(s) you selected?
- Which arrow or arrows indicate a process that cycles carbon from living or nonliving organisms? Describe the process or processes you selected.
- Which arrow or arrows represent reactions that demonstrate a conservation of mass and energy? Explain your answer.

Answers

Answer:

FALSE. The factory uses mechanical energy and when carbon is released into the atmosphere it is the process of chemical energy. ... Arrows C + F represent a release of carbon dioxide. Arrow C shows carbon being released into the air from the factory.Its true because the arrow letter A uses the of solar power from the sun then makes a chemical reaction to make food for the plant so basically photosynthesis. 8.arrow E represents cycling of carbon from living organisms to non-living organisms. this is because it is showing conversion of a carbon from the dead tree to fossil fuel.All the arrows in a combined form are used to show the biogeochemical cycle or the carbon cycle. In this cycle, carbon is cycled between the biotic and abiotic component of the biome. In any biogeochemical cycle, mas and energy are always conserved.


How are antibodies related to the type of blood a person can receive?

Does anyone k one what is

Answers

Answer:

If it is present, that person's blood is Rh positive (+); if not, the blood is Rh negative (-). ... For example, a Blood Group A individual has no B antigens on their red blood cells; therefore, this person's white blood cells will make antibodies against the B antigen (anti-B) that will be present in their plasma.

Explanation:

i hope this helps

Which of the following is a true statement about the physical properties of objects that are composed of the same matter?

Answers

Answer:

D. All of the above

Explanation:

Matter is a substance which has mass and takes up space by volume the properties of matter are,

States of matter (solid,liquid,gas)are inter convertable.

Force of attraction varies from one kind of matter to another.

States of matter can be varied by varying temperature and pressure.

What is the difference between a specialized plant cell and a specialized animal cell?​

Answers

Answer:

Explanation:

Major structural differences between a plant and an animal cell include: Plant cells have a cell wall, but animals cells do not. Chloroplasts enable plants to perform photosynthesis to make food. Plant cells usually have one or more large vacuole(s), while animal cells have smaller vacuoles if any are present.

The complementary strand of DNA to the DNA fragment GGC ATA CAT is: (DNA replication)

CCG UAU GUA
GTA TAT CCG
ATG TAT GCC
CCG TAT GTA
which one ^

Answers

Answer:

CCG TAT GTA

Explanation:

In DNA replication, adenine pairs to thymine and cytosine pairs to guanine. We take the template strand and pair the correct letters (A to T, C to G).

A scientific _______ is an explanation based on many observations by many different researchers.

A scientific _______ is usually an explanation based on one observation by one researcher.
A.
theory; hypothesis
B.
deduction; inference
C.
hypothesis; theory
D.
inference; deduction

Answers

D is the answer

Inference is derived from many or different point of views while a deduction can be gotten or subtracted by one individual or researcher.

In the early stages of development, the embryos of dogs, pigs, and humans resemble one
another. This observation suggests that these animals may have
A)a common ancestry.
B)a similar number of chromosomes.
C)a similar habitat requirements.
D)the same blood components.

Answers

Answer:

a common ancestry.

Explanation:

PLSS HELP ME ASAP!!
I WILL GIVE YOU BRAINLYEST!!

If a school is abandoned how will it look like in 10, 50, and 200 years from now?

What animals/plants will it have in every year?

Answers

Answer:

Well, I believe that as years go by, plants will start to grow though out the school, things will start to wear out at break down because of not having proper thinks taken care of. Probably some rabbits, mice, basically small animals will start to have homes in the school, no major animals will hang around there because it isn't their habitat.

what is the possible liminations of using hair as evidence in crime investgation s\

Answers

Answer:

A limitation of using hair as evidence from a crime scene is that hair can not be directly linked to a suspect. It is impossible to say that a hair sample came from only one specific person.

Answer:

How it got there. Anyone's hair can be carried and blown from anywhere, if so you'd have to go through every persons dna that had contact with a victim and contact with the contactie and so on and so on.

Most plant growth takes place in the ____________________ of the root

Answers

Answer: Primary Growth

Most primary growth occurs at the apices, or tips, of stems and roots.

Explanation:

Ecological succession usually includes changes in all of the following EXCEPT-


A. The number of different kinds of plants

B. The number of plants of any one species

C. The overall size of the dominant plants

D. The rate at which species produce offspring

Answers

Answer: its d i just took the test

Explanation:

Ecological succession usually includes change EXCEPT for the option" A" which is the number of different kinds of plants.

What is Ecological succession?

Ecological succession is the process that describes how the structure of a biological community (that is, an interacting group of various species in a desert, forest, grassland, marine environment, and so on) changes over time.

Thus, according to ecological succession, the number of different kinds of plants.

To learn more about ecological succession click here:

https://brainly.com/question/26683356

Using the letter "T" and "t" with Tall height being dominant over short height. A heterozygous man for height marries a heterozygous woman for height. What is the correct F1 phenotypes for this cross?

Answers

75% would be tall, 25% would be short

genotypes: TT,Tt,tt

Explanation:

Your best friend is concerned about a mole on her arm. Knowing that you are taking a biology class she comes to you and asks for your opinion. You take a sample of her mole and view it under a microscope. While counting a selection of 300 cells, you notice that 87 cells are actively undergoing mitosis. Should your friend be concerned?

Answers

mitosis is a type of cell division that results in two daughter cells each having the same number and kind of chromosomes as the parent nucleus, typical of ordinary tissue growth. if they do not align correctly, they cannot move individually to opposite poles in the later phases of mitosis, and the result will be one cell with extra chromosomes and a daughter cell with missing chromosomes. These mutations can lead to harmful results such as cell death, organic disease or cancer.

Answer:

She should consult a dermatologist immediately.

Explanation:

When doing preemptive diagnosis of a mole, one should compute the Mitotic Rate (MR) - and the MR reported in the question is way above the highest category "greater than 4 per square millimeter" (to compare. there's around 2000 cells per sqmm of skin, so we're at over 500 per square millimeter).

Other Questions
A brochure claims that the average maximum height a certain type of plant is 0.7 m. A gardener suspects that this estimate is not accurate locally due to soil conditions. A random sample of 43 plants is taken. The mean height of the plants in the sample is 0.65m. Using a 1% level of significance, perform a hypothesis test to determine whether the population mean is different from 0.7m. Assume that the population standard deviation is 0.2 m. Disease and _____ killed almost 10 percent of the settlers along the Oregon Trail.starvationanimal attacksaccidentsIndian raids What is the gradient of the graph shown?someone please help I dont understand how to do this. Graph the inequality n > 1.8 The Total cost to rent 5 chairs and 3 tables is $31 dollars. What is the cost to rent each chair and each table? No links please The students decide to model how the motion of two plates occurs. Which statement best describes the ability of the model to predictyplate movement? A The motion of the plates cannot be modeled on a scale that is much smaller than the plates themselves. B The motion of the plates cannot be modeled by simplifying the factors that contribute to plate movement. C The motion of the plates can be modeled by including only the main factors that contribute to plate movement. D The motion of the plates can be modeled only by including every factor that contributes to plate movement. My car magazine reports the numbers of miles driven for different amounts of fas for Three car. Which car travels the fastest on 1 gallon of gas explain CONNETIONSWriters often make connections between blank, blank, and blank If you can drive 340 miles in 5 hours, what is the unit rate? *(2 Points)Enter your answer factorise x^{2} +2x-24[/tex] Alright fam, help me out here with these angles thanks! Which statement best explains why a bird may build a nest in a hidden location?A.Birds build nests in hidden locations because its an innate behavior.B.Birds build nests in hidden locations to avoid predators and decrease the probability of successful reproduction.C.Birds build nest in hidden locations because its a learned behavior.D.Birds build nests in hidden locations to avoid predators and increase the probability of successful reproduction. How would I right subtract 1.9 from the product of 7.4 and 3 WILL GIVE BRAINLESTKeisha conducts a survey to determine how many siblings each of her classmates has. The data are shown below.0, 1, 0, 2, 2, 1, 3, 0, 4, 0, 1, 2What is the mean value of Keishas data? A. 0.75 B. 1 C. 1.3 D. 2 A 10.0 kg mass is moving with constant speed of 10.0 m/s. a.) How much work must be done to double the speed to 20 m/s? b.) How much work must be done to reduce its speed to 5.0 m/s? Help me please and no links Let f be defined by the function f(x) = 1/(x^2+9)(a) Evaluate the improper integral [tex]\int\limits^{}_3 {f(x)} \, dx[/tex] or show that the integral diverges(b) Determine whether the series n=3 f(n) converges or diverges State the conditions of the test used for determining convergence or divergence(c) Determine whether the series n=1(1)n(enf(n))=n=1(1)n(n2+9)en converges absolutely, converges conditionally, or diverges (image put below) Describe one of the techniques william used to avoid being kidnapped A penguin swimming underwater goes 20 meters in 5 seconds. What is its average speed? Which equation represents a linear function