A triangular prism has height 20 cm.
Its triangular face has base 7 cm and height 10 cm.
A. what is the volume of the prism?
B. suppose you triple the height of the prism.what happen to the volume?
C. suppose you triple the base of the triangular face.what happen to the volume?
D. suppose you triple the height of the triangular face.what happen to the volume?
E. suppose you triple all 3 dimensions.what happen to the volume?

Answers

Answer 1

Answer:

A. The volume of the triangular prism can be calculated using the formula V = (1/2)bh × h, where b is the base of the triangular face and h is the height of the prism. Thus, V = (1/2)(7 cm)(10 cm) × 20 cm = 700 cubic centimeters.

B. If the height of the prism is tripled to 60 cm, then the new volume would be V' = (1/2)(7 cm)(10 cm) × 60 cm = 2100 cubic centimeters. Thus, the volume is tripled.

C. If the base of the triangular face is tripled to 21 cm, then the new volume would be V' = (1/2)(21 cm)(10 cm) × 20 cm = 2100 cubic centimeters. Thus, the volume is tripled.

D. If the height of the triangular face is tripled to 30 cm, then the new volume would be V' = (1/2)(7 cm)(30 cm) × 20 cm = 2100 cubic centimeters. Thus, the volume is tripled.

E. If all three dimensions (base, height of triangular face, and height of prism) are tripled, then the new volume would be V' = (1/2)(21 cm)(30 cm) × 60 cm = 18900 cubic centimeters. Thus, the volume is multiplied by a factor of 27.


Related Questions

Suppose we want to choose 5 letters, without replacement, from 15 distinct letters

Answers

[tex]\text{order does not matter}[/tex]

[tex]\text{sample space}= \text{15 letters}[/tex]

[tex]\text{no repetition}[/tex]

[tex]\text{P(A)}= \text{15C5}= \text{3003 ways}[/tex]

Two cars, one going due east at the rate of 90 km/hr and the other going to south at the rate of 60 km/hr are traveling toward the intersection of two roads. At what rate the two cars approaching each other at the instant when the first car is 0.2 km and the second car is 0.15 km from the intersection ?

Answers

The two cars are approaching each other at a rate of 36 km/hr at the given instant.

We can solve this problem by using the Pythagorean theorem and differentiating with respect to time. Let's call the distance of the first car from the intersection "x" and the distance of the second car from the intersection "y". We want to find the rate at which the two cars are approaching each other, which we'll call "r".

At any moment, the distance between the two cars is the hypotenuse of a right triangle with legs x and y, so we can use the Pythagorean theorem

r^2 = x^2 + y^2

To find the rates of change of x and y, we differentiate both sides of this equation with respect to time

2r(dr/dt) = 2x(dx/dt) + 2y(dy/dt)

Simplifying and plugging in the given values

dr/dt = (x(dx/dt) + y(dy/dt)) / r

dr/dt = (0.2 x 90 + 0.15 x (-60)) / sqrt((0.2)^2 + (0.15)^2)

dr/dt = (18 - 9) / sqrt(0.04 + 0.0225)

dr/dt = 9 / sqrt(0.0625)

dr/dt ≈ 36 km/hr

Learn more about Pythagorean theorem here

brainly.com/question/14930619

#SPJ4

If
f(x) = 2x² + 3x - 6, determine the value of f(2).

Answers

Answer:

8

Step-by-step explanation:

2x² + 3x - 6

plug in x with 2

2(2)^2+3(2)-6

2(4)+6-6

8+6-6

14-6

8

Mr. Chand is one of the landlords of his town. He buys a land for his daughter spanning over a
area of 480m². He fences the dimensions of the land measuring (x+12) mx (x+16) m. Now he
plans to erect a house with a beautiful garden in the ratio 5:3 respectively. A total of Rs. 5,00,000 is estimated as the budget for the expenses.

1)Give the area of the land purchased in linear polynomial form using algebraic expression

2)Mr. Chand's daughter is ready to share 3/5" of the expenses by her earnings. Express the
fraction in amount.

3)Can you solve the linear equation/polynomial of the area into different factors?

Answers

The required answers are 1) [tex]$$A = x^2 + 28x + 192$$[/tex] 2) 300000 3) [tex]$$x^2 + 28x + 192 = (x + 14 - 2\sqrt{19})(x + 14 + 2\sqrt{19})$$[/tex].

How to deal with area and fractions?

area of the land purchased is given as 480m², and the dimensions of the land are (x+12)mx(x+16)m. Therefore, the area of the land can be expressed as:

[tex]$$A = (x+12)(x+16)$$[/tex]

Expanding this expression, we get:

[tex]$$A = x^2 + 28x + 192$$[/tex]

Hence, the area of the land purchased is given by the polynomial expression [tex]$x^2 + 28x + 192$[/tex].

The total budget for the expenses is Rs. 5,00,000. If Mr. Chand's daughter is ready to share 3/5 of the expenses, then the fraction of the expenses she will pay is:

[tex]$\frac{3}{5}=\frac{x}{500000}$$[/tex]

Simplifying this expression, we get:

[tex]$x = \frac{3}{5}\times 500000 = 300000$$[/tex]

Therefore, Mr. Chand's daughter will pay Rs. 3,00,000 towards the expenses.

We can solve the polynomial [tex]$x^2 + 28x + 192$[/tex] into different factors by using the quadratic formula:

[tex]$x = \frac{-b \pm \sqrt{b^2 - 4ac}}{2a}$$[/tex]

Here, the coefficients of the polynomial are:

[tex]$$a = 1, \quad b = 28, \quad c = 192$$[/tex]

Substituting these values in the quadratic formula, we get:

[tex]$x = \frac{-28 \pm \sqrt{28^2 - 4\times 1 \times 192}}{2\times 1}$$[/tex]

Simplifying this expression, we get:

[tex]$$x = -14 \pm 2\sqrt{19}$$[/tex]

Therefore, the polynomial [tex]$x^2 + 28x + 192$[/tex] can be factored as:

[tex]$$x^2 + 28x + 192 = (x - (-14 + 2\sqrt{19}))(x - (-14 - 2\sqrt{19}))$$[/tex]

or

[tex]$$x^2 + 28x + 192 = (x + 14 - 2\sqrt{19})(x + 14 + 2\sqrt{19})$$[/tex]

So, we have factored the polynomial into two factors.

To know more about Area visit;

brainly.com/question/22469440

#SPJ1

how many one-to-one functions are there from a set with five elements to sets with the following number of ele- ments? a) 4 b) 5 c) 6 d) 7

Answers

a) Number of one-to-one functions are equal to the zero, because n< m.

b) Number of one-to-one functions are equal to the ⁵P₅ = 120.

c) Number of one-to-one functions are equal to the ⁶P₅ = 720.

c) Number of one-to-one functions are equal to the ⁷P₅ = 2250.

One to one function is a special form of function that defined from one set to another and maps every element of the range to exactly one element of its domain unique output. As we know a set A has m elements and set B has n elements, then

Number of one-to-one functions from set A to Set B = P(n,m) or ⁿPₘ , n≥ m and number of one-to-one functions from set A to Set B = 0 , n< m.

Now, we have a domain set with five elements, m = 5

a) Here, another set (co-domain) has 4 elements, n = 4. So, Number of one-to-one functions = 0 , n<m.

b) number of elements in another set,n= 5

So, Number of one-to-one functions = ⁵P₅ = 5!/(5 - 5 )! ( permutation formula)

= 5!/0! = 120

c) Number of elements in another set, n= 6

So, Number of one-to-one functions= ⁶P₅

= 6!/(6 - 5)!

= 6!/1! = 720

d) Number of elements in another set, n

= 7

So, Number of one-to-one functions

= ⁷P₅ = 7!(7 - 5)!

= 7!/2! = 2250

Hence, required value is 2250.

For more information about one-to-one function, visit :

https://brainly.com/question/28281339

#SPJ4

12. What is the height of the trapezoid in yards? (Hint: Use the formula
A = 1/2h (b 1, + b2,) (Lesson 2)

Answers

Answer:

height = 7 yards

Step-by-step explanation:

the area (A) of a trapezoid is calculated as

A = [tex]\frac{1}{2}[/tex] h (b₁ + b₂ )

where h is the perpendicular height between the 2 parallel bases

here b₁ = 12 , b₂ = 9 and A = 73.5 , then

[tex]\frac{1}{2}[/tex] h(12 + 9) = 73.5 ( multiply both sides by 2 to clear the fraction )

h(21) = 147

21h = 147 ( divide both sides by 21 )

h = 7 yards

Calculate the following limits?

Answers

The answer of the given question based on the limits the answers are as follows, (a)  lim f(x) = 1 , (b)  lim f(x) = 3 , (c)  lim f(x) = 3.

What is Graph?

A graph is  visual representation of data that shows the relationship between two or more variables. Graphs can be used to display  wide variety of information, including numerical data, functions, and networks. The most common types of graphs like line graphs, bar graphs, scatter plots, and pie charts.

Graphs are widely used in many fields, like science, economics, engineering, and social sciences, to help people understand and analyze complex data. They are  powerful tool for visualizing trends, patterns, and relationships, and are often used to communicate findings to wider audience.

a) The limit of f(x) as x approaches 2 from the left:

We can see from the graph that as x approaches 2 from the left, f(x) approaches 1. Therefore, we can write:

lim f(x) = 1

x→2-

b) The limit of f(x) as x approaches 2 from the right:

Similarly, as x approaches 2 from the right, f(x) approaches 3. Therefore:

lim f(x) = 3

x→2+

c) The limit of f(x) as x approaches 2:

Since the limit from the left and the limit from the right exist and are equal, we can say that the limit of f(x) as x approaches 2 exists and equals the common value of the left and right limits. Therefore:

lim f(x) = 3

x→2

To know more about Variable visit:

https://brainly.com/question/2466865

#SPJ1

What is the slope of the line in the following graph?

Answers

Answer:

1/3

Step-by-step explanation:

using rise over run fron the two dots, we can find 2/6, which simplifies down to 1/3

if the slope of the line joining the points (2,4) and (5,k) is 2. find the value of k

Answers

10 is the value of k of  the slope of the line .

What are slopes called?

Slope, usually referred to as rise over run, is a line's perceived steepness. By dividing the difference between the y-values at two places by the difference between the x-values, we can determine slope.

                                   You may determine a line's slope by looking at how steep it is or how much y grows as x grows. slope categories. When lines are inclined from left to right, they are said to have a positive slope, a negative slope, or a zero slope (when lines are horizontal).

the points  (2,4) and (5,k)

formula from slope of two points

        slope = y₂ - y₁/x₂ - x₁

substitute the values in formula

 slope = 2

 slope =  k - 4/5- 2

   2 =k - 4/3

   6 = k - 4

    k = 6 + 4  

      k = 10

Learn more about Slope

brainly.com/question/3605446

#SPJ1

Triangle ABC is similar to triangle DEF. What is AC?

Answers

Answer:

i think side AC is 14 because if you do subtract BC (18) from EF(12) you get 6, so u add 6 to DF(8) and get 14.

if its confusing ask me questions!!

Answer:

12

Step-by-step explanation:

When triangles are similar, their side ratios are the same. The ratio of EF to BC is 18/12, or 3/2. To find the side AC, we would multiply the corresponding part of DEF by 3/2, the same ratio. The corresponding part of DEF would be DF. DF = 8. 8 times 3/2 is 12. So AC is 12.

Let me know if this helped by hitting brainliest! If not, please comment and I'll get back ASAP.

The number 0 is an element of the set of natural numbers.
OA. True
B. False
SUBI

Answers

it is false. 0 is not a natural number. it is a whole number

the value of the given test statistic lies between the given cutoffs -2.58 and 2.58. it falls in acceptance region.

Answers

Here the values -0.94 and 2.12 falls between the points -2.58 and 2.58. The area between is the acceptance region. So we cannot reject the null hypothesis.

The given is an example for two tailed test. A two tailed test is used to determine whether the value is greater than or less than the mean value of the population. It represents the area under both tails or sides on a normal distribution curve.

Here the value of the test statistic lies between -2.58 and 2.58. So the values less than -2.58 and greater than 2.58 fall in the rejection region, where the null hypothesis can be rejected.

a) -0.94 falls between -2.58 and 2.58. So it is in the acceptance region. So null hypothesis is accepted.

b) 2.12 lies between -2.58 and 2.58. It is also in acceptance region. So null hypothesis is accepted.

So in both cases null hypothesis cannot be rejected.

For more information regarding two tailed test, kindly refer

https://brainly.com/question/23946270

#SPJ4

The complete question is :

f the cutoffs for a z test are -2.58 and 2.58, determine whether you would reject or fail to reject the null hypothesis in each of the following cases and explain why:

a. z = −0.94

b. z = 2.12

Model the pair of situations with exponential functions f and g. Find the approximate value of x that makes​ f(x) =​ g(x). ​f: initial value of 500 decreasing at a rate of ​6% ​g: initial value of 90 increasing at a rate of ​6%
The value of x that makes ​f(x)​g(x) is x

Answers

Answer:

Step-by-step explanation:

u got this

I will mark you brainiest!

Given the coordinates shown and given that SU = 10, what are the coordinates of U if STUV is a kite?

A) (10, 18)
B) (0, 28)
C) (18, 28)

Answers

The calculated coordinates of U if STUV is a kite is (10, 18)

Calculating the coordinates of U if STUV is a kite?

From the question, we have the following parameters that can be used in our computation:

The figute of a kite

Also, we have

S = (0, 18)

And the distance SU to be

SU = 10

If the quadrilateral STUV is a kite, then the coordinates S and U are on the same horizontal level (according to the figure)

So, we have

U = (0 + 10, 18)

Evaluate

U = (10, 18)

Hence, the coordinates of U if STUV is a kite is (10, 18)

Read more about distance at

https://brainly.com/question/31617619

#SPJ1

the graph shows the preimage shaded in grey and the image outlined in black. what is the scale factor of the dilation?

Answers

The scale factor of dilation of the shaded in gray to the shaded in black is 3

Calculating the scale factor dilation

Given that

The preimage = shaded in gray

The image = shaded in black

From the graph, we have the following values on the image and the preimage

The preimage = shaded in gray = 4

The image = shaded in black = 12

The scale factor of dilation is then calculated as

Scale factor = shaded in black/shaded in gray

So, we have

Scale factor = 12/4

Evaluate

Scale factor = 3

Hence, the scale factor dilation is 3

Read more about scale factor at

https://brainly.com/question/29229124

#SPJ1

If 5 is increased to 9, the increase is what percentage of the original number

Answers

Answer: It's a 80% increase

Step-by-step explanation:

An instructor is administering a final examination. She tells her class that she with give an A grade to the 10% of the students who earns the highest marks. Past experience with the same examination has yielded grades that are normally distributed with a mean of 70 and a standard deviation of 10. If present class runs true to form, what numerical score would a student need to earn an A grade?

Answers

To earn an A grade, a student needs to score at least 82.8 , calculated using the inverse normal cumulative distribution function with a mean of 70, a standard deviation of 10, and a 10th percentile of 0.10.

Given that the grades are normally distributed with a mean of 70 and a standard deviation of 10.

We need to find the score which is at the 10th percentile of the distribution.

Using the standard normal distribution table, we can find the z-score that corresponds to the 10th percentile.

From the table, we can see that the z-score is approximately -1.28.

Using the formula for standardizing a normal distribution:

z = (x - μ) / σ

where z is the z-score, x is the raw score, μ is the mean, and σ is the standard deviation.

Substituting the given values, we have:

-1.28 = (x - 70) / 10

Solving for x, we get:

x = (-1.28 * 10) + 70

x = 82.8

Therefore, a student would need to earn a score of approximately 82.8 to receive an A grade.

To know more about standard deviation:

https://brainly.com/question/23907081

#SPJ4

how do you find the simplest radical form for this please help me i got a (f) and i really need help that’s why i’m up this late trying to do all of my missing assignments.

Answers

Answer:

[tex]14 {y}^{2} \sqrt{ {x}^{3} {z}^{9} }[/tex]

Step-by-step explanation:

[tex] \sqrt{196 {x}^{3} {y}^{4}{z}^{9} }= \sqrt{196} \times \sqrt{ {x}^{3} } \times \sqrt{ {y}^{4} } \times \sqrt{ {z}^{9} } \\ \sqrt{196} = 14 \\ \sqrt{ {x}^{3} } = {x}^{ \frac{3}{2} } \\ \sqrt{ {y}^{4} } = {y}^{2} \\ \sqrt{ {z}^{9}} = {z}^{ \frac{9}{2} }[/tex]

A fractional exponent is not necessarily simpler so just take out the 1st and 3rd parts of the term which simplify nicely:

[tex] \sqrt{196 {x}^{3} {y}^{4}{z}^{9} } = 14 {y}^{2} \sqrt{ {x}^{3} {z}^{9} } [/tex]

Find the zeros of the function.
y = (x + 1)(x-2)(x - 5)
The zero(s) of the function are
(Use a comma to separate answers as needed.)

Answers

-1,2,5
Switch the signs to get the zeros in a problem.

PLEASE HELP MEEE
whoever answers right gets brainliest!!!

Answers

Answer:

 [tex]30\leq x[/tex]  AND [tex]x \leq 106[/tex]

Notice the valid answer is the one with the AND since need to be both at the same time.

Step-by-step explanation:

Is the one is market, you add 6 to each side and you obtain that answer

[tex]24 \leq x-6\leq 100[/tex]

[tex]24 +6\leq x\leq 100+6[/tex]

[tex]30\leq x\leq 106[/tex]

One side of the triangle is 4 cm, and the sum of the other two sides is equal to a whole number of cm. What is the smallest possible perimeter of the triangle?
F. 9 cm
G. 10 cm
H. 11 cm
J. 15 cm
K. 17 cm

Answers

Answer:

9 cm

Step-by-step explanation:

By the Triangle Inequality, any two sides of a triangle must be greater than the remaining side.

In order to minimize the perimeter, we will assume that 4 cm is the longest side.

Thus, the two remaining sides must be greater than 4.

Since we are given that the sum of the two remaining sides is a whole number, the smallest whole number value greater than 4 is 5.

Hence, the smallest perimeter possible 9 cm.

A invested Rs 4500 for 3 years at the rate of 8% annual compound interest and B invested the
same amount for same time at the rate of per month per rupee I paisa simple interest. Calculate
(i) The interest received by A. (ii) The interest received by B.

Answers

The calculation of the interest received by Investor A and Investor B is as follows:

Investor A = $1,168.70 (Compound)Investor B = $1,620 (Simple).

What is the difference between compound and simple interest?

Compound interest is based on the system of charging interest on accumulated interest and principal for each period.

Simple interest is charged on only the principal for each period.

A's Investment at 8% Annual Compound Interest:

N (# of periods) = 3 years

I/Y (Interest per year) = 8%

PV (Present Value) = $4,500

PMT (Periodic Payment) = $0

Results:

Future Value (FV) = $5,668.70

Total Interest = $1,168.70

B's Investment at Paisa 1 per R1.00 Monthly Simple Interest:

N (# of periods) = 3 years

r = 1 paisa per rupee per month

= 1÷100*100 = 1%

Annually rate =1%*12 = 12%

PV (Present Value) = $4,500

Results:

Total Interest = $1,620 (R4,500 x 12% x 3)

Future Value (FV) = $6,120.

Thus, while Investor A receives $1,168.70 at the end of 3 years, Investor B receives $1,620.

Learn more about compound and simple interests at https://brainly.com/question/2277782.

#SPJ1

What is the difference between the questionnaire and an interview?

Answers

Answer: Questionnaire refers to a research instrument, in which a series of question, is typed or printed along with the choice of answers, expected to be marked by the respondents, used for survey or statistical study. It consists of aformalisedd set of questions, in a definite order on a form, which are mailed to the respondents or manually delivered to them for answers. The respondents are supposed to read, comprehend and give their responses, in the space provided.

A ‘Pilot Study’ is advised to be conducted to test the questionnaire before using this method. A pilot survey is nothing but a preliminary study or say rehearsal to know the time, cost, efforts, reliability and so forth involved in it.

The interview is a data collection method wherein a direct, in-depth conversation between interviewer and respondent takes place. It is carried out with a purpose like a survey, research, and the like, where both the two parties participate in the one to one interaction. Under this method, oral-verbal stimuli are presented and replied by way of oral-verbal responses.

It is considered as one of the best methods for collecting data because it allows two way exchange of information, the interviewer gets to know about the respondent, and the respondent learns about the interviewer. There are two types of interview:

Personal Interview: A type of interview, wherein there is a face to face question-answer session between the interviewer and interviewee, is conducted.

Telephonic Interview: This method involves contacting the interviewee and asking questions to them on the telephone itself.

A questionnaire is considered a voting type of process while an interview is discussing a topic

A large equilateral triangle pyramid stands in front of the city's cultural center. Each side of the base measures 40 feet and the slant height of each lateral side of the pyramid is 50 feet.

A painter can paint 100 square feet of the pyramid in 18 minutes.

How long does it take the painter to paint 75% of the pyramid?

Answers

Answer:

A large equilateral triangle pyramid stands in front of the city's cultural center. Each side of the base measures 40 feet and the slant height of each lateral side of the pyramid is 50 feet.

A painter can paint 100 square feet of the pyramid in 18 minutes.

How long does it take the painter to paint 75% of the pyramid?

Step-by-step explanation:

The total surface area of the pyramid can be calculated using the formula for the lateral surface area of a pyramid:

Lateral surface area = (1/2) × perimeter of base × slant height

Since the base is an equilateral triangle, the perimeter is 3 times the length of one side:

Perimeter of base = 3 × 40 feet = 120 feet

Lateral surface area = (1/2) × 120 feet × 50 feet = 3000 square feet

To paint 75% of the pyramid, the painter needs to paint:

0.75 × 3000 square feet = 2250 square feet

Since the painter can paint 100 square feet in 18 minutes, the time required to paint 2250 square feet can be calculated as:

2250 square feet ÷ 100 square feet per 18 minutes = 225 ÷ 10 × 18 minutes = 405 minutes

Therefore, the painter would need 405 minutes or 6 hours and 45 minutes to paint 75% of the pyramid.

Help please! I have no idea!!!! PLEASEE

Answers

To highlight the line y = 0 on the graph in black/grey, draw a straight line passing through all points whose y-coordinate is 0.

What is graph?

In mathematics, a graph is a visual representation of a set of data, typically as a set of points or lines on a coordinate plane. Graphs are used to represent various types of data, such as numerical values, functions, relationships, and patterns.

Assuming that the graph is a coordinate plane with the x-axis and y-axis, do the following:

To highlight the point (9, 8) on the graph in red, locate the point (9, 8) on the coordinate plane and mark it with a red color.

To highlight the point (20, f(20)) on the graph in green, you need to know the value of f(20) first. Once you have that value, locate the point (20, f(20)) on the coordinate plane and mark it with a green color.

To highlight the line y = 5 on the graph in blue, draw a straight line passing through all points whose y-coordinate is 5. This line should be parallel to the x-axis and should be marked with a blue color.

Therefore To highlight the line y = 0 on the graph in black/grey, draw a straight line passing through all points whose y-coordinate is 0. This line should be parallel to the x-axis and should be marked with a black/grey color.

To learn more about graph from the given link:

https://brainly.com/question/17267403

#SPJ1

find the closed formula for 3,6,11,18 by relating them to a well known sequence. assume the first term given is

Answers

The closed formula for this particular sequence is an = n² + 2.

Take note that the odd numbers 3, 5, 7, 9, and 11 are separate consecutive terms. This shows that the first n odd numbers can be added to the initial term, az, to get the nth term. Hence, the following is how we may represent the nth term a = az + 1 + 3 + 5 + ... + (2n-3) (2n-3). We may utilize the formula for the sum of an arithmetic series to make the sum of odd integers simpler that is 1 + 3 + 5 + ... + (2n-3) = n².

As a result, we get a = az + n^2 - 1. In conclusion, the equation for the series (an)n21, where a1 = az and an is the result of adding the first n odd numbers to az, is as a = az + n^2 - 1. We have the following for the given series where a1 = az = 3.

So, the closed formula for this particular sequence is an = n² + 2.

To learn more about arithmetic sequences, refer to:

Your question is incomplete. The complete question is:

Find the closed formula for the sequence (an)n21. Assume the first term given is az. an = 3, 6, 11, 18, 27... Hint: Think about the perfect squares.

Let G
be a group. Say what it means for a map φ:G→G
to be an automorphism. Show that the set-theoretic composition φψ=φ∘ψ
of any two automorphisms φ,ψ
is an automorphism. Prove that the set Aut(G)
of all automorphisms of the group G
with the operation of taking the composition is a group.

Answers

a) An automorphism of a group G is a bijective map φ:G→G that preserves the group structure. That is, φ(ab) = φ(a)φ(b) and φ(a⁻¹) = φ(a)⁻¹ for all a, b ∈ G.

b) The set-theoretic composition φψ of any two automorphisms φ, ψ is an automorphism, as it preserves the group structure and is bijective.

c) The set Aut(G) of all automorphisms of G, with the operation of composition of maps, is a group. This is because it satisfies the four group axioms: closure, associativity, identity, and inverses. Therefore, Aut(G) is a group under composition of maps.

An automorphism of a group G is a bijective map φ:G→G that preserves the group structure, meaning that for any elements a,b∈G, we have φ(ab) = φ(a)φ(b) and φ(a⁻¹) = φ(a)⁻¹. In other words, an automorphism is an isomorphism from G to itself.

To show that the set-theoretic composition φψ is an automorphism, we need to show that it satisfies the two conditions for being an automorphism. First, we have

(φψ)(ab) = φ(ψ(ab)) = φ(ψ(a)ψ(b)) = φ(ψ(a))φ(ψ(b)) = (φψ)(a)(φψ)(b)

using the fact that ψ and φ are automorphisms. Similarly,

(φψ)(a⁻¹) = φ(ψ(a⁻¹)) = φ(ψ(a))⁻¹ = (φψ)(a)⁻¹

using the fact that ψ and φ are automorphisms. Therefore, φψ is an automorphism.

To show that Aut(G) is a group, we need to show that it satisfies the four group axioms

Closure: If φ,ψ∈Aut(G), then φψ is also in Aut(G), as shown above.

Associativity: Composition of maps is associative, so (φψ)χ = φ(ψχ) for any automorphisms φ,ψ,χ of G.

Identity: The identity map id:G→G is an automorphism, since it clearly preserves the group structure and is bijective. It serves as the identity element in Aut(G), since φid = idφ = φ for any φ∈Aut(G).

Inverses: For any automorphism φ∈Aut(G), its inverse φ⁻¹ is also an automorphism, since it is bijective and preserves the group structure. Therefore, Aut(G) is closed under inverses.

Since Aut(G) satisfies all four group axioms, it is a group under composition of maps.

Learn more about automorphism here

brainly.com/question/30967813

#SPJ4

The sum of the ages of father and son at present is 45 years. If both live on until the son's age becomes equal to the father's present age, the sum of their ages then will be 95 years. Find their present ages.

Answers

Answer:

father age 45 son age 0 this is answer

f the random walk starts in the center, on average how many steps does it take to return to the center?

Answers

Total number of steps taken by an average man in a year while walking with 7192 steps a day is equals to 2,625,080 steps/year.

Number of steps taken by average man in a day is equals to  7192

Then the total number of steps he takes in a year is equals to,

Calculate it by multiplying the average number of steps per day by the number of days in a year.

There are different ways to define a year,

But assuming a regular calendar year of 365 days, the calculation would be,

Total number of days in a year = 365 days

Total number of steps in a year

= 7192 steps/day x 365 days/year

= 2,625,080 steps/year

Therefore, on average the man would walk about 2,625,080 steps in a year.

learn more about average here

brainly.com/question/24278457

#SPJ4

The given question is incomplete, I answer the question in general according to my knowledge:

If a man walks with random steps and the average man takes 7192 steps a day about how many steps does the average man take in a year?

PLEASE HELP !
Use the figure below to answer the questions

Answers

From the figure 1. Two line segments are LA and EP. 2. Two rays are EC and AH. 3. Two lines are b and AP.

What are rays, line segment and line?

A ray is a segment of a line with a single endpoint and unlimited length in a single direction. A ray cannot be measured in terms of length.

The ends of a line segment are two. These endpoints are included, along with every point on the line that connects them. A segment's length can be measured, while a line's length cannot.

A line is a collection of points that extends in two opposing directions and is endlessly long and thin.

From the given figure we observe that,

1. Two line segments are LA and EP.

2. Two rays are EC and AH.

3. Two lines are b and AP.

Learn more about ray here:

https://brainly.com/question/17491571

#SPJ1

Other Questions
you have an rc circuit with a time constant of 5.35 s. if the total resistance in the circuit is 231.2 k , what is the capacitance of the circuit (in f)? don't type the units into the answer box. A file is copied from the hard drive (storage) to ______ when you open it. When you close a file, it's removed from ______ and saved to the hard drive. Select your answer, then click Done. .the him manager tasked the coding manager to development a dashboard that shows the discharges pending final billing so that she can plan for staffing. because this data changes throughout the day, what analysis technique is needed? what is a moral & legalabligation?- what kind of a person do you think?-what moral a bligation do you fulfill in your community?-what you can do to/what you can do? true ior false once credit is established, most people should plan on having at least eight to ten credit cards at any given time Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 Smores, a Taste of Multivariate Normal Distribution Smores Company store makes chocolate (Xi), marshmallow (X2), and graham cracker (Xs). Assume that the profit (in millions) for selling these smores materials follow a multivariate uormal ditributim with parameters 1 0.3 0.3 and = 0.31 0 0.3 01 What is the probability that 1. the profit for selling chocolate is greater than 6 millions? 2. the profit for selling chocolate is greater than 6 millions, given the sales of marshmallow is 5 million and the sales of graham cracker is 5 mllion? 3. P(3X1-1X2 + 3X3 > 20)? suppose the temperature of the input reservoir does not change. as the sink temperature is lowered, the efficiency of the engine_____ g a random sample of 100 automobile owners in the state of alabama shows that an automobile is driven on average 23,500 miles per year with a standard deviation of 3900 miles. assume the distribution of measurements to be approximately normal. a) construct a 99% confidence interval for the average number of miles an automobile is driven annually in alabama. Do the following statements describe actin, myosin, both of the proteins or neither of the proteins?contains a binding site for calciumfound in the I bandexists in a globular (G) form and a filamentous (F) formContains a binding site for ATPis a component of the thin filamentis a component of the thick filamentAnswers:A. actinB. myosinC. neither actin nor myosinD. both actin and myosin The Senate and House of Representatives together have how manymembers? inflation-indexed treasury bonds are intended for investors who wish to ensure that the returns on their investments keep up with the increase in prices over time. a. true b. false God The midwives refused to kill Hebrew babies. Onemidwife was named(1:15) a person recently was diagnosed with social anxiety disorder. a best guess is that the person is in school and is likely than average to have a close relative with social anxiety disorder. group of answer choices elementary; more high; more elementary; less high; less candidates who are behind in election polls often use as a way to gain momentum and make the race competitive. AA contestant on a game show has a 1 in 6 chance of winning for each try at a certain game. Which probability models can be used to simulate the contestants chances of winning?Select ALL of the models that can be used to simulate this event.A) a fair six-sided number cubeB) a fair coinC) a spinner with 7 equal sectionsD) a spinner with 6 equal sectionsE) a bag of 12 black chips and 60 red chips A 200 g air-track glider is attached to a spring. The glider is pushed 10.0 cm against the spring, then released. A student with a stopwatch finds that 10 oscillations take 12.0 s. What is the spring constant? A 200 g ball is tied to a string. It is pulled to an angle of 8.00degree and released to swing as a pendulum. A student with a stopwatch finds that 10 oscillations take 12.0 s. How long is the string? ebay is an example of a(n) b2b? site that allows buyers to bid and compete for a variety of new and used goods -made up of1. I take refuge in the Buddha (=the awakened one- acknowledge the Buddha as the supreme example of the potential of human life)2. I take refuge in the Dharma (=the teachings of the Buddha- to do this is to recognize it as the path to enlightenment and an end to suffering)3. I take refuge in the Sangha (=the Buddhist community- to recognize one's reliance on the Buddhist community-and in particular, the order of the monks-as the custodian of the Dharma, responsible for its preservation and transmission) In an enveloped virus, the ___ found in the viral envelope are derived from the host cell whereas the ___ found in the viral envelope are generally virally encoded.