Answer:
[tex]\Large \boxed{\mathrm{A}}[/tex]
Explanation:
Rust formed from iron and oxygen combining is a chemical change, because in a chemical change, the resulting substance(s) will have different properties from the substance(s) before the chemical change.
I cant comment... So is it Right?
What happens when two objects when they are brought closer together The mass of both objects decrease The mass of both objects increase The gravitational force between them decreases The gravitational force between them increases
Answer:
The correct option is
The gravitational force between them increases
Explanation:
According to Newton's law of universal gravitation states that the force of attraction between two bodies is directly proportional to the product of the masses of the bodies and inversely proportional to the square of the distance of their centers from each other.
The formula for universal gravitation is given as follows;
[tex]F_{1} = F_{2} =G \times \dfrac{m_{1} \times m_{2}}{r^{2}}[/tex]
Where;
F₁, and F₂ = The gravitational forces of attraction on each mass
G = The gravitational constant
m₁ = The mass of one body
m₂ = The mass of the body
r = The distance between the centers of the two bodies
Therefore, the gravitational force of attraction on each object is inversely proportional to the as the distance between the centers of the two bodies
When the distance between the centers of the two bodies decreases, the two objects are brought closer together, the gravitational force of attraction between them increases.
Answer:
Gravitational force between two objects of masses m1/m2
Explanation:
is defined by Gm1xm2/r^2, where G is a universal constant, and r is the distance between the masses. This shows you why B is wrong; it would increase. Also, A is not a good choice, as shown. In the case of B, it would increase by say, 2/1 to 4/1 by doubling ones mass. In C's case the bottom would decrease on the fraction alot (square) if they were moved closer, thus the force would be greater.
Explanation:
in other words the answer is The gravitational force between them increases
100 cm^3 of oxygen diffuses through a Porous in 3second how long will it take 150 cm^3 of sulphur (iv) oxide diffuse through the same pot? ( oxygen= 16 sulphur = 32)
Answer:
3.18 seconds
Explanation:
Given the following :
Volume of oxygen (V1) = 100cm^3
Time taken (t1) = 3 seconds
Volume of Sulphur (iv) oxide (v2) = 150cm^3
From Graham's Law of diffusion:
(r1/r2) = √(m1/m2)
Where r = rate of diffusion
m = molar mass
Note rate (r) = (volume / time)
[(V1/t1) ÷ (v2/t2)] = √(m1/m2)
(v1/t1) * (t2/v2) = √(m1/m2)
m1 = 02 = (16 * 2) = 32
m2 = SO2 = (32 + (16 * 2)) = 64
(100/3) * (t2/150) = √(32/64)
100t2 / 450 = √(32/64)
100t2 / 450 = √32 / 8
100t2 / 450 = √32 / 8
100t2 * 8 = 450 * √32
800t2 = 2545.5844
t2 = 2545.5844 / 800
t2 = 3.1819805
t2 = 3.18 seconds
It will take 3.18s for 150cm^3 of Sulphur (iv) oxide to diffuse through the same pot.
write the formula of three compounds which you know and name the elements in them
Answer:
[tex]\boxed{\sf{view \ explanation}}[/tex]
Explanation:
Compound definition:
A compound is a chemical substance formed by two or more chemically bonded elements.
Three compounds:
Water is a compound with the formula [tex]\sf H_2O[/tex].
Two hydrogen atoms and one oxygen atom is present in one molecule of water.
Sodium chloride or table salt is a compound with the formula [tex]\sf NaCl[/tex].
One sodium atom and one chlorine atom is present in one molecule of sodium chloride.
Ammonia is a compound with the formula [tex]\sf NH_3[/tex].
In one molecule of ammonia, one nitrogen atom and three hydrogen atoms are present.
Answer:
See below
Explanation:
Three compounds are:
1) [tex]\mathrm {H_{2}SO{4}}[/tex] [Sulfuric acid]
The elements in this compound are hydrogen (H) , Sulfur (S) and Oxygen (O).
2) [tex]\mathrm {NaOH}[/tex] [Sodium hydroxide]
The elements in this compound are Sodium (Na) , Oxygen (O) and Hydrogen (H).
3) [tex]\mathrm {HCl}[/tex] [Hydrochloric acid]
The elements are Hydrogen (H) and Chlorine (Cl).
If an object's mass is 70 g, and its volume is 10cm cubed, what is its density?
If an object's mass is 70 g, and its volume is 10cm cubed, its density is 7 centimeter cube.
What is density?The density of any solid substance is the unit of the area occupied by it in per centimeter of the cube of the volume in the given sample and calculated by dividing the mass and the volume of the compound unit will be centimeter cube.
The mass of the given object is 70 gram and the volume is given is 10 cm to find the density,
Density = mass of object / volume of object
substituting the value in the formula,
Density = 70 / 10
Density = 7 centimeter cube.
Therefore, the density of the given object will be 7 centimeter cube if an object's mass is 70 g, and its volume is 10cm cubed.
Learn more about density, here:
https://brainly.com/question/15164682
#SPJ2
how many primary carbon are in 2,3 dimethylpentane
Answer:
There are 7 carbons in 2,3 dimethylpentane
Explanation:
Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16
anyone knows how to do this-
Explanation:
The number of protons in the element C^12 (Carbon) is 6, number of electrons 12 and number of Neutrons is 6, same as the number of protons it contains
C^13 has 13 electrons, 6 protons and 7 Neutrons this one's neutron number is different from proton number because it's an isotope
Na^-1 has gained an electron so the number of electrons it has = 24 and the number of protons shown as 11 which means there are 23 - 11 = 12 Neutrons
O^-2 has gained two electrons and got 18 electrons in total, 8 protons and 8 neutrons
does the tendency to gain electrons decrease as we go down grp 17?
Explanation:
Hi, there!!!!
Let me simply clear you..
Yes,The tendency to gain electrons (in nonmetal) decreases when we go down group 17.
The reason for above answer is when we go downwards in periodic table then the atomic size increases with the addition of number of shells and force of attraction between the nucleus and valance shell decreases. The force of attraction between the nucleus and valance shell becomes weaker due to which the force of attracting the electrons gets decreased.
So, we can say that the tendency to gain electrons decreases as we go down in periodic table.
Hope it helps....
When a substance's particles are packed together tightly and have a definite shape and
volume...it is said to be in what state?
solid
gas
plasma
liquid
Answer:
solid
Explanation:
A baseball has a mass of 135 grams and a softball has a mass of 270 grams. In which of the following situations would they have the same momentum? The baseball and softball are thrown at the same speed in the same direction.
Answer:
The baseball is thrown twice as fast as the softball in the same direction.
Explanation:
PLEASE HELP WILL GIVE BRAINLIEST!!!!
If the concentration of substance A of a reversible reaction in dynamic equilibrium increases, how will the equilibrium change?
A. It will shift to create more of substance A.
B. It will shift towards the reactants.
C. It will shift towards the products.
D. It will shift to create less of substance A.
Answer:
[tex]\boxed{It\ will\ shift\ to\ create\ less\ of\ substance\ A}[/tex]
Explanation:
If the concentration of any substance A in a dynamic equilibrium increases, The equilibrium will be shifted to its opposite side so that Substance A can be created less and the substance opposite to A can be created more so that a "dynamic equilibrium" can again be established.
Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J
Answer:
B)−6,942 J /mol
Explanation:
At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:
ΔG = ΔH - TΔS
Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.
Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):
ΔG = ΔH - TΔS
ΔG = 25450J/mol - 298K×108.7J/molK
ΔG = -6942.6J/mol
Right solution is:
B)−6,942 J /molList the metals Mg, Cu, Au, Na and Al in the decreasing order of their reactivity with air.
Answer:
Na is most reactiveAlcuAu is less reactiveIN HEREAnswer:
Potassium (K)
Sodium (Na)
Calcium (Ca)
Magnesium (Mg)
Aluminium (Al)
Iron (Fe)
Lead (Pb)
Copper (Cu)
Silver (Ag)
Gold (Au)
What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
Chemical change example
Answer: burning paper
Explanation:
The paper burns in air to form smoke and ash. which makes it a chemical change.
please help :) How can scientists ensure that their data are reliable? A) by making a single observation B) by recording values without units C) by keeping the results private D) by repeating trials during an experiment
Answer:
D. by repeating trials during an experiment
Explanation:
chile its actually d
Explanation:
Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?
Answer:
A. 35
B. 7
C. halogênios
Explanation:
Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.
..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.
O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.
A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35
B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família
C. Pertence à família dos halogênios
Tips for memorizing the first 20 elements of the periodic table?
Answer:
hydrant flying with balloon, balloon has lithp letting air out, bee: really yum balloon
= = = =
hydrogen helium lithium beryllium
be bore on the balloon, balloon pops, hydrant drops and makes a car bomb
= =
boron carbon
night row general gets hurt by car bomb nearby, that general gets off boat
=
nitrogen
wearing oxygen mask, mask is full of fluride gel, then he got neon teeth
= = =
oxygen fluorine neon
(try making a story out of the elements, use your imagenation)
I will give u tips to learn whole periodic table
1. Break down the table into sections
2. Spread out the memorisation process
3. Learn the elements in a song
4. Make none sense words made from element symbols
5. Use colour to learn element groups
6. Use mnemonic device to help remember the order of elements
I am sure this will be helpful for uuu
Explanation:
If you are designing an experiment, how will you determine your independent or dependent variable?
Answer:
The independent variable effects the dependent variable.
Explanation:
The independent variable Is what you change whereas the dependent variable would change because of that.
for example, the indipendent variable could be how much you water a plant in ml each day, and the dependent variable would be how tall each plant grown]s with that water doseage per day.
Which of these is true about electrons? posses a positive electrical charge of one (+1) have a negative electrical charge of one (-1) indicates the number of protons in each atom equals the sum of protons plus neutrons in each atom
Answer:
have a negative electrical charge of one (-1)
Explanatio
Electrons have an electrical charge of negative one. When you think electron, always think -1
Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid
Answer: 1. Sodium Benzoate
Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c
Sodium benzoate is a pure preservative.
In the image above the ruler is measuring in centimeters. The blue cylinder falls somewhere between 2.7cm and 2.8cm according to the ruler. Since we can estimate the last digit I would say that the length of the cylinder is 2.76cm. Since I am estimating any number 2.72cm or 2.78cm could also be correct.
Why would 2.755 not be a correct measurement according to estimating the last digit?
Answer:
The answer is below
Explanation:
Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.
I'll GIVE BRAINLIEST: In a redox reaction, CO is changed to CO2. How many electrons must be lost or gained by C and why?
Answer:
C is gaining 2 electrons
Explanation:
O has a 2- charge so for CO to pick up another O atom would add 2 more electrons.
Answer:
C gains 2 electrons
Explanation:
In the redox reaction, CO is changed into CO2 which means there is an additional oxygen. Oxygen loses 2 of its electrons in order to neutralize. So, C must be gaining 2 electrons in order to make the bond.
Describe the reaction of an acid with an alkali.?
Your question has been heard loud and clear.
The reaction of an acid with an alkali is neutralization reaction. It is a neutralization reaction because , they both neutralize each other (means it makes them chemically inactive after reacting) and produce a salt , and maybe water too.
An example: hydrochloric acid + sodium hydroxide → sodium chloride + water
Thank you
it will neutralise because if you add both of them together with a matching Ph such as 5 and 9 equally then it will neutralise and have a Ph of 7
could you please make me brainliest
Which of the following elements has a complete outer shell of electrons? A. Iron (Fe) B. Hydrogen (H) C. Neon (Ne) D. Nitrogen (N)
Answer:
The answer is Neon
Answer:
neon
Explanation:
neon has a complete outer 2n shell
Answer in the correct significant figures: 35.6 + 56.27 *
Answer:
101.87
Explanation:
that's the answer
Select the correct answer from each drop-down menu. At chemical equilibrium, the amount of because .
Answer:
The answer that completes the question are in BOLD:
At chemical equilibrium, the amount of PRODUCT AND REACTANT REMAIN CONSTANT because the RATES OF THE FORWARD AND REVERSE REACTIONS ARE EQUAL.
Explanation:
In a reversible chemical reaction, an equilibrium is said to be achieved when the rates of the forward reaction is equal to that of the reverse reaction. A reversible reaction is one in which products are formed from reactants simultaneously with the formation of reactants from products.
The combination of two or more substances called REACTANTS gives rise to another substance called PRODUCT, which can in turn give rise to Reactants again. With time, the rate at which the reactants give rise the products, which is called the FORWARD REACTION will be equal to the rate at which the products give rise to the reactants, which is called REVERSE REACTION. At this point, the chemical reaction is said to be in a STATE OF EQUILIBRIUM.
When the rate at which both reaction occurs becomes equal i.e. at an equilibrium state, the concentration of both the reactants and the products becomes constant i.e. no longer changes. Hence, the amount of the reactants forming the products is the same as the amount of products forming the reactants.
N.B: At chemical equilibrium, the amount of the reactants and products does not necessarily equals zero (0). It simply means that there is no net change in the concentration/amount of both reactants and products.
If a gas displays a solubility of 0.00290M at a partial pressure of 125 kPa, what is the proportionality constant for this gas in this solvent and at this temperature?
Answer:
The proportionality constant ( Henry’s constant) = 2.32 * 10^-5 M/kPa
Explanation:
Here in this question, we are concerned with calculating the proportionality constant for this gas.
Mathematically, we can get this from Henry law
From Henry law;
Concentration = Henry constant * partial pressure
Thus Henry constant = concentration/partial pressure
Henry constant = 0.00290 M/125 kPa = 2.32 * 10^-5 M/kPa
how many oxygen atoms are in 7.25g of calcium nitrate
Answer:
The answer to this question is approximately equal to 1.6 ×
[tex] 1.6 \times {10}^{23} atom \: o[/tex]
which of the following molecules would you expect to be optically active
1. CCl2F2
2. 2-methyl butane
3. butan-2-ol
Answer:
waaaaaaaaaaqwwwwwwwwwwww
Please help me...
Atoms of elements X, Y and Z have 16, 17 and 19 electrons, respectively. Atoms of argon have 18 electrons.
a Determine the formulae of the compounds formed by the combination of the atoms of the elements:
(i) X and Z
(ii) Y and Z
(iii) X with itself.
b In each of the cases shown in
A (i)–(iii) above, name the type of chemical bond formed.
c Give two properties you would expect to be shown by the compounds formed in an (ii) and an (iii).
Answer:
a 1) XZ2
2) YZ
3) X2
b 1) Ionic bond
2) Ionic bond
3) covalent bond
c) ionic compounds has high melting and boiling point
ionic compounds can conduct electicity in aqueous form
covalent compounds have electrons shared between the atoms
covalent compounds have lower melting point compared to ionic compound
Answer:
(i) XZ = Potassium Sulfide [K2SO4]
(ii) YZ = Potassium Chloride [KCI]
(iii) X = Sulfur [S]
b) (i) Ionic Bond. (ii) Ionic Bond. (iii) Covalent Bond.
c) (i) Ionic compounds have high melting and boiling points.
(ii) Ionic compounds can conduct electricity in a molten state or a solution as they have ions that can move and carry charge.
(iii) Covalent compounds have low melting and boiling points.
(iv) Covalent compounds can not conduct electricity as all electrons are involved in bonding so there are no free electrons or ions to carry the charge.
Hope this is OK :))
Please mark me as Brainliest:))