Answer:
1 ) Δs ( entropy change for hot block ) = - Q / th ( -ve shows heat lost to cold block )
Δs ( entropy change for cold block ) = Q / tc
∴ Total Δs = ΔSc + ΔSh
= Q/tc - Q/th
2) ΔSdecomposition = Δh / Temp = ( 181.6 * 10^3 / 773 ) = 234.928 J/k
Explanation:
1) To show that heat flows spontaneously from high temperature to low temperature
example :
Pick two(2) solid metal blocks with varying temperatures ( i.e. one solid block is hot and the other solid block is cold )
Place both blocks for time (t ) in an insulated system to reduce heat loss or gain to or from the environment
Check the temperature of both blocks after time ( t ) it will be observed that both blocks will have same temperature after time t ( first law of thermodynamics )
Δs ( entropy change for hot block ) = - Q / th ( -ve shows heat lost to cold block )
Δs ( entropy change for cold block ) = Q / tc
∴ Total Δs = ΔSc + ΔSh
= Q/tc - Q/th
2) Entropy change for Decomposition of mercuric oxide
2HgO (s) → 2Hg(l) + O₂ (g)
Δs = positive
there is transition from solid to liquid and the melting point of mercury ( the point at which reaction will take place ) = 500⁰C
hence ΔSdecomposition = S⁻ Hg - S⁻ HgO =
Δh of reaction = 181.6 KJ
Temp = 500 + 273 = 773 k
hence ΔSdecomposition = Δh / Temp = ( 181.6 * 10^3 / 773 ) = 234.928 J/k
#6 and #7. How many carbon atoms are in a mixture of 7.00 mol c2F2 and 0.400 mol carbon dioxide and also #7
Answer:
#6 8.67x10²⁴ atoms
#7
1. Atom
2. Formula unit
3. Molecule
4. Ion
Explanation:
#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:
7.00 mol C₂F₂ * 2 = 14.00 mol CAs for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.
We calculate the total number of C moles:
14.00 mol + 0.400 mol = 14.4 mol CFinally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:
14.4 mol * 6.023x10²³ atoms/mol = 8.67x10²⁴ atoms#7
1. Radon - Atom (Ra)2. Formula unit (It is a crystalline solid, BaBr₂)3. Molecule (NH₃)4. Ion (It has a formal charge, +2)Please help me ASAP in my final project I am ready to pay 20$
Answer:
$20
ASAP PROJECT
what is the machine used to check melting point called?
Answer:
Melting-point apparatus
If I have 25g of Sodium, how much Sodium Chloride will I theoretically create?
O 50g NaCl
0 58.3g NaCl
O 63.7g Naci
0 35.4g NaCl
Answer:
64 g
Explanation:
Step 1: Write the balanced equation
2 Na + Cl₂ ⇒ 2 NaCl
Step 2: Calculate the moles corresponding to 25 g of Na
The molar mass of Na is 22.98 g/mol.
25 g × 1 mol/22.98 g = 1.1 mol
Step 3: Calculate the moles of NaCl formed from 1.1 moles of Na
The molar ratio of Na to NaCl is 2:2. The moles of NaCl formed are 2/2 × 1.1 mol = 1.1 mol.
Step 4: Calculate the mass corresponding to 1.1 moles of NaCl
The molar mass of NaCl is 58.44 g/mol.
1.1 mol × 58.44 g/mol = 64 g
PLEASE HELP!!
How does temperature, agitation, and particle size affect solubility?
Answer:
At higher temperatures, particles move faster and collide more, increasing solubility rates.
Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute
The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.
Explanation:
Que es la actividad física y en qué mejora
Pls pls help me me pls
Answer:
Danger
Explanation:
Draw the Lewis structure for the polyatomic hydronium H3O cation. Be sure to include all resonance structures that
Answer:
Lewis structure of Hydronium ion is shown below :
Explanation:
Lewis structure : It is a representation of valence electrons on the atoms in a molecule
Here , Hydronium ion is given , which contains 1 atom of oxygen and 3 atoms of hydrogen .
Oxygen has a total of 6 valence electrons and hydrogen contains 1 valence electron .
Oxygen share its 3 valence electrons with 3 hydrogen atoms and left with 3 valence electrons. From these three valence electrons of oxygen atom two electrons will be shown as a pair of electrons on oxygen atom but a single electron can not be shown . So , to simplify this, one positive charge is shown overall .
Resonance structure will be same as the hybrid structure because all three atoms are same , that is hydrogen .
the force of attraction between non polar molecules are what
Answer:
dispersion force
Explanation:
Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these
Answer:
b. glass and charcoal
Explanation:
Step 1: Given data
Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mLStep 2: Determine which material will float in molten lead
Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.
C3H8 is ________
A. unsaturated
B. saturated
Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.
a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O
The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
What is the Urms?The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.
Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
Learnmore about Urms: https://brainly.com/question/365923
find out the equivalent weight of Ca(OH)2
Answer:
The equivalent weight of calcium hydroxide is 1/2 he mass of a mol of calcium hydroxide. 1 mol Ca(OH)2 = 74 grams Ca(OH)2 ; 1 equivalent Ca(OH)2 = 37 grams Ca(OH)2......
Explanation:
HOPE IT HELPS YOU
Predict the products of each reaction, and whether the solution at equilibrium will be acidic, basic, or neutral.1. P4O10 + 6H2O (l)---->2. Na2O + H2O(l) ------>3. N2O5 + 3H2O (l)------>
Answer:
For 1: The product is phosphoric acid and the solution is acidic in nature.
For 2: The product is sodium hydroxide and the solution is basic in nature.
For 3: The product is nitric acid and the solution is acidic in nature.
Explanation:
For the given options:
(1): When diphosphorus pentoxide reacts with water, it leads to the formation of phosphoric acid, which makes the solution acidic in nature.
The chemical equation for the reaction follows:
[tex]P_4O_{10}+6H_2O(l)\rightarrow 4H_3PO_4(aq)[/tex]
(2): When disodium oxide reacts with water, it leads to the formation of sodium hydroxide, which makes the solution basic in nature.
The chemical equation for the reaction follows:
[tex]Na_2O+H_2O(l)\rightarrow 2NaOH(aq)[/tex]
(3): When dinitrogen pentoxide reacts with water, it leads to the formation of nitric acid, which makes the solution acidic in nature.
The chemical equation for the reaction follows:
[tex]3N_2O_5+3H_2O(l)\rightarrow 6HNO_3(aq)[/tex]
Which one of the following molecule is planer?
a. NF3 c. PH3
b. BH3 d. NCl3
Answer:
option a
hope helps you
have a great day
To what volume (in mL) would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN?
Answer:
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
Explanation:
Dilution is the reduction of the concentration of a chemical in a solution and consists simply of adding more solvent.
In a dilution the amount of solute does not vary. But as more solvent is added, the concentration of the solute decreases, as the volume (and weight) of the solution increases.
In a solution it is fulfilled:
Ci* Vi = Cf* Vf
where:
Ci: initial concentration Vi: initial volume Cf: final concentration Vf: final volumeIn this case:
Ci= 1.40 MVi= 20 mLCf= 0.088 MVf= ?Replacing:
1.40 M* 20 mL= 0.088 M* Vf
Solving:
[tex]Vf=\frac{1.40 M* 20 mL}{0.088 M}[/tex]
Vf= 318.18 mL
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.
a. True
b. Flase
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
Name the compound CuI2
Answer:
Copper iodide. I think
Answer:
copper iodide(Cul2)hope it helps
stay safe healthy and happy..Identify the options below that are results of adding a catalyst to a chemical system.
The reaction rates are increased.
The reaction quotient is unaffected.
The reaction quotient decreases.
The equilibrium constant is unaffected.
Answer:
The correct options are a, b and d
Explanation:
A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's principle explains how a substance or an "action" can affect a reaction in equilibrium.
The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.
However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).
The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.
What is a catalyst?A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.
The catalyst takes part in the reaction but did not consume in the chemical reaction.
The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.
Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.
Learn more about catalysts, here:
https://brainly.com/question/17052831
Please please help help please
Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:
Answer:
Calculate the moles of N2 molecules in 3.94 grams of nitrogen.
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.
Explanation:
Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT
Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol
Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:
3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:
5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.
Vocabulary: dipole, dipole-dipole force, dipole-induced dipole force, electronegativity, intermolecular force, ionic bond, London dispersion force, molecule, nonpolar, nonpolar covalent bond, partial charges, polar, polar covalent bond, valence electron Prior Knowledge Questions (Do these BEFORE using the Gizmo.) 1. A big bully is having a tug-of-war with a small child. There is a ball attached to the middle of the rope. Toward whom will the ball move
Answer:
Towards the big bully
Explanation:
If a big bully and a small child are involved in a thug of war, it is clear that the bully is stronger than the child and he/she will pull the rope used in the thug of war with a greater force.
By so doing, the ball attached at the centre of the rope will naturally be drawn towards the stronger bully.
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Answer:
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Explanation:
According to IUPAC rules, the name of a compound is:
Prefix+root word+suffix
1) Select the longest carbon chain and it gives the root word.
2) The substituents give the prefix.
3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.
The structure of the given compounds are shown below:
If 0.250 L of a 5.90 M HNO₃ solution is diluted to 2.00 L, what is the molarity of the new solution?
Answer:
0.74 M
Explanation:
From the question given above, the following data were obtained:
Molarity of stock solution (M₁) = 5.90 M
Volume of stock solution (V₁) = 0.250 L
Volume of diluted solution (V₂) = 2 L
Molarity of diluted solution (M₂) =?
The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:
M₁V₁ = M₂V₂
5.90 × 0.250 = M₂ × 2
1.475 = M₂ × 2
Divide both side by 2
M₂ = 1.475 / 2
M₂ = 0.74 M
Thus, the molarity of the diluted solution is 0.74 M
Di- n- pentyl ether can be converted to 1- bromopentane by treatment with HBr through essentially a(n) ________ mechanism.
Answer:
SN1 mechanism
Explanation:
The mechanism of this reaction is shown in the image attached.
The Di- n- pentyl ether is first protonated. The CH3(CH2)4OH is now a good leaving group as shown.
The attack of the bromide ion on the cation formed completes the mechanism to yield 1- bromopentane as shown in the mechanism.
the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces
Answer:
d. van der waals force
Explanation:
Van der Waals force :
the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.
For the following reaction, 11.6 grams of sulfur are allowed to react with 23.8 grams of carbon monoxide .
sulfur(s) + carbon monoxide(g) sulfur dioxide(g) + carbon(s)
What is the maximum amount of sulfur dioxide that can be formed?
What is the formula for the limiting reagent?
What amount of the excess reagent remains after the reaction is complete?
Answer:
S + 2CO = SO2 + 2C
First, look for the amount of substance of sulfur:
n(S) = m / M
n(S) = 14.8 g/32 g / mol = 0.4625 mol
n(CO) = m (CO) / M (CO)
M(CO) = 12 + 16 = 28 g/mol
n(CO) = 19.9 g/28 g/mol = 0.71 mol
S in excess, so for calculating we take CO:
n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol
m(SO2) = M(SO2)*n(SO2)
M(SO2) = 32 + 16*2 = 64 g/mol
m(SO2) = 64 g/mol * 0.355 mol = 22.74 g
The metal tantalum becomes superconducting at temperatures below 4.483 K. Calculate the temperature at which tantalum becomes superconducting in degrees Celsius.
Answer:
The correct answer is "-268.667°C".
Explanation:
Given:
Temperature,
= 4.483 K (below)
Now,
The formula of temperature conversion will be:
⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]
By putting the values, we get
⇒ [tex]=4.483-273.15[/tex]
⇒ [tex]=-268.667^{\circ} C[/tex]
Thus the above is the correct answer.
>
Which statement describes an electron?
EEEE
It has a positive charge and is located in the nucleus.
O It has a positive charge and is located in orbitals around the nucleus.
It has a negative charge and is located in the nucleus.
O It has a negative charge and is located in orbitals around the nucleus.
Answer:
It has a negative charge and is located in orbitals around the nucleus
Explanation:
The statement describes an electron is " It has a negative charge and is located in orbitals around the nucleus."
What is electron?The electron would be a subatomic particle with a negatively one elementary charge electric charge.
What is nucleus?Protons, that have a positive charge, as well as neutrons, which have no electrical charge, make up the nucleus. Quarks were subatomic particles that make up protons but also neutrons.
Electrons were present surrounding the atom's nucleus, in contrast to protons as well as neutrons, that are contained within the nucleus at its core. Negative electrons were drawn to the positive nucleus since the electric charges of opposite polarity attract one another.
To know more about electrons and nucleus.
https://brainly.com/question/23366064
#SPJ3
write any two things that should be remembered while writing chemical equation
Answer:
the product and the reactant must be balanced
if u are required to give the mechanism if the reaction it must be written