According to Newton's law of universal gravitation, how do the masses of two
objects relate to the gravitational force between them?
A. As either mass increases, the gravitational force between them
increases.
B. As either mass increases, the gravitational force between them
decreases.
C. Gravitational force increases only when both masses increase.
D. Gravitational force increases only when both masses decrease.

According To Newton's Law Of Universal Gravitation, How Do The Masses Of Twoobjects Relate To The Gravitational

Answers

Answer 1

Answer:

As either mass increases, the gravitational force between them

increases.

Explanation:

According to Newton's law of universal gravitation;

F α m1m2/r^2

That is, the force between two masses in a gravitational field is directly proportional to the product of the two masses and inversely proportional to their distance apart.

Hence, as either of the masses increase, the force of gravitation between the two masses increases. Hence the answer.


Related Questions

Which is NOT an indicator of a chemical change?

Answers

Answer:

The choice that is not an indicator of a chemical change is "State of matter changes". More common than not, chemical reactions produce energy in the form of light or heat. Along with energy, they also produce a new substance called the product that could be in any state of matter (solid, gas, or liquid).

Explanation:

43.0 mL of 1.49 M perchloric acid is added to 14.0 mL of calcium hydroxide, and the resulting solution is found to be acidic.

29.1 mL of 0.498 M barium hydroxide is required to reach neutrality.

What is the molarity of the original calcium hydroxide solution?

Answers

Answer:

2.29 M

Explanation:

Equation of the reaction;

Ca(OH)2(aq) + 2HClO4(aq) → 2H2O(l) + Ca(ClO4)2(aq)

Concentration of acid CA = 1.49 M

Concentration of base CB= ????

Volume of acid VA= 43.0 ml

Volume of base VB= 14.0 ml

Number of moles of acid NA = 2 moles

Number of moles of base NB = 1 mole

CAVA/CBVB = NA/NB

CAVANB =CBVBNA

CB= CAVANB/VBNA

CB= 1.49 × 43.0 × 1/14.0 × 2

CB= 2.29 M

What is the difference between conjugate acid-base pair?

a. a H atom. c. a mole water
b. a H+ ion d. a OH– ion​

Answers

Answer:

b. a H+ ion

Explanation:

The concept of conjugate acid-base pair is related to Bronsted-Lowry acid-base theory and according to this theory, acid is a proton acceptor.

In short,

conjugate base is formed when an acid donates a proton.

conjugate acid is formed when a base accepts a proton.

Chloride ion is a strong nucleophile and bromide is a good leaving group. The major product of treating (S)-2-bromobutane with NaCl in CH3C(O)CH3 (acetone) is _________. (1S,2R)-1-chloro-2-bromobutane cis-2-butene (1R,2S)-1-chloro-2-bromobutane (S)-2-chlorobutane trans-2-butene (R)-2-chlorobutane

Answers

Answer:

Chloride ion is a strong nucleophile and bromide is a good leaving group. The major product of treating (S)-2-bromobutane with NaCl in CH3C(O)CH3 (acetone) is _________. (1S,2R)-1-chloro-2-bromobutane cis-2-butene (1R,2S)-1-chloro-2-bromobutane (S)-2-chlorobutane trans-2-butene (R)-2-chlorobutane

Explanation:

The reaction of (S)-2-bromobutane with NaCl in CH3C(O)CH3 (acetone) forms the following product:

The answer is (R)-2-chlorobutane.

The reaction take splace through [tex]S_{N} _2[/tex] mechansim and inversion in configuration happens.

Inbox
Question 1
Flagged
III
Initial Knowledge Check
Drafts
Sent
Write the symbol for every chemical element that has atomic number less than 14 and atomic mass greater than 23.2 u.

Answers

Answer:

8 oxygen. 9 flourine. 10. Neon. 5 Boron

In a solution, the solvent is
ANSWER:
A. always water
B. dissolved in the solute
C. present in larger amount than the solute is
D. always nonpolar

Answers

Answer:

dissolved in the solute

Explanation:

A solvent is the component that dissolves the solute and is present in larger amount. The type of solution is determined by the state of the solute and solvent. If you have NaCl, a solid, dissolved in water, a liquid, the type of solution is a solid/liquid solution.

B. dissolved in the solute

15. You are interested in separating 4-methylbenzoic acid from 1,4-dimethoxybenzene using a procedure similar to the extraction procedure we used in lab. You plan to use sodium bicarbonate instead of sodium hydroxide. a) Show the reaction between salicylic acid and sodium bicarbonate. Label the acid, base, conjugate acid, conjugate base. b) Give the pKa values of the acid and conjugate acid. c) Which base will work better, sodium hydroxide or sodium bicarbonate

Answers

Solution :

a). The separation of 4-methylbenzoic acid from 1,4-dimethoxybenzene will work but it will result in lower recovery.

In the reaction of acid-base to form a sodium 4 - methoxy benzoate, that is soluble in the water, 4-methoxy benzoic acid reacts with the sodium bicarbonate to give sodium 4-methoxybenzoate as well as carbonic acid.

b). The pKa for the 4-methoxybenzoic acid is [tex]4.46[/tex], and that of carbonic acid is [tex]6.37[/tex]

c). The Keq for the reaction is [tex]10(6.37 - 4.46) = 101.91[/tex]

Therefore, the equilibrium lies to the right  and also the reaction favors the products and the separation works.

But the recovery will be low when compared to the extraction with Sodium hydroxide as the strong base will drive the equilibrium further to the right position, thus neutralizing all the acids virtually. And the weak base will partially neutralize the acid.

Aluminum hydroxide, with heat, creates____

Answers

Answer:

Water and Aluminium oxide

Explanation:

Have a nice day.

I don’t want to fail help
I need correct answer if u don’t know I will report

When the researcher compiled information which research method did they most likely utilize?

a) documentary
b) survey
c) participant observation
d) case study

Answers

Answer:

a

Explanation:

documentary is best researcher!.

a. Draw 2,3-dichloro octane.
b. Write the lewis structure for H20 molecule.

Answers

Answer:

a.draw 2,3 dicholoro octane

Explanation:

mag isip ka kung paano hehe

Assign oxidation state to each atom in each element ion or compound.
a. Ag
b. Ag+
c. CaF2
d. H2S
e.CO3
f. CrO4
g. Cl2
h. Fe
i. CuCl2
j. CH4

Answers

Answer:

a. [tex]Ag^0[/tex]

b. [tex]Ag^{+}[/tex]

c. [tex]Ca^{2+}F_2^-[/tex]

d. [tex]H_2^+S^{2-}[/tex]

e. [tex](C^{4+}O_3^{2-})^{-}[/tex]

f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]

g. [tex]Cl_2^0[/tex]

h. [tex]Fe^0[/tex]

i. [tex]Cu^{2+}Cl_2^-[/tex]

j. [tex]C^{4-}H_4^+[/tex]

Explanation:

Hello there!

In this case, according to the concept of charge balance, which tell us that the overall charge is zero for any compound, except ions, it turns out possible to proceed as follows:

a. [tex]Ag^0[/tex]

b. [tex]Ag^{+}[/tex]

c. [tex]Ca^{2+}F_2^-[/tex]

d. [tex]H_2^+S^{2-}[/tex]

e. [tex](C^{4+}O_3^{2-})^{-}[/tex]

f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]

g. [tex]Cl_2^0[/tex]

h. [tex]Fe^0[/tex]

i. [tex]Cu^{2+}Cl_2^-[/tex]

j. [tex]C^{4-}H_4^+[/tex]

Keep in mind lonely elements have 0 as their oxidation state.

Regards!

Which safety feature works to slow down nuclear-fission chain reactions?
A. Proliferation
B. Control rods
C. Cooling rods
D. Fuel rods

Answers

Answer:

The answer is

-control rods

Answer:

B. Control Rods.... via A P E X

3)O que são políticas públicas?​

Answers

Answer:

azertyuiopazertyuiiop

13. What would you expect the pH of an aqueous solution of tertiary bromide in water to be (acidic, neutral, or basic)

Answers

Answer:

oshfjidgshsjdh

Explanation:

918474828

1.Using the absorbance of the spinach extract and the equation of the trendline, determine the concentration of the extract solution. Report the concentration in moles/L (M).
2. Calculate the number of rams of chlorophyll-a in the 25ml, spinach solution.
3. Calculate the concentration of the chloropyhll-a soultion in spinach (mg chlorophyll-a/g spinach)
Trendline: y=1609x + .0055
Absorbance spinach extract lamda max: .329
Absorbacne spinach extract, 750 nm: .023
Corrected absorbance: .306
Mass of Spinach: .1876g Total Volume of spinach: 25mL

Answers

Answer:

Explanation:

From the given information:

We are to make use of the spinach absorbance extract which is the corrected absorbance  (y) = 0.306

And also the trendline equation:

y = 1609x + 0.0055

where,

x = absorbance of the spinach extract.

0.306 = 1609x + 0.0055

collecting the like terms

0.306 - 0.0055 = 1609x

0.3005  = 1609x

x = 0.3005/1609

x = 1.8676 × 10⁻⁴

x ≅ 0.0002 M

No. of grams for the chlorophyll can be computed as follows:

recall that:

molar mass of chlorophyll = 893.5 g/mol

the volume = 25ml = (25/1000) L = 0.025 L

In spinach solution, the no. of grams for the chlorophyll:

= (0.0002) mol/L × (893.5 g/mol) × (0.025) L

= 0.0044675 g

≅ 0.0045 g

In the spinach, the concentration of chlorophyll = no of grams of chlorophyll/ mass of the spinach

= 4.5 mg/0.1876 g

= 23.987 mg/g

≅ 24 mg/g

From the given information:

We are to make use of the spinach absorbance extract which is the corrected absorbance  (y) = 0.306

Chlorophyll

Chlorophyll is any member of the class of the green pigments involved in the photosynthesis process.

And also the trendline equation:

y = 1609x + 0.0055

where,

x = absorbance of the spinach extract.

so 0.306 = 1609x + 0.0055

collecting the like terms

0.306 - 0.0055 = 1609x

0.3005  = 1609x

x = 0.3005/1609

x = 1.8676 × 10⁻⁴

x ≅ 0.0002 M

2. No.of grams for the chlorophyll can be computed as follows:

recall that:

molar mass of chlorophyll = 893.5 g/mol

The volume = 25ml = (25/1000) L = 0.025 L

Therefore:

In spinach solution, the no. of grams for the chlorophyll:

= (0.0002) mol/L × (893.5 g/mol) × (0.025) L

= 0.0044675 g

≅ 0.0045 g

3. In the spinach, the concentration of chlorophyll = no of grams of chlorophyll/ mass of the spinach

= 4.5 mg/0.1876 g

= 23.987 mg/g

≅ 24 mg/g

Read more about chlorophyll here:

https://brainly.com/question/3529377

Cal is titrating 57.7 mL of 0.311 M HBr with 0.304 M Ba(OH)2. How many mL of Ba(OH)2 does Cal need to add to reach the equivalence point?

Answers

Answer:

118.06 mL

Explanation:

The neutralization reaction between HBr (acid) and Ba(OH)₂ (base) is the following:

2HBr + Ba(OH)₂ → BaBr₂ + 2H₂O

According to the equation, 2 moles of HBr react with 1 mol Ba(OH)₂. Thus, at the equivalence point the moles of acid and base react completely:

2 moles HBr = 1 mol Ba(OH)₂

We can replace the moles by the product of the molar concentration (M) and volume (V):

2 x (M HBr) x (V HBr) = M Ba(OH)₂ x V Ba(OH)₂

Now, we introduce the data in the equation to calculate the volume in mL of Ba(OH)₂:

V Ba(OH)₂ = (2 x (M HBr) x (V HBr))/M Ba(OH)₂

                 = (2 x 0.311 M x 57.7 mL)/(0.304 M)

                 = 118.06 mL

Therefore, 118 mL of Ba(OH)₂ are needed.

How much carbon dioxide is released when it is fully combusted with 4Kg of ethanol with more than enough oxygen? How do you work it out?

Answers

Answer:

7.640 kg

Explanation:

Step 1: Write the balanced complete combustion equation for ethanol

C₂H₆O + 3 O₂ ⇒ 2 CO₂ + 3 H₂O

Step 2: Calculate the moles corresponding to 4 kg (4000 g) of C₂H₆O

The molar mass of C₂H₆O is 46.07 g/mol.

4000 g × 1 mol/46.07 g = 86.82 mol

Step 3: Calculate the moles of CO₂ released

86.82 mol C₂H₆O × 2 mol CO₂/1 mol C₂H₆O = 173.6 mol CO₂

Step 4: Calculate the mass corresponding to 173.6 moles of CO₂

The molar mass of CO₂ is 44.01 g/mol.

173.6 mol × 44.01 g/mol = 7640 g = 7.640 kg

11th grade chemistry question will mark brainliest
2.50 g of CO2 gas is confined in a rigid cylinder at a pressure
of 4.65 atm. If 0.42 g of gas is released from the cylinder,
what is the new pressure?

Answers

Answer:

3.88 atm

Explanation:

We'll begin by calculating the number of mole of CO₂ in each case. This can be obtained as follow:

For 2.50 g of CO₂:

Mass of CO₂ = 2.5 g

Molar mass of CO₂ = 12 + (2×16) = 44 g/mol

Mole of CO₂ =?

Mole = mass / molar mass

Mole of CO₂ = 2.5 / 44

Mole of CO₂ = 0.06 mole

For 0.42 g of CO₂:

Mass of CO₂ = 2.5 g

Molar mass of CO₂ = 44 g/mol

Mole of CO₂ =?

Mole = mass / molar mass

Mole of CO₂ = 0.42 / 44

Mole of CO₂ = 0.010 mole

Finally, we shall determine the new pressure. This can be obtained as follow:

Initial mole (n₁) = 0.06 mole

Initial pressure (P₁) = 4.65 atm

Final mole (n₂) = 0.06 – 0.010 = 0.05 mole

Final pressure (P₂) =?

NOTE: Temperature and volume is constant.

P₁ / n₁ = P₂ / n₂

4.65 / 0.06 = P₂ / 0.05

Cross multiply

0.06 × P₂ = 4.65 × 0.05

0.06 × P₂ = 0.2325

Divide both side by 0.06

P₂ = 0.2325 / 0.06

P₂ = 3.88 atm

Thus, the new pressure is 3.88 atm.

Question 1 Points 3 23 and Louis immerses his left hand in a beaker containing cold water and immerses his right hand in a beaker containing warm water. Then, he immerses both his hands on a beaker containing water at room temperature. Which of the following statements are true? 1. The hand that was in hot water would feel cold. 2. The hand that was in cold water would feel hot. 3. His two hands will feel the same hotness. Que O2 and 3 0 1 and 2 o 1 and 3 1.2, and 3​

Answers

Answer:look down below

Explanation:

The statements that are true about hands that are immersed in the water are:

1. The hand that was in hot water would feel cold.

2. The hand that was in cold water would feel hot.

The correct option is B 1. and 2.

What is temperature?

Temperature is the measurement of the hotness or coldness of any object. It is measured in Celsius or kelvin. Our body has nerves that feel the different temperatures of any object. The high temperature is called hot and the low temperature is called cold.

When Louis put his hand in the warm water and one hand in the cold water. He feels the temperature of both glasses of water. Then he put both hands in the normal water.

So the hand that is warm would feel the water as cold and the hand with cold water would feel the water as hot.

Thus, the correct option is B. 1. and 2.

Learn more about temperature, here:

https://brainly.com/question/15267055

#SPJ5

One student measured a spectrum and observed double yellow lines. He claimed that it must be Sodium. Please justify if he is correct. Why

Answers

Answer:

We know that the student was measuring a spectrum, and observed double yellow lines, he claimed that it was Sodium.

There are multiple elements with double yellow lines, like Mercury or Sodium, but Sodium has two bright yellow lines, so it is usually identified by them.

So when we look at a spectrum and we see a strong doublet in the yellow range, we can easily assume that it is Sodium.

Here we assume that the student only saw the yellow doublet, this would imply that the yellow doublet is way more intense than the other lines, that can't be seen (while for other elements with double yellow lines, we should see other lines with similar intensity) then we can conclude that it is Sodium.

The student is correct.

5. The Rf of ibuprofen was found to be 0.32 when t-butyl methyl ether was used as the development solvent. What effect would there be on the Rf of ibuprofen if acetone had been used to develop the TLC plate?

Answers

Answer:

The Rf value of ibuprofen increases

Explanation:

TLC involves the elution of a solute using a mobile phase(solvent). The stationary phase is made of an adsorbent such as silica.

The extent of interaction between the solute and the mobile phase affects the Rf value. The greater the interaction between the solute and the solvent, the greater the Rf value.

On the other hand, the polarity of the solvent and the solute also affects the Rf value. If the solvent is changed from t-butyl methyl ether to acetone, the Rf value for ibuprofen increases because ibuprofen is polar and acetone is also polar hence there is greater interaction between the solvent and solute.

How many atoms are in 5.70 x 10^32 mol of Rn?

Answers

To find amount of atoms from mol, multiply the mole amount by Avogadro’s number

5.70x10^32 x 6.02x10^23

= 3.43x10^56 atoms

There are 3.43 × [tex]10^{56}[/tex] atom will be present in 5.70 x [tex]10^{32}[/tex] mol of Rn.

What is atom?

The basic number of matter that may be broken even without producing electrically charged molecules is the atom.

Calculation of atom:

It is given that number of mol = 5.70 x [tex]10^{32}[/tex] mol.

Then, the number of atom = 5.70 x [tex]10^{32}[/tex] mol × 6.02 × [tex]10^{23}[/tex].= 3.43 × [tex]10^{56}[/tex] atom.

Therefore, there are 3.43 × [tex]10^{56}[/tex] atom will be present in 5.70 x [tex]10^{32}[/tex] mol of Rn.

To know more about atom.

https://brainly.com/question/1566330

#SPJ3

Explain why the balls representing fluorine (teal) and hydrogen (white) have only one peg, while carbon (black) has four.

Answers

Answer:

Hydrogen and fluorine form only one bond while carbon forms four bonds to other atoms.

Explanation:

This question brings us to the idea of valency. Fluorine is univalent while carbon is tetravalent.

Univalent means that fluorine can only form one bond to hydrogen while carbon forms as much as four bonds because it is tetravalent.

Hence fluorine and hydrogen have only one peg while carbon has four.

Whate the mass percentage of Sulphure in Na2so4 ?

Answers

Answer:

Water H2O + SULPHATE OXIDE

A 250 mL sample of gas at 1.00 atm and has the temperature increased to and the volume increased to 500 mL. What is the new pressure

Answers

Answer:

0.53atm = P2

Explanation:

Gas at 1.00atm and 20°C. Temperature increased to 40°C...

We can solve this question using combined gas law:

P1*V1 / T1 = P2*V2 / T2

Where P is pressure, V volume and T absolute temperature of 1, initial state and 2, final state.

Compunting the values of the problem:

P1 = 1.00atm

V1 = 250mL

T1 = 20°C + 273.15 = 293.15K

P2 = ?

V2 = 500mL

T2 = 40°C + 273.15 = 313.15K

1.00atm*250mL / 293.15K = P2*500mL / 313.15K

0.53atm = P2

g A sample of chlorine gas starting at 681 mm Hg is placed under a pressure of 991 mm Hg and reduced to a volume of 513.7 mL. What was the initial volume, in mL, of the chlorine gas container if the process was performed at constant temperature?

Answers

Answer:

747.5 mL

Explanation:

Assuming ideal behaviour, we can solve this problem by using Boyle's law, which states that at constant temperature:

P₁V₁ = P₂V₂

Where in this case:

P₁ = 681 mm HgV₁ = ?P₂ = 991 mm HgV₂ = 513.7 mL

We input the data given by the problem:

681 mm Hg * V₁ = 991 mm Hg * 513.7 mL

And solve for V₁:

V₁ = 747.5 mL

Select the statement that correctly describes an endothermic process.

a. The enthalpy change for the process is negative.
b. Heat is lost by the system, but work is done on the system.
c. The enthalpy of the products is higher than that of the reactants.
d. The temperature change of the products is greater than that of the reactants.
e. Heat is released by the system, to the surroundings.

Answers

Answer:

C. The enthalpy of the products is higher than that of the reactants

Explanation:

An endothermic process is any process with an increase in the enthalpy of the system

The enthalpy of the products is higher than that of the reactants describes an endothermic process. Therefore, option (C) is correct.

What is the endothermic process?

An endothermic process can be described as any thermodynamic process with an increase in the enthalpy H of the system. In such a process, a closed system commonly absorbs thermal energy from its surroundings.

An endothermic reaction leads to an increase in the temperature of the system and a decrease temperature of the surroundings. A physical process, such as the melting of ice cubes is an endothermic process.

Whether a process can take place spontaneously depends not only on the enthalpy change but also on the entropy change and absolute temperature.

An endothermic process commonly needs a favorable entropy increase  (∆S > 0) in the system. In an endothermic process, the energy of the products is higher than that of the reactants.

Learn more about the endothermic process, here:

https://brainly.com/question/13818956

#SPJ5

How many alkenes are formed by E2 elimination of HBr from 3-bromo -3,4-dimethylhexane using a strong base such as sodium methoxide (NOTE: draw 3,4-dimethyl as anti configuration)

Answers

Answer:

2

Explanation:

2 alkenes are formed by E2 elimination of HBr from 3-bromo -3, 4 - dimethylhexane using a strong base such as sodium methoxide

what does LPG stand for? mention one important source of LPG give sort answer​

Answers

Answer:

liquefied petroleum gas

LPG is prepared by refining natural gas. it is made by refining crude oil or from extracted natural gas streams as they emerge from the ground.

Please please help help please

Answers

Acute toxin or D) 100% correct
Other Questions
Which of the following represents the factorization of the trinomial below?- 4x3 - 4x2 +24 xO A. -4(x2-2)(x+3)B. -4(x2 + 2)(x+3)O C. -4x(x + 2)(x+3)D. -4x(x - 2)(x+3) Is it normal to like you know... touch yourself like sometimes I feel bad when I do it but... is it normal? Sorry for the weird question I just... feel weird when I do it... can I get answers to see if it's actually normal? You don't have to answer it if you don't want to... Which of the following sentences uses the present perfect correctly? Yo ha dicho todo lo que voy a decir.Yo he dicho todo lo que voy a decir.Yo hemos decido todo lo que voy a decir.Yo has dicido todo lo que voy a decir.. Help me please. "Whats up with you? Which shows the image of rectangle ABCD after the rotation () (W)?13VA1V Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p. Evaluate:64 1/3 Question 11 options: A) 8 B) 16 C) 4 D) 2 the sum of numerator and denominator of the fraction is 12 and the denominator is 2 more than numerator.find the fraction what is the answer to this 3x-y=7 2x-2y=2 help me with this two I don't understand Complete the function table.Input (n) Output (n-2) 1 N 3 4 5 6 Conv A rectangular field is 300 meters long and 250 meters wide. What is the area of the field in square kilometers? Do not round your answer. 1000 millimet 100 centimet 10 decimet 1 decame 2 km X 5. ? 1 hectomei 1 how does technology provide a positive and negative platform for the development of relationships? It can be shown that the line with intercepts (a, 0) and (0, b) has the following equation:x/a + y/b= 1, a 0, b 0.Use this result to write an equation of the line.Point on line: (2, 4)x-intercept: (a, 0)y-intercept: (0, a)(a 0) 700,000 rounded to the nearest hundred thousand The side measurement of the wall of the Green House is 9m. Find the cost of the glass required for the walls of the Green House, if the cost of 1m2 glass is AED 12. Please help!!A) In a movie, a mad scientist enlarges a cow to 100 times its normal size. How much stronger would its legs be than a normal cow?B) How many times more would it weigh than a normal cow?C) Can you see how results A and B would yield a cow that would collapse under its own weight? Structure #5 - a canal that joins the cervix to the outside of the body. It also is known as the birth canal.o vaginaO uterusO Fallopian tubesO ovariesO cervix PLEASE HELP !!Given that p II q, fill in the reasons why each statement is true.