Answer:
Mg is oxidized and Pb is the oxidizing agent
Explanation:
Draw the following structures and name them :
I. CH3CH2(OH)
II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH
III.CH3CH(CH3)CHO
IV.CH2=CH(OH)
V.CH3OCH2CH3
Answer:
hope this helps.answer is in the picture
Question 8 of 10
Which of the following is made of matter?
A. Light
B. Energy
C. The sun
D. Heat
Answer: i Choose the sun
because it has mass
Explanation: matter is anything that has mass and occupies space / Volume
and the sun has mass though it is not a solid one, and is made up of matter
HOPE THIS HELPSS!!!!
Use VSEPR theory to predict the electron-pair geometry and the molecular geometry of CH3Cl. a. The electron-pair geometry is linear, the molecular geometry is linear. b. The electron-pair geometry is tetrahedral, the molecular geometry is trigonal-pyramidal. c. The electron-pair geometry is trigonal-planar, the molecular geometry is bent. d. The electron-pair geometry is tetrahedral, the molecular geometry is tetrahedral. e. The electron-pair geometry is trigonal-planar, the molecular geometry is trigonal planar. Group of answer choices
Answer:
d. The electron-pair geometry is tetrahedral, the molecular geometry is tetrahedral.
Explanation:
According to Valence Shell Electron Pair Repulsion Theory, the shape of a molecule depends on the number of electrons pairs surrounding the valence shell of the central atom in the molecule.
In CH3Cl, the central atom is carbon. Carbon has four regions of electron density surrounding it and no lone pairs. Lone pairs cause molecules to deviate from the expected geometry.
Since CH3Cl has no lone pairs on the carbon central atom, both the molecular and electron pair geometries are tetrahedral.
In CH₃Cl, the electron-pair geometry is trigonal-planar, and the molecular geometry is bent. Therefore, option C is correct.
According to VSEPR (Valence Shell Electron Pair Repulsion) theory, the electron pairs around the central atom in CH₃Cl will arrange themselves to minimize repulsion, resulting in a specific geometry.
In CH₃Cl, the central atom is carbon (C), and it is surrounded by three hydrogen atoms (H) and one chlorine atom (Cl).
The electron-pair geometry is determined by the arrangement of these electron pairs.
Molecular geometry considers only the atoms around the central atom, not the lone pairs.
To learn more about the molecular geometry, follow the link:
https://brainly.com/question/31993718
#SPJ6
what is Ka for hno2(aq) = h+(aq) + no2-(aq)?
The ionization constant of an acid is denoted by the symbol Kₐ. The smaller the value of Kₐ for an acid, the weaker will be the acid. Thus the correct option is D.
What is acid dissociation constant?The acid dissociation constant denotes the measure of the extent to which an acid dissociates in the solution. The strength of an acid is represented by the value Kₐ. The less an acid dissociates, smaller will be the value of Kₐ, the stronger the acid, higher will be the value of Kₐ.
The dissociation of HNO₂ is given as:
HNO₂ (aq) ⇄ H⁺ (aq) + NO₂⁻ (aq)
The dissociation constant of HNO₂ is given as:
Kₐ = [H⁺][NO₂⁻] / HNO₂
The value of Kₐ is constant at a particular temperature. We can use this fact to find out the pH of a weak acid at a particular temperature.
Thus the correct option is D.
To know more about acid dissociation constant, visit;
https://brainly.com/question/14498573
#SPJ7
Which compound is a base? A. HCN B. Ca(OH)2 C. NaF D. CH3COOH
Answer:
Calcium Hydroxide Ca(OH)2
Reduction occurs at which electrode?
A. The electrode that releases ions into solution
B. The electrode with the lowest reduction potential
C. The electrode that removes ions from solution
D. The electrode that loses electrons in a redox reaction
(Answer is C.)
Answer:
The electrode that removes ions from solution
Explanation:
Each electrochemical cell consists of an anode and a cathode. Oxidation occurs at the anode and reduction occurs at the cathode.
At the anode, ions move from the electrode into the solution while at the cathode ions move from the solution to the electrode.
At the cathode, metal ions accept electron(s) and become deposited on the electrode hence this electrode removes ions from solution. This is reduction.
which particle is an atom with only 10 neutrons in its nucleus ?
Answer:
fluorine
Explanation:
which of the following reaction is also be termed as thermal decomposition reaction
Answer:
copper carbonate reaction is known as the termed of thermal decomposition
reaction
What is the pH of a 1.0 x 10-3 M KOH solution?
A. 10
B. 4.0
C. 11
D. 3.0
Answer:
Option C. 11
Explanation:
We'll begin by calculating the concentration of the hydroxide ion [OH¯] in the solution. This can be obtained as follow:
In solution, KOH will dissociate as follow:
KOH (aq) <=> K⁺(aq) + OH¯(aq)
From the balanced equation above,
1 mole of KOH reacted to produce 1 mole of OH¯.
Therefore, 1×10¯³ M KOH will also react to produce 1×10¯³ M OH¯.
Thus, the concentration of hydroxide ion [OH¯] in the solution is 1×10¯³ M
Next, we shall determine the pOH of the solution. This can be obtained as follow:
Concentration of hydroxide ion [OH¯] = 1×10¯³ M
pOH =?
pOH = –Log [OH¯]
pOH = –Log 1×10¯³
pOH = 3
Finally, we shall determine the pH of the solution. This can be obtained as follow:
pOH = 3
pH =?
pH + pOH = 14
pH + 3 = 14
Collect like terms
pH = 14 – 3
pH = 11
Analyse the temperature versus time graph of water, given below.
Which part of graph represent only liquid state and gaseous state and why?
Answer:
Phase C - Liquid State
Phase E - Gaseous State
Explanation:
Usually, in phases of water, we have the following;
When temperature is less than zero, it is said to be in its solid phase as ice.
When temperature is between 0 to 100, we can say it is in the liquid phase as water.
When temperature is above 100°C, It is said to be in the gaseous phase as vapour.
From the diagram;
Phase C is the only liquid state because it falls between temperature of 0°C and 100°
Also, only phase E is in the gaseous phase because the temperature is above 100°C.
. Silver has a density of 10.5 grams/cm3 and gold has a density of
19.3 g/cm3. Which would have the greater mass, 5cm3 of silver or 5cm3 of gold?
Answer:
Gold will have more mass
Explanation:
Mass = volume×density
mass of silver = 5×10.5= 52.5
mass of gold = 5×19.3 = 96.5
Gold has more mass
If you hit the surface of Iron with a photon of energy and find that the ejected electron has a wavelength of .75 nm, what is the wavelength of the incoming photon in nanometers?
Answer:
The wavelength of the incoming photon is 172.8 nm
Explanation:
The wavelength of the incoming photon can be calculated with the photoelectric equation:
[tex] KE = h\frac{c}{\lambda_{p}} - \phi [/tex] (1)
Where:
KE: is the kinetic energy of the electron
h: is Planck's constant = 6.62x10⁻³⁴ J.s
c: is the speed of light = 3.00x10⁸ m/s
[tex]\lambda_{p}[/tex]: is the wavelength of the photon =?
Φ: is the work function of the surface (Iron) = 4.5 eV
The kinetic energy of the electron is given by:
[tex] KE = \frac{p^{2}}{2m} = \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} [/tex] (2)
Where:
p: is the linear momentum = h/λ
m: is the electron's mass = 9.1x10⁻³¹ kg
[tex]\lambda_{e}[/tex]: is the wavelength of the electron = 0.75 nm = 0.75x10⁻⁹ m
Hence, the wavelength of the photon is:
[tex] \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} = h\frac{c}{\lambda_{p}} - \phi [/tex]
[tex]\lambda_{p} = \frac{hc}{\frac{h^{2}}{2m\lambda_{e}^{2}} + \phi} = \frac{6.62 \cdot 10^{-34} J.s*3.00\cdot 10^{8} m/s}{\frac{(6.62 \cdot 10^{-34} J.s)^{2}}{2*9.1 \cdot 10^{-31} kg*(0.75 \cdot 10^{-9} m)^{2}} + 4.5 eV*\frac{1.602 \cdot 10^{-19} J}{1 eV}} = 1.728 \cdot 10^{-7} m = 172.8 nm[/tex]
Therefore, the wavelength of the incoming photon is 172.8 nm.
I hope it helps you!
make a 450 gram solution with the mass by mass concentration of 7% how much salt and water do you need to mix
I NEED HELP WITH THE LAST 4 BOXES PLEASEEEEEEE
Answer:
0.68°C and 0°C.
Explanation:
The average freezing point of sucrose is 0.68°C whereas the average freezing point is 0°C. Both at these temperatures, turn from liquid into solid state. This point is also called transition point because at this point transition of state occurs of both compounds. When the temperature increases, this solid state is again turn into liquid form so temperature is responsible for this change of states of sucrose and water.
How much heat must be transferred to 55 g of ice to change the ice's
temperature from -13°C to -5.0°C? (The specific heat capacity of ice is 2.11
J/g.°C)
Which diagram represents this molecule
Answer:
I think it is C
Explanation:
Hope this helps!! :)
If I'm wrong, then greatest apologies
The boiling point of a substance is known to be 293°C. What is the vapor pressure of that substance at 220°C?
Explanation:
The boiling point of a substance is 293°C.
The boiling point is the temperature at which the vapor pressure of a liquid becomes equal to the atmospheric pressure.
So, at the boiling point:
The vapor pressure =atmospheric pressure = 1 atm.
To get the vapor pressure of the substance at 220°C is definitely less than 1 atm.
Since, as the temperature increases, the vapor pressure of the liquid increases.
Asap please help 15 points
Explanation:
P_H
and
li_n
hope it helps
Which is an advantage of subdividing science into different areas?
Answer:
Explain the advantages of subdividing science into many different areas. Advantages-It allows scientists to delve into a specific topic easier, so that they can go deeper.
hope it helps
Answer:
Science is a vast subject. Scientists have classified it into different areas/branches so that they do not get their concepts mixed or overlapped. We can think of all the sub-branches as different topics studied under one main subject, science. We just divide the main subject so that we can study each of the topic clearly and individually. Science is such a vast subject that most of its sub branches are not even related to each other or interlinked, like computer science and biology. If we did not have subdivisions in science, can you imagine a person studying biology, computer science, chemistry, physics, phycology etc all at the same time, simultaneously? Of course not! That's why, in order to get a clear understanding of each topic, we divide science into different areas.
Hope that helps...
(ii) Describe another method for making ethanol.
Answer:
There are essentially three methods used to produce ethanol:
Manufacture from ethene using steam (the "synthetic" route)
Production from sugars and starches by fermentation, using yeasts.
Production from biomass waste, using bacteria.
Please give brainlist if this helped
What is the action of a catalyst
Answer: A catalyst is a substance that speeds up the rate of a chemical reaction without being used up and remains chemically unchanged itself .
Explanation: For a reaction to take place the particles must collide with enough energy for bonds to break and reaction to occur .
BUT when a catalyst is present the reactants are able to react in a way that requires less energy ,leading to more successful collision so the reaction speeds up without the chemical composition of the catalyst being affected
NOTE: the catalyst must be chosen to suit the particular reaction
HOPE THIS HELPS IF YOU NEED MORE EXAMPLES FEEL FREE TO COMMENT IN THE COMMENT SECTION
1 mole of alkene CxH2x was fully burnt in oxygen. The products were analysed. 264g of Co2 and 108g of of H20 were produced. Use the information to balance the equation and work out the identity of CxH2x.
CxH2x+ O2--> CO2+H2O
PLEASE CAN SOMEONE EXPLAIN THIS TO ME!!!!!!!!!!!!
Answer:
C6H12
Explanation:
Step 1: Find the molar mass of carbon dioxide and water
MH2O = 2(1.008) + 16.00 = 1.802x10^1 g/mol
MCO2 = 12.01 + 2(16.00) = 4.401x10^1 g/mol
Step 2: Calculate the moles of the products
nH2O = 108g / 1.802x10^1 g/mol = 5.99 or about 6
nCO2 = 264g/ 4.401x10^1 g/mol = 5.99 or about 6
Step 3: Enter moles of carbon dioxide and water into the balanced equation
CxH2x + O2 = 6CO2 + 6H2O
Step 4: Balance
We see how there is six carbon dioxide on the right side which means there are six carbons in the equation.
This means x is equal to 6 in our equation.
If you plug the information into the equation you get:
C6H12 + O2 = 6 CO2 + 6 H2O
Now all that's left is to balance the oxygens
We see how there is 18 oxygens on the right side of the equation which means there must be 18 on the left side.
Because we have oxygen gas we divide 18 by 2 which means there are 9 O2's on the left side
Therefore, the balanced equation is C6H12 + 9O2 = 6 CO2 + 6 H2O
NaC2H3O2 product or reactant
Answer:
the reaction between vinegar and baking soda, the reactants are vinegar (acetic acid) and baking soda (sodium bicarbonate). The products are sodium acetate, water, and carbon dioxide gas.
When the volume of a gas is
changed from 250 mL to 425 mL, the temperature will change from 137°C to_____°C.
Answer:
[tex]\boxed {\boxed {\sf 232.9 \textdegree C}}[/tex]
Explanation:
This question asks us to find the temperature change given a volume change. We will use Charles's Law, which states the volume of a gas is directly proportional to the temperature. The formula is:
[tex]\frac {V_1}{T_1}= \frac{V_2}{T_2}[/tex]
The volume of the gas starts at 250 milliliters and the temperature is 137 °C.
[tex]\frac{250 \ mL}{137 \textdegree C}= \frac{V_2}{T_2}[/tex]
The volume of the gas is increased to 425 milliliters, but the temperature is unknown.
[tex]\frac{250 \ mL}{137 \textdegree C}= \frac{425 \ mL}{T_2}[/tex]
We are solving for the new temperature, so we must isolate the variable T₂. First, cross multiply. Multiply the first numerator and second denominator, then multiply the first denominator and second numerator.
[tex]250 \ mL * T_2 = 137 \textdegree C * 425 \ mL[/tex]
Now the variable is being multiplied by 250 milliliters. The inverse of multiplication is division. Divide both sides of the equation by 250 mL.
[tex]\frac{250 \ mL * T_2}{250 \ mL}=\frac{ 137 \textdegree C * 425 \ mL}{250 \ mL}[/tex]
[tex]T_2=\frac{ 137 \textdegree C * 425 \ mL}{250 \ mL}[/tex]
The units of milliliters (mL) cancel.
[tex]T_2=\frac{ 137 \textdegree C * 425 }{250 }[/tex]
[tex]T_2= \frac{58225}{250} \textdegree C[/tex]
[tex]T_2=232.9 \textdegree C[/tex]
The temperature changes to 232.9 degrees Celsius.
Chromium forms a complex with diphenylcarbazide whose molar absorptivity is 4.17*10^4 at 540nm. Calculate the absorbance of a 7.68*10^-6 M solution of the complex at 540nm when measured in a 1.00cm cell and the transmittance of the solution.
Answer:
0.32 liters/mole cm.
Explanation:
According to Beer Lambert's law;
A= εcl
ε = molar absorptivity
c= concentration
l= path length
A= 4.17*10^4 × 7.68*10^-6 × 1
A= 0.32 liters/mole cm.
hii pls help me to write the ionic equation
Answer:
net ionic equation
[tex]\boxed{ SO_4{}^{2-} {}_{(aq.)} + Ba^{2+} {}_{(aq.)} \rightarrow BaSO_4 {}_{(s)}} [/tex]
What is the reducing agent in the reaction Fe + AgNO3 → Fe(NO3)3 + Ag?
O A. Fe
O B. AgNO3
C. Fe(NO3)3
O D. Ag
Answer:
A
Explanation:
Fe up to Fe+3
In the given reaction, Fe is a reducing agent. Therefore, option (A) is correct.
What is a reducing agent?A substance in a redox reaction that donates its electrons to another substance and gets oxidized to a higher valency is called a reducing agent.
A reducing agent can be explained as one of the reactants of a redox reaction that can reduce the other reactant of the chemical reaction by donating its electrons.
If the reducing agent will not provide its electrons to other substances in a chemical reaction, then the reduction cannot take place. The given chemical reaction is:
Fe + AgNO₃ → Fe(NO₃)₃ + Ag
In the above reaction, the Fe is in the zero oxidation state and changes into Fe³⁺ in Fe(NO₃)₃ after the chemical reaction So Fe losses its electron and gets oxidized. Therefore, Fe is a reducing agent in this reaction.
Learn more about reducing agent, here:
brainly.com/question/2890416
#SPJ2
Why is conical flask used in the freezing point of naphthalene activity?
Pick one below.
A Conical flask is used to hold the boiling tube
B Napthalene is poisonous and needs to be contained
C Freezing point can only be determined inside the conical flash
D To ensure the cooling process is not affected by surrounding temperature
Answer:
D. To ensure the cooling process is not affected by surrounding temperature
Explanation:
The conical flask acts as a temperature jacket.
The conical flask is used in freezing point of the naphthalene activity because to ensure the cooling process is not affected by surrounding temperature.
What is the use of conical flask ?In the freezing point determination of naphthalene, a conical flask is used to hold the naphthalene sample and a thermometer. The conical shape of the flask allows for efficient stirring of the naphthalene as it is heated and cooled, ensuring that the temperature is evenly distributed throughout the sample.
The conical flask is also used to protect the naphthalene sample from any external temperature fluctuations that could affect the cooling process. By placing the flask in an ice bath, the cooling process can be closely monitored and controlled, allowing for accurate determination of the freezing point.
Therefore, the primary reason why a conical flask is used in the freezing point determination of naphthalene is to ensure that the cooling process is not affected by surrounding temperature.
Find more on conical flask:
https://brainly.com/question/5897608
#SPJ2
PLZ HELP Which of the following is made up of a group of cells with the same function?
A. Organism
B. Body system
C. Organs
D. Tissues
Answer:
tissues is the answer to your question
find the atoms of 52u of helium
Here, we have been given the the amount of helium to be 52 amu.
Thus,
Atomic mass of Helium is 4u = 2 protons + 2Neutrons = 1 atom. No. of atoms in 52u = $ \sf{\frac{52}{4}}$ = 13 atoms.$ \red{\leadsto}$ Hence, the number of atoms will be 13 atoms.
[tex] \\ [/tex]