1 If a = p^1/3-p^-1/3
prove that: a^3 + 3a = p - 1/p​

Answers

Answer 1

Hello, please consider the following.

We know that

[tex]a = p^{\frac{1}{3}}-p^{-\frac{1}{3}}\\\\=p^{\frac{1}{3}}-\dfrac{1}{p^{\frac{1}{3}}}[/tex]

And we can write that.

[tex](p-\dfrac{1}{p})^3=(p-\dfrac{1}{p})(p^2-2+\dfrac{1}{p^2})\\\\=p^3-2p+\dfrac{1}{p}-p+\dfrac{2}{p}-\dfrac{1}{p^3}\\\\=p^3-\dfrac{1}{p^3}-3(p-\dfrac{1}{p})[/tex]

It means that, by replacing p by [tex]p^{1/3}[/tex]

[tex](p^{1/3}-\dfrac{1}{p^{1/3}})^3=p-\dfrac{1}{p}-3(p^{1/3}-\dfrac{1}{p^{1/3}})\\\\\\\text{ So }\\\\a^3=p-\dfrac{1}{p}-3a\\\\<=>\boxed{ a^3+3a=p-\dfrac{1}{p} }[/tex]

Hope this helps.

Do not hesitate if you need further explanation.

Thank you


Related Questions

The relative frequency approach to probability uses long term relative frequencies, often based on past data.
a. True
b. False

Answers

Answer:

True

Step-by-step explanation:

Relative frequency is the ratio of the occurrence of a singular event and the total number of outcomes. This is a tool that is often used after you collect data. You can compare a single part of the data to the total amount of data collected.

For example, if a particular machine produces 50,000 widgets one at a time, and 5,000 of those widgets are faulty, the probability of that machine producing a faulty widget is approximately 5,000 out of 50,000, or 0.10.

Describe how the graph of y= x2 can be transformed to the graph of the given equation. y = (x - 13)2 + 6

Answers

Answer:

Step-by-step explanation:

if we shift 13 units right and 6 units down we get the reqd. graph.

Answer:

see explanation

Step-by-step explanation:

Given the graph of f(x) then f(x + k) is a horizontal translation of f(x)

• If k > 0 then shift left by k units

• If k < 0 then shift right by k units

Thus y = (x - 13)² represents a shift to the right of 13 units

Given f(x) then f(x) + c is a vertical translation of f(x)

• If c > 0 then shift up by c units

• If c < 0 then shift down by c units

Thus

y = (x - 13)² + 6 is the graph of y = x² translated 13 units right and 6 units up

What is the value of n

Answers

Answer:

9 + 18 = 27

27 + n + 1

= n = 27 - 1 = 26.

n = 26

9 + 18 + 26 + n + 7 =

53 + n + 7

53 + 7 + n

60 + n = 360

n = 360 - 60 = 300

so, n 300

so = 9, 18, 300, 26

Beer shelf life is a problem for brewers and distributors because when beer is stored at room temperature, its flavor deteriorates. When the average furfuryl ether content reaches 6 μg per liter, a typical consumer begins to taste an unpleasant chemical flavor. At α = .05, would the following sample of 12 randomly chosen bottles stored for a month convince you that the mean furfuryl ether content exceeds the taste threshhold? 8.92 6.99 5.54 5.73 6.38 5.51 6.45 7.50 8.48 5.56 6.90 6.46

Answers

Answer:

As the calculated value of t =2.1698 is greater than t (0.05,11) = 1.796 reject H0 . It means  chosen bottles stored for a month convince you that the mean furfuryl ether content exceeds the taste threshhold.

Step-by-step explanation:

We formulate our null and alternative hypotheses as

H0 u≤ 6 ug     Ha : u > 6 ug

The significance level ∝ = 0.05

The test statistic used is

t = X` - u / s/ √n

which if H0 is true, has the students' t test with n-1 = 11 degrees of freedom.

The critical region t > t (0.05,11) = 1.796

We compute the t value from the data

Xi               Xi²

8.92         79.5664

6.99          48.8601

5.54          30.6916

5.73           32.8329

6.38           40.7044

5.51            30.3601

6.45           41.6025

7.50           56.25

8.48           71.9104

5.56          30.9136

6.90          47.61

6.46          41.7316          

80.42         553.0336      

Now x` = ∑x/ n = 80.42/12 = 6.70

S²= 1/n-1 ( ∑(xi- x`)²= 1/11 ( 553.034 - (80.42)²/12)

= 1/11 (553.034-538.948) = 1.2805

s= 1.1316

Putting the values in the test statistics

t = X` - u / s/ √n = 6.70- 6 / 1.1316 / √12

= 2.1698

The critical region t > t (0.05,11) = 1.796

As the calculated value of t =2.1698 is greater than t (0.05,11) = 1.796 reject H0 . It means  chosen bottles stored for a month convince you that the mean furfuryl ether content exceeds the taste threshhold.

URGENT, PLEASE HELP! (1/5) -50 POINTS- !please no wrong answers for the points.! A) [tex]y = 6x - \frac{11}{8}[/tex] B) [tex]y = -6x - 2[/tex] C) [tex]y = \frac{3}{2} x - \frac{1}{8}[/tex] D) [tex]y = -3x + 9[/tex]

Answers

Answer:

C y = 3/2x - 1/8

Step-by-step explanation:

We know that the line has a positive slope, because it goes up from the lower left to upper right

We can eliminate B and D

For y = 6x - 11/8

A slope of 6 is very steep

Putting in 6

y = 6*6 -approximately 1 = 35 so the value at 3 would be 35

This is too big

Checking C

y = 3/2(6) - 0 = 9 or 9  This would be about right

Three students were given the expression shown and were asked to take a common factor out of two of the terms. Use the drop-down menus to complete the statements about whether each student's answer is an equivalent expression. Then choose an expression that is equivalent.

Answers

Answer:

Step-by-step explanation:

Given: 4 - 9x +21

Factorizing this expression, we have;

              4 -3(3x - 7)

i. Chang's expression: 4 - 3(3x + 7)

This is not an equivalent expression, because by expansion of the bracket, the expression gives: 4 -9x -21

ii. Benjamin's expression: 4 + 3(3x + 7)

This is not an equivalent expression, because by expansion of the bracket, the expression gives: 4 +9x +21

iii. Habib's expression: 4 + 12x

This is not an equivalent expression, because the expression is not related to the given question

Comparing the three student's answers with the appropriate expression, none of the student's is an equivalent expression.

This expression that is  equivalent to the given question is;

            4 -3(3x - 7) = 4 -9x + 21

Answer:

1,2,4

Step-by-step explanation:

What is the domain of h?

Answers

Answer:

{-2, -1, 1, 5, 6}

Step-by-step explanation:

The domain includes the five x-values (inputs):  {-2, -1, 1, 5, 6}

Answer:

The x-values -2, -1,1,5 and 6

Step-by-step explanation:

Travis has a budget of $300 that he can spend on perennial flowers and at least 6 annual flowers. Perennial flowers are 18 dollars per plant and annual flowers are 15 dollars per plant. Let x be the amount spent on perennial flowers, and let y be the amount spent on annual flowers. What system of inequalities describes this situation?

Answers

Answer:

18x + 15y ≤ 300x ≥ 0; y ≥ 6

Step-by-step explanation:

Variables are defined in the problem statement.

  18x +15y ≤ 300 . . . . total budget

  y ≥ 6 . . . . . . . . . . . .  minimum number of annuals

  x ≥ 0 . . . . . number of perennials cannot be negative

This system of inequalities describes the situation.

A taste test asks people from Texas and California which pasta they prefer, brand A or brand B. The table shows the results. A person is randomly selected from those tested. What is the probability that the person is from Texas, given that the person prefers Brand B? PLEASE HELP! I'll name you Brainliest if you're answer is the best!

Answers

Answer:

A

Step-by-step explanation:

It would be A because there are 45 people in Texas that prefer brand B. There are 105 people in total that prefer brand B. 45/105 is .42857... so rounded it would be .43, therefore A. I hope this helps.

Answer:

A

Step-by-step explanation:

Randy is walking home from school. According to the diagram above, what is his total distance from school to home? Show your work and include units. If he had a jet pack, would you use distance or displacement? Why?

Answers

Answer:

First, when he walks, we can see in the image that between the school and his house he must walk 4 times a distance of 0.5km, so this is a total of 4¨*0.5km = 2km.

Then he needs to walk 2km.

Now if he has a jet-pack, he can ignore the buildings and just take the shorter path, here we can draw a triangle rectangle, in such a way that the hypotenuse of this triangle is the distance between the home and the school.

One of the catheti is the vertical distance (two blocks of 0.5km, so this catheti has a length of 2*0.5km = 1km), and the other one is the horizontal distance, also 1km.

The actual distance of this path is given by the Pythagorean's theorem:

A^2 + B^2 = H^2

Where A and B are the cathetus, and H is the hypotenuse, then:

H^2 = 1km^2 + 1km^2

H = (√2)km = 1.41km.

Now, in the case that he has a jet-pack, he can actually go to the school using this hypotenuse line as his path, in this case the distance and the displacement would be the same.

This is because the definitions of distance and displacement are:

Distance: "how much ground an object has covered"

Displacement: "Difference between the final position and the initial position"

When he walks, the distance is 2km and the displacement is 1.41km , but when he uses the jet pack, the distance is equal to the displacement, both are 1.41km.

Answer and Step-by-step explanation:

The first thing is we can see in the image, when he walks, that between the house and his school he has to walk four times a distance of 0.5 km.  The result of this is a total of 4¨*0.5 km = 2 km.  The second thing is that he must walk 2 kilometers.  On the other hand, if he has a jetpack, he can simply take the shorter path by ignoring all the buildings.  This idea is where we can draw a triangular rectangle on the map in a way so that the hypotenuse of the triangle is the distance between the school and the home.  As for the Catheti, it is a vertical distance which in this case is two blocks of 0.5 km.  The result is that these catheti have a length of 2*0.5 km = 1 km.  The other is the distance of the horizontal line, which is 1 km.  The absolute distance of this path is given by Pythagorean's theorem, which is A^2 + B^2 = H^2.  Here, A and B are the cathetus, and H is the hypotenuse, then, H^2 = 1 km^2 + 1 km^2.  As well, H = (√2)km = 1.41 km.  Currently, in the situation where he has a jetpack, he can literally fly to the school utilizing this hypotenuse line for the path he would need to follow.  For this specific situation, the displacement, and the distance would be the exact same.  The reason for this is that the definitions of displacement and distance are displacement is the difference between the final position and the initial position and distance is how much area an item has covered.  Also, when he walks, the distance is 2 km and the displacement is 1.41 km.  Also, when he utilizes the jet pack, the distance is equal to the displacement.  Both of these are 1.41 km.

This table shows a linear relationship.
The slope of the line is ?

Answers

Answer:

2

Step-by-step explanation:

2,8 to 4,12 has a rise of 4 and a run of 2.

4/2 = 2

The slope is 2.

Remember rise/run!

Answer:

2

Step-by-step explanation:

We take take two points and use the slope formula

m = (y2-y1)/(x2-x1)

m = (12-8)/(4-2)

   = 4/2

   = 2

Question 2: Jamie has a jar of coins containing the same number of nickels, dimes and quarters. The total value of the coins in the jar is 13.20. How many nickels does Jamie have?

Answers

Answer:

?

Step-by-step explanation:

Answer:

33

Step-by-step explanation:

Let "x" be the number of nickels, of dimes, and of quarters.

The value of the nickels is 5x cents.

The value of the dimes is 10x cents

The value of the quarters is 25x cents.

Equation:

Value of nickels + Value of dimes + Value of quarters =1320 cents

5x + 10x + 25x = 1320

Sove for "x". Then you will know the number of each coin.

Which equation represents this statement: A number minus 6 is 168? 6 − n = 168 n ÷ 6 = 168 n − 6 = 168 6n = 168

Answers

Answer:n-6=168

Step-by-step explanation:

The statement starts with the variable first.

Answer:

n - 6 = 168.

Step-by-step explanation:

Let's say that the value of the number is n.

n minus 6 is 168, so n - 6 = 168.

n - 6 = 168

n = 174.

Hope this helps!

Which relation is a function?

Answers

The number two is a function

First rule of function: for each element of A there is one and only one element of B

For example, in the first one -5 is "collegated" to -2 and 3. So this isn't a function.

Naturally,  every element of B can have more element of A

How do you find volume for prisms?

Answers

Answer:

V =140 units^3

Step-by-step explanation:

The volume of the prism is V = Bh

Where B is the area of the base and h is the height

B is the area of the triangle

B = 1/2 (5 * 7) = 35/2

V = 35/2 * 8

V =140 units^3

Find the rectangular coordinates of the point with the given polar coordinates.

Answers

Answer:

[tex]( - \sqrt{3} \: an d \: 1)[/tex]

Bighorn sheep are beautiful wild animals found throughout the western United States. Data for this problem are based on information taken from The Desert Bighorn, edited by Monson and Sumner 9University of Arizona Press). Let x be the age of a bighorn sheep (in years), and let y be the mortality rate (percent that die) for this age group. For example, x = 1, y = 14 means that 14% of the bighorn sheep between 1 and 2 years old died. A random sample of Arizona bighorn sheep gave the following information:
x 1 2 3 4 5
y 14 18.9 14.4 19.6 20.0
∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275
(a) Draw a scatter diagram.
(b) Find the equation of the least-squares line, and plot the line on the scatter diagram of part (a).
(c) Find the correlation coefficient r. Find the coefficient of determination . What percentage of variation in y is explained by the variation in x and the least squares model?

Answers

Answer:

The answer and explanation are below

Step-by-step explanation:

i followed the data that was given in the question.

∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275

a.)  please refer to the attachment for the scatter diagram. Y was plotted against X.

b. The equation is given as:

Y = b₁ + b₀X

∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275

b₁ = n∑xy - (∑x)(∑y)/n(∑x²) - (∑x)²

b₁ = 5 x 275 - 15 x 87.3/5 x 55 - (15²)

= 1375-1309.5/275-225

= 65.5/50

= 1.31

b₀ = 87.3/5 - 1.31(15/5)

= 87.3/5 - 1.31x3

= 13.53

the regression line is

Y = 13.53 + 1.31X

please refer to the attachment for the diagram for the regression line.

c. we are required to find r.

r = n∑XY - (∑X)(∑Y)/√n∑X²-(∑X)² × √n∑y²-(∑y)²

∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275

inserting these values:

r = 5 x 275-(15)(87.3)/√275-225 x √7848.85 - 7621.29

= 65.5/106.69

= 0.6139

Coefficient of determination = r²

r = 0.6139

r² = 0.3769 = 37.69%

Therefore 37.69% variation in y is explained by variation in x and the least square model.

HELP PRECALC NEED IN PROOF FORM

Answers

Hello, please consider the following.

We know the following, right ?

[tex](\forall a, b \in \mathbb{R}) \left( sin(a+b)=sin(a)sin(b)+cos(a)cos(b) \right)[/tex]

So, here, it gives.

[tex]Asin(\omega t+\phi)=Asin(\phi){\sf \bf sin(\omega t)}+Acos(\phi){\sf \bf cos(\omega t)}\\\\=c_2{\sf \bf sin(\omega t)}+c_1{\sf \bf cos(\omega t)}\\\\\text{ *** where }c_2=Asin(\phi) \text{ and } c_1=Acos(\phi) \text{ ***}[/tex]

Do not hesitate if you need further explanation.

can anyone show me this in verbal form?

Answers

Answer:

2 * (x + 2) = 50

Step-by-step explanation:

Let's call the unknown number x. "A number and 2" means that we need to add the numbers, therefore it would be x + 2. "Twice" means 2 times a quantity so "twice a number and 2" would be 2 * (x + 2). "Is" denotes that we need to use the "=" sign and because 50 comes after "is", we know that 50 goes on the right side of the "=" so the final answer is 2 * (x + 2) = 50.

Use a double angle identity to rewrite the formula r(Θ)=[tex]1/16v^2sin(theta)cos(theta)[/tex]

Answers

Answer:

1/32v²sin2θ

Step-by-step explanation:

Given the expression r(theta) = 1/16v²sinθcosθ

According to double angle of trigonometry identity;

Sin2θ = sin(θ+θ)

Sin2θ = sinθcosθ + cosθsinθ

Sin2θ = 2sinθcosθ

sinθcosθ = sin2θ/2 ... **

Substituting equation ** into the question

1/16v²sinθcosθ = 1/16v²(sin2θ/2)

1/16v²sinθcosθ = 1/2×1/16v²(sin2θ)

1/16v²sinθcosθ = 1/32v²sin2θ

Hence using the double angle identity, the equivalent expression is 1/32v²sin2θ

3 1/2 ft into inches

Answers

Answer:

42 inches

Step-by-step explanation:

1 ft = 12 inch

Answer:

42 inches.

Step-by-step explanation:

Unit of measurement:

1 foot = 12 inches.

3 ft x 12 inches = 36 inches.

1/2 foot x 12 inches = 12/2 = 6 inches.

36 inches + 6 inches = 42 inches

42 inches is your answer.

~

A lime passes through the point (5,7) has a slope of 3. Which of the following gives the equation of the line

Answers

Answer:

Hey There!! The answer to this is (6, 10) There are no answer choices, so I will just list a few. But first, we need to create the equation.

Plugging in (5,7) into the equation y=mx+b, we can solve for b since all of the other variables are known, with m=3 as the slope.

So, 7=3*5+b

7=15+b

b = -8

y=3x-8 is your equation.

So, you can plug in any value of x you get a certain value of y.

(1,-5), (2,-2), (3,1), (4,4), (5,7), (6,10), (7,13) Thus, for The correct option (6, 10). Hope It Helped!~ ♡

ItsNobody~ ☆

Answer:

y=3x-8

Step-by-step explanation:

We can start by writing the equation of the line in point-slope form.

Point-slope form is y-y1=m(x-x1)

This is where:

y1= y-coordinate of a given point on the line

m= slope of the line

x1= x-coordinate of a given point on the line

The given point in this example is (5,7)

A point is (x-coordinate, y-coordinate)

Therefore,

y1=7

m=3

x1=5

Plug that into the form.

y-7=3(x-5)

We can now simplify that to slope-intercept form,since that is most standard.

y-7=3(x-5)

Start by distributing the right side.

y-7=3x-15

Add 7 to both sides.

y=3x-8

find the value of x? please help​

Answers

Answer:

49

Step-by-step explanation:

With these types of problems, you have to subtract the outer and inner values and then divide by 2. So, (125-27)/2 = 49. Hope this helps!

the value of x is 49

Fuller bought 4 cantaloupes at the grocery store. Each cantaloupe weighed between 4.5 and 6.3 pounds. Fuller estimates a reasonable weight of all the cantaloupes to be 21.2 pounds.

Answers

Answer:

Step-by-step explanation:

3w + 2c = 32

4w + 3c = 44

Multiply the 1st equation by 4 and 2nd equation by 3, we get:

12w + 8 c = 128

12w + 9 c = 132

Subtracting the top equation from the bottom equation, we get: c = 4

Substituting c = 4 in any one of the above equations and solving, we get: w = 8

Therefore, weight of 2w + 1c = 2(8) + 4 = 20 pounds (Answer)

You roll two fair dice, a green one and a red one. (a) What is the probability of getting a sum of 6? (Enter your answer as a fraction.) (b) What is the probability of getting a sum of 10? (Enter your answer as a fraction.) (c) What is the probability of getting a sum of 6 or 10? (Enter your answer as a fraction.) Are these outcomes mutually exclusive? Yes No

Answers

Answer:

5/36 ; 1/12 ; 2/9 ; yes

Step-by-step explanation:

Given the following :

Roll of two fair dice : green and red

Probability = (number of required outcomes / number of total possible outcomes)

(a) What is the probability of getting a sum of 6?

Number of required outcomes = 5

P(sum of 6) = 5/36

b.) What is the probability of getting a sum of 10?

Number of required outcomes = 3

P(sum of 10) = 3 / 36 = 1/12

c.) What is the probability of getting a sum of 6 or 10?

P(getting a sum of 6) + P(getting a sum of 10)

(5/36) + (1/12) = (5 + 3) / 36

= 8/36 = 2/9

The events are mutually exclusive because each event cannot occur at the same time.

What is the solution to the system of equations? -2x-3y+z=-6, z=6, 3x-y+z=13

Answers

Answer:

B is the correct answer.

Step-by-step explanation:

-2x+3y+z=-6

z=6

-2x+3y+6=-6

-2x+3y=-12

-2(3)+3(2)

-6+6=0 A is incorrect

-2(3)+3(-2)=-12

-6-6=-12

B is the correct answer.

I am not going to show C or D, because you have the right answer. Hope this helps you. Thank you.

Maxwell Communications paid a dividend of $1.20 last year. Over the next 12 months, the dividend is expected to grow at 13 percent, which is the constant growth rate for the firm (g). The new dividend after 12 months will represent D1. The required rate of return (Ke) is 17 percent. Compute the price of the stock (P0). (Do not round intermediate calculations. Round your answer to 2 decimal places.)

Answers

Answer:

The  price of the stock is [tex]P_o = \$ 33.9[/tex]

Step-by-step explanation:

From the question we are told that

     The dividend is  [tex]k = \$ 1.20[/tex]

     The expected growth rate is  [tex]r = 13\% = 0.13[/tex]

      The required rate of return is  [tex]K_e = 17 \% = 0.17[/tex]

The new dividend after 12 months is mathematically represented as

          [tex]D_1 = k * (1 + r)[/tex]

substituting values

           [tex]D_1 = 1.20 * (1 + 0.13)[/tex]

           [tex]D_1 = \$ 1.356[/tex]

The  price of the stock the price of stock is mathematically represented as

        [tex]P_o = \frac{D_1}{ K_e - r }[/tex]

substituting values

       [tex]P_o = \frac{ 1.356}{ 0.17 - 0.13 }[/tex]

       [tex]P_o = \$ 33.9[/tex]

   

Which is the best definition of mathematical proof? a/A sequence of statements that demonstrates the truth of an assertion. b/Statements that show the assertion is false using a counterexample. c/A paragraph that always has three parts and shows that an assertion is true. d/Statements in any order that show that an assertion is true.

Answers

Answer:

A. A sequence of statements that demonstrates the truth of an assertion.

Step-by-step explanation:

Mathematical proofs are a series of statements in order that help prove that something is true.

Proofs do not prove that something is false, they are not always 3 parts, and they are not in any order, because they have to be in an organized sequence.

So, A is correct.

Answer:

A sequence of statements that demonstrates the truth of an assertion.

Step-by-step explanation:

A speedboat moves at a rate of 25 km/hr in still water. How long will it take
someone to ride the boat 87 km downstream if the river's current moves at a rate of
4 km/hr?

Answers

Answer:

3 hours

Step-by-step explanation:

Downstream, the speeds add up:

25 + 4 = 29 km/h

It will take:

87/29= 3 hrs

To ride 87 km.

Theresa bought 2 pineapples for $6. She be wants to find the constant of proportionality in terms of dollars per pineapple. She modeled this proportional relationship on a number line diagram, as shown.

Part A

Using the diagram, find the constant of proportionality in terms of dollars per pineapple.

Answers

Answer:

$3 per pineapple

Step-by-step explanation:

Hey there!

If 2 pineapples are $6,

6 / 2 = 3

So 1 pineapple is $3.

Hope this helps :)

Answer:

3 dollars for 1 pineapple

Step-by-step explanation:

well 2 pinapples is 6 bucks. so 2x=6, and to get x, just divide each side by 2. 6/2=3.

Other Questions
Why must you include the water soluble vitamins in your daily diet? They cannot be stored by the body because they are water soluble and are eliminated daily. They help carry oxygen in the blood They help digest fats. They help build body tissue. Expectant mothers many times see their unborn child for the first time during an ultrasonic examination. In ultrasonic imaging, the blood flow and heartbeat of the child can be measured using an echolocation technique similar to that used by bats. For the purposes of these questions, please use 1500 m/s as the speed of sound in tissue. I need help with part B and C To clearly see an image, the wavelength used must be at most 1/4 of the size of the object that is to be imaged. What frequency is needed to image a fetus at 8 weeks of gestation that is 1.6 cm long? A. 380 kHz B. 3.8 kHz C. 85 kHz D. 3.8 MHz What are the main characteristics of the authors STYLE in where the crawdads sing? List the specific devices sentence length, diction, use of figurative language and/or imagery, dialect, point of view, detailed description, etc.and give some examples from the novel. PLEASEEE HELP What does the tape measure say Measurement # 2 is? Using the power series methods solve the 1st order Lane-Emden Equation: xy = 2y + xy = 0 You may only use a power series solution to find both linearly independent functions. This means you may not use Abels theorem, variation of parameters or reduction of order. what is (a x b) x c, if a = 11, b = 9, and c = 1? PLEASE HELP!!! Give me five different examples :persuading someone to do something How does the design of your experiment control for outside factors that may affect the results? If 75% of a number 60, what is the number? Find the first six partial sums S1, S2, S3, S4, S5, S6 of the sequence whose nth term is given. 1 2 , 1 22 , 1 23 , 1 24 , . . (-23)+(32) how do we solve it Which statement best complete the diagram of the steps in federal criminal case? Someone pls help me . Thank you sm Question 9 Lipids and proteins can be formed from carbohydrates. Which elements do these molecules have in common that help form different molecules? carbon hydrogen sodium oxygen The date the directors vote to pay a dividend is called the: Multiple Choice Date of declaration. Date of record. Create an accurate summary of the pilot and his reasons for obeying the rules of the EDS. Provide your answer in two to three sentences. The book is the cold equations This rectangular wall is to be painted. Paint is sold in tins. How much does it cost to paint the wall? What is the difference between a consistent and inconsistent system of equations? The length of a rectangle is three times its width. If the perimeter of the rectangle is 160 cm, what are the dimensions of this rectangle? this is progressioni need to know C plsssssthanksssssssssssssssss